about summary refs log tree commit homepage
diff options
context:
space:
mode:
-rw-r--r--Documentation/design_notes.txt2
-rwxr-xr-xDocumentation/extman.perl2
-rw-r--r--Documentation/flow.ge2
-rw-r--r--Documentation/flow.txt2
-rw-r--r--Documentation/include.mk2
-rwxr-xr-xDocumentation/mknews.perl14
-rw-r--r--Documentation/public-inbox-compact.pod2
-rw-r--r--Documentation/public-inbox-config.pod2
-rw-r--r--Documentation/public-inbox-convert.pod2
-rw-r--r--Documentation/public-inbox-daemon.pod2
-rw-r--r--Documentation/public-inbox-edit.pod2
-rw-r--r--Documentation/public-inbox-extindex-format.pod110
-rw-r--r--Documentation/public-inbox-httpd.pod2
-rw-r--r--Documentation/public-inbox-imapd.pod2
-rw-r--r--Documentation/public-inbox-index.pod21
-rw-r--r--Documentation/public-inbox-init.pod2
-rw-r--r--Documentation/public-inbox-learn.pod2
-rw-r--r--Documentation/public-inbox-mda.pod2
-rw-r--r--Documentation/public-inbox-nntpd.pod2
-rw-r--r--Documentation/public-inbox-overview.pod2
-rw-r--r--Documentation/public-inbox-purge.pod2
-rw-r--r--Documentation/public-inbox-tuning.pod2
-rw-r--r--Documentation/public-inbox-v1-format.pod2
-rw-r--r--Documentation/public-inbox-v2-format.pod2
-rw-r--r--Documentation/public-inbox-watch.pod2
-rw-r--r--Documentation/public-inbox-xcpdb.pod2
-rw-r--r--Documentation/public-inbox.cgi.pod2
-rwxr-xr-xDocumentation/standards.perl5
-rwxr-xr-xDocumentation/txt2pre2
-rw-r--r--INSTALL23
-rw-r--r--MANIFEST47
-rw-r--r--Makefile.PL37
-rw-r--r--README19
-rwxr-xr-xci/deps.perl2
-rwxr-xr-xci/profiles.sh2
-rwxr-xr-xci/run.sh2
-rw-r--r--contrib/completion/lei-completion.bash11
-rw-r--r--examples/README.unsubscribe2
-rw-r--r--examples/cgit-commit-filter.lua2
-rw-r--r--examples/cgit-wwwhighlight-filter.lua2
-rw-r--r--examples/cgit.psgi6
-rw-r--r--examples/highlight.psgi2
-rw-r--r--examples/newswww.psgi2
-rw-r--r--examples/public-inbox.psgi2
-rw-r--r--examples/unsubscribe.milter2
-rw-r--r--examples/unsubscribe.psgi2
-rwxr-xr-xlei.sh7
-rw-r--r--lib/PublicInbox/Address.pm14
-rw-r--r--lib/PublicInbox/AddressPP.pm23
-rw-r--r--lib/PublicInbox/Admin.pm124
-rw-r--r--lib/PublicInbox/AdminEdit.pm2
-rw-r--r--lib/PublicInbox/AltId.pm2
-rw-r--r--lib/PublicInbox/Cgit.pm26
-rw-r--r--lib/PublicInbox/CmdIPC4.pm36
-rw-r--r--lib/PublicInbox/CompressNoop.pm2
-rw-r--r--lib/PublicInbox/Config.pm116
-rw-r--r--lib/PublicInbox/ConfigIter.pm2
-rw-r--r--lib/PublicInbox/ContentHash.pm2
-rw-r--r--lib/PublicInbox/DS.pm105
-rw-r--r--lib/PublicInbox/DSKQXS.pm8
-rw-r--r--lib/PublicInbox/DSPoll.pm5
-rw-r--r--lib/PublicInbox/Daemon.pm57
-rw-r--r--lib/PublicInbox/DirIdle.pm2
-rw-r--r--lib/PublicInbox/DummyInbox.pm8
-rw-r--r--lib/PublicInbox/EOFpipe.pm2
-rw-r--r--lib/PublicInbox/Emergency.pm2
-rw-r--r--lib/PublicInbox/Eml.pm2
-rw-r--r--lib/PublicInbox/EmlContentFoo.pm2
-rw-r--r--lib/PublicInbox/ExtMsg.pm53
-rw-r--r--lib/PublicInbox/ExtSearch.pm123
-rw-r--r--lib/PublicInbox/ExtSearchIdx.pm1133
-rw-r--r--lib/PublicInbox/FakeInotify.pm2
-rw-r--r--lib/PublicInbox/Feed.pm10
-rw-r--r--lib/PublicInbox/Filter/Base.pm2
-rw-r--r--lib/PublicInbox/Filter/Gmane.pm2
-rw-r--r--lib/PublicInbox/Filter/Mirror.pm2
-rw-r--r--lib/PublicInbox/Filter/RubyLang.pm4
-rw-r--r--lib/PublicInbox/Filter/SubjectTag.pm2
-rw-r--r--lib/PublicInbox/Filter/Vger.pm2
-rw-r--r--lib/PublicInbox/Gcf2.pm110
-rw-r--r--lib/PublicInbox/Gcf2Client.pm85
-rw-r--r--lib/PublicInbox/GetlineBody.pm2
-rw-r--r--lib/PublicInbox/Git.pm212
-rw-r--r--lib/PublicInbox/GitAsyncCat.pm80
-rw-r--r--lib/PublicInbox/GitCredential.pm2
-rw-r--r--lib/PublicInbox/GitHTTPBackend.pm2
-rw-r--r--lib/PublicInbox/GzipFilter.pm6
-rw-r--r--lib/PublicInbox/HTTP.pm2
-rw-r--r--lib/PublicInbox/HTTPD.pm2
-rw-r--r--lib/PublicInbox/HTTPD/Async.pm2
-rw-r--r--lib/PublicInbox/HlMod.pm2
-rw-r--r--lib/PublicInbox/Hval.pm2
-rw-r--r--lib/PublicInbox/IMAP.pm49
-rw-r--r--lib/PublicInbox/IMAPD.pm51
-rw-r--r--lib/PublicInbox/IMAPTracker.pm2
-rw-r--r--lib/PublicInbox/IMAPdeflate.pm2
-rw-r--r--lib/PublicInbox/IMAPsearchqp.pm8
-rw-r--r--lib/PublicInbox/IPC.pm447
-rw-r--r--lib/PublicInbox/IdxStack.pm20
-rw-r--r--lib/PublicInbox/Import.pm73
-rw-r--r--lib/PublicInbox/In2Tie.pm2
-rw-r--r--lib/PublicInbox/Inbox.pm149
-rw-r--r--lib/PublicInbox/InboxIdle.pm24
-rw-r--r--lib/PublicInbox/InboxWritable.pm24
-rw-r--r--lib/PublicInbox/Isearch.pm127
-rw-r--r--lib/PublicInbox/KQNotify.pm2
-rw-r--r--lib/PublicInbox/LEI.pm1007
-rw-r--r--lib/PublicInbox/LeiDedupe.pm131
-rw-r--r--lib/PublicInbox/LeiExternal.pm142
-rw-r--r--lib/PublicInbox/LeiOverview.pm294
-rw-r--r--lib/PublicInbox/LeiQuery.pm119
-rw-r--r--lib/PublicInbox/LeiSearch.pm27
-rw-r--r--lib/PublicInbox/LeiStore.pm240
-rw-r--r--lib/PublicInbox/LeiToMail.pm500
-rw-r--r--lib/PublicInbox/LeiXSearch.pm412
-rw-r--r--lib/PublicInbox/Linkify.pm2
-rw-r--r--lib/PublicInbox/Listener.pm2
-rw-r--r--lib/PublicInbox/Lock.pm19
-rw-r--r--lib/PublicInbox/MDA.pm6
-rw-r--r--lib/PublicInbox/MID.pm17
-rw-r--r--lib/PublicInbox/ManifestJsGz.pm114
-rw-r--r--lib/PublicInbox/Mbox.pm77
-rw-r--r--lib/PublicInbox/MboxGz.pm8
-rw-r--r--lib/PublicInbox/MboxReader.pm124
-rw-r--r--lib/PublicInbox/MiscIdx.pm151
-rw-r--r--lib/PublicInbox/MiscSearch.pm191
-rw-r--r--lib/PublicInbox/MsgIter.pm2
-rw-r--r--lib/PublicInbox/MsgTime.pm2
-rw-r--r--lib/PublicInbox/Msgmap.pm9
-rw-r--r--lib/PublicInbox/NDC_PP.pm2
-rw-r--r--lib/PublicInbox/NNTP.pm434
-rw-r--r--lib/PublicInbox/NNTPD.pm56
-rw-r--r--lib/PublicInbox/NNTPdeflate.pm2
-rw-r--r--lib/PublicInbox/NewsWWW.pm41
-rw-r--r--lib/PublicInbox/OnDestroy.pm21
-rw-r--r--lib/PublicInbox/OpPipe.pm41
-rw-r--r--lib/PublicInbox/Over.pm23
-rw-r--r--lib/PublicInbox/OverIdx.pm222
-rw-r--r--lib/PublicInbox/ProcessPipe.pm61
-rw-r--r--lib/PublicInbox/Qspawn.pm60
-rw-r--r--lib/PublicInbox/Reply.pm2
-rw-r--r--lib/PublicInbox/SaPlugin/ListMirror.pm2
-rw-r--r--lib/PublicInbox/SaPlugin/ListMirror.pod2
-rw-r--r--lib/PublicInbox/Search.pm166
-rw-r--r--lib/PublicInbox/SearchIdx.pm396
-rw-r--r--lib/PublicInbox/SearchIdxShard.pm166
-rw-r--r--lib/PublicInbox/SearchQuery.pm2
-rw-r--r--lib/PublicInbox/SearchThread.pm4
-rw-r--r--lib/PublicInbox/SearchView.pm37
-rw-r--r--lib/PublicInbox/SharedKV.pm154
-rw-r--r--lib/PublicInbox/Sigfd.pm18
-rw-r--r--lib/PublicInbox/Smsg.pm61
-rw-r--r--lib/PublicInbox/SolverGit.pm4
-rw-r--r--lib/PublicInbox/Spamcheck.pm6
-rw-r--r--lib/PublicInbox/Spamcheck/Spamc.pm2
-rw-r--r--lib/PublicInbox/Spawn.pm123
-rw-r--r--lib/PublicInbox/SpawnPP.pm2
-rw-r--r--lib/PublicInbox/Syscall.pm74
-rw-r--r--lib/PublicInbox/TLS.pm2
-rw-r--r--lib/PublicInbox/TestCommon.pm38
-rw-r--r--lib/PublicInbox/Tmpfile.pm9
-rw-r--r--lib/PublicInbox/URIimap.pm2
-rw-r--r--lib/PublicInbox/Unsubscribe.pm17
-rw-r--r--lib/PublicInbox/UserContent.pm2
-rw-r--r--lib/PublicInbox/V2Writable.pm607
-rw-r--r--lib/PublicInbox/View.pm24
-rw-r--r--lib/PublicInbox/ViewDiff.pm2
-rw-r--r--lib/PublicInbox/ViewVCS.pm4
-rw-r--r--lib/PublicInbox/WWW.pm52
-rw-r--r--lib/PublicInbox/WWW.pod2
-rw-r--r--lib/PublicInbox/Watch.pm42
-rw-r--r--lib/PublicInbox/WwwAltId.pm4
-rw-r--r--lib/PublicInbox/WwwAtomStream.pm12
-rw-r--r--lib/PublicInbox/WwwAttach.pm12
-rw-r--r--lib/PublicInbox/WwwHighlight.pm2
-rw-r--r--lib/PublicInbox/WwwListing.pm9
-rw-r--r--lib/PublicInbox/WwwStatic.pm2
-rw-r--r--lib/PublicInbox/WwwStream.pm48
-rw-r--r--lib/PublicInbox/WwwText.pm16
-rw-r--r--lib/PublicInbox/Xapcmd.pm10
-rw-r--r--lib/PublicInbox/gcf2_libgit2.h142
-rwxr-xr-xscript/lei114
-rwxr-xr-xscript/public-inbox-compact2
-rwxr-xr-xscript/public-inbox-convert30
-rwxr-xr-xscript/public-inbox-edit5
-rw-r--r--script/public-inbox-extindex81
-rwxr-xr-xscript/public-inbox-httpd3
-rwxr-xr-xscript/public-inbox-imapd2
-rwxr-xr-xscript/public-inbox-index65
-rwxr-xr-xscript/public-inbox-init50
-rwxr-xr-xscript/public-inbox-learn13
-rwxr-xr-xscript/public-inbox-mda10
-rwxr-xr-xscript/public-inbox-nntpd2
-rwxr-xr-xscript/public-inbox-purge4
-rwxr-xr-xscript/public-inbox-watch12
-rwxr-xr-xscript/public-inbox-xcpdb2
-rwxr-xr-xscript/public-inbox.cgi2
-rwxr-xr-xscripts/dc-dlvr2
-rw-r--r--scripts/dupe-finder2
-rwxr-xr-xscripts/import_slrnspool6
-rw-r--r--scripts/import_vger_from_mbox2
-rwxr-xr-xscripts/slrnspool2maildir2
-rwxr-xr-xscripts/ssoma-replay2
-rwxr-xr-xscripts/xhdr-num2mid2
-rw-r--r--t/address.t35
-rw-r--r--t/admin.t38
-rw-r--r--t/altid.t2
-rw-r--r--t/altid_v2.t2
-rw-r--r--t/cgi.t2
-rw-r--r--t/check-www-inbox.perl2
-rw-r--r--t/cmd_ipc.t130
-rw-r--r--t/config.t4
-rw-r--r--t/config_limiter.t2
-rw-r--r--t/content_hash.t2
-rw-r--r--t/convert-compact.t6
-rw-r--r--t/data/message_embed.eml2
-rw-r--r--t/dir_idle.t2
-rw-r--r--t/ds-kqxs.t2
-rw-r--r--t/ds-leak.t2
-rw-r--r--t/ds-poll.t30
-rw-r--r--t/edit.t2
-rw-r--r--t/emergency.t2
-rw-r--r--t/eml.t2
-rw-r--r--t/eml_content_disposition.t2
-rw-r--r--t/eml_content_type.t2
-rw-r--r--t/epoll.t8
-rw-r--r--t/extsearch.t369
-rw-r--r--t/fake_inotify.t2
-rw-r--r--t/feed.t8
-rw-r--r--t/filter_base.t2
-rw-r--r--t/filter_mirror.t2
-rw-r--r--t/filter_rubylang.t4
-rw-r--r--t/filter_subjecttag.t2
-rw-r--r--t/filter_vger.t2
-rw-r--r--t/gcf2.t162
-rw-r--r--t/gcf2_client.t90
-rw-r--r--t/git-http-backend.psgi2
-rw-r--r--t/git.t7
-rw-r--r--t/gzip_filter.t2
-rw-r--r--t/hl_mod.t2
-rw-r--r--t/html_index.t2
-rw-r--r--t/httpd-corner.psgi2
-rw-r--r--t/httpd-corner.t2
-rw-r--r--t/httpd-https.t2
-rw-r--r--t/httpd-unix.t2
-rw-r--r--t/httpd.t2
-rw-r--r--t/hval.t2
-rw-r--r--t/idx_stack.t22
-rw-r--r--t/imap.t2
-rw-r--r--t/imap_searchqp.t8
-rw-r--r--t/imap_tracker.t2
-rw-r--r--t/imapd-tls.t2
-rw-r--r--t/imapd.t10
-rw-r--r--t/import.t14
-rw-r--r--t/inbox.t2
-rw-r--r--t/inbox_idle.t10
-rw-r--r--t/index-git-times.t5
-rw-r--r--t/indexlevels-mirror-v1.t2
-rw-r--r--t/indexlevels-mirror.t6
-rw-r--r--t/init.t2
-rw-r--r--t/ipc.t210
-rw-r--r--t/kqnotify.t2
-rw-r--r--t/lei-oneshot.t8
-rw-r--r--t/lei.t376
-rw-r--r--t/lei_dedupe.t86
-rw-r--r--t/lei_external.t18
-rw-r--r--t/lei_overview.t33
-rw-r--r--t/lei_store.t131
-rw-r--r--t/lei_to_mail.t267
-rw-r--r--t/lei_xsearch.t81
-rw-r--r--t/linkify.t2
-rw-r--r--t/mbox_reader.t94
-rw-r--r--t/mda.t2
-rw-r--r--t/mda_filter_rubylang.t6
-rw-r--r--t/mid.t2
-rw-r--r--t/mime.t2
-rw-r--r--t/miscsearch.t57
-rw-r--r--t/msg_iter.t2
-rw-r--r--t/msgmap.t4
-rw-r--r--t/msgtime.t2
-rw-r--r--t/multi-mid.t2
-rw-r--r--t/nntp.t27
-rw-r--r--t/nntpd-tls.t2
-rw-r--r--t/nntpd-v2.t2
-rw-r--r--t/nntpd.t2
-rw-r--r--t/nodatacow.t2
-rw-r--r--t/nulsubject.t2
-rw-r--r--t/on_destroy.t34
-rw-r--r--t/over.t26
-rw-r--r--t/plack.t6
-rw-r--r--t/precheck.t2
-rw-r--r--t/psgi_attach.t2
-rw-r--r--t/psgi_bad_mids.t2
-rw-r--r--t/psgi_mount.t22
-rw-r--r--t/psgi_multipart_not.t2
-rw-r--r--t/psgi_scan_all.t2
-rw-r--r--t/psgi_search.t8
-rw-r--r--t/psgi_text.t2
-rw-r--r--t/psgi_v2.t13
-rw-r--r--t/purge.t2
-rw-r--r--t/qspawn.t2
-rw-r--r--t/replace.t5
-rw-r--r--t/reply.t2
-rwxr-xr-xt/run.perl5
-rw-r--r--t/search-thr-index.t2
-rw-r--r--t/search.t10
-rw-r--r--t/shared_kv.t54
-rw-r--r--t/sigfd.t8
-rw-r--r--t/solver_git.t2
-rw-r--r--t/spamcheck_spamc.t2
-rw-r--r--t/spawn.t44
-rw-r--r--t/thread-cycle.t2
-rw-r--r--t/thread-index-gap.t9
-rw-r--r--t/time.t2
-rw-r--r--t/uri_imap.t2
-rw-r--r--t/v1-add-remove-add.t2
-rw-r--r--t/v1reindex.t2
-rw-r--r--t/v2-add-remove-add.t2
-rw-r--r--t/v2dupindex.t2
-rw-r--r--t/v2mda.t2
-rw-r--r--t/v2mirror.t2
-rw-r--r--t/v2reindex.t2
-rw-r--r--t/v2writable.t5
-rw-r--r--t/view.t2
-rw-r--r--t/watch_filter_rubylang.t12
-rw-r--r--t/watch_imap.t2
-rw-r--r--t/watch_maildir.t28
-rw-r--r--t/watch_maildir_v2.t50
-rw-r--r--t/watch_multiple_headers.t10
-rw-r--r--t/watch_nntp.t2
-rw-r--r--t/www_altid.t2
-rw-r--r--t/www_listing.t15
-rw-r--r--t/www_static.t2
-rw-r--r--t/xcpdb-reshard.t2
-rw-r--r--xt/cmp-msgstr.t2
-rw-r--r--xt/cmp-msgview.t4
-rw-r--r--xt/create-many-inboxes.t99
-rw-r--r--xt/eml_check_limits.t2
-rw-r--r--xt/git-http-backend.t2
-rw-r--r--xt/git_async_cmp.t2
-rw-r--r--xt/httpd-async-stream.t2
-rw-r--r--xt/imapd-mbsync-oimap.t2
-rw-r--r--xt/imapd-validate.t2
-rw-r--r--xt/lei-sigpipe.t35
-rw-r--r--xt/mem-imapd-tls.t2
-rw-r--r--xt/mem-msgview.t2
-rw-r--r--xt/msgtime_cmp.t2
-rw-r--r--xt/nntpd-validate.t2
-rw-r--r--xt/perf-msgview.t4
-rw-r--r--xt/perf-nntpd.t2
-rw-r--r--xt/perf-threading.t4
-rw-r--r--xt/solver.t2
352 files changed, 11775 insertions, 2272 deletions
diff --git a/Documentation/design_notes.txt b/Documentation/design_notes.txt
index e871f4c8..bc668da3 100644
--- a/Documentation/design_notes.txt
+++ b/Documentation/design_notes.txt
@@ -149,5 +149,5 @@ problems solved.
 Copyright
 ---------
 
-Copyright 2013-2020 all contributors <meta@public-inbox.org>
+Copyright 2013-2021 all contributors <meta@public-inbox.org>
 License: AGPL-3.0+ <http://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/Documentation/extman.perl b/Documentation/extman.perl
index a9a830c0..c6cfb4c5 100755
--- a/Documentation/extman.perl
+++ b/Documentation/extman.perl
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # prints a manpage to stdout
 use strict;
diff --git a/Documentation/flow.ge b/Documentation/flow.ge
index 0cc1c333..4308989a 100644
--- a/Documentation/flow.ge
+++ b/Documentation/flow.ge
@@ -24,5 +24,5 @@ graph { flow: down }
  public-inbox-imapd\n
  public-inbox-nntpd]
 
-# Copyright 2020 all contributors <meta@public-inbox.org>
+# Copyright 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/Documentation/flow.txt b/Documentation/flow.txt
index 8225cc8f..1116a917 100644
--- a/Documentation/flow.txt
+++ b/Documentation/flow.txt
@@ -29,5 +29,5 @@
                                                  | public-inbox-nntpd |
                                                  +--------------------+
 
-# Copyright 2020 all contributors <meta@public-inbox.org>
+# Copyright 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/Documentation/include.mk b/Documentation/include.mk
index 207983f0..df6c17e0 100644
--- a/Documentation/include.mk
+++ b/Documentation/include.mk
@@ -1,4 +1,4 @@
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 all::
 
diff --git a/Documentation/mknews.perl b/Documentation/mknews.perl
index 510a4e18..1936cea7 100755
--- a/Documentation/mknews.perl
+++ b/Documentation/mknews.perl
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Generates NEWS, NEWS.atom, and NEWS.html files using release emails
 # this uses unstable internal APIs of public-inbox, and this script
@@ -43,7 +43,7 @@ if ($dst eq 'NEWS') {
         );
         $ibx->{-primary_address} = $addr;
         my $ctx = {
-                -inbox => $ibx,
+                ibx => $ibx,
                 -upfx => "$base_url/",
                 -hr => 1,
         };
@@ -119,10 +119,10 @@ sub html_start {
 }
 
 sub html_end {
-        print $out <<EOF or die;
-        git clone $PublicInbox::WwwStream::CODE_URL
-</pre></body></html>
-EOF
+        for (@$PublicInbox::WwwStream::CODE_URL) {
+                print $out "        git clone $_\n" or die;
+        }
+        print $out "</pre></body></html>\n" or die;
 }
 
 sub atom_start {
@@ -131,7 +131,7 @@ sub atom_start {
         # WwwAtomStream stats this dir for mtime
         my $astream = PublicInbox::WwwAtomStream->new($ctx);
         delete $astream->{emit_header};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $title = PublicInbox::WwwAtomStream::title_tag($ibx->description);
         my $updated = PublicInbox::WwwAtomStream::feed_updated($mtime);
         print $out <<EOF or die;
diff --git a/Documentation/public-inbox-compact.pod b/Documentation/public-inbox-compact.pod
index 4e9b6d9f..04612a7e 100644
--- a/Documentation/public-inbox-compact.pod
+++ b/Documentation/public-inbox-compact.pod
@@ -68,7 +68,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2018-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2018-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-config.pod b/Documentation/public-inbox-config.pod
index 2d845f16..4a97fe3b 100644
--- a/Documentation/public-inbox-config.pod
+++ b/Documentation/public-inbox-config.pod
@@ -412,7 +412,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-convert.pod b/Documentation/public-inbox-convert.pod
index a7958cf8..f400fab8 100644
--- a/Documentation/public-inbox-convert.pod
+++ b/Documentation/public-inbox-convert.pod
@@ -91,7 +91,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-daemon.pod b/Documentation/public-inbox-daemon.pod
index 747c1452..7405cdf9 100644
--- a/Documentation/public-inbox-daemon.pod
+++ b/Documentation/public-inbox-daemon.pod
@@ -174,7 +174,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-edit.pod b/Documentation/public-inbox-edit.pod
index 55d1c163..8014d7c3 100644
--- a/Documentation/public-inbox-edit.pod
+++ b/Documentation/public-inbox-edit.pod
@@ -114,7 +114,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-extindex-format.pod b/Documentation/public-inbox-extindex-format.pod
new file mode 100644
index 00000000..52eb8e85
--- /dev/null
+++ b/Documentation/public-inbox-extindex-format.pod
@@ -0,0 +1,110 @@
+% public-inbox developer manual
+
+=head1 NAME
+
+public-inbox extindex format description
+
+=head1 DESCRIPTION
+
+The extindex is an index-only evolution of the per-inbox
+SQLite and Xapian indices used by L<public-inbox-v2-format(5)>
+and L<public-inbox-v1-format(5)>.  It exists to facilitate
+searches across multiple inboxes as well as to reduce index
+space when messages are cross-posted to several existing
+inboxes.
+
+It transparently indexes messages across any combination of v1 and v2
+inboxes and data about inboxes themselves.
+
+=head1 DIRECTORY LAYOUT
+
+While inspired by v2, there is no git blob storage nor
+C<msgmap.sqlite3> DB.
+
+Instead, there is an C<ALL.git> (all caps) git repo which treats
+every indexed v1 inbox or v2 epoch as a git alternate.
+
+As with v2 inboxes, it uses C<over.sqlite3> and Xapian "shards"
+for WWW and IMAP use.  Several exclusive new tables are added
+to deal with L</XREF3 DEDUPLICATION> and metadata.
+
+Unlike v1 and v2 inboxes, it is NOT designed to map to a NNTP
+newsgroup.  Thus it lacks C<msgmap.sqlite3> to enforce the
+unique Message-ID requirement of NNTP.
+
+=head2 INDEX OVERVIEW AND DEFINITIONS
+
+  $SCHEMA_VERSION - DB schema version (for Xapian)
+  $SHARD - Integer starting with 0 based on parallelism
+
+  foo/                              # "foo" is the name of the index
+  - ei.lock                         # lock file to protect global state
+  - ALL.git                         # empty, alternates for inboxes
+  - ei$SCHEMA_VERSION/$SHARD        # per-shard Xapian DB
+  - ei$SCHEMA_VERSION/over.sqlite3  # overview DB for WWW, IMAP
+  - ei$SCHEMA_VERSION/misc          # misc Xapian DB
+
+File and directory names are intentionally different from
+analogous v2 names to ensure extindex and v2 inboxes can
+easily be distinguished from each other.
+
+=head2 XREF3 DEDUPLICATION
+
+Due to cross-posted messages being the norm in the large Linux kernel
+development community and Xapian indices being the primary consumer of
+storage, it makes sense to deduplicate indexing as much as possible.
+
+The internal storage format is based on the NNTP "Xref" tuple,
+but with the addition of a third element: the git blob OID.
+Thus the triple is expressed in string form as:
+
+        $NEWSGROUP_NAME:$ARTICLE_NUM:$OID
+
+If no C<newsgroup> is configured for an inbox, the C<inboxdir>
+of the inbox is used.
+
+This data is stored in the C<xref3> table of over.sqlite3.
+
+=head2 misc XAPIAN DB
+
+In addition to the numeric Xapian shards for indexing messages,
+there is a new, in-development Xapian index for storing data
+about inboxes themselves and other non-message data.  This
+index allows us to speed up operations involving hundreds or
+thousands of inboxes.
+
+=head1 BENEFITS
+
+In addition to providing cross-inbox search capabilities, it can
+also replace per-inbox Xapian shards (but not per-inbox
+over.sqlite3).  This allows reduction in disk space, open file
+handles, and associated memory use.
+
+=head1 CAVEATS
+
+Relocating v1 and v2 inboxes on the filesystem will require
+extindex to be garbage-collected and/or reindexed.
+
+Configuring and maintaining stable C<newsgroup> names before any
+messages are indexed from every inbox can avoid expensive
+reindexing and rely exclusively on GC.
+
+=head1 LOCKING
+
+L<flock(2)> locking exclusively locks the empty ei.lock file
+for all non-atomic operations.
+
+=head1 THANKS
+
+Thanks to the Linux Foundation for sponsoring the development
+and testing.
+
+=head1 COPYRIGHT
+
+Copyright 2020-2021 all contributors L<mailto:meta@public-inbox.org>
+
+License: AGPL-3.0+ L<http://www.gnu.org/licenses/agpl-3.0.txt>
+
+=head1 SEE ALSO
+
+L<public-inbox-v2-format(5)>
diff --git a/Documentation/public-inbox-httpd.pod b/Documentation/public-inbox-httpd.pod
index f4e9945a..eef3dccd 100644
--- a/Documentation/public-inbox-httpd.pod
+++ b/Documentation/public-inbox-httpd.pod
@@ -29,7 +29,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-imapd.pod b/Documentation/public-inbox-imapd.pod
index a5c996b8..99632871 100644
--- a/Documentation/public-inbox-imapd.pod
+++ b/Documentation/public-inbox-imapd.pod
@@ -81,7 +81,7 @@ L<nntp://hjrcffqmbrq6wope.onion/inbox.comp.mail.public-inbox.meta>
 
 =head1 COPYRIGHT
 
-Copyright 2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2020-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-index.pod b/Documentation/public-inbox-index.pod
index 0848e860..67219a23 100644
--- a/Documentation/public-inbox-index.pod
+++ b/Documentation/public-inbox-index.pod
@@ -162,6 +162,23 @@ See L<public-inbox-init(1)/--skip-docdata> for description and caveats.
 
 Available in public-inbox 1.6.0+.
 
+=item --update-extindex=EXTINDEX, -E
+
+Update the given external index (L<public-inbox-extindex-format(5)>.
+Either the configured section name (e.g. C<all>) or a directory name
+may be specified.
+
+Defaults to C<all> if C<[extindex "all"]> is configured,
+otherwise no external indices are updated.
+
+May be specified multiple times in rare cases where multiple
+external indices are configured.
+
+=item --no-update-extindex
+
+Do not update the C<all> external index by default.  This negates
+all uses of C<-E> / C<--update-extindex=> on the command-line.
+
 =back
 
 =head1 FILES
@@ -291,10 +308,10 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
 =head1 SEE ALSO
 
-L<Search::Xapian>, L<DBD::SQLite>
+L<Search::Xapian>, L<DBD::SQLite>, L<public-inbox-extindex-format(5)>
diff --git a/Documentation/public-inbox-init.pod b/Documentation/public-inbox-init.pod
index f1ec05de..771775d3 100644
--- a/Documentation/public-inbox-init.pod
+++ b/Documentation/public-inbox-init.pod
@@ -142,7 +142,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-learn.pod b/Documentation/public-inbox-learn.pod
index 498c5092..54bc7f50 100644
--- a/Documentation/public-inbox-learn.pod
+++ b/Documentation/public-inbox-learn.pod
@@ -82,7 +82,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-mda.pod b/Documentation/public-inbox-mda.pod
index a5e353e5..b992ca24 100644
--- a/Documentation/public-inbox-mda.pod
+++ b/Documentation/public-inbox-mda.pod
@@ -78,7 +78,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-nntpd.pod b/Documentation/public-inbox-nntpd.pod
index 18f83c9c..0e820602 100644
--- a/Documentation/public-inbox-nntpd.pod
+++ b/Documentation/public-inbox-nntpd.pod
@@ -81,7 +81,7 @@ L<nntp://hjrcffqmbrq6wope.onion/inbox.comp.mail.public-inbox.meta>
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-overview.pod b/Documentation/public-inbox-overview.pod
index 44989e6e..6a087896 100644
--- a/Documentation/public-inbox-overview.pod
+++ b/Documentation/public-inbox-overview.pod
@@ -124,6 +124,6 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/Documentation/public-inbox-purge.pod b/Documentation/public-inbox-purge.pod
index a9479657..30227422 100644
--- a/Documentation/public-inbox-purge.pod
+++ b/Documentation/public-inbox-purge.pod
@@ -74,7 +74,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-tuning.pod b/Documentation/public-inbox-tuning.pod
index f5a25676..e9702416 100644
--- a/Documentation/public-inbox-tuning.pod
+++ b/Documentation/public-inbox-tuning.pod
@@ -151,6 +151,6 @@ L<http://hjrcffqmbrq6wope.onion/meta/>, and other places
 
 =head1 COPYRIGHT
 
-Copyright 2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2020-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/Documentation/public-inbox-v1-format.pod b/Documentation/public-inbox-v1-format.pod
index da19d2c9..db223fd9 100644
--- a/Documentation/public-inbox-v1-format.pod
+++ b/Documentation/public-inbox-v1-format.pod
@@ -175,7 +175,7 @@ This is up to the administrators.
 
 =head1 COPYRIGHT
 
-Copyright 2013-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2013-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<http://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-v2-format.pod b/Documentation/public-inbox-v2-format.pod
index 3c89f13e..e93d7fc7 100644
--- a/Documentation/public-inbox-v2-format.pod
+++ b/Documentation/public-inbox-v2-format.pod
@@ -235,7 +235,7 @@ and testing of the v2 format.
 
 =head1 COPYRIGHT
 
-Copyright 2018-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2018-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<http://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-watch.pod b/Documentation/public-inbox-watch.pod
index 38686645..dd38351a 100644
--- a/Documentation/public-inbox-watch.pod
+++ b/Documentation/public-inbox-watch.pod
@@ -201,7 +201,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox-xcpdb.pod b/Documentation/public-inbox-xcpdb.pod
index 1bc1b1df..5f99c4ab 100644
--- a/Documentation/public-inbox-xcpdb.pod
+++ b/Documentation/public-inbox-xcpdb.pod
@@ -129,7 +129,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/public-inbox.cgi.pod b/Documentation/public-inbox.cgi.pod
index 8fd6f3e7..2fd256a3 100644
--- a/Documentation/public-inbox.cgi.pod
+++ b/Documentation/public-inbox.cgi.pod
@@ -25,7 +25,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright 2019-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright 2019-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<https://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/Documentation/standards.perl b/Documentation/standards.perl
index 1c56830e..32003c91 100755
--- a/Documentation/standards.perl
+++ b/Documentation/standards.perl
@@ -1,6 +1,6 @@
 #!/usr/bin/perl -w
 use strict;
-# Copyright 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 print <<EOF;
@@ -28,6 +28,9 @@ my $rfcs = [
         1036 => 'Standard for Interchange of USENET Messages',
         5536 => 'Netnews Article Format',
         5537 => 'Netnews Architecture and Protocols',
+        1738 => 'Uniform resource locators',
+        5092 => 'IMAP URL scheme',
+        5538 => 'NNTP URI schemes',
         6048 => 'NNTP additions to LIST command (TODO)',
         8054 => 'NNTP compression',
         4642 => 'NNTP TLS',
diff --git a/Documentation/txt2pre b/Documentation/txt2pre
index 75d2d12b..75e4725c 100755
--- a/Documentation/txt2pre
+++ b/Documentation/txt2pre
@@ -1,5 +1,5 @@
 #!/usr/bin/env perl
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Stupid script to make HTML from preformatted, utf-8 text versions,
diff --git a/INSTALL b/INSTALL
index 9f05c3f6..de871b1a 100644
--- a/INSTALL
+++ b/INSTALL
@@ -2,7 +2,7 @@ public-inbox (server-side) installation
 ---------------------------------------
 
 This is for folks who want to setup their own public-inbox instance.
-Clients should use normal git-clone/git-fetch, or NNTP clients
+Clients should use normal git-clone/git-fetch, IMAP or NNTP clients
 if they want to import mail into their personal inboxes.
 
 public-inbox is developed on Debian GNU/Linux systems and will
@@ -24,7 +24,7 @@ functionality.  The core tools are, of course:
 
 * Git (1.8.0+, 2.6+ for writing v2 inboxes)
 * Perl 5.10.1+
-* DBD::SQLite (needed for NNTP, message threading, and v2 inboxes)
+* DBD::SQLite (needed for IMAP, NNTP, message threading, and v2 inboxes)
 
 To accept incoming mail into a public inbox, you'll likely want:
 
@@ -70,17 +70,17 @@ Numerous optional modules are likely to be useful as well:
 - DBD::SQLite                      deb: libdbd-sqlite3-perl
                                    pkg: p5-DBD-SQLite
                                    rpm: perl-DBD-SQLite
-                                   (for v2, NNTP, or gzipped mboxes)
+                                   (for v2, IMAP, NNTP, or gzipped mboxes)
 
 - Search::Xapian                   deb: libsearch-xapian-perl
                                    pkg: p5-Search-Xapian
                                    rpm: perl-Search-Xapian
-                                   (HTTP search)
+                                   (HTTP and IMAP search)
 
 - Net::Server                      deb: libnet-server-perl
                                    pkg: pkg-Net-Server
                                    rpm: perl-Net-Server
-                                   (for HTTP/NNTP background daemons,
+                                   (for HTTP/IMAP/NNTP background daemons,
                                     not needed as systemd services or
                                     foreground servers)
 
@@ -92,7 +92,14 @@ Numerous optional modules are likely to be useful as well:
 - Email::Address::XS               deb: libemail-address-xs-perl
                                    pkg: pkg-Email-Address-XS
                                    (correct parsing of tricky email
-                                    addresses, phrases and comments)
+                                    addresses, phrases and comments,
+                                    required for IMAP)
+
+- Parse::RecDescent                deb: libparse-recdescent-perl
+                                   pkg: p5-Parse-RecDescent
+                                   rpm: perl-ParseRecDescent
+                                   (optional, for public-inbox-imapd(1))
+
 
 - Plack::Middleware::ReverseProxy  deb: libplack-middleware-reverseproxy-perl
                                    pkg: p5-Plack-Middleware-ReverseProxy
@@ -129,7 +136,7 @@ above, so there is no need to explicitly install them:
 
 - Linux::Inotify2                  deb: liblinux-inotify2-perl
                                    rpm: perl-Linux-Inotify2
-                                   (for public-inbox-watch on Linux)
+                                   (for public-inbox-watch and -imapd on Linux)
 
 - IO::Compress (::Gzip)            deb: perl-modules (or libio-compress-perl)
                                    pkg: perl5
@@ -196,5 +203,5 @@ the installation is complete.
 Copyright
 ---------
 
-Copyright 2013-2020 all contributors <meta@public-inbox.org>
+Copyright 2013-2021 all contributors <meta@public-inbox.org>
 License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/MANIFEST b/MANIFEST
index 8a47ccbf..f981f2ac 100644
--- a/MANIFEST
+++ b/MANIFEST
@@ -28,6 +28,7 @@ Documentation/public-inbox-config.pod
 Documentation/public-inbox-convert.pod
 Documentation/public-inbox-daemon.pod
 Documentation/public-inbox-edit.pod
+Documentation/public-inbox-extindex-format.pod
 Documentation/public-inbox-httpd.pod
 Documentation/public-inbox-imapd.pod
 Documentation/public-inbox-index.pod
@@ -62,6 +63,7 @@ ci/README
 ci/deps.perl
 ci/profiles.sh
 ci/run.sh
+contrib/completion/lei-completion.bash
 contrib/css/216dark.css
 contrib/css/216light.css
 contrib/css/README
@@ -101,12 +103,14 @@ examples/unsubscribe-psgi@.service
 examples/unsubscribe.milter
 examples/unsubscribe.psgi
 examples/varnish-4.vcl
+lei.sh
 lib/PublicInbox/Address.pm
 lib/PublicInbox/AddressPP.pm
 lib/PublicInbox/Admin.pm
 lib/PublicInbox/AdminEdit.pm
 lib/PublicInbox/AltId.pm
 lib/PublicInbox/Cgit.pm
+lib/PublicInbox/CmdIPC4.pm
 lib/PublicInbox/CompressNoop.pm
 lib/PublicInbox/Config.pm
 lib/PublicInbox/ConfigIter.pm
@@ -122,6 +126,8 @@ lib/PublicInbox/Emergency.pm
 lib/PublicInbox/Eml.pm
 lib/PublicInbox/EmlContentFoo.pm
 lib/PublicInbox/ExtMsg.pm
+lib/PublicInbox/ExtSearch.pm
+lib/PublicInbox/ExtSearchIdx.pm
 lib/PublicInbox/FakeInotify.pm
 lib/PublicInbox/Feed.pm
 lib/PublicInbox/Filter/Base.pm
@@ -130,6 +136,8 @@ lib/PublicInbox/Filter/Mirror.pm
 lib/PublicInbox/Filter/RubyLang.pm
 lib/PublicInbox/Filter/SubjectTag.pm
 lib/PublicInbox/Filter/Vger.pm
+lib/PublicInbox/Gcf2.pm
+lib/PublicInbox/Gcf2Client.pm
 lib/PublicInbox/GetlineBody.pm
 lib/PublicInbox/Git.pm
 lib/PublicInbox/GitAsyncCat.pm
@@ -147,13 +155,24 @@ lib/PublicInbox/IMAPD.pm
 lib/PublicInbox/IMAPTracker.pm
 lib/PublicInbox/IMAPdeflate.pm
 lib/PublicInbox/IMAPsearchqp.pm
+lib/PublicInbox/IPC.pm
 lib/PublicInbox/IdxStack.pm
 lib/PublicInbox/Import.pm
 lib/PublicInbox/In2Tie.pm
 lib/PublicInbox/Inbox.pm
 lib/PublicInbox/InboxIdle.pm
 lib/PublicInbox/InboxWritable.pm
+lib/PublicInbox/Isearch.pm
 lib/PublicInbox/KQNotify.pm
+lib/PublicInbox/LEI.pm
+lib/PublicInbox/LeiDedupe.pm
+lib/PublicInbox/LeiExternal.pm
+lib/PublicInbox/LeiOverview.pm
+lib/PublicInbox/LeiQuery.pm
+lib/PublicInbox/LeiSearch.pm
+lib/PublicInbox/LeiStore.pm
+lib/PublicInbox/LeiToMail.pm
+lib/PublicInbox/LeiXSearch.pm
 lib/PublicInbox/Linkify.pm
 lib/PublicInbox/Listener.pm
 lib/PublicInbox/Lock.pm
@@ -163,6 +182,9 @@ lib/PublicInbox/MIME.pm
 lib/PublicInbox/ManifestJsGz.pm
 lib/PublicInbox/Mbox.pm
 lib/PublicInbox/MboxGz.pm
+lib/PublicInbox/MboxReader.pm
+lib/PublicInbox/MiscIdx.pm
+lib/PublicInbox/MiscSearch.pm
 lib/PublicInbox/MsgIter.pm
 lib/PublicInbox/MsgTime.pm
 lib/PublicInbox/Msgmap.pm
@@ -171,6 +193,8 @@ lib/PublicInbox/NNTP.pm
 lib/PublicInbox/NNTPD.pm
 lib/PublicInbox/NNTPdeflate.pm
 lib/PublicInbox/NewsWWW.pm
+lib/PublicInbox/OnDestroy.pm
+lib/PublicInbox/OpPipe.pm
 lib/PublicInbox/Over.pm
 lib/PublicInbox/OverIdx.pm
 lib/PublicInbox/ProcessPipe.pm
@@ -184,6 +208,7 @@ lib/PublicInbox/SearchIdxShard.pm
 lib/PublicInbox/SearchQuery.pm
 lib/PublicInbox/SearchThread.pm
 lib/PublicInbox/SearchView.pm
+lib/PublicInbox/SharedKV.pm
 lib/PublicInbox/Sigfd.pm
 lib/PublicInbox/Smsg.pm
 lib/PublicInbox/SolverGit.pm
@@ -214,13 +239,16 @@ lib/PublicInbox/WwwStatic.pm
 lib/PublicInbox/WwwStream.pm
 lib/PublicInbox/WwwText.pm
 lib/PublicInbox/Xapcmd.pm
+lib/PublicInbox/gcf2_libgit2.h
 sa_config/Makefile
 sa_config/README
 sa_config/root/etc/spamassassin/public-inbox.pre
 sa_config/user/.spamassassin/user_prefs
+script/lei
 script/public-inbox-compact
 script/public-inbox-convert
 script/public-inbox-edit
+script/public-inbox-extindex
 script/public-inbox-httpd
 script/public-inbox-imapd
 script/public-inbox-index
@@ -251,6 +279,7 @@ t/altid.t
 t/altid_v2.t
 t/cgi.t
 t/check-www-inbox.perl
+t/cmd_ipc.t
 t/config.t
 t/config_limiter.t
 t/content_hash.t
@@ -267,6 +296,7 @@ t/eml.t
 t/eml_content_disposition.t
 t/eml_content_type.t
 t/epoll.t
+t/extsearch.t
 t/fail-bin/spamc
 t/fake_inotify.t
 t/feed.t
@@ -277,6 +307,8 @@ t/filter_mirror.t
 t/filter_rubylang.t
 t/filter_subjecttag.t
 t/filter_vger.t
+t/gcf2.t
+t/gcf2_client.t
 t/git-http-backend.psgi
 t/git.fast-import-data
 t/git.t
@@ -302,15 +334,26 @@ t/index-git-times.t
 t/indexlevels-mirror-v1.t
 t/indexlevels-mirror.t
 t/init.t
+t/ipc.t
 t/iso-2202-jp.eml
 t/kqnotify.t
+t/lei-oneshot.t
+t/lei.t
+t/lei_dedupe.t
+t/lei_external.t
+t/lei_overview.t
+t/lei_store.t
+t/lei_to_mail.t
+t/lei_xsearch.t
 t/linkify.t
 t/main-bin/spamc
+t/mbox_reader.t
 t/mda-mime.eml
 t/mda.t
 t/mda_filter_rubylang.t
 t/mid.t
 t/mime.t
+t/miscsearch.t
 t/msg_iter-nested.eml
 t/msg_iter-order.eml
 t/msg_iter.t
@@ -323,6 +366,7 @@ t/nntpd-v2.t
 t/nntpd.t
 t/nodatacow.t
 t/nulsubject.t
+t/on_destroy.t
 t/over.t
 t/plack-2-txt-bodies.eml
 t/plack-attached-patch.eml
@@ -348,6 +392,7 @@ t/run.perl
 t/search-amsg.eml
 t/search-thr-index.t
 t/search.t
+t/shared_kv.t
 t/sigfd.t
 t/solve/0001-simple-mod.patch
 t/solve/0002-rename-with-modifications.patch
@@ -381,12 +426,14 @@ t/x-unknown-alpine.eml
 t/xcpdb-reshard.t
 xt/cmp-msgstr.t
 xt/cmp-msgview.t
+xt/create-many-inboxes.t
 xt/eml_check_limits.t
 xt/git-http-backend.t
 xt/git_async_cmp.t
 xt/httpd-async-stream.t
 xt/imapd-mbsync-oimap.t
 xt/imapd-validate.t
+xt/lei-sigpipe.t
 xt/mem-imapd-tls.t
 xt/mem-msgview.t
 xt/msgtime_cmp.t
diff --git a/Makefile.PL b/Makefile.PL
index be3471a6..9d0a361a 100644
--- a/Makefile.PL
+++ b/Makefile.PL
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use ExtUtils::MakeMaker;
@@ -31,9 +31,20 @@ my @syn = (@EXE_FILES, grep(m!^lib/.*\.pm$!, @manifest), @scripts);
 @syn = grep(!/SaPlugin/, @syn) if !eval { require Mail::SpamAssasin };
 $v->{syn_files} = \@syn;
 $v->{my_syntax} = [map { "$_.syntax" } @syn];
-$v->{-m1} = [ map { (split('/'))[-1] } @EXE_FILES ];
+my @no_pod;
+$v->{-m1} = [ map {
+                my $x = (split('/'))[-1];
+                my $pod = "Documentation/$x.pod";
+                if (-f $pod) {
+                        $x;
+                } else {
+                        warn "W: $pod missing\n";
+                        push @no_pod, $x;
+                        ();
+                }
+        } @EXE_FILES ];
 $v->{-m5} = [ qw(public-inbox-config public-inbox-v1-format
-                public-inbox-v2-format) ];
+                public-inbox-v2-format public-inbox-extindex-format) ];
 $v->{-m7} = [ qw(public-inbox-overview public-inbox-tuning) ];
 $v->{-m8} = [ qw(public-inbox-daemon) ];
 my @sections = (1, 5, 7, 8);
@@ -109,6 +120,7 @@ my %man3 = map {; # semi-colon tells Perl this is a BLOCK (and not EXPR)
         $mod =~ s/\.\w+\z//;
         "lib/PublicInbox/$_" => "blib/man3/PublicInbox::$mod.\$(MAN3EXT)"
 } qw(Git.pm Import.pm WWW.pod SaPlugin/ListMirror.pod);
+my $warn_no_pod = @no_pod ? "\n\t\@echo W: missing .pod: @no_pod\n" : '';
 
 WriteMakefile(
         NAME => 'PublicInbox', # n.b. camel-case is not our choice
@@ -172,6 +184,8 @@ $VARS
 -include Documentation/include.mk
 $TGTS
 
+check-man ::$warn_no_pod
+
 # syntax checks are currently GNU make only:
 %.syntax :: %
         @\$(PERL) -w -I lib -c \$<
@@ -209,5 +223,22 @@ Makefile.PL : MANIFEST
         touch -r MANIFEST \$@
         \$(PERLRUN) \$@
 
+# Install symlinks to ~/bin (which is hopefuly in PATH) which point to
+# this source tree.
+# prefix + bindir matches git.git Makefile:
+prefix = \$(HOME)
+bindir = \$(prefix)/bin
+symlink-install :
+        mkdir -p \$(bindir)
+        lei=\$\$(realpath lei.sh) && cd \$(bindir) && \\
+        for x in \$(EXE_FILES); do \\
+                ln -sf "\$\$lei" \$\$(basename "\$\$x"); \\
+        done
+
+update-copyrights :
+        \@case '\$(GNULIB_PATH)' in '') echo >&2 GNULIB_PATH unset; false;; esac
+        git ls-files | UPDATE_COPYRIGHT_HOLDER='all contributors' \\
+                UPDATE_COPYRIGHT_USE_INTERVALS=2 \\
+                xargs \$(GNULIB_PATH)/build-aux/update-copyright
 EOF
 }
diff --git a/README b/README
index ae428bcf..5f8a1a68 100644
--- a/README
+++ b/README
@@ -3,7 +3,7 @@ public-inbox - an "archives first" approach to mailing lists
 
 public-inbox implements the sharing of an email inbox via git to
 complement or replace traditional mailing lists.  Readers may
-read via NNTP, Atom feeds or HTML archives.
+read via NNTP, IMAP, Atom feeds or HTML archives.
 
 public-inbox spawned around three main ideas:
 
@@ -38,7 +38,7 @@ headers.  List server admins are also burdened with delivery
 failures.
 
 public-inbox uses the "pull" model.  Casual readers may
-follow the list via NNTP, Atom feed or HTML archives.
+follow the list via NNTP, IMAP, Atom feed or HTML archives.
 
 If a reader loses interest, they simply stop following.
 
@@ -56,7 +56,7 @@ Features
 
 * stores email in git, readers may have a complete archive of the inbox
 
-* Atom feed and NNTP allows casual readers to follow via feed reader
+* Atom feed, IMAP, NNTP allows casual readers to follow via local tools
 
 * uses only well-documented and easy-to-implement data formats
 
@@ -64,7 +64,7 @@ Try it out now, see https://try.public-inbox.org/
 
 Requirements for reading:
 
-* any software capable of NNTP or following Atom feeds
+* any software capable of IMAP, NNTP or following Atom feeds
 
 Any basic web browser will do for the HTML archives.
 We primarily develop on w3m to maximize accessibility.
@@ -94,6 +94,7 @@ AGPL source code is available via git:
 
         git clone https://public-inbox.org/public-inbox.git
         git clone https://repo.or.cz/public-inbox.git
+        torsocks git clone http://ou63pmih66umazou.onion/public-inbox.git
         torsocks git clone http://hjrcffqmbrq6wope.onion/public-inbox
 
 See below for contact info.
@@ -113,15 +114,19 @@ subscription.  This also makes it easier to rope in folks of
 tangentially related projects we depend on (e.g. git developers
 on git@vger.kernel.org).
 
-The archives are readable via NNTP or HTTP:
+The archives are readable via IMAP, NNTP or HTTP:
 
-        nntp://news.public-inbox.org/inbox.comp.mail.public-inbox.meta
+        nntps://news.public-inbox.org/inbox.comp.mail.public-inbox.meta
+        imaps://news.public-inbox.org/inbox.comp.mail.public-inbox.meta.0
         https://public-inbox.org/meta/
 
+AUTH=ANONYMOUS is supported for IMAP, but any username + password works
+
 And as Tor hidden services:
 
         http://hjrcffqmbrq6wope.onion/meta/
         nntp://hjrcffqmbrq6wope.onion/inbox.comp.mail.public-inbox.meta
+        imap://hjrcffqmbrq6wope.onion/inbox.comp.mail.public-inbox.meta.0
 
 You may also clone all messages via git:
 
@@ -152,7 +157,7 @@ aims to preserve the focus on content, and not presentation.
 Copyright
 ---------
 
-Copyright 2013-2020 all contributors <meta@public-inbox.org>
+Copyright 2013-2021 all contributors <meta@public-inbox.org>
 License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 This program is free software: you can redistribute it and/or modify
diff --git a/ci/deps.perl b/ci/deps.perl
index 4c273337..643e86c0 100755
--- a/ci/deps.perl
+++ b/ci/deps.perl
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Helper script for installing/uninstalling packages for CI use
 # Intended for use on non-production chroots or VMs since it
diff --git a/ci/profiles.sh b/ci/profiles.sh
index c891494f..3cd8fa38 100755
--- a/ci/profiles.sh
+++ b/ci/profiles.sh
@@ -1,5 +1,5 @@
 #!/bin/sh
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Prints OS-specific package profiles to stdout (one per-newline) to use
diff --git a/ci/run.sh b/ci/run.sh
index 3f36d0d9..9613943b 100755
--- a/ci/run.sh
+++ b/ci/run.sh
@@ -1,5 +1,5 @@
 #!/bin/sh
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 set -e
 SUDO=${SUDO-'sudo'} PERL=${PERL-'perl'} MAKE=${MAKE-'make'}
diff --git a/contrib/completion/lei-completion.bash b/contrib/completion/lei-completion.bash
new file mode 100644
index 00000000..0b82b109
--- /dev/null
+++ b/contrib/completion/lei-completion.bash
@@ -0,0 +1,11 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# preliminary bash completion support for lei (Local Email Interface)
+# Needs a lot of work, see `lei__complete' in lib/PublicInbox::LEI.pm
+_lei() {
+        COMPREPLY=($(compgen -W "$(lei _complete ${COMP_WORDS[@]})" \
+                        -- "${COMP_WORDS[COMP_CWORD]}"))
+        return 0
+}
+complete -o default -o bashdefault -F _lei lei
diff --git a/examples/README.unsubscribe b/examples/README.unsubscribe
index f84e9355..3e80e838 100644
--- a/examples/README.unsubscribe
+++ b/examples/README.unsubscribe
@@ -36,5 +36,5 @@ in /etc/postfix/main.cf:
   # This is not needed for mlmmj since mlmmj uses SMTP:
   # non_smtpd_milters = local:/var/spool/postfix/unsubscribe/unsubscribe.sock
 
-Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
diff --git a/examples/cgit-commit-filter.lua b/examples/cgit-commit-filter.lua
index 73af9948..8f9d3eb5 100644
--- a/examples/cgit-commit-filter.lua
+++ b/examples/cgit-commit-filter.lua
@@ -1,4 +1,4 @@
--- Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+-- Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 -- License: GPLv2 or later <https://www.gnu.org/licenses/gpl-2.0.txt>
 -- This commit filter maps a subject line to a search URL of a public-inbox
 -- disclaimer: written by someone who does not know Lua.
diff --git a/examples/cgit-wwwhighlight-filter.lua b/examples/cgit-wwwhighlight-filter.lua
index 708e8696..a622e9f8 100644
--- a/examples/cgit-wwwhighlight-filter.lua
+++ b/examples/cgit-wwwhighlight-filter.lua
@@ -1,4 +1,4 @@
--- Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+-- Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 -- License: GPL-2.0+ <https://www.gnu.org/licenses/gpl-2.0.txt>
 --
 -- This filter accesses the PublicInbox::WwwHighlight PSGI endpoint
diff --git a/examples/cgit.psgi b/examples/cgit.psgi
index 7ad38e28..876171b9 100644
--- a/examples/cgit.psgi
+++ b/examples/cgit.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: GPL-3.0+ <https://www.gnu.org/licenses/gpl-3.0.txt>
 #
 # PublicInbox::Cgit may be used independently of WWW.
@@ -14,8 +14,8 @@ use warnings;
 use Plack::Builder;
 use PublicInbox::Cgit;
 use PublicInbox::Config;
-my $pi_config = PublicInbox::Config->new;
-my $cgit = PublicInbox::Cgit->new($pi_config);
+my $pi_cfg = PublicInbox::Config->new;
+my $cgit = PublicInbox::Cgit->new($pi_cfg);
 
 builder {
         eval { enable 'ReverseProxy' };
diff --git a/examples/highlight.psgi b/examples/highlight.psgi
index 23ec7861..d0f0be41 100644
--- a/examples/highlight.psgi
+++ b/examples/highlight.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Usage: plackup [OPTIONS] /path/to/this/file
diff --git a/examples/newswww.psgi b/examples/newswww.psgi
index 52ad7043..44462dd3 100644
--- a/examples/newswww.psgi
+++ b/examples/newswww.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: GPL-3.0+ <https://www.gnu.org/licenses/gpl-3.0.txt>
 #
 # NewsWWW may be used independently of WWW.  This can be useful
diff --git a/examples/public-inbox.psgi b/examples/public-inbox.psgi
index 3537be2c..e017b2fb 100644
--- a/examples/public-inbox.psgi
+++ b/examples/public-inbox.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: GPL-3.0+ <https://www.gnu.org/licenses/gpl-3.0.txt>
 # Note: this is part of our test suite, update t/plack.t if this changes
 # Usage: plackup [OPTIONS] /path/to/this/file
diff --git a/examples/unsubscribe.milter b/examples/unsubscribe.milter
index 23229511..7b126e30 100644
--- a/examples/unsubscribe.milter
+++ b/examples/unsubscribe.milter
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/examples/unsubscribe.psgi b/examples/unsubscribe.psgi
index 7b97e253..c804b7d0 100644
--- a/examples/unsubscribe.psgi
+++ b/examples/unsubscribe.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: GPL-3.0+ <https://www.gnu.org/licenses/gpl-3.0.txt>
 # This should not require any other PublicInbox code, but may use
 # PublicInbox::Config if ~/.public-inbox/config exists or
diff --git a/lei.sh b/lei.sh
new file mode 100755
index 00000000..f1510a73
--- /dev/null
+++ b/lei.sh
@@ -0,0 +1,7 @@
+#!/bin/sh -e
+# symlink this file to a directory in PATH to run lei (or anything in script/*)
+# without needing perms to install globally.  Used by "make symlink-install"
+p=$(realpath "$0" || readlink "$0") # neither is POSIX, but common
+p=$(dirname "$p") c=$(basename "$0") # both are POSIX
+exec ${PERL-perl} -w -I"$p"/lib "$p"/script/"${c%.sh}" "$@"
+: this script is too short to copyright
diff --git a/lib/PublicInbox/Address.pm b/lib/PublicInbox/Address.pm
index f413c2f6..2c9c4395 100644
--- a/lib/PublicInbox/Address.pm
+++ b/lib/PublicInbox/Address.pm
@@ -1,8 +1,10 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::Address;
 use strict;
-use warnings;
+use v5.10.1;
+use parent 'Exporter';
+our @EXPORT_OK = qw(pairs);
 
 sub xs_emails {
         grep { defined } map { $_->address() } parse_email_addresses($_[0])
@@ -17,17 +19,25 @@ sub xs_names {
         } parse_email_addresses($_[0]);
 }
 
+sub xs_pairs { # for JMAP, RFC 8621 section 4.1.2.3
+        [ map { # LHS (name) may be undef
+                [ $_->phrase // $_->comment, $_->address ]
+        } parse_email_addresses($_[0]) ];
+}
+
 eval {
         require Email::Address::XS;
         Email::Address::XS->import(qw(parse_email_addresses));
         *emails = \&xs_emails;
         *names = \&xs_names;
+        *pairs = \&xs_pairs;
 };
 
 if ($@) {
         require PublicInbox::AddressPP;
         *emails = \&PublicInbox::AddressPP::emails;
         *names = \&PublicInbox::AddressPP::names;
+        *pairs = \&PublicInbox::AddressPP::pairs;
 }
 
 1;
diff --git a/lib/PublicInbox/AddressPP.pm b/lib/PublicInbox/AddressPP.pm
index 74a82843..6a3ae4fe 100644
--- a/lib/PublicInbox/AddressPP.pm
+++ b/lib/PublicInbox/AddressPP.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::AddressPP;
 use strict;
@@ -13,6 +13,7 @@ sub emails {
 }
 
 sub names {
+        # split by address and post-address comment
         my @p = split(/<?([^@<>]+)\@[\w\.\-]+>?\s*(\(.*?\))?(?:,\s*|\z)/,
                         $_[0]);
         my @ret;
@@ -35,4 +36,24 @@ sub names {
         @ret;
 }
 
+sub pairs { # for JMAP, RFC 8621 section 4.1.2.3
+        my ($s) = @_;
+        [ map {
+                my $addr = $_;
+                if ($s =~ s/\A\s*(.*?)\s*<\Q$addr\E>\s*(.*?)\s*(?:,|\z)// ||
+                    $s =~ s/\A\s*(.*?)\s*\Q$addr\E\s*(.*?)\s*(?:,|\z)//) {
+                        my ($phrase, $comment) = ($1, $2);
+                        $phrase =~ tr/\r\n\t / /s;
+                        $phrase =~ s/\A['"\s]*//;
+                        $phrase =~ s/['"\s]*\z//;
+                        $phrase =~ s/\s*<*\s*\z//;
+                        $phrase = undef if $phrase !~ /\S/;
+                        $comment = ($comment =~ /\((.*?)\)/) ? $1 : undef;
+                        [ $phrase // $comment, $addr ]
+                } else {
+                        ();
+                }
+        } emails($s) ];
+}
+
 1;
diff --git a/lib/PublicInbox/Admin.pm b/lib/PublicInbox/Admin.pm
index fb88e621..f96397ea 100644
--- a/lib/PublicInbox/Admin.pm
+++ b/lib/PublicInbox/Admin.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # common stuff for administrative command-line tools
@@ -6,15 +6,15 @@
 package PublicInbox::Admin;
 use strict;
 use parent qw(Exporter);
-use Cwd qw(abs_path);
-use POSIX ();
-our @EXPORT_OK = qw(resolve_repo_dir setup_signals);
+our @EXPORT_OK = qw(setup_signals);
 use PublicInbox::Config;
 use PublicInbox::Inbox;
 use PublicInbox::Spawn qw(popen_rd);
+*rel2abs_collapsed = \&PublicInbox::Config::rel2abs_collapsed;
 
 sub setup_signals {
         my ($cb, $arg) = @_; # optional
+        require POSIX;
 
         # we call exit() here instead of _exit() so DESTROY methods
         # get called (e.g. File::Temp::Dir and PublicInbox::Msgmap)
@@ -27,21 +27,34 @@ sub setup_signals {
         };
 }
 
-sub resolve_repo_dir {
+sub resolve_inboxdir {
         my ($cd, $ver) = @_;
-        my $prefix = defined $cd ? $cd : './';
-        if (-d $prefix && -f "$prefix/inbox.lock") { # v2
-                $$ver = 2 if $ver;
-                return abs_path($prefix);
+        my $try = $cd // '.';
+        my $root_dev_ino;
+        while (1) { # favor v2, first
+                if (-f "$try/inbox.lock") {
+                        $$ver = 2 if $ver;
+                        return rel2abs_collapsed($try);
+                } elsif (-d $try) {
+                        my @try = stat _;
+                        $root_dev_ino //= do {
+                                my @root = stat('/') or die "stat /: $!\n";
+                                "$root[0]\0$root[1]";
+                        };
+                        last if "$try[0]\0$try[1]" eq $root_dev_ino;
+                        $try .= '/..'; # continue, cd up
+                } else {
+                        die "`$try' is not a directory\n";
+                }
         }
+        # try v1 bare git dirs
         my $cmd = [ qw(git rev-parse --git-dir) ];
         my $fh = popen_rd($cmd, undef, {-C => $cd});
         my $dir = do { local $/; <$fh> };
-        close $fh or die "error in ".join(' ', @$cmd)." (cwd:$cd): $!\n";
+        close $fh or die "error in @$cmd (cwd:${\($cd // '.')}): $!\n";
         chomp $dir;
         $$ver = 1 if $ver;
-        return abs_path($cd) if ($dir eq '.' && defined $cd);
-        abs_path($dir);
+        rel2abs_collapsed($dir eq '.' ? ($cd // $dir) : $dir);
 }
 
 # for unconfigured inboxes
@@ -78,8 +91,8 @@ sub unconfigured_ibx ($$) {
                 name => $name,
                 address => [ "$name\@example.com" ],
                 inboxdir => $dir,
-                # TODO: consumers may want to warn on this:
-                #-unconfigured => 1,
+                # consumers (-convert) warn on this:
+                -unconfigured => 1,
         });
 }
 
@@ -95,40 +108,53 @@ sub resolve_inboxes ($;$$) {
         }
 
         my $min_ver = $opt->{-min_inbox_version} || 0;
+        # lookup inboxes by st_dev + st_ino instead of {inboxdir} pathnames,
+        # pathnames are not unique due to symlinks and bind mounts
         my (@old, @ibxs);
-        my %dir2ibx;
-        if ($cfg) {
+        if ($opt->{all}) {
                 $cfg->each_inbox(sub {
                         my ($ibx) = @_;
-                        my $path = abs_path($ibx->{inboxdir});
-                        if (defined($path)) {
-                                $dir2ibx{$path} = $ibx;
+                        if (-e $ibx->{inboxdir}) {
+                                push(@ibxs, $ibx) if $ibx->version >= $min_ver;
                         } else {
-                                warn <<EOF;
-W: $ibx->{name} $ibx->{inboxdir}: $!
-EOF
+                                warn "W: $ibx->{name} $ibx->{inboxdir}: $!\n";
                         }
                 });
-        }
-        if ($opt->{all}) {
-                my @all = values %dir2ibx;
-                @all = grep { $_->version >= $min_ver } @all;
-                push @ibxs, @all;
         } else { # directories specified on the command-line
-                my $i = 0;
                 my @dirs = @$argv;
-                push @dirs, '.' unless @dirs;
-                foreach (@dirs) {
-                        my $v;
-                        my $dir = resolve_repo_dir($_, \$v);
-                        if ($v < $min_ver) {
+                push @dirs, '.' if !@dirs && $opt->{-use_cwd};
+                my %s2i; # "st_dev\0st_ino" => array index
+                for (my $i = 0; $i <= $#dirs; $i++) {
+                        my $dir = $dirs[$i];
+                        my @st = stat($dir) or die "stat($dir): $!\n";
+                        $dir = $dirs[$i] = resolve_inboxdir($dir, \(my $ver));
+                        if ($ver >= $min_ver) {
+                                $s2i{"$st[0]\0$st[1]"} //= $i;
+                        } else {
                                 push @old, $dir;
-                                next;
                         }
-                        my $ibx = $dir2ibx{$dir} ||= unconfigured_ibx($dir, $i);
-                        $i++;
-                        push @ibxs, $ibx;
                 }
+                my $done = \'done';
+                eval {
+                        $cfg->each_inbox(sub {
+                                my ($ibx) = @_;
+                                return if $ibx->version < $min_ver;
+                                my $dir = $ibx->{inboxdir};
+                                if (my @s = stat $dir) {
+                                        my $i = delete($s2i{"$s[0]\0$s[1]"})
+                                                // return;
+                                        $ibxs[$i] = $ibx;
+                                        die $done if !keys(%s2i);
+                                } else {
+                                        warn "W: $ibx->{name} $dir: $!\n";
+                                }
+                        });
+                };
+                die $@ if $@ && $@ ne $done;
+                for my $i (sort { $a <=> $b } values %s2i) {
+                        $ibxs[$i] = unconfigured_ibx($dirs[$i], $i);
+                }
+                @ibxs = grep { defined } @ibxs; # duplicates are undef
         }
         if (@old) {
                 die "-V$min_ver inboxes not supported by $0\n\t",
@@ -208,12 +234,20 @@ sub index_terminate {
 
 sub index_inbox {
         my ($ibx, $im, $opt) = @_;
+        require PublicInbox::InboxWritable;
         my $jobs = delete $opt->{jobs} if $opt;
         if (my $pr = $opt->{-progress}) {
                 $pr->("indexing $ibx->{inboxdir} ...\n");
         }
         local %SIG = %SIG;
         setup_signals(\&index_terminate, $ibx);
+        my $warn_cb = $SIG{__WARN__} // \&CORE::warn;
+        my $idx = { current_info => $ibx->{inboxdir} };
+        my $warn_ignore = PublicInbox::InboxWritable->can('warn_ignore');
+        local $SIG{__WARN__} = sub {
+                return if $warn_ignore->(@_);
+                $warn_cb->($idx->{current_info}, ': ', @_);
+        };
         if (ref($ibx) && $ibx->version == 2) {
                 eval { require PublicInbox::V2Writable };
                 die "v2 requirements not met: $@\n" if $@;
@@ -225,21 +259,19 @@ sub index_inbox {
                         } else {
                                 my $n = $v2w->{shards};
                                 if ($jobs < ($n + 1) && !$opt->{reshard}) {
-                                        warn
-"Unable to respect --jobs=$jobs on index, inbox was created with $n shards\n";
+                                        warn <<EOM;
+Unable to respect --jobs=$jobs on index, inbox was created with $n shards
+EOM
                                 }
                         }
                 }
-                my $warn_cb = $SIG{__WARN__} || sub { print STDERR @_ };
-                local $SIG{__WARN__} = sub {
-                        $warn_cb->($v2w->{current_info}, ': ', @_);
-                };
-                $v2w->index_sync($opt);
+                $idx = $v2w;
         } else {
                 require PublicInbox::SearchIdx;
-                my $s = PublicInbox::SearchIdx->new($ibx, 1);
-                $s->index_sync($opt);
+                $idx = PublicInbox::SearchIdx->new($ibx, 1);
         }
+        $idx->index_sync($opt);
+        $idx->{nidx} // 0; # returns number processed
 }
 
 sub progress_prepare ($) {
diff --git a/lib/PublicInbox/AdminEdit.pm b/lib/PublicInbox/AdminEdit.pm
index 4448dcc2..2f6707d8 100644
--- a/lib/PublicInbox/AdminEdit.pm
+++ b/lib/PublicInbox/AdminEdit.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # common stuff between -edit, -purge (and maybe -learn in the future)
diff --git a/lib/PublicInbox/AltId.pm b/lib/PublicInbox/AltId.pm
index 6d16242a..80757ceb 100644
--- a/lib/PublicInbox/AltId.pm
+++ b/lib/PublicInbox/AltId.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Used for giving serial numbers to messages.  This can be tied to
diff --git a/lib/PublicInbox/Cgit.pm b/lib/PublicInbox/Cgit.pm
index fb0d0e60..f38e8b6b 100644
--- a/lib/PublicInbox/Cgit.pm
+++ b/lib/PublicInbox/Cgit.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # wrapper for cgit(1) and git-http-backend(1) for browsing and
@@ -16,9 +16,9 @@ use PublicInbox::Qspawn;
 use PublicInbox::WwwStatic qw(r);
 
 sub locate_cgit ($) {
-        my ($pi_config) = @_;
-        my $cgit_bin = $pi_config->{'publicinbox.cgitbin'};
-        my $cgit_data = $pi_config->{'publicinbox.cgitdata'};
+        my ($pi_cfg) = @_;
+        my $cgit_bin = $pi_cfg->{'publicinbox.cgitbin'};
+        my $cgit_data = $pi_cfg->{'publicinbox.cgitdata'};
 
         # /var/www/htdocs/cgit is the default install path from cgit.git
         # /usr/{lib,share}/cgit is where Debian puts cgit
@@ -51,28 +51,28 @@ sub locate_cgit ($) {
 }
 
 sub new {
-        my ($class, $pi_config) = @_;
-        my ($cgit_bin, $cgit_data) = locate_cgit($pi_config);
+        my ($class, $pi_cfg) = @_;
+        my ($cgit_bin, $cgit_data) = locate_cgit($pi_cfg);
 
         my $self = bless {
                 cmd => [ $cgit_bin ],
                 cgit_data => $cgit_data,
-                pi_config => $pi_config,
+                pi_cfg => $pi_cfg,
         }, $class;
 
-        $pi_config->fill_all; # fill in -code_repos mapped to inboxes
+        $pi_cfg->fill_all; # fill in -code_repos mapped to inboxes
 
         # some cgit repos may not be mapped to inboxes, so ensure those exist:
-        my $code_repos = $pi_config->{-code_repos};
-        foreach my $k (keys %$pi_config) {
+        my $code_repos = $pi_cfg->{-code_repos};
+        foreach my $k (keys %$pi_cfg) {
                 $k =~ /\Acoderepo\.(.+)\.dir\z/ or next;
-                my $dir = $pi_config->{$k};
+                my $dir = $pi_cfg->{$k};
                 $code_repos->{$1} ||= PublicInbox::Git->new($dir);
         }
         while (my ($nick, $repo) = each %$code_repos) {
                 $self->{"\0$nick"} = $repo;
         }
-        my $cgit_static = $pi_config->{-cgit_static};
+        my $cgit_static = $pi_cfg->{-cgit_static};
         my $static = join('|', map { quotemeta $_ } keys %$cgit_static);
         $self->{static} = qr/\A($static)\z/;
         $self;
@@ -120,7 +120,7 @@ sub call {
 
         my $rdr = input_prepare($env) or return r(500);
         my $qsp = PublicInbox::Qspawn->new($self->{cmd}, $cgi_env, $rdr);
-        my $limiter = $self->{pi_config}->limiter('-cgit');
+        my $limiter = $self->{pi_cfg}->limiter('-cgit');
         $qsp->psgi_return($env, $limiter, $parse_cgi_headers);
 }
 
diff --git a/lib/PublicInbox/CmdIPC4.pm b/lib/PublicInbox/CmdIPC4.pm
new file mode 100644
index 00000000..c244f6a1
--- /dev/null
+++ b/lib/PublicInbox/CmdIPC4.pm
@@ -0,0 +1,36 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# callers should use PublicInbox::CmdIPC4->can('send_cmd4') (or recv_cmd4)
+# first choice for script/lei front-end and 2nd choice for lei backend
+# libsocket-msghdr-perl is in Debian but many other distros as of 2021.
+package PublicInbox::CmdIPC4;
+use strict;
+use v5.10.1;
+use Socket qw(SOL_SOCKET SCM_RIGHTS);
+BEGIN { eval {
+require Socket::MsgHdr; # XS
+no warnings 'once';
+
+# 3 FDs per-sendmsg(2) + buffer
+*send_cmd4 = sub ($$$$) { # (sock, fds, buf, flags) = @_;
+        my ($sock, $fds, undef, $flags) = @_;
+        my $mh = Socket::MsgHdr->new(buf => $_[2]);
+        $mh->cmsghdr(SOL_SOCKET, SCM_RIGHTS,
+                        pack('i' x scalar(@$fds), @$fds));
+        Socket::MsgHdr::sendmsg($sock, $mh, $flags);
+};
+
+*recv_cmd4 = sub ($$$) {
+        my ($s, undef, $len) = @_; # $_[1] = destination buffer
+        my $mh = Socket::MsgHdr->new(buflen => $len, controllen => 256);
+        my $r = Socket::MsgHdr::recvmsg($s, $mh, 0) // return ($_[1] = undef);
+        $_[1] = $mh->buf;
+        return () if $r == 0;
+        my (undef, undef, $data) = $mh->cmsghdr;
+        defined($data) ? unpack('i' x (length($data) / 4), $data) : ();
+};
+
+} } # /eval /BEGIN
+
+1;
diff --git a/lib/PublicInbox/CompressNoop.pm b/lib/PublicInbox/CompressNoop.pm
index fe73c2d1..e3301473 100644
--- a/lib/PublicInbox/CompressNoop.pm
+++ b/lib/PublicInbox/CompressNoop.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Provide the same methods as Compress::Raw::Zlib::Deflate but
diff --git a/lib/PublicInbox/Config.pm b/lib/PublicInbox/Config.pm
index d57c361a..4f63bc93 100644
--- a/lib/PublicInbox/Config.pm
+++ b/lib/PublicInbox/Config.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used throughout the project for reading configuration
@@ -33,6 +33,7 @@ sub new {
         $self->{-by_list_id} = {};
         $self->{-by_name} = {};
         $self->{-by_newsgroup} = {};
+        $self->{-by_eidx_key} = {};
         $self->{-no_obfuscate} = {};
         $self->{-limiters} = {};
         $self->{-code_repos} = {}; # nick => PublicInbox::Git object
@@ -89,6 +90,14 @@ sub lookup_name ($$) {
         $self->{-by_name}->{$name} // _fill($self, "publicinbox.$name");
 }
 
+sub lookup_ei {
+        my ($self, $name) = @_;
+        $self->{-ei_by_name}->{$name} //= _fill_ei($self, "extindex.$name");
+}
+
+# special case for [extindex "all"]
+sub ALL { lookup_ei($_[0], 'all') }
+
 sub each_inbox {
         my ($self, $cb, @arg) = @_;
         # may auto-vivify if config file is non-existent:
@@ -123,20 +132,16 @@ sub default_file {
 
 sub config_fh_parse ($$$) {
         my ($fh, $rs, $fs) = @_;
-        my %rv;
-        my (%section_seen, @section_order);
+        my (%rv, %seen, @section_order, $line, $k, $v, $section, $cur, $i);
         local $/ = $rs;
-        while (defined(my $line = <$fh>)) {
-                chomp $line;
-                my ($k, $v) = split($fs, $line, 2);
-                my ($section) = ($k =~ /\A(\S+)\.[^\.]+\z/);
-                unless (defined $section_seen{$section}) {
-                        $section_seen{$section} = 1;
-                        push @section_order, $section;
-                }
-
-                my $cur = $rv{$k};
-                if (defined $cur) {
+        while (defined($line = <$fh>)) { # perf critical with giant configs
+                $i = index($line, $fs);
+                $k = substr($line, 0, $i);
+                $v = substr($line, $i + 1, -1); # chop off $fs
+                $section = substr($k, 0, rindex($k, '.'));
+                $seen{$section} //= push(@section_order, $section);
+
+                if (defined($cur = $rv{$k})) {
                         if (ref($cur) eq "ARRAY") {
                                 push @$cur, $v;
                         } else {
@@ -154,11 +159,10 @@ sub config_fh_parse ($$$) {
 sub git_config_dump {
         my ($file) = @_;
         return {} unless -e $file;
-        my @cmd = (qw/git config -z -l --includes/, "--file=$file");
-        my $cmd = join(' ', @cmd);
-        my $fh = popen_rd(\@cmd);
+        my $cmd = [ qw(git config -z -l --includes), "--file=$file" ];
+        my $fh = popen_rd($cmd);
         my $rv = config_fh_parse($fh, "\0", "\n");
-        close $fh or die "failed to close ($cmd) pipe: $?";
+        close $fh or die "failed to close (@$cmd) pipe: $?";
         $rv;
 }
 
@@ -360,6 +364,16 @@ sub git_bool {
         }
 }
 
+# abs_path resolves symlinks, so we want to avoid it if rel2abs
+# is sufficient and doesn't leave "/.." or "/../"
+sub rel2abs_collapsed {
+        require File::Spec;
+        my $p = File::Spec->rel2abs($_[-1]);
+        return $p if substr($p, -3, 3) ne '/..' && index($p, '/../') < 0;
+        require Cwd;
+        Cwd::abs_path($p);
+}
+
 sub _fill {
         my ($self, $pfx) = @_;
         my $ibx = {};
@@ -382,10 +396,10 @@ EOF
                 }
         }
 
-        # backwards compatibility:
-        $ibx->{inboxdir} //= $self->{"$pfx.mainrepo"};
-        if (($ibx->{inboxdir} // '') =~ /\n/s) {
-                warn "E: `$ibx->{inboxdir}' must not contain `\\n'\n";
+        # "mainrepo" is backwards compatibility:
+        my $dir = $ibx->{inboxdir} //= $self->{"$pfx.mainrepo"} // return;
+        if (index($dir, "\n") >= 0) {
+                warn "E: `$dir' must not contain `\\n'\n";
                 return;
         }
         foreach my $k (qw(obfuscate)) {
@@ -406,17 +420,14 @@ EOF
                 }
         }
 
-        return unless defined($ibx->{inboxdir});
-        my $name = $pfx;
-        $name =~ s/\Apublicinbox\.//;
-
+        my $name = substr($pfx, length('publicinbox.'));
         if (!valid_inbox_name($name)) {
                 warn "invalid inbox name: '$name'\n";
                 return;
         }
 
         $ibx->{name} = $name;
-        $ibx->{-pi_config} = $self;
+        $ibx->{-pi_cfg} = $self;
         $ibx = PublicInbox::Inbox->new($ibx);
         foreach (@{$ibx->{address}}) {
                 my $lc_addr = lc($_);
@@ -429,8 +440,31 @@ EOF
                         $self->{-by_list_id}->{lc($list_id)} = $ibx;
                 }
         }
-        if (my $ng = $ibx->{newsgroup}) {
-                $self->{-by_newsgroup}->{$ng} = $ibx;
+        if (defined(my $ngname = $ibx->{newsgroup})) {
+                if (ref($ngname)) {
+                        delete $ibx->{newsgroup};
+                        warn 'multiple newsgroups not supported: '.
+                                join(', ', @$ngname). "\n";
+                # Newsgroup name needs to be compatible with RFC 3977
+                # wildmat-exact and RFC 3501 (IMAP) ATOM-CHAR.
+                # Leave out a few chars likely to cause problems or conflicts:
+                # '|', '<', '>', ';', '#', '$', '&',
+                } elsif ($ngname =~ m![^A-Za-z0-9/_\.\-\~\@\+\=:]! ||
+                                $ngname eq '') {
+                        delete $ibx->{newsgroup};
+                        warn "newsgroup name invalid: `$ngname'\n";
+                } else {
+                        # PublicInbox::NNTPD does stricter ->nntp_usable
+                        # checks, keep this lean for startup speed
+                        $self->{-by_newsgroup}->{$ngname} = $ibx;
+                }
+        }
+        unless (defined $ibx->{newsgroup}) { # for ->eidx_key
+                my $abs = rel2abs_collapsed($dir);
+                if ($abs ne $dir) {
+                        warn "W: `$dir' canonicalized to `$abs'\n";
+                        $ibx->{inboxdir} = $abs;
+                }
         }
         $self->{-by_name}->{$name} = $ibx;
         if ($ibx->{obfuscate}) {
@@ -453,8 +487,18 @@ EOF
                         push @$repo_objs, $repo if $repo;
                 }
         }
+        if (my $es = ALL($self)) {
+                require PublicInbox::Isearch;
+                $ibx->{isrch} = PublicInbox::Isearch->new($ibx, $es);
+        }
+        $self->{-by_eidx_key}->{$ibx->eidx_key} = $ibx;
+}
 
-        $ibx
+sub _fill_ei ($$) {
+        my ($self, $pfx) = @_;
+        require PublicInbox::ExtSearch;
+        my $d = $self->{"$pfx.topdir"};
+        defined($d) && -d $d ? PublicInbox::ExtSearch->new($d) : undef;
 }
 
 sub urlmatch {
@@ -476,4 +520,16 @@ sub urlmatch {
         }
 }
 
+sub json {
+        state $json;
+        $json //= do {
+                for my $mod (qw(Cpanel::JSON::XS JSON::MaybeXS JSON JSON::PP)) {
+                        eval "require $mod" or next;
+                        # ->ascii encodes non-ASCII to "\uXXXX"
+                        $json = $mod->new->ascii(1) and last;
+                }
+                $json;
+        };
+}
+
 1;
diff --git a/lib/PublicInbox/ConfigIter.pm b/lib/PublicInbox/ConfigIter.pm
index e6fa8172..24cb09bf 100644
--- a/lib/PublicInbox/ConfigIter.pm
+++ b/lib/PublicInbox/ConfigIter.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Intended for PublicInbox::DS->EventLoop in read-only daemons
diff --git a/lib/PublicInbox/ContentHash.pm b/lib/PublicInbox/ContentHash.pm
index 1fe22955..838fdd6f 100644
--- a/lib/PublicInbox/ContentHash.pm
+++ b/lib/PublicInbox/ContentHash.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Unstable internal API.
diff --git a/lib/PublicInbox/DS.pm b/lib/PublicInbox/DS.pm
index a02b3bb7..40994fd4 100644
--- a/lib/PublicInbox/DS.pm
+++ b/lib/PublicInbox/DS.pm
@@ -21,19 +21,19 @@
 #        (tmpio = [ GLOB, offset, [ length ] ])
 package PublicInbox::DS;
 use strict;
+use v5.10.1;
+use parent qw(Exporter);
 use bytes;
-use POSIX qw(WNOHANG);
+use POSIX qw(WNOHANG sigprocmask SIG_SETMASK);
 use IO::Handle qw();
 use Fcntl qw(SEEK_SET :DEFAULT O_APPEND);
 use Time::HiRes qw(clock_gettime CLOCK_MONOTONIC);
-use parent qw(Exporter);
-our @EXPORT_OK = qw(now msg_more);
-use 5.010_001;
 use Scalar::Util qw(blessed);
 use PublicInbox::Syscall qw(:epoll);
 use PublicInbox::Tmpfile;
 use Errno qw(EAGAIN EINVAL);
 use Carp qw(confess carp);
+our @EXPORT_OK = qw(now msg_more dwaitpid);
 
 my $nextq; # queue for next_tick
 my $wait_pids; # list of [ pid, callback, callback_arg ]
@@ -50,7 +50,6 @@ our (
      $PostLoopCallback,          # subref to call at the end of each loop, if defined (global)
 
      $LoopTimeout,               # timeout of event loop in milliseconds
-     $DoneInit,                  # if we've done the one-time module init yet
      @Timers,                    # timers
      $in_loop,
      );
@@ -67,20 +66,18 @@ Reset all state
 
 =cut
 sub Reset {
+    $in_loop = undef; # first in case DESTROY callbacks use this
     %DescriptorMap = ();
-    $in_loop = $wait_pids = $later_queue = $reap_armed = undef;
+    $wait_pids = $later_queue = $reap_armed = undef;
     $EXPMAP = {};
     $nextq = $ToClose = $later_timer = $exp_timer = undef;
     $LoopTimeout = -1;  # no timeout by default
     @Timers = ();
 
     $PostLoopCallback = undef;
-    $DoneInit = 0;
 
     $_io = undef; # closes real $Epoll FD
     $Epoll = undef; # may call DSKQXS::DESTROY
-
-    *EventLoop = *FirstTimeEventLoop;
 }
 
 =head2 C<< CLASS->SetLoopTimeout( $timeout ) >>
@@ -91,9 +88,7 @@ A timeout of 0 (zero) means poll forever. A timeout of -1 means poll and return
 immediately.
 
 =cut
-sub SetLoopTimeout {
-    return $LoopTimeout = $_[1] + 0;
-}
+sub SetLoopTimeout { $LoopTimeout = $_[1] + 0 }
 
 =head2 C<< PublicInbox::DS::add_timer( $seconds, $coderef, $arg) >>
 
@@ -137,14 +132,13 @@ sub set_cloexec ($) {
     fcntl($_io, F_SETFD, $fl | FD_CLOEXEC);
 }
 
+# caller sets return value to $Epoll
 sub _InitPoller
 {
-    return if $DoneInit;
-    $DoneInit = 1;
-
     if (PublicInbox::Syscall::epoll_defined())  {
-        $Epoll = epoll_create();
-        set_cloexec($Epoll) if (defined($Epoll) && $Epoll >= 0);
+        my $fd = epoll_create();
+        set_cloexec($fd) if (defined($fd) && $fd >= 0);
+        $fd;
     } else {
         my $cls;
         for (qw(DSKQXS DSPoll)) {
@@ -152,9 +146,8 @@ sub _InitPoller
             last if eval "require $cls";
         }
         $cls->import(qw(epoll_ctl epoll_wait));
-        $Epoll = $cls->new;
+        $cls->new;
     }
-    *EventLoop = *EpollEventLoop;
 }
 
 =head2 C<< CLASS->EventLoop() >>
@@ -163,13 +156,6 @@ Start processing IO events. In most daemon programs this never exits. See
 C<PostLoopCallback> below for how to exit the loop.
 
 =cut
-sub FirstTimeEventLoop {
-    my $class = shift;
-
-    _InitPoller();
-
-    EventLoop($class);
-}
 
 sub now () { clock_gettime(CLOCK_MONOTONIC) }
 
@@ -213,12 +199,17 @@ sub RunTimers {
     my $timeout = int(($Timers[0][0] - $now) * 1000) + 1;
 
     # -1 is an infinite timeout, so prefer a real timeout
-    return $timeout     if $LoopTimeout == -1;
+    ($LoopTimeout < 0 || $LoopTimeout >= $timeout) ? $timeout : $LoopTimeout;
+}
+
+sub sig_setmask { sigprocmask(SIG_SETMASK, @_) or die "sigprocmask: $!" }
 
-    # otherwise pick the lower of our regular timeout and time until
-    # the next timer
-    return $LoopTimeout if $LoopTimeout < $timeout;
-    return $timeout;
+sub block_signals () {
+        my $oldset = POSIX::SigSet->new;
+        my $newset = POSIX::SigSet->new;
+        $newset->fillset or die "fillset: $!";
+        sig_setmask($newset, $oldset);
+        $oldset;
 }
 
 # We can't use waitpid(-1) safely here since it can hit ``, system(),
@@ -230,17 +221,22 @@ sub reap_pids {
         $reap_armed = undef;
         my $tmp = $wait_pids or return;
         $wait_pids = undef;
+        my $oldset = block_signals();
         foreach my $ary (@$tmp) {
                 my ($pid, $cb, $arg) = @$ary;
                 my $ret = waitpid($pid, WNOHANG);
                 if ($ret == 0) {
                         push @$wait_pids, $ary; # autovivifies @$wait_pids
-                } elsif ($cb) {
-                        eval { $cb->($arg, $pid) };
+                } elsif ($ret == $pid) {
+                        if ($cb) {
+                                eval { $cb->($arg, $pid) };
+                                warn "E: dwaitpid($pid) in_loop: $@" if $@;
+                        }
+                } else {
+                        warn "waitpid($pid, WNOHANG) = $ret, \$!=$!, \$?=$?";
                 }
         }
-        # we may not be done, yet, and could've missed/masked a SIGCHLD:
-        $reap_armed //= requeue(\&reap_pids) if $wait_pids;
+        sig_setmask($oldset);
 }
 
 # reentrant SIGCHLD handler (since reap_pids is not reentrant)
@@ -271,21 +267,21 @@ sub PostEventLoop () {
         $PostLoopCallback ? $PostLoopCallback->(\%DescriptorMap) : 1;
 }
 
-sub EpollEventLoop {
+sub EventLoop {
+    $Epoll //= _InitPoller();
     local $in_loop = 1;
+    my @events;
     do {
-        my @events;
-        my $i;
         my $timeout = RunTimers();
 
         # get up to 1000 events
-        my $evcount = epoll_wait($Epoll, 1000, $timeout, \@events);
-        for ($i=0; $i<$evcount; $i++) {
+        epoll_wait($Epoll, 1000, $timeout, \@events);
+        for my $fd (@events) {
             # it's possible epoll_wait returned many events, including some at the end
             # that ones in the front triggered unregister-interest actions.  if we
             # can't find the %sock entry, it's because we're no longer interested
             # in that event.
-            $DescriptorMap{$events[$i]->[0]}->event_step;
+            $DescriptorMap{$fd}->event_step;
         }
     } while (PostEventLoop());
     _run_later();
@@ -330,8 +326,7 @@ sub new {
     $self->{sock} = $sock;
     my $fd = fileno($sock);
 
-    _InitPoller();
-
+    $Epoll //= _InitPoller();
 retry:
     if (epoll_ctl($Epoll, EPOLL_CTL_ADD, $fd, $ev)) {
         if ($! == EINVAL && ($ev & EPOLLEXCLUSIVE)) {
@@ -629,13 +624,23 @@ sub shutdn ($) {
     }
 }
 
-# must be called with eval, PublicInbox::DS may not be loaded (see t/qspawn.t)
-sub dwaitpid ($$$) {
-        die "Not in EventLoop\n" unless $in_loop;
-        push @$wait_pids, [ @_ ]; # [ $pid, $cb, $arg ]
-
-        # We could've just missed our SIGCHLD, cover it, here:
-        enqueue_reap();
+sub dwaitpid ($;$$) {
+        my ($pid, $cb, $arg) = @_;
+        if ($in_loop) {
+                push @$wait_pids, [ $pid, $cb, $arg ];
+                # We could've just missed our SIGCHLD, cover it, here:
+                enqueue_reap();
+        } else {
+                my $ret = waitpid($pid, 0);
+                if ($ret == $pid) {
+                        if ($cb) {
+                                eval { $cb->($arg, $pid) };
+                                carp "E: dwaitpid($pid) !in_loop: $@" if $@;
+                        }
+                } else {
+                        carp "waitpid($pid, 0) = $ret, \$!=$!, \$?=$?";
+                }
+        }
 }
 
 sub _run_later () {
diff --git a/lib/PublicInbox/DSKQXS.pm b/lib/PublicInbox/DSKQXS.pm
index d1d3fe60..acc31d9b 100644
--- a/lib/PublicInbox/DSKQXS.pm
+++ b/lib/PublicInbox/DSKQXS.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # Licensed the same as Danga::Socket (and Perl5)
 # License: GPL-1.0+ or Artistic-1.0-Perl
 #  <https://www.gnu.org/licenses/gpl-1.0.txt>
@@ -18,7 +18,7 @@ use Symbol qw(gensym);
 use IO::KQueue;
 use Errno qw(EAGAIN);
 use PublicInbox::Syscall qw(EPOLLONESHOT EPOLLIN EPOLLOUT EPOLLET
-        EPOLL_CTL_ADD EPOLL_CTL_MOD EPOLL_CTL_DEL $SFD_NONBLOCK);
+        EPOLL_CTL_ADD EPOLL_CTL_MOD EPOLL_CTL_DEL SFD_NONBLOCK);
 our @EXPORT_OK = qw(epoll_ctl epoll_wait);
 
 sub EV_DISPATCH () { 0x0080 }
@@ -57,7 +57,7 @@ sub signalfd {
 sub TIEHANDLE { # similar to signalfd()
         my ($class, $signo, $flags) = @_;
         my $self = $class->new;
-        $self->{timeout} = ($flags & $SFD_NONBLOCK) ? 0 : -1;
+        $self->{timeout} = ($flags & SFD_NONBLOCK) ? 0 : -1;
         my $kq = $self->{kq};
         $kq->EV_SET($_, EVFILT_SIGNAL, EV_ADD) for @$signo;
         $self;
@@ -134,7 +134,7 @@ sub epoll_wait {
                 }
         }
         # caller only cares for $events[$i]->[0]
-        scalar(@$events);
+        $_ = $_->[0] for @$events;
 }
 
 # kqueue is close-on-fork (not exec), so we must not close it
diff --git a/lib/PublicInbox/DSPoll.pm b/lib/PublicInbox/DSPoll.pm
index 1d9b51d9..56a400c2 100644
--- a/lib/PublicInbox/DSPoll.pm
+++ b/lib/PublicInbox/DSPoll.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # Licensed the same as Danga::Socket (and Perl5)
 # License: GPL-1.0+ or Artistic-1.0-Perl
 #  <https://www.gnu.org/licenses/gpl-1.0.txt>
@@ -45,14 +45,13 @@ sub epoll_wait {
                         my $fd = $pset[$i++];
                         my $revents = $pset[$i++] or next;
                         delete($self->{$fd}) if $self->{$fd} & EPOLLONESHOT;
-                        push @$events, [ $fd ];
+                        push @$events, $fd;
                 }
                 my $nevents = scalar @$events;
                 if ($n != $nevents) {
                         warn "BUG? poll() returned $n, but got $nevents";
                 }
         }
-        $n;
 }
 
 1;
diff --git a/lib/PublicInbox/Daemon.pm b/lib/PublicInbox/Daemon.pm
index 5fdcba14..b5f97d81 100644
--- a/lib/PublicInbox/Daemon.pm
+++ b/lib/PublicInbox/Daemon.pm
@@ -1,7 +1,9 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
-# contains common daemon code for the httpd, imapd, and nntpd servers.
-# This may be used for read-only IMAP server if we decide to implement it.
+#
+# Contains common daemon code for the httpd, imapd, and nntpd servers
+# and designed for handling thousands of untrusted clients over slow
+# and/or lossy connections.
 package PublicInbox::Daemon;
 use strict;
 use warnings;
@@ -11,14 +13,14 @@ use IO::Socket;
 use POSIX qw(WNOHANG :signal_h);
 use Socket qw(IPPROTO_TCP SOL_SOCKET);
 sub SO_ACCEPTFILTER () { 0x1000 }
-use Cwd qw/abs_path/;
 STDOUT->autoflush(1);
 STDERR->autoflush(1);
 use PublicInbox::DS qw(now);
-use PublicInbox::Syscall qw($SFD_NONBLOCK);
+use PublicInbox::Syscall qw(SFD_NONBLOCK);
 require PublicInbox::Listener;
 use PublicInbox::EOFpipe;
 use PublicInbox::Sigfd;
+use PublicInbox::GitAsyncCat;
 my @CMD;
 my ($set_user, $oldset);
 my (@cfg_listen, $stdout, $stderr, $group, $user, $pid_file, $daemonize);
@@ -75,7 +77,7 @@ sub accept_tls_opt ($) {
 sub daemon_prepare ($) {
         my ($default_listen) = @_;
         my $listener_names = {}; # sockname => IO::Handle
-        $oldset = PublicInbox::Sigfd::block_signals();
+        $oldset = PublicInbox::DS::block_signals();
         @CMD = ($0, @ARGV);
         my ($prog) = ($CMD[0] =~ m!([^/]+)\z!g);
         my $help = <<EOF;
@@ -201,10 +203,11 @@ sub check_absolute ($$) {
 
 sub daemonize () {
         if ($daemonize) {
+                require Cwd;
                 foreach my $i (0..$#ARGV) {
                         my $arg = $ARGV[$i];
                         next unless -e $arg;
-                        $ARGV[$i] = abs_path($arg);
+                        $ARGV[$i] = Cwd::abs_path($arg);
                 }
                 check_absolute('stdout', $stdout);
                 check_absolute('stderr', $stderr);
@@ -236,8 +239,7 @@ EOF
         };
 
         if ($daemonize) {
-                my $pid = fork;
-                die "could not fork: $!\n" unless defined $pid;
+                my $pid = fork // die "fork: $!";
                 exit if $pid;
 
                 open(STDIN, '+<', '/dev/null') or
@@ -245,8 +247,7 @@ EOF
                 open STDOUT, '>&STDIN' or die "redirect stdout failed: $!\n";
                 open STDERR, '>&STDIN' or die "redirect stderr failed: $!\n";
                 POSIX::setsid();
-                $pid = fork;
-                die "could not fork: $!\n" unless defined $pid;
+                $pid = fork // die "fork: $!";
                 exit if $pid;
         }
         return unless defined $pid_file;
@@ -368,14 +369,12 @@ sub inherit ($) {
         foreach my $fd (3..$end) {
                 my $s = IO::Handle->new_from_fd($fd, 'r');
                 if (my $k = sockname($s)) {
-                        if ($s->blocking) {
-                                $s->blocking(0);
-                                warn <<"";
+                        my $prev_was_blocking = $s->blocking(0);
+                        warn <<"" if $prev_was_blocking;
 Inherited socket (fd=$fd) is blocking, making it non-blocking.
 Set 'NonBlocking = true' in the systemd.service unit to avoid stalled
 processes when multiple service instances start.
 
-                        }
                         $listener_names->{$k} = $s;
                         push @rv, $s;
                 } else {
@@ -422,11 +421,8 @@ sub upgrade { # $_[0] = signal name or number (unused)
 }
 
 sub kill_workers ($) {
-        my ($s) = @_;
-
-        while (my ($pid, $id) = each %pids) {
-                kill $s, $pid;
-        }
+        my ($sig) = @_;
+        kill $sig, keys(%pids);
 }
 
 sub upgrade_aborted ($) {
@@ -518,8 +514,8 @@ EOF
                 CHLD => \&reap_children,
         };
         my $sigfd = PublicInbox::Sigfd->new($sig, 0);
-        local %SIG = (%SIG, %$sig) if !$sigfd;
-        PublicInbox::Sigfd::sig_setmask($oldset) if !$sigfd;
+        local @SIG{keys %$sig} = values(%$sig) unless $sigfd;
+        PublicInbox::DS::sig_setmask($oldset) if !$sigfd;
         while (1) { # main loop
                 my $n = scalar keys %pids;
                 unless (@listeners) {
@@ -535,12 +531,15 @@ EOF
                 }
                 my $want = $worker_processes - 1;
                 if ($n <= $want) {
-                        PublicInbox::Sigfd::block_signals() if !$sigfd;
+                        PublicInbox::DS::block_signals() if !$sigfd;
                         for my $i ($n..$want) {
+                                my $seed = rand(0xffffffff);
                                 my $pid = fork;
                                 if (!defined $pid) {
                                         warn "failed to fork worker[$i]: $!\n";
                                 } elsif ($pid == 0) {
+                                        srand($seed);
+                                        eval { Net::SSLeay::randomize() };
                                         $set_user->() if $set_user;
                                         return $p0; # run normal work code
                                 } else {
@@ -548,7 +547,7 @@ EOF
                                         $pids{$pid} = $i;
                                 }
                         }
-                        PublicInbox::Sigfd::sig_setmask($oldset) if !$sigfd;
+                        PublicInbox::DS::sig_setmask($oldset) if !$sigfd;
                 }
 
                 if ($sigfd) { # Linux and IO::KQueue users:
@@ -631,12 +630,12 @@ sub daemon_loop ($$$$) {
                 # this calls epoll_create:
                 PublicInbox::Listener->new($_, $tls_cb || $post_accept)
         } @listeners;
-        my $sigfd = PublicInbox::Sigfd->new($sig, $SFD_NONBLOCK);
-        local %SIG = (%SIG, %$sig) if !$sigfd;
+        my $sigfd = PublicInbox::Sigfd->new($sig, SFD_NONBLOCK);
+        local @SIG{keys %$sig} = values(%$sig) unless $sigfd;
         if (!$sigfd) {
                 # wake up every second to accept signals if we don't
                 # have signalfd or IO::KQueue:
-                PublicInbox::Sigfd::sig_setmask($oldset);
+                PublicInbox::DS::sig_setmask($oldset);
                 PublicInbox::DS->SetLoopTimeout(1000);
         }
         PublicInbox::DS->EventLoop;
@@ -648,6 +647,10 @@ sub run ($$$;$) {
         daemon_prepare($default);
         my $af_default = $default =~ /:8080\z/ ? 'httpready' : undef;
         my $for_destroy = daemonize();
+
+        # localize GCF2C for tests:
+        local $PublicInbox::GitAsyncCat::GCF2C;
+
         daemon_loop($refresh, $post_accept, $tlsd, $af_default);
         PublicInbox::DS->Reset;
         # ->DESTROY runs when $for_destroy goes out-of-scope
diff --git a/lib/PublicInbox/DirIdle.pm b/lib/PublicInbox/DirIdle.pm
index 458285e2..5437190d 100644
--- a/lib/PublicInbox/DirIdle.pm
+++ b/lib/PublicInbox/DirIdle.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Used by public-inbox-watch for Maildir (and possibly MH in the future)
diff --git a/lib/PublicInbox/DummyInbox.pm b/lib/PublicInbox/DummyInbox.pm
index 69b0b683..c516eec4 100644
--- a/lib/PublicInbox/DummyInbox.pm
+++ b/lib/PublicInbox/DummyInbox.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # An EXAMINE-able, PublicInbox::Inbox-like object for IMAP.  Some
@@ -7,16 +7,16 @@
 package PublicInbox::DummyInbox;
 use strict;
 
-sub created_at { 0 } # Msgmap::created_at
+sub uidvalidity { 0 } # Msgmap::created_at
 sub mm { shift }
 sub uid_range { [] } # Over::uid_range
 sub subscribe_unlock { undef };
 
 no warnings 'once';
-*max = \&created_at;
+*max = \&uidvalidity;
 *query_xover = \&uid_range;
 *over = \&mm;
-*search = *unsubscribe_unlock =
+*isrch = *search = *unsubscribe_unlock =
         *get_art = *description = *base_url = \&subscribe_unlock;
 
 1;
diff --git a/lib/PublicInbox/EOFpipe.pm b/lib/PublicInbox/EOFpipe.pm
index 489caf82..e537e2aa 100644
--- a/lib/PublicInbox/EOFpipe.pm
+++ b/lib/PublicInbox/EOFpipe.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 package PublicInbox::EOFpipe;
diff --git a/lib/PublicInbox/Emergency.pm b/lib/PublicInbox/Emergency.pm
index b705e776..67f27bc7 100644
--- a/lib/PublicInbox/Emergency.pm
+++ b/lib/PublicInbox/Emergency.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Emergency Maildir delivery for MDA
diff --git a/lib/PublicInbox/Eml.pm b/lib/PublicInbox/Eml.pm
index 4d3fffc0..462d51fc 100644
--- a/lib/PublicInbox/Eml.pm
+++ b/lib/PublicInbox/Eml.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Lazy MIME parser, it still slurps the full message but keeps short
diff --git a/lib/PublicInbox/EmlContentFoo.pm b/lib/PublicInbox/EmlContentFoo.pm
index c163eaf5..80fc7364 100644
--- a/lib/PublicInbox/EmlContentFoo.pm
+++ b/lib/PublicInbox/EmlContentFoo.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # Copyright (C) 2004- Simon Cozens, Casey West, Ricardo SIGNES
 # This library is free software; you can redistribute it and/or modify
 # it under the same terms as Perl itself.
diff --git a/lib/PublicInbox/ExtMsg.pm b/lib/PublicInbox/ExtMsg.pm
index 03faf3a1..5c8bf561 100644
--- a/lib/PublicInbox/ExtMsg.pm
+++ b/lib/PublicInbox/ExtMsg.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used by the web interface to link to messages outside of the our
@@ -32,8 +32,8 @@ sub PARTIAL_MAX () { 100 }
 sub search_partial ($$) {
         my ($ibx, $mid) = @_;
         return if length($mid) < $MIN_PARTIAL_LEN;
-        my $srch = $ibx->search or return;
-        my $opt = { limit => PARTIAL_MAX, mset => 2 };
+        my $srch = $ibx->search or return; # NOT ->isrch, we already try ->ALL
+        my $opt = { limit => PARTIAL_MAX, relevance => -1 };
         my @try = ("m:$mid*");
         my $chop = $mid;
         if ($chop =~ s/(\W+)(\w*)\z//) {
@@ -76,7 +76,7 @@ sub search_partial ($$) {
 sub ext_msg_i {
         my ($other, $ctx) = @_;
 
-        return if $other->{name} eq $ctx->{-inbox}->{name} || !$other->base_url;
+        return if $other->{name} eq $ctx->{ibx}->{name} || !$other->base_url;
 
         my $mm = $other->mm or return;
 
@@ -103,19 +103,48 @@ sub ext_msg_step {
         }
 }
 
+sub ext_msg_ALL ($) {
+        my ($ctx) = @_;
+        my $ALL = $ctx->{www}->{pi_cfg}->ALL or return;
+        my $by_eidx_key = $ctx->{www}->{pi_cfg}->{-by_eidx_key};
+        my $cur_key = eval { $ctx->{ibx}->eidx_key } //
+                        return partial_response($ctx); # $cur->{ibx} == $ALL
+        my %seen = ($cur_key => 1);
+        my ($id, $prev);
+        while (my $x = $ALL->over->next_by_mid($ctx->{mid}, \$id, \$prev)) {
+                my $xr3 = $ALL->over->get_xref3($x->{num});
+                for my $k (@$xr3) {
+                        $k =~ s/:[0-9]+:$x->{blob}\z// or next;
+                        next if $k eq $cur_key;
+                        my $ibx = $by_eidx_key->{$k} // next;
+                        my $url = $ibx->base_url or next;
+                        push(@{$ctx->{found}}, $ibx) unless $seen{$k}++;
+                }
+        }
+        return exact($ctx) if $ctx->{found};
+
+        # fall back to partial MID matching
+        for my $ibxish ($ctx->{ibx}, $ALL) {
+                my $mids = search_partial($ibxish, $ctx->{mid}) or next;
+                push @{$ctx->{partial}}, [ $ibxish, $mids ];
+                last if ($ctx->{n_partial} += scalar(@$mids)) >= PARTIAL_MAX;
+        }
+        partial_response($ctx);
+}
+
 sub ext_msg {
         my ($ctx) = @_;
-        sub {
+        ext_msg_ALL($ctx) // sub {
                 $ctx->{-wcb} = $_[0]; # HTTP server write callback
 
                 if ($ctx->{env}->{'pi-httpd.async'}) {
                         require PublicInbox::ConfigIter;
                         my $iter = PublicInbox::ConfigIter->new(
-                                                $ctx->{www}->{pi_config},
+                                                $ctx->{www}->{pi_cfg},
                                                 \&ext_msg_step, $ctx);
                         $iter->event_step;
                 } else {
-                        $ctx->{www}->{pi_config}->each_inbox(\&ext_msg_i, $ctx);
+                        $ctx->{www}->{pi_cfg}->each_inbox(\&ext_msg_i, $ctx);
                         finalize_exact($ctx);
                 }
         };
@@ -141,7 +170,7 @@ sub finalize_exact {
 
         # fall back to partial MID matching
         my $mid = $ctx->{mid};
-        my $cur = $ctx->{-inbox};
+        my $cur = $ctx->{ibx};
         my $mids = search_partial($cur, $mid);
         if ($mids) {
                 $ctx->{n_partial} = scalar(@$mids);
@@ -159,7 +188,7 @@ sub finalize_exact {
         finalize_partial($ctx);
 }
 
-sub finalize_partial {
+sub partial_response ($) {
         my ($ctx) = @_;
         my $mid = $ctx->{mid};
         my $code = 404;
@@ -172,7 +201,7 @@ sub finalize_partial {
                 my $es = $n_partial == 1 ? '' : 'es';
                 $n_partial .= '+' if ($n_partial == PARTIAL_MAX);
                 $s .= "\n$n_partial partial match$es found:\n\n";
-                my $cur_name = $ctx->{-inbox}->{name};
+                my $cur_name = $ctx->{ibx}->{name};
                 foreach my $pair (@{$ctx->{partial}}) {
                         my ($ibx, $res) = @$pair;
                         my $env = $ctx->{env} if $ibx->{name} eq $cur_name;
@@ -192,9 +221,11 @@ sub finalize_partial {
         $ctx->{-html_tip} = $s .= '</pre>';
         $ctx->{-title_html} = $title;
         $ctx->{-upfx} = '../';
-        $ctx->{-wcb}->(html_oneshot($ctx, $code));
+        html_oneshot($ctx, $code);
 }
 
+sub finalize_partial ($) { $_[0]->{-wcb}->(partial_response($_[0])) }
+
 sub ext_urls {
         my ($ctx, $mid, $href, $html) = @_;
 
diff --git a/lib/PublicInbox/ExtSearch.pm b/lib/PublicInbox/ExtSearch.pm
new file mode 100644
index 00000000..8ba4d396
--- /dev/null
+++ b/lib/PublicInbox/ExtSearch.pm
@@ -0,0 +1,123 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Read-only external (detached) index for cross inbox search.
+# This is a read-only counterpart to PublicInbox::ExtSearchIdx
+# and behaves like PublicInbox::Inbox AND PublicInbox::Search
+package PublicInbox::ExtSearch;
+use strict;
+use v5.10.1;
+use PublicInbox::Over;
+use PublicInbox::Inbox;
+use PublicInbox::MiscSearch;
+use DBI qw(:sql_types); # SQL_BLOB
+
+# for ->reopen, ->mset, ->mset_to_artnums
+use parent qw(PublicInbox::Search);
+
+sub new {
+        my ($class, $topdir) = @_;
+        bless {
+                topdir => $topdir,
+                # xpfx => 'ei15'
+                xpfx => "$topdir/ei".PublicInbox::Search::SCHEMA_VERSION
+        }, $class;
+}
+
+sub misc {
+        my ($self) = @_;
+        $self->{misc} //= PublicInbox::MiscSearch->new("$self->{xpfx}/misc");
+}
+
+# same as per-inbox ->over, for now...
+sub over {
+        my ($self) = @_;
+        $self->{over} //= PublicInbox::Over->new("$self->{xpfx}/over.sqlite3");
+}
+
+sub git {
+        my ($self) = @_;
+        $self->{git} //= PublicInbox::Git->new("$self->{topdir}/ALL.git");
+}
+
+# returns a hashref of { $NEWSGROUP_NAME => $ART_NO } using the `xref3' table
+sub nntp_xref_for { # NNTP only
+        my ($self, $xibx, $xsmsg) = @_;
+        my $dbh = over($self)->dbh;
+
+        my $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT ibx_id FROM inboxes WHERE eidx_key = ? LIMIT 1
+
+        $sth->execute($xibx->{newsgroup});
+        my $xibx_id = $sth->fetchrow_array // do {
+                warn "W: `$xibx->{newsgroup}' not found in $self->{topdir}\n";
+                return;
+        };
+
+        $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT docid FROM xref3 WHERE oidbin = ? AND xnum = ? AND ibx_id = ? LIMIT 1
+
+        $sth->bind_param(1, pack('H*', $xsmsg->{blob}), SQL_BLOB);
+
+        # NNTP::cmd_over can set {num} to zero according to RFC 3977 8.3.2
+        $sth->bind_param(2, $xsmsg->{num} || $xsmsg->{-orig_num});
+        $sth->bind_param(3, $xibx_id);
+        $sth->execute;
+        my $docid = $sth->fetchrow_array // do {
+                warn <<EOF;
+W: `$xibx->{newsgroup}:$xsmsg->{num}' not found in $self->{topdir}"
+EOF
+                return;
+        };
+
+        # LIMIT is number of newsgroups on server:
+        $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT ibx_id,xnum FROM xref3 WHERE docid = ? AND ibx_id != ?
+
+        $sth->execute($docid, $xibx_id);
+        my $rows = $sth->fetchall_arrayref;
+
+        my $eidx_key_sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT eidx_key FROM inboxes WHERE ibx_id = ? LIMIT 1
+
+        my %xref = map {
+                my ($ibx_id, $xnum) = @$_;
+
+                $eidx_key_sth->execute($ibx_id);
+                my $eidx_key = $eidx_key_sth->fetchrow_array;
+
+                # only include if there's a newsgroup name
+                $eidx_key && index($eidx_key, '/') >= 0 ?
+                        () : ($eidx_key => $xnum)
+        } @$rows;
+        $xref{$xibx->{newsgroup}} = $xsmsg->{num};
+        \%xref;
+}
+
+sub mm { undef }
+
+sub altid_map { {} }
+
+sub description {
+        my ($self) = @_;
+        ($self->{description} //=
+                PublicInbox::Inbox::cat_desc("$self->{topdir}/description")) //
+                '$EXTINDEX_DIR/description missing';
+}
+
+sub cloneurl { [] } # TODO
+
+sub base_url { 'https://example.com/TODO/' }
+sub nntp_url { [] }
+
+no warnings 'once';
+*smsg_eml = \&PublicInbox::Inbox::smsg_eml;
+*smsg_by_mid = \&PublicInbox::Inbox::smsg_by_mid;
+*msg_by_mid = \&PublicInbox::Inbox::msg_by_mid;
+*modified = \&PublicInbox::Inbox::modified;
+*recent = \&PublicInbox::Inbox::recent;
+
+*max_git_epoch = *nntp_usable = *msg_by_path = \&mm; # undef
+*isrch = *search = \&PublicInbox::Search::reopen;
+
+1;
diff --git a/lib/PublicInbox/ExtSearchIdx.pm b/lib/PublicInbox/ExtSearchIdx.pm
new file mode 100644
index 00000000..c782a62a
--- /dev/null
+++ b/lib/PublicInbox/ExtSearchIdx.pm
@@ -0,0 +1,1133 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Detached/external index cross inbox search indexing support
+# read-write counterpart to PublicInbox::ExtSearch
+#
+# It's based on the same ideas as public-inbox-v2-format(5) using
+# over.sqlite3 for dedupe and sharded Xapian.  msgmap.sqlite3 is
+# missing, so there is no Message-ID conflict resolution, meaning
+# no NNTP support for now.
+#
+# v2 has a 1:1 mapping of index:inbox or msgmap for NNTP support.
+# This is intended to be an M:N index:inbox mapping, but it'll likely
+# be 1:N in common practice (M==1)
+
+package PublicInbox::ExtSearchIdx;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::ExtSearch PublicInbox::Lock);
+use Carp qw(croak carp);
+use Sys::Hostname qw(hostname);
+use POSIX qw(strftime);
+use PublicInbox::Search;
+use PublicInbox::SearchIdx qw(prepare_stack is_ancestor is_bad_blob);
+use PublicInbox::OverIdx;
+use PublicInbox::MiscIdx;
+use PublicInbox::MID qw(mids);
+use PublicInbox::V2Writable;
+use PublicInbox::InboxWritable;
+use PublicInbox::ContentHash qw(content_hash);
+use PublicInbox::Eml;
+use PublicInbox::DS qw(now);
+use DBI qw(:sql_types); # SQL_BLOB
+
+sub new {
+        my (undef, $dir, $opt) = @_;
+        my $l = $opt->{indexlevel} // 'full';
+        $l !~ $PublicInbox::SearchIdx::INDEXLEVELS and
+                die "invalid indexlevel=$l\n";
+        $l eq 'basic' and die "E: indexlevel=basic not yet supported\n";
+        my $self = bless {
+                xpfx => "$dir/ei".PublicInbox::Search::SCHEMA_VERSION,
+                topdir => $dir,
+                creat => $opt->{creat},
+                ibx_map => {}, # (newsgroup//inboxdir) => $ibx
+                ibx_list => [],
+                indexlevel => $l,
+                transact_bytes => 0,
+                total_bytes => 0,
+                current_info => '',
+                parallel => 1,
+                lock_path => "$dir/ei.lock",
+        }, __PACKAGE__;
+        $self->{shards} = $self->count_shards || nproc_shards($opt->{creat});
+        my $oidx = PublicInbox::OverIdx->new("$self->{xpfx}/over.sqlite3");
+        $self->{-no_fsync} = $oidx->{-no_fsync} = 1 if !$opt->{fsync};
+        $self->{oidx} = $oidx;
+        $self
+}
+
+sub attach_inbox {
+        my ($self, $ibx) = @_;
+        $self->{ibx_map}->{$ibx->eidx_key} //= do {
+                push @{$self->{ibx_list}}, $ibx;
+                $ibx;
+        }
+}
+
+sub _ibx_attach { # each_inbox callback
+        my ($ibx, $self) = @_;
+        attach_inbox($self, $ibx);
+}
+
+sub attach_config {
+        my ($self, $cfg) = @_;
+        $self->{cfg} = $cfg;
+        $cfg->each_inbox(\&_ibx_attach, $self);
+}
+
+sub check_batch_limit ($) {
+        my ($req) = @_;
+        my $self = $req->{self};
+        my $new_smsg = $req->{new_smsg};
+        my $n = $self->{transact_bytes} += $new_smsg->{bytes};
+
+        # set flag for PublicInbox::V2Writable::index_todo:
+        ${$req->{need_checkpoint}} = 1 if $n >= $self->{batch_bytes};
+}
+
+sub do_xpost ($$) {
+        my ($req, $smsg) = @_;
+        my $self = $req->{self};
+        my $docid = $smsg->{num};
+        my $idx = $self->idx_shard($docid);
+        my $oid = $req->{oid};
+        my $xibx = $req->{ibx};
+        my $eml = $req->{eml};
+        my $eidx_key = $xibx->eidx_key;
+        if (my $new_smsg = $req->{new_smsg}) { # 'm' on cross-posted message
+                my $xnum = $req->{xnum};
+                $self->{oidx}->add_xref3($docid, $xnum, $oid, $eidx_key);
+                $idx->ipc_do('add_eidx_info', $docid, $eidx_key, $eml);
+                check_batch_limit($req);
+        } else { # 'd'
+                my $rm_eidx_info;
+                my $nr = $self->{oidx}->remove_xref3($docid, $oid, $eidx_key,
+                                                        \$rm_eidx_info);
+                if ($nr == 0) {
+                        $self->{oidx}->eidxq_del($docid);
+                        $idx->ipc_do('xdb_remove', $docid);
+                } elsif ($rm_eidx_info) {
+                        $idx->ipc_do('remove_eidx_info',
+                                        $docid, $eidx_key, $eml);
+                        $self->{oidx}->eidxq_add($docid); # yes, add
+                }
+        }
+}
+
+# called by V2Writable::sync_prepare
+sub artnum_max { $_[0]->{oidx}->eidx_max }
+
+sub index_unseen ($) {
+        my ($req) = @_;
+        my $new_smsg = $req->{new_smsg} or die 'BUG: {new_smsg} unset';
+        my $eml = delete $req->{eml};
+        $new_smsg->populate($eml, $req);
+        my $self = $req->{self};
+        my $docid = $self->{oidx}->adj_counter('eidx_docid', '+');
+        $new_smsg->{num} = $docid;
+        my $idx = $self->idx_shard($docid);
+        $self->{oidx}->add_overview($eml, $new_smsg);
+        my $oid = $new_smsg->{blob};
+        my $ibx = delete $req->{ibx} or die 'BUG: {ibx} unset';
+        $self->{oidx}->add_xref3($docid, $req->{xnum}, $oid, $ibx->eidx_key);
+        $idx->index_eml($eml, $new_smsg, $ibx->eidx_key);
+        check_batch_limit($req);
+}
+
+sub do_finalize ($) {
+        my ($req) = @_;
+        if (my $indexed = $req->{indexed}) {
+                do_xpost($req, $_) for @$indexed;
+        } elsif (exists $req->{new_smsg}) { # totally unseen messsage
+                index_unseen($req);
+        } else {
+                # `d' message was already unindexed in the v1/v2 inboxes,
+                # so it's too noisy to warn, here.
+        }
+        # cur_cmt may be undef for unindex_oid, set by V2Writable::index_todo
+        if (defined(my $cur_cmt = $req->{cur_cmt})) {
+                ${$req->{latest_cmt}} = $cur_cmt;
+        }
+}
+
+sub do_step ($) { # main iterator for adding messages to the index
+        my ($req) = @_;
+        my $self = $req->{self} // die 'BUG: {self} missing';
+        while (1) {
+                if (my $next_arg = $req->{next_arg}) {
+                        if (my $smsg = $self->{oidx}->next_by_mid(@$next_arg)) {
+                                $req->{cur_smsg} = $smsg;
+                                $self->git->cat_async($smsg->{blob},
+                                                        \&ck_existing, $req);
+                                return; # ck_existing calls do_step
+                        }
+                        delete $req->{cur_smsg};
+                        delete $req->{next_arg};
+                }
+                my $mid = shift(@{$req->{mids}});
+                last unless defined $mid;
+                my ($id, $prev);
+                $req->{next_arg} = [ $mid, \$id, \$prev ];
+                # loop again
+        }
+        do_finalize($req);
+}
+
+sub _blob_missing ($) { # called when req->{cur_smsg}->{blob} is bad
+        my ($req) = @_;
+        my $smsg = $req->{cur_smsg} or die 'BUG: {cur_smsg} missing';
+        my $self = $req->{self};
+        my $xref3 = $self->{oidx}->get_xref3($smsg->{num});
+        my @keep = grep(!/:$smsg->{blob}\z/, @$xref3);
+        if (@keep) {
+                $keep[0] =~ /:([a-f0-9]{40,}+)\z/ or
+                        die "BUG: xref $keep[0] has no OID";
+                my $oidhex = $1;
+                $self->{oidx}->remove_xref3($smsg->{num}, $smsg->{blob});
+                my $upd = $self->{oidx}->update_blob($smsg, $oidhex);
+                my $saved = $self->{oidx}->get_art($smsg->{num});
+        } else {
+                $self->{oidx}->delete_by_num($smsg->{num});
+        }
+}
+
+sub ck_existing { # git->cat_async callback
+        my ($bref, $oid, $type, $size, $req) = @_;
+        my $smsg = $req->{cur_smsg} or die 'BUG: {cur_smsg} missing';
+        if ($type eq 'missing') {
+                _blob_missing($req);
+        } elsif (!is_bad_blob($oid, $type, $size, $smsg->{blob})) {
+                my $self = $req->{self} // die 'BUG: {self} missing';
+                local $self->{current_info} = "$self->{current_info} $oid";
+                my $cur = PublicInbox::Eml->new($bref);
+                if (content_hash($cur) eq $req->{chash}) {
+                        push @{$req->{indexed}}, $smsg; # for do_xpost
+                } # else { index_unseen later }
+        }
+        do_step($req);
+}
+
+# is the messages visible in the inbox currently being indexed?
+# return the number if so
+sub cur_ibx_xnum ($$) {
+        my ($req, $bref) = @_;
+        my $ibx = $req->{ibx} or die 'BUG: current {ibx} missing';
+
+        $req->{eml} = PublicInbox::Eml->new($bref);
+        $req->{chash} = content_hash($req->{eml});
+        $req->{mids} = mids($req->{eml});
+        my @q = @{$req->{mids}}; # copy
+        while (defined(my $mid = shift @q)) {
+                my ($id, $prev);
+                while (my $x = $ibx->over->next_by_mid($mid, \$id, \$prev)) {
+                        return $x->{num} if $x->{blob} eq $req->{oid};
+                }
+        }
+        undef;
+}
+
+sub index_oid { # git->cat_async callback for 'm'
+        my ($bref, $oid, $type, $size, $req) = @_;
+        my $self = $req->{self};
+        local $self->{current_info} = "$self->{current_info} $oid";
+        return if is_bad_blob($oid, $type, $size, $req->{oid});
+        my $new_smsg = $req->{new_smsg} = bless {
+                blob => $oid,
+        }, 'PublicInbox::Smsg';
+        $new_smsg->set_bytes($$bref, $size);
+        defined($req->{xnum} = cur_ibx_xnum($req, $bref)) or return;
+        ++${$req->{nr}};
+        do_step($req);
+}
+
+sub unindex_oid { # git->cat_async callback for 'd'
+        my ($bref, $oid, $type, $size, $req) = @_;
+        my $self = $req->{self};
+        local $self->{current_info} = "$self->{current_info} $oid";
+        return if is_bad_blob($oid, $type, $size, $req->{oid});
+        return if defined(cur_ibx_xnum($req, $bref)); # was re-added
+        do_step($req);
+}
+
+# overrides V2Writable::last_commits, called by sync_ranges via sync_prepare
+sub last_commits {
+        my ($self, $sync) = @_;
+        my $heads = [];
+        my $ekey = $sync->{ibx}->eidx_key;
+        my $uv = $sync->{ibx}->uidvalidity;
+        for my $i (0..$sync->{epoch_max}) {
+                $heads->[$i] = $self->{oidx}->eidx_meta("lc-v2:$ekey//$uv;$i");
+        }
+        $heads;
+}
+
+sub _ibx_index_reject ($) {
+        my ($ibx) = @_;
+        $ibx->mm // return 'unindexed, no msgmap.sqlite3';
+        $ibx->uidvalidity // return 'no UIDVALIDITY';
+        $ibx->over // return 'unindexed, no over.sqlite3';
+        undef;
+}
+
+sub _sync_inbox ($$$) {
+        my ($self, $sync, $ibx) = @_;
+        my $ekey = $ibx->eidx_key;
+        if (defined(my $err = _ibx_index_reject($ibx))) {
+                return "W: skipping $ekey ($err)";
+        }
+        $sync->{ibx} = $ibx;
+        $sync->{nr} = \(my $nr = 0);
+        my $v = $ibx->version;
+        if ($v == 2) {
+                $sync->{epoch_max} = $ibx->max_git_epoch // return;
+                sync_prepare($self, $sync); # or return # TODO: once MiscIdx is stable
+        } elsif ($v == 1) {
+                my $uv = $ibx->uidvalidity;
+                my $lc = $self->{oidx}->eidx_meta("lc-v1:$ekey//$uv");
+                my $head = $ibx->mm->last_commit //
+                        return "E: $ibx->{inboxdir} is not indexed";
+                my $stk = prepare_stack($sync, $lc ? "$lc..$head" : $head);
+                my $unit = { stack => $stk, git => $ibx->git };
+                push @{$sync->{todo}}, $unit;
+        } else {
+                return "E: $ekey unsupported inbox version (v$v)";
+        }
+        for my $unit (@{delete($sync->{todo}) // []}) {
+                last if $sync->{quit};
+                index_todo($self, $sync, $unit);
+        }
+        $self->{midx}->index_ibx($ibx) unless $sync->{quit};
+        $ibx->git->cleanup; # done with this inbox, now
+        undef;
+}
+
+sub gc_unref_doc ($$$$) {
+        my ($self, $ibx_id, $eidx_key, $docid) = @_;
+        my $dbh = $self->{oidx}->dbh;
+
+        # for debug/info purposes, oids may no longer be accessible
+        my $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT oidbin FROM xref3 WHERE docid = ? AND ibx_id = ?
+
+        $sth->execute($docid, $ibx_id);
+        my @oid = map { unpack('H*', $_->[0]) } @{$sth->fetchall_arrayref};
+
+        $dbh->prepare_cached(<<'')->execute($docid, $ibx_id);
+DELETE FROM xref3 WHERE docid = ? AND ibx_id = ?
+
+        my $remain = $self->{oidx}->get_xref3($docid);
+        if (scalar(@$remain)) {
+                $self->{oidx}->eidxq_add($docid); # enqueue for reindex
+                for my $oid (@oid) {
+                        warn "I: unref #$docid $eidx_key $oid\n";
+                }
+        } else {
+                warn "I: remove #$docid $eidx_key @oid\n";
+                $self->idx_shard($docid)->ipc_do('xdb_remove', $docid);
+        }
+}
+
+sub eidx_gc {
+        my ($self, $opt) = @_;
+        $self->{cfg} or die "E: GC requires ->attach_config\n";
+        $opt->{-idx_gc} = 1;
+        $self->idx_init($opt); # acquire lock via V2Writable::_idx_init
+
+        my $dbh = $self->{oidx}->dbh;
+        my $x3_doc = $dbh->prepare('SELECT docid FROM xref3 WHERE ibx_id = ?');
+        my $ibx_ck = $dbh->prepare('SELECT ibx_id,eidx_key FROM inboxes');
+        my $lc_i = $dbh->prepare('SELECT key FROM eidx_meta WHERE key LIKE ?');
+
+        $ibx_ck->execute;
+        while (my ($ibx_id, $eidx_key) = $ibx_ck->fetchrow_array) {
+                next if $self->{ibx_map}->{$eidx_key};
+                $self->{midx}->remove_eidx_key($eidx_key);
+                warn "I: deleting messages for $eidx_key...\n";
+                $x3_doc->execute($ibx_id);
+                while (defined(my $docid = $x3_doc->fetchrow_array)) {
+                        gc_unref_doc($self, $ibx_id, $eidx_key, $docid);
+                }
+                $dbh->prepare_cached(<<'')->execute($ibx_id);
+DELETE FROM inboxes WHERE ibx_id = ?
+
+                # drop last_commit info
+                my $pat = $eidx_key;
+                $pat =~ s/([_%])/\\$1/g;
+                $lc_i->execute("lc-%:$pat//%");
+                while (my ($key) = $lc_i->fetchrow_array) {
+                        next if $key !~ m!\Alc-v[1-9]+:\Q$eidx_key\E//!;
+                        warn "I: removing $key\n";
+                        $dbh->prepare_cached(<<'')->execute($key);
+DELETE FROM eidx_meta WHERE key = ?
+
+                }
+
+                warn "I: $eidx_key removed\n";
+        }
+
+        # it's not real unless it's in `over', we use parallelism here,
+        # shards will be reading directly from over, so commit
+        $self->{oidx}->commit_lazy;
+        $self->{oidx}->begin_lazy;
+
+        for my $idx (@{$self->{idx_shards}}) {
+                warn "I: cleaning up shard #$idx->{shard}\n";
+                $idx->shard_over_check($self->{oidx});
+        }
+        my $nr = $dbh->do(<<'');
+DELETE FROM xref3 WHERE docid NOT IN (SELECT num FROM over)
+
+        warn "I: eliminated $nr stale xref3 entries\n" if $nr != 0;
+
+        done($self);
+}
+
+sub _ibx_for ($$$) {
+        my ($self, $sync, $smsg) = @_;
+        my $ibx_id = delete($smsg->{ibx_id}) // die '{ibx_id} unset';
+        my $pos = $sync->{id2pos}->{$ibx_id} // die "$ibx_id no pos";
+        $self->{ibx_list}->[$pos] // die "BUG: ibx for $smsg->{blob} not mapped"
+}
+
+sub _fd_constrained ($) {
+        my ($self) = @_;
+        $self->{-fd_constrained} //= do {
+                my $soft;
+                if (eval { require BSD::Resource; 1 }) {
+                        my $NOFILE = BSD::Resource::RLIMIT_NOFILE();
+                        ($soft, undef) = BSD::Resource::getrlimit($NOFILE);
+                } else {
+                        chomp($soft = `sh -c 'ulimit -n'`);
+                }
+                if (defined($soft)) {
+                        my $want = scalar(@{$self->{ibx_list}}) + 64; # estimate
+                        my $ret = $want > $soft;
+                        if ($ret) {
+                                warn <<EOF;
+RLIMIT_NOFILE=$soft insufficient (want: $want), will close DB handles early
+EOF
+                        }
+                        $ret;
+                } else {
+                        warn "Unable to determine RLIMIT_NOFILE: $@\n";
+                        1;
+                }
+        };
+}
+
+sub _reindex_finalize ($$$) {
+        my ($req, $smsg, $eml) = @_;
+        my $sync = $req->{sync};
+        my $self = $sync->{self};
+        my $by_chash = delete $req->{by_chash} or die 'BUG: no {by_chash}';
+        my $nr = scalar(keys(%$by_chash)) or die 'BUG: no content hashes';
+        my $orig_smsg = $req->{orig_smsg} // die 'BUG: no {orig_smsg}';
+        my $docid = $smsg->{num} = $orig_smsg->{num};
+        $self->{oidx}->add_overview($eml, $smsg); # may rethread
+        check_batch_limit({ %$sync, new_smsg => $smsg });
+        my $chash0 = $smsg->{chash} // die "BUG: $smsg->{blob} no {chash}";
+        my $stable = delete($by_chash->{$chash0}) //
+                                die "BUG: $smsg->{blob} chash missing";
+        my $idx = $self->idx_shard($docid);
+        my $top_smsg = pop @$stable;
+        $top_smsg == $smsg or die 'BUG: top_smsg != smsg';
+        my $ibx = _ibx_for($self, $sync, $smsg);
+        $idx->index_eml($eml, $smsg, $ibx->eidx_key);
+        for my $x (reverse @$stable) {
+                $ibx = _ibx_for($self, $sync, $x);
+                my $hdr = delete $x->{hdr} // die 'BUG: no {hdr}';
+                $idx->ipc_do('add_eidx_info', $docid, $ibx->eidx_key, $hdr);
+        }
+        return if $nr == 1; # likely, all good
+
+        warn "W: #$docid split into $nr due to deduplication change\n";
+        my @todo;
+        for my $ary (values %$by_chash) {
+                for my $x (reverse @$ary) {
+                        warn "removing #$docid xref3 $x->{blob}\n";
+                        my $n = $self->{oidx}->remove_xref3($docid, $x->{blob});
+                        die "BUG: $x->{blob} invalidated #$docid" if $n == 0;
+                }
+                my $x = pop(@$ary) // die "BUG: #$docid {by_chash} empty";
+                $x->{num} = delete($x->{xnum}) // die '{xnum} unset';
+                $ibx = _ibx_for($self, $sync, $x);
+                if (my $over = $ibx->over) {
+                        my $e = $over->get_art($x->{num});
+                        $e->{blob} eq $x->{blob} or die <<EOF;
+$x->{blob} != $e->{blob} (${\$ibx->eidx_key}:$e->{num});
+EOF
+                        push @todo, $ibx, $e;
+                        $over->dbh_close if _fd_constrained($self);
+                } else {
+                        die "$ibx->{inboxdir}: over.sqlite3 unusable: $!\n";
+                }
+        }
+        undef $by_chash;
+        while (my ($ibx, $e) = splice(@todo, 0, 2)) {
+                reindex_unseen($self, $sync, $ibx, $e);
+        }
+}
+
+sub _reindex_oid { # git->cat_async callback
+        my ($bref, $oid, $type, $size, $req) = @_;
+        my $sync = $req->{sync};
+        my $self = $sync->{self};
+        my $orig_smsg = $req->{orig_smsg} // die 'BUG: no {orig_smsg}';
+        my $expect_oid = $req->{xr3r}->[$req->{ix}]->[2];
+        my $docid = $orig_smsg->{num};
+        if (is_bad_blob($oid, $type, $size, $expect_oid)) {
+                my $remain = $self->{oidx}->remove_xref3($docid, $expect_oid);
+                if ($remain == 0) {
+                        warn "W: #$docid gone or corrupted\n";
+                        $self->idx_shard($docid)->ipc_do('xdb_remove', $docid);
+                } elsif (my $next_oid = $req->{xr3r}->[++$req->{ix}]->[2]) {
+                        $self->git->cat_async($next_oid, \&_reindex_oid, $req);
+                } else {
+                        warn "BUG: #$docid gone (UNEXPECTED)\n";
+                        $self->idx_shard($docid)->ipc_do('xdb_remove', $docid);
+                }
+                return;
+        }
+        my $ci = $self->{current_info};
+        local $self->{current_info} = "$ci #$docid $oid";
+        my $re_smsg = bless { blob => $oid }, 'PublicInbox::Smsg';
+        $re_smsg->set_bytes($$bref, $size);
+        my $eml = PublicInbox::Eml->new($bref);
+        $re_smsg->populate($eml, { autime => $orig_smsg->{ds},
+                                cotime => $orig_smsg->{ts} });
+        my $chash = content_hash($eml);
+        $re_smsg->{chash} = $chash;
+        $re_smsg->{xnum} = $req->{xr3r}->[$req->{ix}]->[1];
+        $re_smsg->{ibx_id} = $req->{xr3r}->[$req->{ix}]->[0];
+        $re_smsg->{hdr} = $eml->header_obj;
+        push @{$req->{by_chash}->{$chash}}, $re_smsg;
+        if (my $next_oid = $req->{xr3r}->[++$req->{ix}]->[2]) {
+                $self->git->cat_async($next_oid, \&_reindex_oid, $req);
+        } else { # last $re_smsg is the highest priority xref3
+                local $self->{current_info} = "$ci #$docid";
+                _reindex_finalize($req, $re_smsg, $eml);
+        }
+}
+
+sub _reindex_smsg ($$$) {
+        my ($self, $sync, $smsg) = @_;
+        my $docid = $smsg->{num};
+        my $xr3 = $self->{oidx}->get_xref3($docid, 1);
+        if (scalar(@$xr3) == 0) { # _reindex_check_stale should've covered this
+                warn <<"";
+BUG? #$docid $smsg->{blob} is not referenced by inboxes during reindex
+
+                $self->{oidx}->delete_by_num($docid);
+                $self->idx_shard($docid)->ipc_do('xdb_remove', $docid);
+                return;
+        }
+
+        # we sort {xr3r} in the reverse order of {ibx_list} so we can
+        # hit the common case in _reindex_finalize without rereading
+        # from git (or holding multiple messages in memory).
+        my $id2pos = $sync->{id2pos}; # index in {ibx_list}
+        @$xr3 = sort {
+                $id2pos->{$b->[0]} <=> $id2pos->{$a->[0]}
+                                ||
+                $b->[1] <=> $a->[1] # break ties with {xnum}
+        } @$xr3;
+        @$xr3 = map { [ $_->[0], $_->[1], unpack('H*', $_->[2]) ] } @$xr3;
+        my $req = { orig_smsg => $smsg, sync => $sync, xr3r => $xr3, ix => 0 };
+        $self->git->cat_async($xr3->[$req->{ix}]->[2], \&_reindex_oid, $req);
+}
+
+sub checkpoint_due ($) {
+        my ($sync) = @_;
+        ${$sync->{need_checkpoint}} || (now() > $sync->{next_check});
+}
+
+sub host_ident () {
+        # I've copied FS images and only changed the hostname before,
+        # so prepend hostname.  Use `state' since these a BOFH can change
+        # these while this process is running and we always want to be
+        # able to release locks taken by this process.
+        state $retval = hostname . '-' . do {
+                my $m; # machine-id(5) is systemd
+                if (open(my $fh, '<', '/etc/machine-id')) { $m = <$fh> }
+                # (g)hostid(1) is in GNU coreutils, kern.hostid is most BSDs
+                chomp($m ||= `{ sysctl -n kern.hostid ||
+                                hostid || ghostid; } 2>/dev/null`
+                        || "no-machine-id-or-hostid-on-$^O");
+                $m;
+        };
+}
+
+sub eidxq_release {
+        my ($self) = @_;
+        my $expect = delete($self->{-eidxq_locked}) or return;
+        my ($owner_pid, undef) = split(/-/, $expect);
+        return if $owner_pid != $$; # shards may fork
+        my $oidx = $self->{oidx};
+        $oidx->begin_lazy;
+        my $cur = $oidx->eidx_meta('eidxq_lock') // '';
+        if ($cur eq $expect) {
+                $oidx->eidx_meta('eidxq_lock', '');
+                return 1;
+        } elsif ($cur ne '') {
+                warn "E: eidxq_lock($expect) stolen by $cur\n";
+        } else {
+                warn "E: eidxq_lock($expect) released by another process\n";
+        }
+        undef;
+}
+
+sub DESTROY {
+        my ($self) = @_;
+        eidxq_release($self) and $self->{oidx}->commit_lazy;
+}
+
+sub _eidxq_take ($) {
+        my ($self) = @_;
+        my $val = "$$-${\time}-$>-".host_ident;
+        $self->{oidx}->eidx_meta('eidxq_lock', $val);
+        $self->{-eidxq_locked} = $val;
+}
+
+sub eidxq_lock_acquire ($) {
+        my ($self) = @_;
+        my $oidx = $self->{oidx};
+        $oidx->begin_lazy;
+        my $cur = $oidx->eidx_meta('eidxq_lock') || return _eidxq_take($self);
+        if (my $locked = $self->{-eidxq_locked}) { # be lazy
+                return $locked if $locked eq $cur;
+        }
+        my ($pid, $time, $euid, $ident) = split(/-/, $cur, 4);
+        my $t = strftime('%Y-%m-%d %k:%M:%S', gmtime($time));
+        if ($euid == $> && $ident eq host_ident) {
+                if (kill(0, $pid)) {
+                        warn <<EOM; return;
+I: PID:$pid (re)indexing Xapian since $t, it will continue our work
+EOM
+                }
+                if ($!{ESRCH}) {
+                        warn "I: eidxq_lock is stale ($cur), clobbering\n";
+                        return _eidxq_take($self);
+                }
+                warn "E: kill(0, $pid) failed: $!\n"; # fall-through:
+        }
+        my $fn = $oidx->dbh->sqlite_db_filename;
+        warn <<EOF;
+W: PID:$pid, UID:$euid on $ident is indexing Xapian since $t
+W: If this is unexpected, delete `eidxq_lock' from the `eidx_meta' table:
+W:        sqlite3 $fn 'DELETE FROM eidx_meta WHERE key = "eidxq_lock"'
+EOF
+        undef;
+}
+
+sub eidxq_process ($$) { # for reindexing
+        my ($self, $sync) = @_;
+
+        return unless eidxq_lock_acquire($self);
+        my $dbh = $self->{oidx}->dbh;
+        my $tot = $dbh->selectrow_array('SELECT COUNT(*) FROM eidxq') or return;
+        ${$sync->{nr}} = 0;
+        local $sync->{-regen_fmt} = "%u/$tot\n";
+        my $pr = $sync->{-opt}->{-progress};
+        if ($pr) {
+                my $min = $dbh->selectrow_array('SELECT MIN(docid) FROM eidxq');
+                my $max = $dbh->selectrow_array('SELECT MAX(docid) FROM eidxq');
+                $pr->("Xapian indexing $min..$max (total=$tot)\n");
+        }
+        $sync->{id2pos} //= do {
+                my %id2pos;
+                my $pos = 0;
+                $id2pos{$_->{-ibx_id}} = $pos++ for @{$self->{ibx_list}};
+                \%id2pos;
+        };
+        my ($del, $iter);
+restart:
+        $del = $dbh->prepare('DELETE FROM eidxq WHERE docid = ?');
+        $iter = $dbh->prepare('SELECT docid FROM eidxq ORDER BY docid ASC');
+        $iter->execute;
+        while (defined(my $docid = $iter->fetchrow_array)) {
+                last if $sync->{quit};
+                if (my $smsg = $self->{oidx}->get_art($docid)) {
+                        _reindex_smsg($self, $sync, $smsg);
+                } else {
+                        warn "E: #$docid does not exist in over\n";
+                }
+                $del->execute($docid);
+                ++${$sync->{nr}};
+
+                if (checkpoint_due($sync)) {
+                        $dbh = $del = $iter = undef;
+                        reindex_checkpoint($self, $sync); # release lock
+                        $dbh = $self->{oidx}->dbh;
+                        goto restart;
+                }
+        }
+        $self->git->async_wait_all;
+        $pr->("reindexed ${$sync->{nr}}/$tot\n") if $pr;
+}
+
+sub _reindex_unseen { # git->cat_async callback
+        my ($bref, $oid, $type, $size, $req) = @_;
+        return if is_bad_blob($oid, $type, $size, $req->{oid});
+        my $self = $req->{self} // die 'BUG: {self} unset';
+        local $self->{current_info} = "$self->{current_info} $oid";
+        my $new_smsg = bless { blob => $oid, }, 'PublicInbox::Smsg';
+        $new_smsg->set_bytes($$bref, $size);
+        my $eml = $req->{eml} = PublicInbox::Eml->new($bref);
+        $req->{new_smsg} = $new_smsg;
+        $req->{chash} = content_hash($eml);
+        $req->{mids} = mids($eml); # do_step iterates through this
+        do_step($req); # enter the normal indexing flow
+}
+
+# --reindex may catch totally unseen messages, this handles them
+sub reindex_unseen ($$$$) {
+        my ($self, $sync, $ibx, $xsmsg) = @_;
+        my $req = {
+                %$sync, # has {self}
+                autime => $xsmsg->{ds},
+                cotime => $xsmsg->{ts},
+                oid => $xsmsg->{blob},
+                ibx => $ibx,
+                xnum => $xsmsg->{num},
+                # {mids} and {chash} will be filled in at _reindex_unseen
+        };
+        warn "I: reindex_unseen ${\$ibx->eidx_key}:$req->{xnum}:$req->{oid}\n";
+        $self->git->cat_async($xsmsg->{blob}, \&_reindex_unseen, $req);
+}
+
+sub _reindex_check_unseen ($$$) {
+        my ($self, $sync, $ibx) = @_;
+        my $ibx_id = $ibx->{-ibx_id};
+        my $slice = 1000;
+        my ($beg, $end) = (1, $slice);
+
+        # first, check if we missed any messages in target $ibx
+        my $msgs;
+        my $pr = $sync->{-opt}->{-progress};
+        my $ekey = $ibx->eidx_key;
+        local $sync->{-regen_fmt} =
+                        "$ekey checking unseen %u/".$ibx->over->max."\n";
+        ${$sync->{nr}} = 0;
+
+        while (scalar(@{$msgs = $ibx->over->query_xover($beg, $end)})) {
+                ${$sync->{nr}} = $beg;
+                $beg = $msgs->[-1]->{num} + 1;
+                $end = $beg + $slice;
+                if (checkpoint_due($sync)) {
+                        reindex_checkpoint($self, $sync); # release lock
+                }
+
+                my $inx3 = $self->{oidx}->dbh->prepare_cached(<<'', undef, 1);
+SELECT DISTINCT(docid) FROM xref3 WHERE
+ibx_id = ? AND xnum = ? AND oidbin = ?
+
+                for my $xsmsg (@$msgs) {
+                        my $oidbin = pack('H*', $xsmsg->{blob});
+                        $inx3->bind_param(1, $ibx_id);
+                        $inx3->bind_param(2, $xsmsg->{num});
+                        $inx3->bind_param(3, $oidbin, SQL_BLOB);
+                        $inx3->execute;
+                        my $docids = $inx3->fetchall_arrayref;
+                        # index messages which were totally missed
+                        # the first time around ASAP:
+                        if (scalar(@$docids) == 0) {
+                                reindex_unseen($self, $sync, $ibx, $xsmsg);
+                        } else { # already seen, reindex later
+                                for my $r (@$docids) {
+                                        $self->{oidx}->eidxq_add($r->[0]);
+                                }
+                        }
+                        last if $sync->{quit};
+                }
+                last if $sync->{quit};
+        }
+}
+
+sub _reindex_check_stale ($$$) {
+        my ($self, $sync, $ibx) = @_;
+        my $min = 0;
+        my $pr = $sync->{-opt}->{-progress};
+        my $fetching;
+        my $ekey = $ibx->eidx_key;
+        local $sync->{-regen_fmt} =
+                        "$ekey check stale/missing %u/".$ibx->over->max."\n";
+        ${$sync->{nr}} = 0;
+        do {
+                if (checkpoint_due($sync)) {
+                        reindex_checkpoint($self, $sync); # release lock
+                }
+                # now, check if there's stale xrefs
+                my $iter = $self->{oidx}->dbh->prepare_cached(<<'', undef, 1);
+SELECT docid,xnum,oidbin FROM xref3 WHERE ibx_id = ? AND docid > ?
+ORDER BY docid,xnum ASC LIMIT 10000
+
+                $iter->execute($ibx->{-ibx_id}, $min);
+                $fetching = undef;
+
+                while (my ($docid, $xnum, $oidbin) = $iter->fetchrow_array) {
+                        return if $sync->{quit};
+                        ${$sync->{nr}} = $xnum;
+
+                        $fetching = $min = $docid;
+                        my $smsg = $ibx->over->get_art($xnum);
+                        my $oidhex = unpack('H*', $oidbin);
+                        my $err;
+                        if (!$smsg) {
+                                $err = 'stale';
+                        } elsif ($smsg->{blob} ne $oidhex) {
+                                $err = "mismatch (!= $smsg->{blob})";
+                        } else {
+                                next; # likely, all good
+                        }
+                        # current_info already has eidx_key
+                        warn "$xnum:$oidhex (#$docid): $err\n";
+                        my $del = $self->{oidx}->dbh->prepare_cached(<<'');
+DELETE FROM xref3 WHERE ibx_id = ? AND xnum = ? AND oidbin = ?
+
+                        $del->bind_param(1, $ibx->{-ibx_id});
+                        $del->bind_param(2, $xnum);
+                        $del->bind_param(3, $oidbin, SQL_BLOB);
+                        $del->execute;
+
+                        # get_xref3 over-fetches, but this is a rare path:
+                        my $xr3 = $self->{oidx}->get_xref3($docid);
+                        my $idx = $self->idx_shard($docid);
+                        if (scalar(@$xr3) == 0) { # all gone
+                                $self->{oidx}->delete_by_num($docid);
+                                $self->{oidx}->eidxq_del($docid);
+                                $idx->ipc_do('xdb_remove', $docid);
+                        } else { # enqueue for reindex of remaining messages
+                                $idx->ipc_do('remove_eidx_info',
+                                                $docid, $ibx->eidx_key);
+                                $self->{oidx}->eidxq_add($docid); # yes, add
+                        }
+                }
+        } while (defined $fetching);
+}
+
+sub _reindex_inbox ($$$) {
+        my ($self, $sync, $ibx) = @_;
+        my $ekey = $ibx->eidx_key;
+        local $self->{current_info} = $ekey;
+        if (defined(my $err = _ibx_index_reject($ibx))) {
+                warn "W: cannot reindex $ekey ($err)\n";
+        } else {
+                _reindex_check_unseen($self, $sync, $ibx);
+                _reindex_check_stale($self, $sync, $ibx) unless $sync->{quit};
+        }
+        delete @$ibx{qw(over mm search git)}; # won't need these for a bit
+}
+
+sub eidx_reindex {
+        my ($self, $sync) = @_;
+
+        # acquire eidxq_lock early because full reindex takes forever
+        # and incremental -extindex processes can run during our checkpoints
+        if (!eidxq_lock_acquire($self)) {
+                warn "E: aborting --reindex\n";
+                return;
+        }
+        for my $ibx (@{$self->{ibx_list}}) {
+                _reindex_inbox($self, $sync, $ibx);
+                last if $sync->{quit};
+        }
+        $self->git->async_wait_all; # ensure eidxq gets filled completely
+        eidxq_process($self, $sync) unless $sync->{quit};
+}
+
+sub sync_inbox {
+        my ($self, $sync, $ibx) = @_;
+        my $err = _sync_inbox($self, $sync, $ibx);
+        delete @$ibx{qw(mm over)};
+        warn $err, "\n" if defined($err);
+}
+
+sub eidx_sync { # main entry point
+        my ($self, $opt) = @_;
+
+        my $warn_cb = $SIG{__WARN__} || \&CORE::warn;
+        local $self->{current_info} = '';
+        local $SIG{__WARN__} = sub {
+                $warn_cb->($self->{current_info}, ': ', @_);
+        };
+        $self->idx_init($opt); # acquire lock via V2Writable::_idx_init
+        $self->{oidx}->rethread_prepare($opt);
+        my $sync = {
+                need_checkpoint => \(my $need_checkpoint = 0),
+                check_intvl => 10,
+                next_check => now() + 10,
+                -opt => $opt,
+                # DO NOT SET {reindex} here, it's incompatible with reused
+                # V2Writable code, reindex is totally different here
+                # compared to v1/v2 inboxes because we have multiple histories
+                self => $self,
+                -regen_fmt => "%u/?\n",
+        };
+        local $SIG{USR1} = sub { $need_checkpoint = 1 };
+        my $quit = PublicInbox::SearchIdx::quit_cb($sync);
+        local $SIG{QUIT} = $quit;
+        local $SIG{INT} = $quit;
+        local $SIG{TERM} = $quit;
+        for my $ibx (@{$self->{ibx_list}}) {
+                $ibx->{-ibx_id} //= $self->{oidx}->ibx_id($ibx->eidx_key);
+        }
+        if (delete($opt->{reindex})) {
+                local $sync->{checkpoint_unlocks} = 1;
+                eidx_reindex($self, $sync);
+        }
+
+        # don't use $_ here, it'll get clobbered by reindex_checkpoint
+        if ($opt->{scan} // 1) {
+                for my $ibx (@{$self->{ibx_list}}) {
+                        last if $sync->{quit};
+                        sync_inbox($self, $sync, $ibx);
+                }
+        }
+        $self->{oidx}->rethread_done($opt) unless $sync->{quit};
+        eidxq_process($self, $sync) unless $sync->{quit};
+
+        eidxq_release($self);
+        done($self);
+        $sync; # for eidx_watch
+}
+
+sub update_last_commit { # overrides V2Writable
+        my ($self, $sync, $stk) = @_;
+        my $unit = $sync->{unit} // return;
+        my $latest_cmt = $stk ? $stk->{latest_cmt} : ${$sync->{latest_cmt}};
+        defined($latest_cmt) or return;
+        my $ibx = $sync->{ibx} or die 'BUG: {ibx} missing';
+        my $ekey = $ibx->eidx_key;
+        my $uv = $ibx->uidvalidity;
+        my $epoch = $unit->{epoch};
+        my $meta_key;
+        my $v = $ibx->version;
+        if ($v == 2) {
+                die 'No {epoch} for v2 unit' unless defined $epoch;
+                $meta_key = "lc-v2:$ekey//$uv;$epoch";
+        } elsif ($v == 1) {
+                die 'Unexpected {epoch} for v1 unit' if defined $epoch;
+                $meta_key = "lc-v1:$ekey//$uv";
+        } else {
+                die "Unsupported inbox version: $v";
+        }
+        my $last = $self->{oidx}->eidx_meta($meta_key);
+        if (defined $last && is_ancestor($self->git, $last, $latest_cmt)) {
+                my @cmd = (qw(rev-list --count), "$last..$latest_cmt");
+                chomp(my $n = $unit->{git}->qx(@cmd));
+                return if $n ne '' && $n == 0;
+        }
+        $self->{oidx}->eidx_meta($meta_key, $latest_cmt);
+}
+
+sub _idx_init { # with_umask callback
+        my ($self, $opt) = @_;
+        PublicInbox::V2Writable::_idx_init($self, $opt);
+        $self->{midx} = PublicInbox::MiscIdx->new($self);
+}
+
+sub idx_init { # similar to V2Writable
+        my ($self, $opt) = @_;
+        return if $self->{idx_shards};
+
+        $self->git->cleanup;
+        my $mode = 0644;
+        my $ALL = $self->git->{git_dir}; # ALL.git
+        my $old = -d $ALL;
+        if ($opt->{-private}) { # LeiStore
+                $mode = 0600;
+                if (!$old) {
+                        umask 077; # don't bother restoring
+                        PublicInbox::Import::init_bare($ALL);
+                        $self->git->qx(qw(config core.sharedRepository 0600));
+                }
+        } else {
+                PublicInbox::Import::init_bare($ALL) unless $old;
+        }
+        my $info_dir = "$ALL/objects/info";
+        my $alt = "$info_dir/alternates";
+        my (@old, @new, %seen); # seen: st_dev + st_ino
+        if (-e $alt) {
+                open(my $fh, '<', $alt) or die "open $alt: $!";
+                $mode = (stat($fh))[2] & 07777;
+                while (my $line = <$fh>) {
+                        chomp(my $d = $line);
+
+                        # expand relative path (/local/ stuff)
+                        substr($d, 0, 3) eq '../' and
+                                $d = "$ALL/objects/$d";
+                        if (my @st = stat($d)) {
+                                next if $seen{"$st[0]\0$st[1]"}++;
+                        } else {
+                                warn "W: stat($d) failed (from $alt): $!\n";
+                                next if $opt->{-idx_gc};
+                        }
+                        push @old, $line;
+                }
+        }
+
+        # for LeiStore, and possibly some mirror-only state
+        if (opendir(my $dh, my $local = "$self->{topdir}/local")) {
+                # highest numbered epoch first
+                for my $n (sort { $b <=> $a } map { substr($_, 0, -4) + 0 }
+                                grep(/\A[0-9]+\.git\z/, readdir($dh))) {
+                        my $d = "$local/$n.git/objects"; # absolute path
+                        if (my @st = stat($d)) {
+                                next if $seen{"$st[0]\0$st[1]"}++;
+                                # favor relative paths for rename-friendliness
+                                push @new, "../../local/$n.git/objects\n";
+                        } else {
+                                warn "W: stat($d) failed: $!\n";
+                        }
+                }
+        }
+        for my $ibx (@{$self->{ibx_list}}) {
+                my $line = $ibx->git->{git_dir} . "/objects\n";
+                chomp(my $d = $line);
+                if (my @st = stat($d)) {
+                        next if $seen{"$st[0]\0$st[1]"}++;
+                } else {
+                        warn "W: stat($d) failed (from $ibx->{inboxdir}): $!\n";
+                        next if $opt->{-idx_gc};
+                }
+                push @new, $line;
+        }
+        if (scalar @new) {
+                push @old, @new;
+                my $o = \@old;
+                PublicInbox::V2Writable::write_alternates($info_dir, $mode, $o);
+        }
+        $self->parallel_init($self->{indexlevel});
+        $self->with_umask(\&_idx_init, $self, $opt);
+        $self->{oidx}->begin_lazy;
+        $self->{oidx}->eidx_prep;
+        $self->git->batch_prepare;
+        $self->{midx}->begin_txn;
+}
+
+sub _watch_commit { # PublicInbox::DS::add_timer callback
+        my ($self) = @_;
+        delete $self->{-commit_timer};
+        eidxq_process($self, $self->{-watch_sync});
+        eidxq_release($self);
+        delete local $self->{-watch_sync}->{-regen_fmt};
+        reindex_checkpoint($self, $self->{-watch_sync});
+
+        # call event_step => done unless commit_timer is armed
+        PublicInbox::DS::requeue($self);
+}
+
+sub on_inbox_unlock { # called by PublicInbox::InboxIdle
+        my ($self, $ibx) = @_;
+        my $opt = $self->{-watch_sync}->{-opt};
+        my $pr = $opt->{-progress};
+        my $ekey = $ibx->eidx_key;
+        local $0 = "sync $ekey";
+        $pr->("indexing $ekey\n") if $pr;
+        $self->idx_init($opt);
+        sync_inbox($self, $self->{-watch_sync}, $ibx);
+        $self->{-commit_timer} //= PublicInbox::DS::add_timer(
+                                        $opt->{'commit-interval'} // 10,
+                                        \&_watch_commit, $self);
+}
+
+sub eidx_reload { # -extindex --watch SIGHUP handler
+        my ($self, $idler) = @_;
+        if ($self->{cfg}) {
+                my $pr = $self->{-watch_sync}->{-opt}->{-progress};
+                $pr->('reloading ...') if $pr;
+                delete $self->{-resync_queue};
+                @{$self->{ibx_list}} = ();
+                %{$self->{ibx_map}} = ();
+                delete $self->{-watch_sync}->{id2pos};
+                my $cfg = PublicInbox::Config->new;
+                attach_config($self, $cfg);
+                $idler->refresh($cfg);
+                $pr->(" done\n") if $pr;
+        } else {
+                warn "reload not supported without --all\n";
+        }
+}
+
+sub eidx_resync_start ($) { # -extindex --watch SIGUSR1 handler
+        my ($self) = @_;
+        $self->{-resync_queue} //= [ @{$self->{ibx_list}} ];
+        PublicInbox::DS::requeue($self); # trigger our ->event_step
+}
+
+sub event_step { # PublicInbox::DS::requeue callback
+        my ($self) = @_;
+        if (my $resync_queue = $self->{-resync_queue}) {
+                if (my $ibx = shift(@$resync_queue)) {
+                        on_inbox_unlock($self, $ibx);
+                        PublicInbox::DS::requeue($self);
+                } else {
+                        delete $self->{-resync_queue};
+                        _watch_commit($self);
+                }
+        } else {
+                done($self) unless $self->{-commit_timer};
+        }
+}
+
+sub eidx_watch { # public-inbox-extindex --watch main loop
+        my ($self, $opt) = @_;
+        local %SIG = %SIG;
+        for my $sig (qw(HUP USR1 TSTP QUIT INT TERM)) {
+                $SIG{$sig} = sub { warn "SIG$sig ignored while scanning\n" };
+        }
+        require PublicInbox::InboxIdle;
+        require PublicInbox::DS;
+        require PublicInbox::Syscall;
+        require PublicInbox::Sigfd;
+        my $idler = PublicInbox::InboxIdle->new($self->{cfg});
+        if (!$self->{cfg}) {
+                $idler->watch_inbox($_) for @{$self->{ibx_list}};
+        }
+        $_->subscribe_unlock(__PACKAGE__, $self) for @{$self->{ibx_list}};
+        my $pr = $opt->{-progress};
+        $pr->("performing initial scan ...\n") if $pr;
+        my $sync = eidx_sync($self, $opt); # initial sync
+        return if $sync->{quit};
+        my $oldset = PublicInbox::DS::block_signals();
+        local $self->{current_info} = '';
+        my $cb = $SIG{__WARN__} || \&CORE::warn;
+        local $SIG{__WARN__} = sub { $cb->($self->{current_info}, ': ', @_) };
+        my $sig = {
+                HUP => sub { eidx_reload($self, $idler) },
+                USR1 => sub { eidx_resync_start($self) },
+                TSTP => sub { kill('STOP', $$) },
+        };
+        my $quit = PublicInbox::SearchIdx::quit_cb($sync);
+        $sig->{QUIT} = $sig->{INT} = $sig->{TERM} = $quit;
+        my $sigfd = PublicInbox::Sigfd->new($sig,
+                                        $PublicInbox::Syscall::SFD_NONBLOCK);
+        %SIG = (%SIG, %$sig) if !$sigfd;
+        local $self->{-watch_sync} = $sync; # for ->on_inbox_unlock
+        if (!$sigfd) {
+                # wake up every second to accept signals if we don't
+                # have signalfd or IO::KQueue:
+                PublicInbox::DS::sig_setmask($oldset);
+                PublicInbox::DS->SetLoopTimeout(1000);
+        }
+        PublicInbox::DS->SetPostLoopCallback(sub { !$sync->{quit} });
+        $pr->("initial scan complete, entering event loop\n") if $pr;
+        PublicInbox::DS->EventLoop; # calls InboxIdle->event_step
+        done($self);
+}
+
+no warnings 'once';
+*done = \&PublicInbox::V2Writable::done;
+*with_umask = \&PublicInbox::InboxWritable::with_umask;
+*parallel_init = \&PublicInbox::V2Writable::parallel_init;
+*nproc_shards = \&PublicInbox::V2Writable::nproc_shards;
+*sync_prepare = \&PublicInbox::V2Writable::sync_prepare;
+*index_todo = \&PublicInbox::V2Writable::index_todo;
+*count_shards = \&PublicInbox::V2Writable::count_shards;
+*atfork_child = \&PublicInbox::V2Writable::atfork_child;
+*idx_shard = \&PublicInbox::V2Writable::idx_shard;
+*reindex_checkpoint = \&PublicInbox::V2Writable::reindex_checkpoint;
+
+1;
diff --git a/lib/PublicInbox/FakeInotify.pm b/lib/PublicInbox/FakeInotify.pm
index 92758613..326b2391 100644
--- a/lib/PublicInbox/FakeInotify.pm
+++ b/lib/PublicInbox/FakeInotify.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # for systems lacking Linux::Inotify2 or IO::KQueue, just emulates
diff --git a/lib/PublicInbox/Feed.pm b/lib/PublicInbox/Feed.pm
index 805076f0..b2219dad 100644
--- a/lib/PublicInbox/Feed.pm
+++ b/lib/PublicInbox/Feed.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used for generating Atom feeds for web-accessible mailing list archives.
@@ -24,7 +24,7 @@ sub generate {
 
 sub generate_thread_atom {
         my ($ctx) = @_;
-        my $msgs = $ctx->{msgs} = $ctx->{-inbox}->over->get_thread($ctx->{mid});
+        my $msgs = $ctx->{msgs} = $ctx->{ibx}->over->get_thread($ctx->{mid});
         return _no_thread() unless @$msgs;
         PublicInbox::WwwAtomStream->response($ctx, 200, \&generate_i);
 }
@@ -34,7 +34,7 @@ sub generate_html_index {
         # if the 'r' query parameter is given, it is a legacy permalink
         # which we must continue supporting:
         my $qp = $ctx->{qp};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         if ($qp && !$qp->{r} && $ibx->over) {
                 return PublicInbox::View::index_topics($ctx);
         }
@@ -79,8 +79,8 @@ sub _no_thread () {
 
 sub recent_msgs {
         my ($ctx) = @_;
-        my $ibx = $ctx->{-inbox};
-        my $max = $ibx->{feedmax};
+        my $ibx = $ctx->{ibx};
+        my $max = $ibx->{feedmax} // 25;
         return PublicInbox::View::paginate_recent($ctx, $max) if $ibx->over;
 
         # only for rare v1 inboxes which aren't indexed at all
diff --git a/lib/PublicInbox/Filter/Base.pm b/lib/PublicInbox/Filter/Base.pm
index d54570fd..f6355e1b 100644
--- a/lib/PublicInbox/Filter/Base.pm
+++ b/lib/PublicInbox/Filter/Base.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # base class for creating per-list or per-project filters
diff --git a/lib/PublicInbox/Filter/Gmane.pm b/lib/PublicInbox/Filter/Gmane.pm
index c326faca..a18b77d2 100644
--- a/lib/PublicInbox/Filter/Gmane.pm
+++ b/lib/PublicInbox/Filter/Gmane.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Filter for importing some archives from gmane
diff --git a/lib/PublicInbox/Filter/Mirror.pm b/lib/PublicInbox/Filter/Mirror.pm
index 9f6dd342..fe915fc3 100644
--- a/lib/PublicInbox/Filter/Mirror.pm
+++ b/lib/PublicInbox/Filter/Mirror.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Dumb filter for blindly accepting everything
diff --git a/lib/PublicInbox/Filter/RubyLang.pm b/lib/PublicInbox/Filter/RubyLang.pm
index 06e4ea75..09aa6aa8 100644
--- a/lib/PublicInbox/Filter/RubyLang.pm
+++ b/lib/PublicInbox/Filter/RubyLang.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Filter for lists.ruby-lang.org trailers
@@ -16,7 +16,7 @@ sub new {
         my ($class, %opts) = @_;
         my $altid = delete $opts{-altid};
         my $self = $class->SUPER::new(%opts);
-        my $ibx = $self->{-inbox};
+        my $ibx = $self->{ibx};
         # altid = serial:ruby-core:file=msgmap.sqlite3
         if (!$altid && $ibx && $ibx->{altid}) {
                 $altid ||= $ibx->{altid}->[0];
diff --git a/lib/PublicInbox/Filter/SubjectTag.pm b/lib/PublicInbox/Filter/SubjectTag.pm
index aca6688b..ecedf666 100644
--- a/lib/PublicInbox/Filter/SubjectTag.pm
+++ b/lib/PublicInbox/Filter/SubjectTag.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Filter for various [tags] in subjects
diff --git a/lib/PublicInbox/Filter/Vger.pm b/lib/PublicInbox/Filter/Vger.pm
index 2c73738d..0b1f5dd3 100644
--- a/lib/PublicInbox/Filter/Vger.pm
+++ b/lib/PublicInbox/Filter/Vger.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Filter for vger.kernel.org list trailer
diff --git a/lib/PublicInbox/Gcf2.pm b/lib/PublicInbox/Gcf2.pm
new file mode 100644
index 00000000..01b83c96
--- /dev/null
+++ b/lib/PublicInbox/Gcf2.pm
@@ -0,0 +1,110 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# backend for a git-cat-file-workalike based on libgit2,
+# other libgit2 stuff may go here, too.
+package PublicInbox::Gcf2;
+use strict;
+use PublicInbox::Spawn qw(which popen_rd);
+use Fcntl qw(LOCK_EX);
+use IO::Handle; # autoflush
+my (%CFG, $c_src, $lockfh);
+BEGIN {
+        # PublicInbox::Spawn will set PERL_INLINE_DIRECTORY
+        # to ~/.cache/public-inbox/inline-c if it exists
+        my $inline_dir = $ENV{PERL_INLINE_DIRECTORY} //
+                die 'PERL_INLINE_DIRECTORY not defined';
+        my $f = "$inline_dir/.public-inbox.lock";
+        open $lockfh, '>', $f or die "failed to open $f: $!\n";
+        my $pc = which($ENV{PKG_CONFIG} // 'pkg-config');
+        my ($dir) = (__FILE__ =~ m!\A(.+?)/[^/]+\z!);
+        my $rdr = {};
+        open $rdr->{2}, '>', '/dev/null' or die "open /dev/null: $!";
+        for my $x (qw(libgit2)) {
+                my $l = popen_rd([$pc, '--libs', $x], undef, $rdr);
+                $l = do { local $/; <$l> };
+                next if $?;
+                my $c = popen_rd([$pc, '--cflags', $x], undef, $rdr);
+                $c = do { local $/; <$c> };
+                next if $?;
+
+                # note: we name C source files .h to prevent
+                # ExtUtils::MakeMaker from automatically trying to
+                # build them.
+                my $f = "$dir/gcf2_$x.h";
+                if (open(my $fh, '<', $f)) {
+                        chomp($l, $c);
+                        local $/;
+                        defined($c_src = <$fh>) or die "read $f: $!\n";
+                        $CFG{LIBS} = $l;
+                        $CFG{CCFLAGSEX} = $c;
+                        last;
+                } else {
+                        die "E: $f: $!\n";
+                }
+        }
+        die "E: libgit2 not installed\n" unless $c_src;
+
+        # CentOS 7.x ships Inline 0.53, 0.64+ has built-in locking
+        flock($lockfh, LOCK_EX) or die "LOCK_EX failed on $f: $!\n";
+}
+
+# we use Capitalized and ALLCAPS for compatibility with old Inline::C
+use Inline C => Config => %CFG, BOOT => 'git_libgit2_init();';
+use Inline C => $c_src;
+undef $c_src;
+undef %CFG;
+undef $lockfh;
+
+sub add_alt ($$) {
+        my ($gcf2, $objdir) = @_;
+
+        # libgit2 (tested 0.27.7+dfsg.1-0.2 and 0.28.3+dfsg.1-1~bpo10+1
+        # in Debian) doesn't handle relative epochs properly when nested
+        # multiple levels.  Add all the absolute paths to workaround it,
+        # since $EXTINDEX_DIR/ALL.git/objects/info/alternates uses absolute
+        # paths to reference $V2INBOX_DIR/all.git/objects and
+        # $V2INBOX_DIR/all.git/objects/info/alternates uses relative paths
+        # to refer to $V2INBOX_DIR/git/$EPOCH.git/objects
+        #
+        # See https://bugs.debian.org/975607
+        if (open(my $fh, '<', "$objdir/info/alternates")) {
+                chomp(my @abs_alt = grep(m!^/!, <$fh>));
+                $gcf2->add_alternate($_) for @abs_alt;
+        }
+        $gcf2->add_alternate($objdir);
+}
+
+# Usage: $^X -MPublicInbox::Gcf2 -e PublicInbox::Gcf2::loop
+# (see lib/PublicInbox/Gcf2Client.pm)
+sub loop () {
+        my $gcf2 = new();
+        my %seen;
+        STDERR->autoflush(1);
+        STDOUT->autoflush(1);
+
+        while (<STDIN>) {
+                chomp;
+                my ($oid, $git_dir) = split(/ /, $_, 2);
+                $seen{$git_dir}++ or add_alt($gcf2, "$git_dir/objects");
+                if (!$gcf2->cat_oid(1, $oid)) {
+                        # retry once if missing.  We only get unabbreviated OIDs
+                        # from SQLite or Xapian DBs, here, so malicious clients
+                        # can't trigger excessive retries:
+                        warn "I: $$ $oid missing, retrying in $git_dir\n";
+
+                        $gcf2 = new();
+                        %seen = ($git_dir => 1);
+                        add_alt($gcf2, "$git_dir/objects");
+
+                        if ($gcf2->cat_oid(1, $oid)) {
+                                warn "I: $$ $oid found after retry\n";
+                        } else {
+                                warn "W: $$ $oid missing after retry\n";
+                                print "$oid missing\n"; # mimic git-cat-file
+                        }
+                }
+        }
+}
+
+1;
diff --git a/lib/PublicInbox/Gcf2Client.pm b/lib/PublicInbox/Gcf2Client.pm
new file mode 100644
index 00000000..397774f9
--- /dev/null
+++ b/lib/PublicInbox/Gcf2Client.pm
@@ -0,0 +1,85 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# connects public-inbox processes to PublicInbox::Gcf2::loop()
+package PublicInbox::Gcf2Client;
+use strict;
+use parent qw(PublicInbox::DS);
+use PublicInbox::Git;
+use PublicInbox::Gcf2; # fails if Inline::C or libgit2-dev isn't available
+use PublicInbox::Spawn qw(spawn);
+use Socket qw(AF_UNIX SOCK_STREAM);
+use PublicInbox::Syscall qw(EPOLLIN EPOLLET);
+# fields:
+#        sock => socket to Gcf2::loop
+# The rest of these fields are compatible with what PublicInbox::Git
+# uses code-sharing
+#        pid => PID of Gcf2::loop process
+#        pid.owner => process which spawned {pid}
+#        in => same as {sock}, for compatibility with PublicInbox::Git
+#        inflight => array (see PublicInbox::Git)
+#        cat_rbuf => scalarref, may be non-existent or empty
+sub new  {
+        my ($rdr) = @_;
+        my $self = bless {}, __PACKAGE__;
+        # ensure the child process has the same @INC we do:
+        my $env = { PERL5LIB => join(':', @INC) };
+        my ($s1, $s2);
+        socketpair($s1, $s2, AF_UNIX, SOCK_STREAM, 0) or die "socketpair $!";
+        $rdr //= {};
+        $rdr->{0} = $rdr->{1} = $s2;
+        my $cmd = [$^X, qw[-MPublicInbox::Gcf2 -e PublicInbox::Gcf2::loop]];
+        $self->{'pid.owner'} = $$;
+        $self->{pid} = spawn($cmd, $env, $rdr);
+        $s1->blocking(0);
+        $self->{inflight} = [];
+        $self->{in} = $s1;
+        $self->SUPER::new($s1, EPOLLIN|EPOLLET);
+}
+
+sub fail {
+        my $self = shift;
+        $self->close; # PublicInbox::DS::close
+        PublicInbox::Git::fail($self, @_);
+}
+
+sub gcf2_async ($$$;$) {
+        my ($self, $req, $cb, $arg) = @_;
+        my $inflight = $self->{inflight} or return $self->close;
+
+        # {wbuf} is rare, I hope:
+        cat_async_step($self, $inflight) if $self->{wbuf};
+
+        $self->fail("gcf2c write: $!") if !$self->write($req) && !$self->{sock};
+        push @$inflight, $req, $cb, $arg;
+}
+
+# ensure PublicInbox::Git::cat_async_step never calls cat_async_retry
+sub alternates_changed {}
+
+# DS->EventLoop will call this
+sub event_step {
+        my ($self) = @_;
+        $self->flush_write;
+        $self->close if !$self->{in} || !$self->{sock}; # process died
+        my $inflight = $self->{inflight};
+        if ($inflight && @$inflight) {
+                cat_async_step($self, $inflight);
+                return $self->close unless $self->{in}; # process died
+
+                # ok, more to do, requeue for fairness
+                $self->requeue if @$inflight || exists($self->{cat_rbuf});
+        }
+}
+
+sub DESTROY {
+        my ($self) = @_;
+        delete $self->{sock}; # if outside EventLoop
+        PublicInbox::Git::DESTROY($self);
+}
+
+no warnings 'once';
+
+*cat_async_step = \&PublicInbox::Git::cat_async_step;
+
+1;
diff --git a/lib/PublicInbox/GetlineBody.pm b/lib/PublicInbox/GetlineBody.pm
index 988bc63f..0e781224 100644
--- a/lib/PublicInbox/GetlineBody.pm
+++ b/lib/PublicInbox/GetlineBody.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Wrap a pipe or file for PSGI streaming response bodies and calls the
diff --git a/lib/PublicInbox/Git.pm b/lib/PublicInbox/Git.pm
index a7ba57f9..3d97300c 100644
--- a/lib/PublicInbox/Git.pm
+++ b/lib/PublicInbox/Git.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: GPLv2 or later <https://www.gnu.org/licenses/gpl-2.0.txt>
 #
 # Used to read files from a git repository without excessive forking.
@@ -12,15 +12,20 @@ use v5.10.1;
 use parent qw(Exporter);
 use POSIX ();
 use IO::Handle; # ->autoflush
-use Errno qw(EINTR);
+use Errno qw(EINTR EAGAIN);
 use File::Glob qw(bsd_glob GLOB_NOSORT);
+use File::Spec ();
 use Time::HiRes qw(stat);
 use PublicInbox::Spawn qw(popen_rd);
 use PublicInbox::Tmpfile;
+use IO::Poll qw(POLLIN);
 use Carp qw(croak);
+use Digest::SHA ();
+use PublicInbox::DS qw(dwaitpid);
 our @EXPORT_OK = qw(git_unquote git_quote);
 our $PIPE_BUFSIZ = 65536; # Linux default
 our $in_cleanup;
+our $RDTIMEO = 60_000; # milliseconds
 
 use constant MAX_INFLIGHT =>
         (($^O eq 'linux' ? 4096 : POSIX::_POSIX_PIPE_BUF()) * 3)
@@ -92,9 +97,9 @@ sub alternates_changed {
 sub last_check_err {
         my ($self) = @_;
         my $fh = $self->{err_c} or return;
-        sysseek($fh, 0, 0) or fail($self, "sysseek failed: $!");
+        sysseek($fh, 0, 0) or $self->fail("sysseek failed: $!");
         defined(sysread($fh, my $buf, -s $fh)) or
-                        fail($self, "sysread failed: $!");
+                        $self->fail("sysread failed: $!");
         $buf;
 }
 
@@ -103,24 +108,25 @@ sub _bidi_pipe {
         if ($self->{$pid}) {
                 if (defined $err) { # "err_c"
                         my $fh = $self->{$err};
-                        sysseek($fh, 0, 0) or fail($self, "sysseek failed: $!");
-                        truncate($fh, 0) or fail($self, "truncate failed: $!");
+                        sysseek($fh, 0, 0) or $self->fail("sysseek failed: $!");
+                        truncate($fh, 0) or $self->fail("truncate failed: $!");
                 }
                 return;
         }
         my ($out_r, $out_w);
-        pipe($out_r, $out_w) or fail($self, "pipe failed: $!");
+        pipe($out_r, $out_w) or $self->fail("pipe failed: $!");
         my @cmd = (qw(git), "--git-dir=$self->{git_dir}",
                         qw(-c core.abbrev=40 cat-file), $batch);
         my $redir = { 0 => $out_r };
         if ($err) {
                 my $id = "git.$self->{git_dir}$batch.err";
-                my $fh = tmpfile($id) or fail($self, "tmpfile($id): $!");
+                my $fh = tmpfile($id) or $self->fail("tmpfile($id): $!");
                 $self->{$err} = $fh;
                 $redir->{2} = $fh;
         }
         my ($in_r, $p) = popen_rd(\@cmd, undef, $redir);
         $self->{$pid} = $p;
+        $self->{"$pid.owner"} = $$;
         $out_w->autoflush(1);
         if ($^O eq 'linux') { # 1031: F_SETPIPE_SZ
                 fcntl($out_w, 1031, 4096);
@@ -130,6 +136,8 @@ sub _bidi_pipe {
         $self->{$in} = $in_r;
 }
 
+sub poll_in ($) { IO::Poll::_poll($RDTIMEO, fileno($_[0]), my $ev = POLLIN) }
+
 sub my_read ($$$) {
         my ($fh, $rbuf, $len) = @_;
         my $left = $len - length($$rbuf);
@@ -138,9 +146,12 @@ sub my_read ($$$) {
                 $r = sysread($fh, $$rbuf, $PIPE_BUFSIZ, length($$rbuf));
                 if ($r) {
                         $left -= $r;
+                } elsif (defined($r)) { # EOF
+                        return 0;
                 } else {
-                        next if (!defined($r) && $! == EINTR);
-                        return $r;
+                        next if ($! == EAGAIN and poll_in($fh));
+                        next if $! == EINTR; # may be set by sysread or poll_in
+                        return; # unrecoverable error
                 }
         }
         \substr($$rbuf, 0, $len, '');
@@ -152,9 +163,15 @@ sub my_readline ($$) {
                 if ((my $n = index($$rbuf, "\n")) >= 0) {
                         return substr($$rbuf, 0, $n + 1, '');
                 }
-                my $r = sysread($fh, $$rbuf, $PIPE_BUFSIZ, length($$rbuf));
-                next if $r || (!defined($r) && $! == EINTR);
-                return defined($r) ? '' : undef; # EOF or error
+                my $r = sysread($fh, $$rbuf, $PIPE_BUFSIZ, length($$rbuf))
+                                                                and next;
+
+                # return whatever's left on EOF
+                return substr($$rbuf, 0, length($$rbuf)+1, '') if defined($r);
+
+                next if ($! == EAGAIN and poll_in($fh));
+                next if $! == EINTR; # may be set by sysread or poll_in
+                return; # unrecoverable error
         }
 }
 
@@ -172,7 +189,7 @@ sub cat_async_retry ($$$$$) {
         for (my $i = 0; $i < @$inflight; $i += 3) {
                 $buf .= "$inflight->[$i]\n";
         }
-        print { $self->{out} } $buf or fail($self, "write error: $!");
+        print { $self->{out} } $buf or $self->fail("write error: $!");
         unshift(@$inflight, \$req, $cb, $arg); # \$ref to indicate retried
 
         cat_async_step($self, $inflight); # take one step
@@ -185,30 +202,34 @@ sub cat_async_step ($$) {
         my $rbuf = delete($self->{cat_rbuf}) // \(my $new = '');
         my ($bref, $oid, $type, $size);
         my $head = my_readline($self->{in}, $rbuf);
+        # ->fail may be called via Gcf2Client.pm
         if ($head =~ /^([0-9a-f]{40,}) (\S+) ([0-9]+)$/) {
                 ($oid, $type, $size) = ($1, $2, $3 + 0);
                 $bref = my_read($self->{in}, $rbuf, $size + 1) or
-                        fail($self, defined($bref) ? 'read EOF' : "read: $!");
-                chop($$bref) eq "\n" or fail($self, 'LF missing after blob');
-        } elsif ($head =~ / missing$/) {
+                        $self->fail(defined($bref) ? 'read EOF' : "read: $!");
+                chop($$bref) eq "\n" or $self->fail('LF missing after blob');
+        } elsif ($head =~ s/ missing\n//s) {
+                $oid = $head;
                 # ref($req) indicates it's already been retried
-                if (!ref($req) && !$in_cleanup && alternates_changed($self)) {
+                # -gcf2 retries internally, so it never hits this path:
+                if (!ref($req) && !$in_cleanup && $self->alternates_changed) {
                         return cat_async_retry($self, $inflight,
                                                 $req, $cb, $arg);
                 }
                 $type = 'missing';
-                $oid = ref($req) ? $$req : $req;
+                $oid = ref($req) ? $$req : $req if $oid eq '';
         } else {
-                fail($self, "Unexpected result from async git cat-file: $head");
+                my $err = $! ? " ($!)" : '';
+                $self->fail("bad result from async cat-file: $head$err");
         }
-        eval { $cb->($bref, $oid, $type, $size, $arg) };
         $self->{cat_rbuf} = $rbuf if $$rbuf ne '';
+        eval { $cb->($bref, $oid, $type, $size, $arg) };
         warn "E: $oid: $@\n" if $@;
 }
 
 sub cat_async_wait ($) {
         my ($self) = @_;
-        my $inflight = delete $self->{inflight} or return;
+        my $inflight = $self->{inflight} or return;
         while (scalar(@$inflight)) {
                 cat_async_step($self, $inflight);
         }
@@ -236,7 +257,7 @@ sub check_async_step ($$) {
         my ($self, $inflight_c) = @_;
         die 'BUG: inflight empty or odd' if scalar(@$inflight_c) < 3;
         my ($req, $cb, $arg) = splice(@$inflight_c, 0, 3);
-        my $rbuf = delete($self->{rbuf_c}) // \(my $new = '');
+        my $rbuf = delete($self->{chk_rbuf}) // \(my $new = '');
         chomp(my $line = my_readline($self->{in_c}, $rbuf));
         my ($hex, $type, $size) = split(/ /, $line);
 
@@ -246,16 +267,16 @@ sub check_async_step ($$) {
         # https://public-inbox.org/git/20190118033845.s2vlrb3wd3m2jfzu@dcvr/T/
         if ($hex eq 'dangling' || $hex eq 'notdir' || $hex eq 'loop') {
                 my $ret = my_read($self->{in_c}, $rbuf, $type + 1);
-                fail($self, defined($ret) ? 'read EOF' : "read: $!") if !$ret;
+                $self->fail(defined($ret) ? 'read EOF' : "read: $!") if !$ret;
         }
+        $self->{chk_rbuf} = $rbuf if $$rbuf ne '';
         eval { $cb->($hex, $type, $size, $arg, $self) };
         warn "E: check($req) $@\n" if $@;
-        $self->{rbuf_c} = $rbuf if $$rbuf ne '';
 }
 
 sub check_async_wait ($) {
         my ($self) = @_;
-        my $inflight_c = delete $self->{inflight_c} or return;
+        my $inflight_c = $self->{inflight_c} or return;
         while (scalar(@$inflight_c)) {
                 check_async_step($self, $inflight_c);
         }
@@ -272,10 +293,10 @@ sub check_async_begin ($) {
 sub check_async ($$$$) {
         my ($self, $oid, $cb, $arg) = @_;
         my $inflight_c = $self->{inflight_c} // check_async_begin($self);
-        if (scalar(@$inflight_c) >= MAX_INFLIGHT) {
+        while (scalar(@$inflight_c) >= MAX_INFLIGHT) {
                 check_async_step($self, $inflight_c);
         }
-        print { $self->{out_c} } $oid, "\n" or fail($self, "write error: $!");
+        print { $self->{out_c} } $oid, "\n" or $self->fail("write error: $!");
         push(@$inflight_c, $oid, $cb, $arg);
 }
 
@@ -302,40 +323,70 @@ sub check {
 
 sub _destroy {
         my ($self, $rbuf, $in, $out, $pid, $err) = @_;
-        my $p = delete $self->{$pid} or return;
         delete @$self{($rbuf, $in, $out)};
         delete $self->{$err} if $err; # `err_c'
 
-        # PublicInbox::DS may not be loaded
-        eval { PublicInbox::DS::dwaitpid($p, undef, undef) };
-        waitpid($p, 0) if $@; # wait synchronously if not in event loop
+        # GitAsyncCat::event_step may delete {pid}
+        my $p = delete $self->{$pid} or return;
+        dwaitpid($p) if $$ == $self->{"$pid.owner"};
 }
 
 sub cat_async_abort ($) {
         my ($self) = @_;
-        my $inflight = delete $self->{inflight} or die 'BUG: not in async';
+        if (my $inflight = $self->{inflight}) {
+                while (@$inflight) {
+                        my ($req, $cb, $arg) = splice(@$inflight, 0, 3);
+                        $req =~ s/ .*//; # drop git_dir for Gcf2Client
+                        eval { $cb->(undef, $req, undef, undef, $arg) };
+                        warn "E: $req: $@ (in abort)\n" if $@;
+                }
+                delete $self->{cat_rbuf};
+                delete $self->{inflight};
+        }
         cleanup($self);
 }
 
-sub fail {
+sub fail { # may be augmented in subclasses
         my ($self, $msg) = @_;
-        $self->{inflight} ? cat_async_abort($self) : cleanup($self);
-        croak("git $self->{git_dir}: $msg");
+        cat_async_abort($self);
+        croak(ref($self) . ' ' . ($self->{git_dir} // '') . ": $msg");
 }
 
+# $git->popen(qw(show f00)); # or
+# $git->popen(qw(show f00), { GIT_CONFIG => ... }, { 2 => ... });
 sub popen {
-        my ($self, @cmd) = @_;
-        @cmd = ('git', "--git-dir=$self->{git_dir}", @cmd);
-        popen_rd(\@cmd);
+        my ($self, $cmd) = splice(@_, 0, 2);
+        $cmd = [ 'git', "--git-dir=$self->{git_dir}",
+                ref($cmd) ? @$cmd : ($cmd, grep { defined && !ref } @_) ];
+        popen_rd($cmd, grep { !defined || ref } @_); # env and opt
 }
 
+# same args as popen above
 sub qx {
-        my ($self, @cmd) = @_;
-        my $fh = $self->popen(@cmd);
-        local $/ = "\n";
-        return <$fh> if wantarray;
-        local $/;
-        <$fh>
+        my $self = shift;
+        my $fh = $self->popen(@_);
+        if (wantarray) {
+                local $/ = "\n";
+                my @ret = <$fh>;
+                close $fh; # caller should check $?
+                @ret;
+        } else {
+                local $/;
+                my $ret = <$fh>;
+                close $fh; # caller should check $?
+                $ret;
+        }
+}
+
+# check_async and cat_async may trigger the other, so ensure they're
+# both completely done by using this:
+sub async_wait_all ($) {
+        my ($self) = @_;
+        while (scalar(@{$self->{inflight_c} // []}) ||
+                        scalar(@{$self->{inflight} // []})) {
+                $self->check_async_wait;
+                $self->cat_async_wait;
+        }
 }
 
 # returns true if there are pending "git cat-file" processes
@@ -343,13 +394,15 @@ sub cleanup {
         my ($self) = @_;
         local $in_cleanup = 1;
         delete $self->{async_cat};
-        check_async_wait($self);
-        cat_async_wait($self);
+        async_wait_all($self);
+        delete $self->{inflight};
+        delete $self->{inflight_c};
         _destroy($self, qw(cat_rbuf in out pid));
         _destroy($self, qw(chk_rbuf in_c out_c pid_c err_c));
         !!($self->{pid} || $self->{pid_c});
 }
 
+
 # assuming a well-maintained repo, this should be a somewhat
 # accurate estimation of its size
 # TODO: show this in the WWW UI as a hint to potential cloners
@@ -394,8 +447,8 @@ sub pub_urls {
 
 sub cat_async_begin {
         my ($self) = @_;
-        cleanup($self) if alternates_changed($self);
-        batch_prepare($self);
+        cleanup($self) if $self->alternates_changed;
+        $self->batch_prepare;
         die 'BUG: already in async' if $self->{inflight};
         $self->{inflight} = [];
 }
@@ -403,24 +456,21 @@ sub cat_async_begin {
 sub cat_async ($$$;$) {
         my ($self, $oid, $cb, $arg) = @_;
         my $inflight = $self->{inflight} // cat_async_begin($self);
-        if (scalar(@$inflight) >= MAX_INFLIGHT) {
+        while (scalar(@$inflight) >= MAX_INFLIGHT) {
                 cat_async_step($self, $inflight);
         }
-
-        print { $self->{out} } $oid, "\n" or fail($self, "write error: $!");
+        print { $self->{out} } $oid, "\n" or $self->fail("write error: $!");
         push(@$inflight, $oid, $cb, $arg);
 }
 
-# this is safe to call inside $cb, but not guaranteed to enqueue
-# returns true if successful, undef if not.
 sub async_prefetch {
         my ($self, $oid, $cb, $arg) = @_;
-        if (defined($self->{async_cat}) && (my $inflight = $self->{inflight})) {
+        if (my $inflight = $self->{inflight}) {
                 # we could use MAX_INFLIGHT here w/o the halving,
                 # but lets not allow one client to monopolize a git process
                 if (scalar(@$inflight) < int(MAX_INFLIGHT/2)) {
                         print { $self->{out} } $oid, "\n" or
-                                                fail($self, "write error: $!");
+                                                $self->fail("write error: $!");
                         return push(@$inflight, $oid, $cb, $arg);
                 }
         }
@@ -451,6 +501,56 @@ sub modified ($) {
         $modified || time;
 }
 
+# for grokmirror, which doesn't read gitweb.description
+# templates/hooks--update.sample and git-multimail in git.git
+# only match "Unnamed repository", not the full contents of
+# templates/this--description in git.git
+sub manifest_entry {
+        my ($self, $epoch, $default_desc) = @_;
+        my $fh = $self->popen('show-ref');
+        my $dig = Digest::SHA->new(1);
+        while (read($fh, my $buf, 65536)) {
+                $dig->add($buf);
+        }
+        close $fh or return; # empty, uninitialized git repo
+        undef $fh; # for open, below
+        my $git_dir = $self->{git_dir};
+        my $ent = {
+                fingerprint => $dig->hexdigest,
+                reference => undef,
+                modified => modified($self),
+        };
+        chomp(my $owner = $self->qx('config', 'gitweb.owner'));
+        utf8::decode($owner);
+        $ent->{owner} = $owner eq '' ? undef : $owner;
+        my $desc = '';
+        if (open($fh, '<', "$git_dir/description")) {
+                local $/ = "\n";
+                chomp($desc = <$fh>);
+                utf8::decode($desc);
+        }
+        $desc = 'Unnamed repository' if $desc eq '';
+        if (defined $epoch && $desc =~ /\AUnnamed repository/) {
+                $desc = "$default_desc [epoch $epoch]";
+        }
+        $ent->{description} = $desc;
+        if (open($fh, '<', "$git_dir/objects/info/alternates")) {
+                # n.b.: GitPython doesn't seem to handle comments or C-quoted
+                # strings like native git does; and we don't for now, either.
+                local $/ = "\n";
+                chomp(my @alt = <$fh>);
+
+                # grokmirror only supports 1 alternate for "reference",
+                if (scalar(@alt) == 1) {
+                        my $objdir = "$git_dir/objects";
+                        my $ref = File::Spec->rel2abs($alt[0], $objdir);
+                        $ref =~ s!/[^/]+/?\z!!; # basename
+                        $ent->{reference} = $ref;
+                }
+        }
+        $ent;
+}
+
 1;
 __END__
 =pod
diff --git a/lib/PublicInbox/GitAsyncCat.pm b/lib/PublicInbox/GitAsyncCat.pm
index 5f785df7..7d1a13db 100644
--- a/lib/PublicInbox/GitAsyncCat.pm
+++ b/lib/PublicInbox/GitAsyncCat.pm
@@ -1,42 +1,88 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # internal class used by PublicInbox::Git + PublicInbox::DS
 # This parses the output pipe of "git cat-file --batch"
-#
-# Note: this does NOT set the non-blocking flag, we expect `git cat-file'
-# to be a local process, and git won't start writing a blob until it's
-# fully read.  So minimize context switching and read as much as possible
-# and avoid holding a buffer in our heap any longer than it has to live.
 package PublicInbox::GitAsyncCat;
 use strict;
 use parent qw(PublicInbox::DS Exporter);
+use POSIX qw(WNOHANG);
 use PublicInbox::Syscall qw(EPOLLIN EPOLLET);
-our @EXPORT = qw(git_async_cat);
+our @EXPORT = qw(git_async_cat git_async_prefetch);
+use PublicInbox::Git ();
+
+our $GCF2C; # singleton PublicInbox::Gcf2Client
 
-sub _add {
-        my ($class, $git) = @_;
-        $git->batch_prepare;
-        my $self = bless { git => $git }, $class;
-        $self->SUPER::new($git->{in}, EPOLLIN|EPOLLET);
-        \undef; # this is a true ref()
+sub close {
+        my ($self) = @_;
+        if (my $git = delete $self->{git}) {
+                $git->cat_async_abort;
+        }
+        $self->SUPER::close; # PublicInbox::DS::close
 }
 
 sub event_step {
         my ($self) = @_;
-        my $git = $self->{git};
+        my $git = $self->{git} or return;
         return $self->close if ($git->{in} // 0) != ($self->{sock} // 1);
         my $inflight = $git->{inflight};
         if ($inflight && @$inflight) {
                 $git->cat_async_step($inflight);
-                $self->requeue if @$inflight || exists $git->{cat_rbuf};
+
+                # child death?
+                if (($git->{in} // 0) != ($self->{sock} // 1)) {
+                        $self->close;
+                } elsif (@$inflight || exists $git->{cat_rbuf}) {
+                        # ok, more to do, requeue for fairness
+                        $self->requeue;
+                }
+        } elsif ((my $pid = waitpid($git->{pid}, WNOHANG)) > 0) {
+                # May happen if the child process is killed by a BOFH
+                # (or segfaults)
+                delete $git->{pid};
+                warn "E: git $pid exited with \$?=$?\n";
+                $self->close;
         }
 }
 
 sub git_async_cat ($$$$) {
         my ($git, $oid, $cb, $arg) = @_;
-        $git->cat_async($oid, $cb, $arg);
-        $git->{async_cat} //= _add(__PACKAGE__, $git);
+        if ($GCF2C //= eval {
+                require PublicInbox::Gcf2Client;
+                PublicInbox::Gcf2Client::new();
+        } // 0) { # 0: do not retry if libgit2 or Inline::C are missing
+                $GCF2C->gcf2_async(\"$oid $git->{git_dir}\n", $cb, $arg);
+                \undef;
+        } else { # read-only end of git-cat-file pipe
+                $git->cat_async($oid, $cb, $arg);
+                $git->{async_cat} //= do {
+                        my $self = bless { git => $git }, __PACKAGE__;
+                        $git->{in}->blocking(0);
+                        $self->SUPER::new($git->{in}, EPOLLIN|EPOLLET);
+                        \undef; # this is a true ref()
+                };
+        }
+}
+
+# this is safe to call inside $cb, but not guaranteed to enqueue
+# returns true if successful, undef if not.
+sub git_async_prefetch {
+        my ($git, $oid, $cb, $arg) = @_;
+        if ($GCF2C) {
+                if (!$GCF2C->{wbuf}) {
+                        $oid .= " $git->{git_dir}\n";
+                        return $GCF2C->gcf2_async(\$oid, $cb, $arg); # true
+                }
+        } elsif ($git->{async_cat} && (my $inflight = $git->{inflight})) {
+                # we could use MAX_INFLIGHT here w/o the halving,
+                # but lets not allow one client to monopolize a git process
+                if (@$inflight < int(PublicInbox::Git::MAX_INFLIGHT/2)) {
+                        print { $git->{out} } $oid, "\n" or
+                                                $git->fail("write error: $!");
+                        return push(@$inflight, $oid, $cb, $arg);
+                }
+        }
+        undef;
 }
 
 1;
diff --git a/lib/PublicInbox/GitCredential.pm b/lib/PublicInbox/GitCredential.pm
index c6da6a09..9e193029 100644
--- a/lib/PublicInbox/GitCredential.pm
+++ b/lib/PublicInbox/GitCredential.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::GitCredential;
 use strict;
diff --git a/lib/PublicInbox/GitHTTPBackend.pm b/lib/PublicInbox/GitHTTPBackend.pm
index fd2e00dd..c179ffef 100644
--- a/lib/PublicInbox/GitHTTPBackend.pm
+++ b/lib/PublicInbox/GitHTTPBackend.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # when no endpoints match, fallback to this and serve a static file
diff --git a/lib/PublicInbox/GzipFilter.pm b/lib/PublicInbox/GzipFilter.pm
index 20030433..48ed11a5 100644
--- a/lib/PublicInbox/GzipFilter.pm
+++ b/lib/PublicInbox/GzipFilter.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # In public-inbox <=1.5.0, public-inbox-httpd favored "getline"
@@ -169,7 +169,7 @@ sub async_blob_cb { # git->cat_async callback
         if (!defined($oid)) {
                 # it's possible to have TOCTOU if an admin runs
                 # public-inbox-(edit|purge), just move onto the next message
-                warn "E: $smsg->{blob} missing in $self->{-inbox}->{inboxdir}\n";
+                warn "E: $smsg->{blob} missing in $self->{ibx}->{inboxdir}\n";
                 return $http->next_step($self->can('async_next'));
         }
         $smsg->{blob} eq $oid or bail($self, "BUG: $smsg->{blob} != $oid");
@@ -180,7 +180,7 @@ sub async_blob_cb { # git->cat_async callback
 
 sub smsg_blob {
         my ($self, $smsg) = @_;
-        git_async_cat($self->{-inbox}->git, $smsg->{blob},
+        git_async_cat($self->{ibx}->git, $smsg->{blob},
                         \&async_blob_cb, $self);
 }
 
diff --git a/lib/PublicInbox/HTTP.pm b/lib/PublicInbox/HTTP.pm
index 88020ae8..d0708c5b 100644
--- a/lib/PublicInbox/HTTP.pm
+++ b/lib/PublicInbox/HTTP.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Generic PSGI server for convenience.  It aims to provide
diff --git a/lib/PublicInbox/HTTPD.pm b/lib/PublicInbox/HTTPD.pm
index a9f55ff6..b193c9ae 100644
--- a/lib/PublicInbox/HTTPD.pm
+++ b/lib/PublicInbox/HTTPD.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # wraps a listen socket for HTTP and links it to the PSGI app in
diff --git a/lib/PublicInbox/HTTPD/Async.pm b/lib/PublicInbox/HTTPD/Async.pm
index 87a6a5f9..bd1fd8fa 100644
--- a/lib/PublicInbox/HTTPD/Async.pm
+++ b/lib/PublicInbox/HTTPD/Async.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # XXX This is a totally unstable API for public-inbox internal use only
diff --git a/lib/PublicInbox/HlMod.pm b/lib/PublicInbox/HlMod.pm
index de285fc2..9016db3a 100644
--- a/lib/PublicInbox/HlMod.pm
+++ b/lib/PublicInbox/HlMod.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # I have no idea how stable or safe this is for handling untrusted
diff --git a/lib/PublicInbox/Hval.pm b/lib/PublicInbox/Hval.pm
index fb21041a..d20f70ae 100644
--- a/lib/PublicInbox/Hval.pm
+++ b/lib/PublicInbox/Hval.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # represents a header value in various forms.  Used for HTML generation
diff --git a/lib/PublicInbox/IMAP.pm b/lib/PublicInbox/IMAP.pm
index c9a024d6..226e98a2 100644
--- a/lib/PublicInbox/IMAP.pm
+++ b/lib/PublicInbox/IMAP.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Each instance of this represents an IMAP client connected to
@@ -627,7 +627,7 @@ sub fetch_blob_cb { # called by git->cat_async via git_async_cat
         }
         my $pre;
         if (!$self->{wbuf} && (my $nxt = $msgs->[0])) {
-                $pre = $ibx->git->async_prefetch($nxt->{blob},
+                $pre = git_async_prefetch($ibx->git, $nxt->{blob},
                                                 \&fetch_blob_cb, $fetch_arg);
         }
         fetch_run_ops($self, $smsg, $bref, $ops, $partial);
@@ -1110,7 +1110,7 @@ sub search_uid_range { # long_response
         1; # more
 }
 
-sub parse_query ($$) {
+sub parse_imap_query ($$) {
         my ($self, $query) = @_;
         my $q = PublicInbox::IMAPsearchqp::parse($self, $query);
         if (ref($q)) {
@@ -1122,37 +1122,10 @@ sub parse_query ($$) {
         $q;
 }
 
-sub refill_xap ($$$$) {
-        my ($self, $uids, $range_info, $q) = @_;
-        my ($beg, $end) = @$range_info;
-        my $srch = $self->{ibx}->search;
-        my $opt = { mset => 2, limit => 1000 };
-        my $mset = $srch->mset("$q uid:$beg..$end", $opt);
-        @$uids = @{$srch->mset_to_artnums($mset)};
-        if (@$uids) {
-                $range_info->[0] = $uids->[-1] + 1; # update $beg
-                return; # possibly more
-        }
-        0; # all done
-}
-
-sub search_xap_range { # long_response
-        my ($self, $tag, $q, $range_info, $want_msn) = @_;
-        my $uids = [];
-        if (defined(my $err = refill_xap($self, $uids, $range_info, $q))) {
-                $err ||= 'OK Search done';
-                $self->write("\r\n$tag $err\r\n");
-                return;
-        }
-        msn_convert($self, $uids) if $want_msn;
-        $self->msg_more(join(' ', '', @$uids));
-        1; # more
-}
-
 sub search_common {
         my ($self, $tag, $query, $want_msn) = @_;
         my $ibx = $self->{ibx} or return "$tag BAD No mailbox selected\r\n";
-        my $q = parse_query($self, $query);
+        my $q = parse_imap_query($self, $query);
         return "$tag $q\r\n" if !ref($q);
         my ($sql, $range_info) = delete @$q{qw(sql range_info)};
         if (!scalar(keys %$q)) { # overview.sqlite3
@@ -1160,11 +1133,17 @@ sub search_common {
                 long_response($self, \&search_uid_range,
                                 $tag, $sql, $range_info, $want_msn);
         } elsif ($q = $q->{xap}) {
-                $self->{ibx}->search or
+                my $srch = $self->{ibx}->isrch or
                         return "$tag BAD search not available for mailbox\r\n";
-                $self->msg_more('* SEARCH');
-                long_response($self, \&search_xap_range,
-                                $tag, $q, $range_info, $want_msn);
+                my $opt = {
+                        relevance => -1,
+                        limit => UID_SLICE,
+                        uid_range => $range_info
+                };
+                my $mset = $srch->mset($q, $opt);
+                my $uids = $srch->mset_to_artnums($mset, $opt);
+                msn_convert($self, $uids) if scalar(@$uids) && $want_msn;
+                "* SEARCH @$uids\r\n$tag OK Search done\r\n";
         } else {
                 "$tag BAD Error\r\n";
         }
diff --git a/lib/PublicInbox/IMAPD.pm b/lib/PublicInbox/IMAPD.pm
index 3c211ee1..7425409d 100644
--- a/lib/PublicInbox/IMAPD.pm
+++ b/lib/PublicInbox/IMAPD.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # represents an IMAPD (currently a singleton),
@@ -19,33 +19,34 @@ sub new {
                 err => \*STDERR,
                 out => \*STDOUT,
                 # accept_tls => { SSL_server => 1, ..., SSL_reuse_ctx => ... }
-                # pi_config => PublicInbox::Config
+                # pi_cfg => PublicInbox::Config
                 # idler => PublicInbox::InboxIdle
         }, $class;
 }
 
-sub imapd_refresh_ibx { # pi_config->each_inbox cb
+sub imapd_refresh_ibx { # pi_cfg->each_inbox cb
         my ($ibx, $imapd) = @_;
         my $ngname = $ibx->{newsgroup} or return;
-        if (ref $ngname) {
-                warn 'multiple newsgroups not supported: '.
-                        join(', ', @$ngname). "\n";
-                return;
-        } elsif ($ngname =~ m![^a-z0-9/_\.\-\~\@\+\=:]! ||
-                 $ngname =~ /\.[0-9]+\z/) {
+
+        # We require lower-case since IMAP mailbox names are
+        # case-insensitive (but -nntpd matches INN in being
+        # case-sensitive
+        if ($ngname =~ m![^a-z0-9/_\.\-\~\@\+\=:]! ||
+                        # don't confuse with 50K slices
+                        $ngname =~ /\.[0-9]+\z/) {
                 warn "mailbox name invalid: newsgroup=`$ngname'\n";
                 return;
         }
         $ibx->over or return;
         $ibx->{over} = undef;
-        my $mm = $ibx->mm or return;
-        $ibx->{mm} = undef;
 
         # RFC 3501 2.3.1.1 -  "A good UIDVALIDITY value to use in
         # this case is a 32-bit representation of the creation
         # date/time of the mailbox"
-        defined($ibx->{uidvalidity} = $mm->created_at) or return;
-        PublicInbox::IMAP::ensure_slices_exist($imapd, $ibx, $mm->max // 0);
+        eval { $ibx->uidvalidity };
+        my $mm = delete($ibx->{mm}) or return;
+        defined($ibx->{uidvalidity}) or return;
+        PublicInbox::IMAP::ensure_slices_exist($imapd, $ibx, $mm->max);
 
         # preload to avoid fragmentation:
         $ibx->description;
@@ -59,7 +60,7 @@ sub imapd_refresh_ibx { # pi_config->each_inbox cb
 }
 
 sub imapd_refresh_finalize {
-        my ($imapd, $pi_config) = @_;
+        my ($imapd, $pi_cfg) = @_;
         my $mailboxes;
         if (my $next = delete $imapd->{imapd_next}) {
                 $imapd->{mailboxes} = delete $next->{mailboxes};
@@ -77,40 +78,40 @@ sub imapd_refresh_finalize {
                         qq[* LIST (\\Has${no}Children) "." $u\r\n]
                 } keys %$mailboxes
         ];
-        $imapd->{pi_config} = $pi_config;
+        $imapd->{pi_cfg} = $pi_cfg;
         if (my $idler = $imapd->{idler}) {
-                $idler->refresh($pi_config);
+                $idler->refresh($pi_cfg);
         }
 }
 
-sub imapd_refresh_step { # pi_config->iterate_start cb
-        my ($pi_config, $section, $imapd) = @_;
+sub imapd_refresh_step { # pi_cfg->iterate_start cb
+        my ($pi_cfg, $section, $imapd) = @_;
         if (defined($section)) {
                 return if $section !~ m!\Apublicinbox\.([^/]+)\z!;
-                my $ibx = $pi_config->lookup_name($1) or return;
+                my $ibx = $pi_cfg->lookup_name($1) or return;
                 imapd_refresh_ibx($ibx, $imapd->{imapd_next});
         } else { # undef == "EOF"
-                imapd_refresh_finalize($imapd, $pi_config);
+                imapd_refresh_finalize($imapd, $pi_cfg);
         }
 }
 
 sub refresh_groups {
         my ($self, $sig) = @_;
-        my $pi_config = PublicInbox::Config->new;
+        my $pi_cfg = PublicInbox::Config->new;
         if ($sig) { # SIGHUP is handled through the event loop
                 $self->{imapd_next} = { dummies => {}, mailboxes => {} };
-                my $iter = PublicInbox::ConfigIter->new($pi_config,
+                my $iter = PublicInbox::ConfigIter->new($pi_cfg,
                                                 \&imapd_refresh_step, $self);
                 $iter->event_step;
         } else { # initial start is synchronous
                 $self->{dummies} = {};
-                $pi_config->each_inbox(\&imapd_refresh_ibx, $self);
-                imapd_refresh_finalize($self, $pi_config);
+                $pi_cfg->each_inbox(\&imapd_refresh_ibx, $self);
+                imapd_refresh_finalize($self, $pi_cfg);
         }
 }
 
 sub idler_start {
-        $_[0]->{idler} //= PublicInbox::InboxIdle->new($_[0]->{pi_config});
+        $_[0]->{idler} //= PublicInbox::InboxIdle->new($_[0]->{pi_cfg});
 }
 
 1;
diff --git a/lib/PublicInbox/IMAPTracker.pm b/lib/PublicInbox/IMAPTracker.pm
index be9caf76..6d4fb227 100644
--- a/lib/PublicInbox/IMAPTracker.pm
+++ b/lib/PublicInbox/IMAPTracker.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::IMAPTracker;
 use strict;
diff --git a/lib/PublicInbox/IMAPdeflate.pm b/lib/PublicInbox/IMAPdeflate.pm
index b98a069d..d5929ef2 100644
--- a/lib/PublicInbox/IMAPdeflate.pm
+++ b/lib/PublicInbox/IMAPdeflate.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # TODO: reduce duplication from PublicInbox::NNTPdeflate
 
diff --git a/lib/PublicInbox/IMAPsearchqp.pm b/lib/PublicInbox/IMAPsearchqp.pm
index 190fefb9..2fb92bb8 100644
--- a/lib/PublicInbox/IMAPsearchqp.pm
+++ b/lib/PublicInbox/IMAPsearchqp.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # IMAP search query parser.  cf RFC 3501
 
@@ -124,7 +124,7 @@ sub ON {
         my ($self, $item) = @_;
         my $ts = yyyymmdd($item);
         my $end = $ts + 86399; # no leap day
-        push @{$self->{xap}}, "ts:$ts..$end";
+        push @{$self->{xap}}, "rt:$ts..$end";
         my $sql = $self->{sql} or return 1;
         $$sql .= " AND ts >= $ts AND ts <= $end";
 }
@@ -132,7 +132,7 @@ sub ON {
 sub BEFORE {
         my ($self, $item) = @_;
         my $ts = yyyymmdd($item);
-        push @{$self->{xap}}, "ts:..$ts";
+        push @{$self->{xap}}, "rt:..$ts";
         my $sql = $self->{sql} or return 1;
         $$sql .= " AND ts <= $ts";
 }
@@ -140,7 +140,7 @@ sub BEFORE {
 sub SINCE {
         my ($self, $item) = @_;
         my $ts = yyyymmdd($item);
-        push @{$self->{xap}}, "ts:$ts..";
+        push @{$self->{xap}}, "rt:$ts..";
         my $sql = $self->{sql} or return 1;
         $$sql .= " AND ts >= $ts";
 }
diff --git a/lib/PublicInbox/IPC.pm b/lib/PublicInbox/IPC.pm
new file mode 100644
index 00000000..c52441f7
--- /dev/null
+++ b/lib/PublicInbox/IPC.pm
@@ -0,0 +1,447 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# base class for remote IPC calls and workqueues, requires Storable or Sereal
+package PublicInbox::IPC;
+use strict;
+use v5.10.1;
+use Carp qw(confess croak);
+use PublicInbox::DS qw(dwaitpid);
+use PublicInbox::Spawn;
+use POSIX qw(mkfifo WNOHANG);
+use Socket qw(AF_UNIX MSG_EOR SOCK_STREAM);
+use Errno qw(EMSGSIZE);
+use File::Temp 0.19 (); # 0.19 for ->newdir
+my $SEQPACKET = eval { Socket::SOCK_SEQPACKET() }; # portable enough?
+use constant PIPE_BUF => $^O eq 'linux' ? 4096 : POSIX::_POSIX_PIPE_BUF();
+my $WQ_MAX_WORKERS = 4096;
+my ($enc, $dec);
+# ->imports at BEGIN turns sereal_*_with_object into custom ops on 5.14+
+# and eliminate method call overhead
+BEGIN {
+        eval {
+                require Sereal::Encoder;
+                require Sereal::Decoder;
+                Sereal::Encoder->import('sereal_encode_with_object');
+                Sereal::Decoder->import('sereal_decode_with_object');
+                ($enc, $dec) = (Sereal::Encoder->new, Sereal::Decoder->new);
+        };
+};
+
+if ($enc && $dec) { # should be custom ops
+        *freeze = sub ($) { sereal_encode_with_object $enc, $_[0] };
+        *thaw = sub ($) { sereal_decode_with_object $dec, $_[0], my $ret };
+} else {
+        eval { # some distros have Storable as a separate package from Perl
+                require Storable;
+                Storable->import(qw(freeze thaw));
+                $enc = 1;
+        } // warn("Storable (part of Perl) missing: $@\n");
+}
+
+my $recv_cmd = PublicInbox::Spawn->can('recv_cmd4');
+my $send_cmd = PublicInbox::Spawn->can('send_cmd4') // do {
+        require PublicInbox::CmdIPC4;
+        $recv_cmd //= PublicInbox::CmdIPC4->can('recv_cmd4');
+        PublicInbox::CmdIPC4->can('send_cmd4');
+};
+
+sub _get_rec ($) {
+        my ($r) = @_;
+        defined(my $len = <$r>) or return;
+        chop($len) eq "\n" or croak "no LF byte in $len";
+        defined(my $n = read($r, my $buf, $len)) or croak "read error: $!";
+        $n == $len or croak "short read: $n != $len";
+        thaw($buf);
+}
+
+sub _pack_rec ($) {
+        my ($ref) = @_;
+        my $buf = freeze($ref);
+        length($buf) . "\n" . $buf;
+}
+
+sub _send_rec ($$) {
+        my ($w, $ref) = @_;
+        print $w _pack_rec($ref) or croak "print: $!";
+}
+
+sub ipc_return ($$$) {
+        my ($w, $ret, $exc) = @_;
+        _send_rec($w, $exc ? bless(\$exc, 'PublicInbox::IPC::Die') : $ret);
+}
+
+sub ipc_worker_loop ($$$) {
+        my ($self, $r_req, $w_res) = @_;
+        my ($rec, $wantarray, $sub, @args);
+        local $/ = "\n";
+        while ($rec = _get_rec($r_req)) {
+                ($wantarray, $sub, @args) = @$rec;
+                # no waiting if client doesn't care,
+                # this is the overwhelmingly likely case
+                if (!defined($wantarray)) {
+                        eval { $self->$sub(@args) };
+                        warn "$$ die: $@ (from nowait $sub)\n" if $@;
+                } elsif ($wantarray) {
+                        my @ret = eval { $self->$sub(@args) };
+                        ipc_return($w_res, \@ret, $@);
+                } else { # '' => wantscalar
+                        my $ret = eval { $self->$sub(@args) };
+                        ipc_return($w_res, \$ret, $@);
+                }
+        }
+}
+
+# starts a worker if Sereal or Storable is installed
+sub ipc_worker_spawn {
+        my ($self, $ident, $oldset) = @_;
+        return unless $enc; # no Sereal or Storable
+        return if ($self->{-ipc_ppid} // -1) == $$; # idempotent
+        delete(@$self{qw(-ipc_req -ipc_res -ipc_ppid -ipc_pid)});
+        pipe(my ($r_req, $w_req)) or die "pipe: $!";
+        pipe(my ($r_res, $w_res)) or die "pipe: $!";
+        my $sigset = $oldset // PublicInbox::DS::block_signals();
+        $self->ipc_atfork_prepare;
+        my $seed = rand(0xffffffff);
+        my $pid = fork // die "fork: $!";
+        if ($pid == 0) {
+                srand($seed);
+                eval { PublicInbox::DS->Reset };
+                delete @$self{qw(-wq_s1 -wq_workers -wq_ppid)};
+                $w_req = $r_res = undef;
+                $w_res->autoflush(1);
+                $SIG{$_} = 'IGNORE' for (qw(TERM INT QUIT));
+                local $0 = $ident;
+                PublicInbox::DS::sig_setmask($sigset);
+                my $on_destroy = $self->ipc_atfork_child;
+                eval { ipc_worker_loop($self, $r_req, $w_res) };
+                die "worker $ident PID:$$ died: $@\n" if $@;
+                exit;
+        }
+        PublicInbox::DS::sig_setmask($sigset) unless $oldset;
+        $r_req = $w_res = undef;
+        $w_req->autoflush(1);
+        $self->{-ipc_req} = $w_req;
+        $self->{-ipc_res} = $r_res;
+        $self->{-ipc_ppid} = $$;
+        $self->{-ipc_pid} = $pid;
+}
+
+sub ipc_worker_reap { # dwaitpid callback
+        my ($self, $pid) = @_;
+        # SIGTERM (15) is our default exit signal
+        warn "PID:$pid died with \$?=$?\n" if $? && ($? & 127) != 15;
+}
+
+sub wq_wait_old {
+        my ($self) = @_;
+        my $pids = delete $self->{"-wq_old_pids.$$"} or return;
+        dwaitpid($_, \&ipc_worker_reap, $self) for @$pids;
+}
+
+# for base class, override in sub classes
+sub ipc_atfork_prepare {}
+
+sub ipc_atfork_child {
+        my ($self) = @_;
+        my $io = delete($self->{-ipc_atfork_child_close}) or return;
+        close($_) for @$io;
+        undef;
+}
+
+# idempotent, can be called regardless of whether worker is active or not
+sub ipc_worker_stop {
+        my ($self) = @_;
+        my ($pid, $ppid) = delete(@$self{qw(-ipc_pid -ipc_ppid)});
+        my ($w_req, $r_res) = delete(@$self{qw(-ipc_req -ipc_res)});
+        if (!$w_req && !$r_res) {
+                die "unexpected PID:$pid without IPC pipes" if $pid;
+                return; # idempotent
+        }
+        die 'no PID with IPC pipes' unless $pid;
+        $w_req = $r_res = undef;
+
+        return if $$ != $ppid;
+        dwaitpid($pid, \&ipc_worker_reap, $self);
+}
+
+# use this if we have multiple readers reading curl or "pigz -dc"
+# and writing to the same store
+sub ipc_lock_init {
+        my ($self, $f) = @_;
+        require PublicInbox::Lock;
+        $self->{-ipc_lock} //= bless { lock_path => $f }, 'PublicInbox::Lock'
+}
+
+sub ipc_async_wait ($$) {
+        my ($self, $max) = @_; # max == -1 to wait for all
+        my $aif = $self->{-async_inflight} or return;
+        my $r_res = $self->{-ipc_res} or die 'BUG: no ipc_res';
+        while (my ($sub, $bytes, $cb, $cb_arg) = splice(@$aif, 0, 4)) {
+                my $ret = _get_rec($r_res) //
+                        die "no response on $sub (req.size=$bytes)";
+                $self->{-async_inflight_bytes} -= $bytes;
+
+                eval { $cb->($cb_arg, $ret) };
+                warn "E: $sub callback error: $@\n" if $@;
+                return if --$max == 0;
+        }
+}
+
+# call $self->$sub(@args), on a worker if ipc_worker_spawn was used
+sub ipc_do {
+        my ($self, $sub, @args) = @_;
+        if (my $w_req = $self->{-ipc_req}) { # run in worker
+                my $ipc_lock = $self->{-ipc_lock};
+                my $lock = $ipc_lock ? $ipc_lock->lock_for_scope : undef;
+                if (defined(wantarray)) {
+                        my $r_res = $self->{-ipc_res} or die 'BUG: no ipc_res';
+                        ipc_async_wait($self, -1);
+                        _send_rec($w_req, [ wantarray, $sub, @args ]);
+                        my $ret = _get_rec($r_res) // die "no response on $sub";
+                        die $$ret if ref($ret) eq 'PublicInbox::IPC::Die';
+                        wantarray ? @$ret : $$ret;
+                } else { # likely, fire-and-forget into pipe
+                        _send_rec($w_req, [ undef , $sub, @args ]);
+                }
+        } else { # run locally
+                $self->$sub(@args);
+        }
+}
+
+sub ipc_async {
+        my ($self, $sub, $sub_args, $cb, $cb_arg) = @_;
+        if (my $w_req = $self->{-ipc_req}) { # run in worker
+                my $rec = _pack_rec([ 1, $sub, @$sub_args ]);
+                my $cur_bytes = \($self->{-async_inflight_bytes} //= 0);
+                while (($$cur_bytes + length($rec)) > PIPE_BUF) {
+                        ipc_async_wait($self, 1);
+                }
+                my $ipc_lock = $self->{-ipc_lock};
+                my $lock = $ipc_lock ? $ipc_lock->lock_for_scope : undef;
+                print $w_req $rec or croak "print: $!";
+                $$cur_bytes += length($rec);
+                push @{$self->{-async_inflight}},
+                                $sub, length($rec), $cb, $cb_arg;
+        } else {
+                my $ret = [ eval { $self->$sub(@$sub_args) } ];
+                if (my $exc = $@) {
+                        $ret = ( bless(\$exc, 'PublicInbox::IPC::Die') );
+                }
+                eval { $cb->($cb_arg, $ret) };
+                warn "E: $sub callback error: $@\n" if $@;
+        }
+}
+
+# needed when there's multiple IPC workers and the parent forking
+# causes newer siblings to inherit older siblings sockets
+sub ipc_sibling_atfork_child {
+        my ($self) = @_;
+        my ($pid, undef) = delete(@$self{qw(-ipc_pid -ipc_ppid)});
+        delete(@$self{qw(-ipc_req -ipc_res)});
+        $pid == $$ and die "BUG: $$ ipc_atfork_child called on itself";
+}
+
+sub _recv_and_run {
+        my ($self, $s2, $len, $full_stream) = @_;
+        my @fds = $recv_cmd->($s2, my $buf, $len);
+        my $n = length($buf // '') or return;
+        my $nfd = 0;
+        for my $fd (@fds) {
+                if (open(my $cmdfh, '+<&=', $fd)) {
+                        $self->{$nfd++} = $cmdfh;
+                        $cmdfh->autoflush(1);
+                } else {
+                        die "$$ open(+<&=$fd) (FD:$nfd): $!";
+                }
+        }
+        while ($full_stream && $n < $len) {
+                my $r = sysread($s2, $buf, $len - $n, $n) // croak "read: $!";
+                croak "read EOF after $n/$len bytes" if $r == 0;
+                $n = length($buf);
+        }
+        # Sereal dies on truncated data, Storable returns undef
+        my $args = thaw($buf) // die "thaw error on buffer of size: $n";
+        undef $buf;
+        my $sub = shift @$args;
+        eval { $self->$sub(@$args) };
+        warn "$$ wq_worker: $@" if $@ && ref($@) ne 'PublicInbox::SIGPIPE';
+        delete @$self{0..($nfd-1)};
+        $n;
+}
+
+sub wq_worker_loop ($) {
+        my ($self) = @_;
+        my $len = $self->{wq_req_len} // (4096 * 33);
+        my $s2 = $self->{-wq_s2} // die 'BUG: no -wq_s2';
+        1 while (_recv_and_run($self, $s2, $len));
+}
+
+sub do_sock_stream { # via wq_do, for big requests
+        my ($self, $len) = @_;
+        _recv_and_run($self, delete $self->{0}, $len, 1);
+}
+
+sub wq_do { # always async
+        my ($self, $sub, $ios, @args) = @_;
+        if (my $s1 = $self->{-wq_s1}) { # run in worker
+                my $fds = [ map { fileno($_) } @$ios ];
+                my $n = $send_cmd->($s1, $fds, freeze([$sub, @args]), MSG_EOR);
+                return if defined($n);
+                croak "sendmsg error: $!" if $! != EMSGSIZE;
+                socketpair(my $r, my $w, AF_UNIX, SOCK_STREAM, 0) or
+                        croak "socketpair: $!";
+                my $buf = freeze([$sub, @args]);
+                $n = $send_cmd->($s1, [ fileno($r) ],
+                                freeze(['do_sock_stream', length($buf)]),
+                                MSG_EOR) // croak "sendmsg: $!";
+                undef $r;
+                $n = $send_cmd->($w, $fds, $buf, 0) // croak "sendmsg: $!";
+                while ($n < length($buf)) {
+                        my $x = syswrite($w, $buf, length($buf) - $n, $n) //
+                                        croak "syswrite: $!";
+                        croak "syswrite wrote 0 bytes" if $x == 0;
+                        $n += $x;
+                }
+        } else {
+                @$self{0..$#$ios} = @$ios;
+                eval { $self->$sub(@args) };
+                warn "wq_do: $@" if $@ && ref($@) ne 'PublicInbox::SIGPIPE';
+                delete @$self{0..$#$ios}; # don't close
+        }
+}
+
+sub _wq_worker_start ($$) {
+        my ($self, $oldset) = @_;
+        my $seed = rand(0xffffffff);
+        my $pid = fork // die "fork: $!";
+        if ($pid == 0) {
+                srand($seed);
+                eval { PublicInbox::DS->Reset };
+                delete @$self{qw(-wq_s1 -wq_workers -wq_ppid)};
+                $SIG{$_} = 'IGNORE' for (qw(PIPE TTOU TTIN));
+                $SIG{$_} = 'DEFAULT' for (qw(TERM QUIT INT CHLD));
+                local $0 = $self->{-wq_ident};
+                PublicInbox::DS::sig_setmask($oldset);
+                # ensure we properly exit even if warn() dies:
+                my $end = PublicInbox::OnDestroy->new($$, sub { exit(!!$@) });
+                my $on_destroy = $self->ipc_atfork_child;
+                eval { wq_worker_loop($self) };
+                warn "worker $self->{-wq_ident} PID:$$ died: $@" if $@;
+                undef $on_destroy;
+                undef $end; # trigger exit
+        } else {
+                $self->{-wq_workers}->{$pid} = \undef;
+        }
+}
+
+# starts workqueue workers if Sereal or Storable is installed
+sub wq_workers_start {
+        my ($self, $ident, $nr_workers, $oldset) = @_;
+        ($enc && $send_cmd && $recv_cmd && defined($SEQPACKET)) or return;
+        return if $self->{-wq_s1}; # idempotent
+        $self->{-wq_s1} = $self->{-wq_s2} = undef;
+        socketpair($self->{-wq_s1}, $self->{-wq_s2}, AF_UNIX, $SEQPACKET, 0) or
+                die "socketpair: $!";
+        $self->ipc_atfork_prepare;
+        $nr_workers //= 4;
+        $nr_workers = $WQ_MAX_WORKERS if $nr_workers > $WQ_MAX_WORKERS;
+        my $sigset = $oldset // PublicInbox::DS::block_signals();
+        $self->{-wq_workers} = {};
+        $self->{-wq_ident} = $ident;
+        _wq_worker_start($self, $sigset) for (1..$nr_workers);
+        PublicInbox::DS::sig_setmask($sigset) unless $oldset;
+        $self->{-wq_ppid} = $$;
+}
+
+sub wq_worker_incr { # SIGTTIN handler
+        my ($self, $oldset) = @_;
+        $self->{-wq_s2} or return;
+        return if wq_workers($self) >= $WQ_MAX_WORKERS;
+        $self->ipc_atfork_prepare;
+        my $sigset = $oldset // PublicInbox::DS::block_signals();
+        _wq_worker_start($self, $sigset);
+        PublicInbox::DS::sig_setmask($sigset) unless $oldset;
+}
+
+sub wq_exit { # wakes up wq_worker_decr_wait
+        send($_[0]->{-wq_s2}, $$, MSG_EOR) // die "$$ send: $!";
+        exit;
+}
+
+sub wq_worker_decr { # SIGTTOU handler, kills first idle worker
+        my ($self) = @_;
+        return unless wq_workers($self);
+        my $s2 = $self->{-wq_s2} // die 'BUG: no wq_s2';
+        $self->wq_do('wq_exit', [ $s2, $s2, $s2 ]);
+        # caller must call wq_worker_decr_wait in main loop
+}
+
+sub wq_worker_decr_wait {
+        my ($self, $timeout) = @_;
+        return if $self->{-wq_ppid} != $$; # can't reap siblings or parents
+        my $s1 = $self->{-wq_s1} // croak 'BUG: no wq_s1';
+        vec(my $rin = '', fileno($s1), 1) = 1;
+        select(my $rout = $rin, undef, undef, $timeout) or
+                croak 'timed out waiting for wq_exit';
+        recv($s1, my $pid, 64, 0) // croak "recv: $!";
+        my $workers = $self->{-wq_workers} // croak 'BUG: no wq_workers';
+        delete $workers->{$pid} // croak "BUG: PID:$pid invalid";
+        dwaitpid($pid, \&ipc_worker_reap, $self);
+}
+
+# set or retrieve number of workers
+sub wq_workers {
+        my ($self, $nr) = @_;
+        my $cur = $self->{-wq_workers} or return;
+        if (defined $nr) {
+                while (scalar(keys(%$cur)) > $nr) {
+                        $self->wq_worker_decr;
+                        $self->wq_worker_decr_wait;
+                }
+                $self->wq_worker_incr while scalar(keys(%$cur)) < $nr;
+        }
+        scalar(keys(%$cur));
+}
+
+sub wq_close {
+        my ($self, $nohang) = @_;
+        delete @$self{qw(-wq_s1 -wq_s2)} or return;
+        my $ppid = delete $self->{-wq_ppid} or return;
+        my $workers = delete $self->{-wq_workers} // die 'BUG: no wq_workers';
+        return if $ppid != $$; # can't reap siblings or parents
+        my @pids = map { $_ + 0 } keys %$workers;
+        if ($nohang) {
+                push @{$self->{"-wq_old_pids.$$"}}, @pids;
+        } else {
+                dwaitpid($_, \&ipc_worker_reap, $self) for @pids;
+        }
+}
+
+sub wq_kill_old {
+        my ($self) = @_;
+        my $pids = $self->{"-wq_old_pids.$$"} or return;
+        kill 'TERM', @$pids;
+}
+
+sub wq_kill {
+        my ($self, $sig) = @_;
+        my $workers = $self->{-wq_workers} or return;
+        kill($sig // 'TERM', keys %$workers);
+}
+
+sub WQ_MAX_WORKERS { $WQ_MAX_WORKERS }
+
+sub DESTROY {
+        my ($self) = @_;
+        my $ppid = $self->{-wq_ppid};
+        wq_kill($self) if $ppid && $ppid == $$;
+        wq_close($self);
+        wq_wait_old($self);
+        ipc_worker_stop($self);
+}
+
+# Sereal doesn't have dclone
+sub deep_clone { thaw(freeze($_[-1])) }
+
+1;
diff --git a/lib/PublicInbox/IdxStack.pm b/lib/PublicInbox/IdxStack.pm
index ce75b46a..d5123006 100644
--- a/lib/PublicInbox/IdxStack.pm
+++ b/lib/PublicInbox/IdxStack.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # temporary stack for public-inbox-index
@@ -6,19 +6,27 @@ package PublicInbox::IdxStack;
 use v5.10.1;
 use strict;
 use Fcntl qw(:seek);
-use constant FMT => eval { pack('Q', 1) } ? 'A1QQH*' : 'A1IIH*';
+use constant PACK_FMT => eval { pack('Q', 1) } ? 'A1QQH*H*' : 'A1IIH*H*';
 
 # start off in write-only mode
 sub new {
         open(my $io, '+>', undef) or die "open: $!";
+        # latest_cmt is still useful when the newest revision is a `d'(elete),
+        # otherwise we favor $sync->{latest_cmt} for checkpoints and {quit}
         bless { wr => $io, latest_cmt => $_[1] }, __PACKAGE__
 }
 
 # file_char = [d|m]
 sub push_rec {
-        my ($self, $file_char, $at, $ct, $blob_oid) = @_;
-        my $rec = pack(FMT, $file_char, $at, $ct, $blob_oid);
-        $self->{rec_size} //= length($rec);
+        my ($self, $file_char, $at, $ct, $blob_oid, $cmt_oid) = @_;
+        my $rec = pack(PACK_FMT, $file_char, $at, $ct, $blob_oid, $cmt_oid);
+        $self->{unpack_fmt} //= do {
+                my $len = length($cmt_oid);
+                my $fmt = PACK_FMT;
+                $fmt =~ s/H\*/H$len/g;
+                $self->{rec_size} = length($rec);
+                $fmt;
+        };
         print { $self->{wr} } $rec or die "print: $!";
         $self->{tot_size} += length($rec);
 }
@@ -46,7 +54,7 @@ sub pop_rec {
         my $r = read($io, my $buf, $sz);
         defined($r) or die "read: $!";
         $r == $sz or die "read($r != $sz)";
-        unpack(FMT, $buf);
+        unpack($self->{unpack_fmt}, $buf);
 }
 
 1;
diff --git a/lib/PublicInbox/Import.pm b/lib/PublicInbox/Import.pm
index 2cb4896a..8a06a661 100644
--- a/lib/PublicInbox/Import.pm
+++ b/lib/PublicInbox/Import.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # git fast-import-based ssoma-mda MDA replacement
@@ -9,7 +9,7 @@ package PublicInbox::Import;
 use strict;
 use parent qw(PublicInbox::Lock);
 use v5.10.1;
-use PublicInbox::Spawn qw(spawn popen_rd);
+use PublicInbox::Spawn qw(run_die popen_rd);
 use PublicInbox::MID qw(mids mid2path);
 use PublicInbox::Address;
 use PublicInbox::Smsg;
@@ -19,13 +19,22 @@ use PublicInbox::MDA;
 use PublicInbox::Eml;
 use POSIX qw(strftime);
 
+sub default_branch () {
+        state $default_branch = do {
+                delete local $ENV{GIT_CONFIG};
+                my $r = popen_rd([qw(git config --global init.defaultBranch)]);
+                chomp(my $h = <$r> // '');
+                $h eq '' ? 'refs/heads/master' : $h;
+        }
+}
+
 sub new {
         # we can't change arg order, this is documented in POD
         # and external projects may rely on it:
         my ($class, $git, $name, $email, $ibx) = @_;
-        my $ref = 'refs/heads/master';
+        my $ref;
         if ($ibx) {
-                $ref = $ibx->{ref_head} // 'refs/heads/master';
+                $ref = $ibx->{ref_head};
                 $name //= $ibx->{name};
                 $email //= $ibx->{-primary_address};
                 $git //= $ibx->git;
@@ -34,7 +43,7 @@ sub new {
                 git => $git,
                 ident => "$name <$email>",
                 mark => 1,
-                ref => $ref,
+                ref => $ref // default_branch,
                 ibx => $ibx,
                 path_type => '2/38', # or 'v2'
                 lock_path => "$git->{git_dir}/ssoma.lock", # v2 changes this
@@ -46,9 +55,9 @@ sub new {
 sub gfi_start {
         my ($self) = @_;
 
-        return ($self->{in}, $self->{out}) if $self->{pid};
+        return ($self->{in}, $self->{out}) if $self->{in};
 
-        my (@ret, $out_r, $out_w);
+        my ($in_r, $out_r, $out_w);
         pipe($out_r, $out_w) or die "pipe failed: $!";
 
         $self->lock_acquire;
@@ -56,27 +65,26 @@ sub gfi_start {
                 my ($git, $ref) = @$self{qw(git ref)};
                 local $/ = "\n";
                 chomp($self->{tip} = $git->qx(qw(rev-parse --revs-only), $ref));
+                die "fatal: rev-parse --revs-only $ref: \$?=$?" if $?;
                 if ($self->{path_type} ne '2/38' && $self->{tip}) {
                         local $/ = "\0";
                         my @t = $git->qx(qw(ls-tree -r -z --name-only), $ref);
+                        die "fatal: ls-tree -r -z --name-only $ref: \$?=$?" if $?;
                         chomp @t;
                         $self->{-tree} = { map { $_ => 1 } @t };
                 }
-                my @cmd = ('git', "--git-dir=$git->{git_dir}",
-                        qw(fast-import --quiet --done --date-format=raw));
-                my ($in_r, $pid) = popen_rd(\@cmd, undef, { 0 => $out_r });
+                $in_r = $self->{in} = $git->popen(qw(fast-import
+                                        --quiet --done --date-format=raw),
+                                        undef, { 0 => $out_r });
                 $out_w->autoflush(1);
-                $self->{in} = $in_r;
                 $self->{out} = $out_w;
-                $self->{pid} = $pid;
                 $self->{nchg} = 0;
-                @ret = ($in_r, $out_w);
         };
         if ($@) {
                 $self->lock_release;
                 die $@;
         }
-        @ret;
+        ($in_r, $out_w);
 }
 
 sub wfail () { die "write to fast-import failed: $!" }
@@ -153,14 +161,14 @@ sub check_remove_v1 {
 
 sub checkpoint {
         my ($self) = @_;
-        return unless $self->{pid};
+        return unless $self->{in};
         print { $self->{out} } "checkpoint\n" or wfail;
         undef;
 }
 
 sub progress {
         my ($self, $msg) = @_;
-        return unless $self->{pid};
+        return unless $self->{in};
         print { $self->{out} } "progress $msg\n" or wfail;
         readline($self->{in}) eq "progress $msg\n" or die
                 "progress $msg not received\n";
@@ -209,7 +217,7 @@ sub barrier {
 # used for v2
 sub get_mark {
         my ($self, $mark) = @_;
-        die "not active\n" unless $self->{pid};
+        die "not active\n" unless $self->{in};
         my ($r, $w) = $self->gfi_start;
         print $w "get-mark $mark\n" or wfail;
         defined(my $oid = <$r>) or die "get-mark failed, need git 2.6.0+\n";
@@ -404,8 +412,10 @@ sub add {
         # v2: we need this for Xapian
         if ($smsg) {
                 $smsg->{blob} = $self->get_mark(":$blob");
-                $smsg->{raw_bytes} = $n;
-                $smsg->{-raw_email} = \$raw_email;
+                $smsg->set_bytes($raw_email, $n);
+                if (my $oidx = delete $smsg->{-oidx}) { # used by LeiStore
+                        return if $oidx->blob_exists($smsg->{blob});
+                }
         }
         my $ref = $self->{ref};
         my $commit = $self->{mark}++;
@@ -429,14 +439,7 @@ sub add {
         $self->{tip} = ":$commit";
 }
 
-sub run_die ($;$$) {
-        my ($cmd, $env, $rdr) = @_;
-        my $pid = spawn($cmd, $env, $rdr);
-        waitpid($pid, 0) == $pid or die join(' ', @$cmd) .' did not finish';
-        $? == 0 or die join(' ', @$cmd) . " failed: $?\n";
-}
-
-my @INIT_FILES = ('HEAD' => "ref: refs/heads/master\n",
+my @INIT_FILES = ('HEAD' => undef, # filled in at runtime
                 'description' => <<EOD,
 Unnamed repository; edit this file 'description' to name the repository.
 EOD
@@ -450,15 +453,18 @@ EOD
 EOC
 
 sub init_bare {
-        my ($dir) = @_; # or self
+        my ($dir, $head) = @_; # or self
         $dir = $dir->{git}->{git_dir} if ref($dir);
         require File::Path;
         File::Path::mkpath([ map { "$dir/$_" } qw(objects/info refs/heads) ]);
-        for (my $i = 0; $i < @INIT_FILES; $i++) {
-                my $f = $dir.'/'.$INIT_FILES[$i++];
+        $INIT_FILES[1] //= 'ref: '.default_branch."\n";
+        my @fn_contents = @INIT_FILES;
+        $fn_contents[1] = "ref: refs/heads/$head\n" if defined $head;
+        while (my ($fn, $contents) = splice(@fn_contents, 0, 2)) {
+                my $f = $dir.'/'.$fn;
                 next if -f $f;
                 open my $fh, '>', $f or die "open $f: $!";
-                print $fh $INIT_FILES[$i] or die "print $f: $!";
+                print $fh $contents or die "print $f: $!";
                 close $fh or die "close $f: $!";
         }
 }
@@ -472,10 +478,7 @@ sub done {
         eval {
                 my $r = delete $self->{in} or die 'BUG: missing {in} when done';
                 print $w "done\n" or wfail;
-                my $pid = delete $self->{pid} or
-                                die 'BUG: missing {pid} when done';
-                waitpid($pid, 0) == $pid or die 'fast-import did not finish';
-                $? == 0 or die "fast-import failed: $?";
+                close $r or die "fast-import failed: $?"; # ProcessPipe::CLOSE
         };
         my $wait_err = $@;
         my $nchg = delete $self->{nchg};
diff --git a/lib/PublicInbox/In2Tie.pm b/lib/PublicInbox/In2Tie.pm
index 7dee3627..ffe26a44 100644
--- a/lib/PublicInbox/In2Tie.pm
+++ b/lib/PublicInbox/In2Tie.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # used to ensure PublicInbox::DS can call fileno() as a function
diff --git a/lib/PublicInbox/Inbox.pm b/lib/PublicInbox/Inbox.pm
index e9efd29d..bee44f8a 100644
--- a/lib/PublicInbox/Inbox.pm
+++ b/lib/PublicInbox/Inbox.pm
@@ -1,13 +1,13 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Represents a public-inbox (which may have multiple mailing addresses)
 package PublicInbox::Inbox;
 use strict;
-use warnings;
 use PublicInbox::Git;
 use PublicInbox::MID qw(mid2path);
 use PublicInbox::Eml;
+use List::Util qw(max);
 
 # Long-running "git-cat-file --batch" processes won't notice
 # unlinked packs, so we need to restart those processes occasionally.
@@ -74,18 +74,8 @@ sub _cleanup_later ($) {
         $CLEANUP->{"$self"} = $self;
 }
 
-sub _set_uint ($$$) {
-        my ($opts, $field, $default) = @_;
-        my $val = $opts->{$field};
-        if (defined $val) {
-                $val = $val->[-1] if ref($val) eq 'ARRAY';
-                $val = undef if $val !~ /\A[0-9]+\z/;
-        }
-        $opts->{$field} = $val || $default;
-}
-
 sub _set_limiter ($$$) {
-        my ($self, $pi_config, $pfx) = @_;
+        my ($self, $pi_cfg, $pfx) = @_;
         my $lkey = "-${pfx}_limiter";
         $self->{$lkey} ||= do {
                 # full key is: publicinbox.$NAME.httpbackendmax
@@ -96,7 +86,7 @@ sub _set_limiter ($$$) {
                         require PublicInbox::Qspawn;
                         $lim = PublicInbox::Qspawn::Limiter->new($val);
                 } elsif ($val =~ /\A[a-z][a-z0-9]*\z/) {
-                        $lim = $pi_config->limiter($val);
+                        $lim = $pi_cfg->limiter($val);
                         warn "$mkey limiter=$val not found\n" if !$lim;
                 } else {
                         warn "$mkey limiter=$val not understood\n";
@@ -110,14 +100,15 @@ sub new {
         my $v = $opts->{address} ||= [ 'public-inbox@example.com' ];
         my $p = $opts->{-primary_address} = ref($v) eq 'ARRAY' ? $v->[0] : $v;
         $opts->{domain} = ($p =~ /\@(\S+)\z/) ? $1 : 'localhost';
-        my $pi_config = delete $opts->{-pi_config};
-        _set_limiter($opts, $pi_config, 'httpbackend');
-        _set_uint($opts, 'feedmax', 25);
-        $opts->{nntpserver} ||= $pi_config->{'publicinbox.nntpserver'};
-        my $dir = $opts->{inboxdir};
-        if (defined $dir && -f "$dir/inbox.lock") {
-                $opts->{version} = 2;
+        my $pi_cfg = delete $opts->{-pi_cfg};
+        _set_limiter($opts, $pi_cfg, 'httpbackend');
+        my $fmax = $opts->{feedmax};
+        if (defined($fmax) && $fmax =~ /\A[0-9]+\z/) {
+                $opts->{feedmax} += 0;
+        } else {
+                delete $opts->{feedmax};
         }
+        $opts->{nntpserver} ||= $pi_cfg->{'publicinbox.nntpserver'};
 
         # allow any combination of multi-line or comma-delimited hide entries
         my $hide = {};
@@ -130,16 +121,18 @@ sub new {
         bless $opts, $class;
 }
 
-sub version { $_[0]->{version} // 1 }
+sub version {
+        $_[0]->{version} //= -f "$_[0]->{inboxdir}/inbox.lock" ? 2 : 1
+}
 
 sub git_epoch {
-        my ($self, $epoch) = @_;
-        $self->version == 2 or return;
+        my ($self, $epoch) = @_; # v2-only, callers always supply $epoch
         $self->{"$epoch.git"} ||= do {
                 my $git_dir = "$self->{inboxdir}/git/$epoch.git";
+                return unless -d $git_dir;
                 my $g = PublicInbox::Git->new($git_dir);
                 $g->{-httpbackend_limiter} = $self->{-httpbackend_limiter};
-                # no cleanup needed, we never cat-file off this, only clone
+                # caller must manually cleanup when done
                 $g;
         };
 }
@@ -160,19 +153,15 @@ sub max_git_epoch {
         my ($self) = @_;
         return if $self->version < 2;
         my $cur = $self->{-max_git_epoch};
-        my $changed = git($self)->alternates_changed;
-        if (!defined($cur) || $changed) {
+        my $changed;
+        if (!defined($cur) || ($changed = git($self)->alternates_changed)) {
                 git_cleanup($self) if $changed;
                 my $gits = "$self->{inboxdir}/git";
                 if (opendir my $dh, $gits) {
-                        my $max = -1;
-                        while (defined(my $git_dir = readdir($dh))) {
-                                $git_dir =~ m!\A([0-9]+)\.git\z! or next;
-                                $max = $1 if $1 > $max;
-                        }
-                        $cur = $self->{-max_git_epoch} = $max if $max >= 0;
-                } else {
-                        warn "opendir $gits failed: $!\n";
+                        my $max = max(map {
+                                substr($_, 0, -4) + 0; # drop ".git" suffix
+                        } grep(/\A[0-9]+\.git\z/, readdir($dh))) // return;
+                        $cur = $self->{-max_git_epoch} = $max;
                 }
         }
         $cur;
@@ -191,50 +180,54 @@ sub mm {
         };
 }
 
-sub search ($;$$) {
-        my ($self, $over_only, $ctx) = @_;
-        my $srch = $self->{search} ||= eval {
+sub search {
+        my ($self) = @_;
+        my $srch = $self->{search} //= eval {
                 _cleanup_later($self);
                 require PublicInbox::Search;
                 PublicInbox::Search->new($self);
         };
-        ($over_only || eval { $srch->xdb }) ? $srch : do {
-                $ctx and $ctx->{env}->{'psgi.errors'}->print(<<EOF);
-`$self->{name}' search went away unexpectedly
-EOF
-                undef;
-        };
+        (eval { $srch->xdb }) ? $srch : undef;
 }
 
+# isrch is preferred for read-only interfaces if available since it
+# reduces kernel cache and FD overhead
+sub isrch { $_[0]->{isrch} // search($_[0]) }
+
 sub over {
         $_[0]->{over} //= eval {
-                my $srch = search($_[0], 1) or return;
+                my $srch = $_[0]->{search} //= eval {
+                        _cleanup_later($_[0]);
+                        require PublicInbox::Search;
+                        PublicInbox::Search->new($_[0]);
+                };
                 my $over = PublicInbox::Over->new("$srch->{xpfx}/over.sqlite3");
                 $over->dbh; # may fail
                 $over;
         };
 }
 
+
 sub try_cat {
         my ($path) = @_;
-        my $rv = '';
-        if (open(my $fh, '<', $path)) {
-                local $/;
-                $rv = <$fh>;
-        }
-        $rv;
+        open(my $fh, '<', $path) or return '';
+        local $/;
+        <$fh> // '';
+}
+
+sub cat_desc ($) {
+        my $desc = try_cat($_[0]);
+        local $/ = "\n";
+        chomp $desc;
+        utf8::decode($desc);
+        $desc =~ s/\s+/ /smg;
+        $desc eq '' ? undef : $desc;
 }
 
 sub description {
         my ($self) = @_;
-        ($self->{description} //= do {
-                my $desc = try_cat("$self->{inboxdir}/description");
-                local $/ = "\n";
-                chomp $desc;
-                utf8::decode($desc);
-                $desc =~ s/\s+/ /smg;
-                $desc eq '' ? undef : $desc;
-        }) // '($INBOX_DIR/description missing)';
+        ($self->{description} //= cat_desc("$self->{inboxdir}/description")) //
+                '($INBOX_DIR/description missing)';
 }
 
 sub cloneurl {
@@ -331,7 +324,7 @@ sub msg_by_smsg ($$) {
         return unless defined $smsg;
         defined(my $blob = $smsg->{blob}) or return;
 
-        git($self)->cat_file($blob);
+        $self->git->cat_file($blob);
 }
 
 sub smsg_eml {
@@ -342,39 +335,35 @@ sub smsg_eml {
         $eml;
 }
 
-sub mid2num($$) {
-        my ($self, $mid) = @_;
-        my $mm = mm($self) or return;
-        $mm->num_for($mid);
-}
-
 sub smsg_by_mid ($$) {
         my ($self, $mid) = @_;
-        my $over = over($self) or return;
-        # favor the Message-ID we used for the NNTP article number:
-        defined(my $num = mid2num($self, $mid)) or return;
-        my $smsg = $over->get_art($num) or return;
-        PublicInbox::Smsg::psgi_cull($smsg);
+        my $over = $self->over or return;
+        my $smsg;
+        if (my $mm = $self->mm) {
+                # favor the Message-ID we used for the NNTP article number:
+                defined(my $num = $mm->num_for($mid)) or return;
+                $smsg = $over->get_art($num);
+        } else {
+                my ($id, $prev);
+                $smsg = $over->next_by_mid($mid, \$id, \$prev);
+        }
+        $smsg ? PublicInbox::Smsg::psgi_cull($smsg) : undef;
 }
 
 sub msg_by_mid ($$) {
         my ($self, $mid) = @_;
-
-        over($self) or
-                return msg_by_path($self, mid2path($mid));
-
         my $smsg = smsg_by_mid($self, $mid);
-        $smsg ? msg_by_smsg($self, $smsg) : undef;
+        $smsg ? msg_by_smsg($self, $smsg) : msg_by_path($self, mid2path($mid));
 }
 
 sub recent {
         my ($self, $opts, $after, $before) = @_;
-        over($self)->recent($opts, $after, $before);
+        $self->over->recent($opts, $after, $before);
 }
 
 sub modified {
         my ($self) = @_;
-        if (my $over = over($self)) {
+        if (my $over = $self->over) {
                 my $msgs = $over->recent({limit => 1});
                 if (my $smsg = $msgs->[0]) {
                         return $smsg->{ts};
@@ -428,4 +417,8 @@ sub on_unlock {
         }
 }
 
+sub uidvalidity { $_[0]->{uidvalidity} //= eval { $_[0]->mm->created_at } }
+
+sub eidx_key { $_[0]->{newsgroup} // $_[0]->{inboxdir} }
+
 1;
diff --git a/lib/PublicInbox/InboxIdle.pm b/lib/PublicInbox/InboxIdle.pm
index 60948bea..4d74b354 100644
--- a/lib/PublicInbox/InboxIdle.pm
+++ b/lib/PublicInbox/InboxIdle.pm
@@ -1,14 +1,12 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # fields:
-# pi_config: PublicInbox::Config ref
 # inot: Linux::Inotify2-like object
 # pathmap => { inboxdir => [ ibx, watch1, watch2, watch3... ] } mapping
 package PublicInbox::InboxIdle;
 use strict;
 use parent qw(PublicInbox::DS);
-use Cwd qw(abs_path);
 use PublicInbox::Syscall qw(EPOLLIN EPOLLET);
 my $IN_MODIFY = 0x02; # match Linux inotify
 my $ino_cls;
@@ -23,11 +21,7 @@ require PublicInbox::In2Tie if $ino_cls;
 
 sub in2_arm ($$) { # PublicInbox::Config::each_inbox callback
         my ($ibx, $self) = @_;
-        my $dir = abs_path($ibx->{inboxdir});
-        if (!defined($dir)) {
-                warn "W: $ibx->{inboxdir} not watched: $!\n";
-                return;
-        }
+        my $dir = $ibx->{inboxdir};
         my $inot = $self->{inot};
         my $cur = $self->{pathmap}->{$dir} //= [];
         my $lock = "$dir/".($ibx->version >= 2 ? 'inbox.lock' : 'ssoma.lock');
@@ -65,12 +59,15 @@ I: consider increasing /proc/sys/fs/inotify/max_user_watches
 }
 
 sub refresh {
-        my ($self, $pi_config) = @_;
-        $pi_config->each_inbox(\&in2_arm, $self);
+        my ($self, $pi_cfg) = @_;
+        $pi_cfg->each_inbox(\&in2_arm, $self);
 }
 
+# internal API for ease-of-use
+sub watch_inbox { in2_arm($_[1], $_[0]) };
+
 sub new {
-        my ($class, $pi_config) = @_;
+        my ($class, $pi_cfg) = @_;
         my $self = bless {}, $class;
         my $inot;
         if ($ino_cls) {
@@ -84,7 +81,7 @@ sub new {
         $self->{inot} = $inot;
         $self->{pathmap} = {}; # inboxdir => [ ibx, watch1, watch2, watch3...]
         $self->{on_unlock} = {}; # lock path => ibx
-        refresh($self, $pi_config);
+        refresh($self, $pi_cfg) if $pi_cfg;
         PublicInbox::FakeInotify::poll_once($self) if !$ino_cls;
         $self;
 }
@@ -95,7 +92,8 @@ sub event_step {
                 my @events = $self->{inot}->read; # Linux::Inotify2::read
                 my $on_unlock = $self->{on_unlock};
                 for my $ev (@events) {
-                        if (my $ibx = $on_unlock->{$ev->fullname}) {
+                        my $fn = $ev->fullname // next; # cancelled
+                        if (my $ibx = $on_unlock->{$fn}) {
                                 $ibx->on_unlock;
                         }
                 }
diff --git a/lib/PublicInbox/InboxWritable.pm b/lib/PublicInbox/InboxWritable.pm
index 752f1997..982ad6e5 100644
--- a/lib/PublicInbox/InboxWritable.pm
+++ b/lib/PublicInbox/InboxWritable.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Extends read-only Inbox for writing
@@ -46,12 +46,13 @@ sub _init_v1 {
                 require PublicInbox::Msgmap;
                 my $sidx = PublicInbox::SearchIdx->new($self, 1); # just create
                 $sidx->begin_txn_lazy;
+                my $mm = PublicInbox::Msgmap->new($self->{inboxdir}, 1);
                 if (defined $skip_artnum) {
-                        my $mm = PublicInbox::Msgmap->new($self->{inboxdir}, 1);
                         $mm->{dbh}->begin_work;
                         $mm->skip_artnum($skip_artnum);
                         $mm->{dbh}->commit;
                 }
+                undef $mm; # ->created_at set
                 $sidx->commit_txn_lazy;
         } else {
                 open my $fh, '>>', "$self->{inboxdir}/ssoma.lock" or
@@ -64,7 +65,6 @@ sub init_inbox {
         if ($self->version == 1) {
                 my $dir = assert_usable_dir($self);
                 PublicInbox::Import::init_bare($dir);
-                $self->umask_prepare;
                 $self->with_umask(\&_init_v1, $self, $skip_artnum);
         } else {
                 my $v2w = importer($self);
@@ -102,7 +102,7 @@ sub filter {
                         $im->done;
                 }
 
-                my @args = (-inbox => $self);
+                my @args = (ibx => $self);
                 # basic line splitting, only
                 # Perhaps we can have proper quote splitting one day...
                 ($f, @args) = split(/\s+/, $f) if $f =~ /\s+/;
@@ -259,7 +259,7 @@ sub _umask_for {
 
 sub with_umask {
         my ($self, $cb, @arg) = @_;
-        my $old = umask $self->{umask};
+        my $old = umask($self->{umask} //= umask_prepare($self));
         my $rv = eval { $cb->(@arg) };
         my $err = $@;
         umask $old;
@@ -270,8 +270,7 @@ sub with_umask {
 sub umask_prepare {
         my ($self) = @_;
         my $perm = _git_config_perm($self);
-        my $umask = _umask_for($perm);
-        $self->{umask} = $umask;
+        _umask_for($perm);
 }
 
 sub cleanup ($) {
@@ -287,15 +286,24 @@ sub warn_ignore {
         # PublicInbox::MsgTime
         || $s =~ /^bogus TZ offset: .+?, ignoring and assuming \+0000/
         || $s =~ /^bad Date: .+? in /
+        # Encode::Unicode::UTF7
+        || $s =~ /^Bad UTF7 data escape at /
 }
 
 # this expects to be RHS in this assignment: "local $SIG{__WARN__} = ..."
 sub warn_ignore_cb {
-        my $cb = $SIG{__WARN__} // sub { print STDERR @_ };
+        my $cb = $SIG{__WARN__} // \&CORE::warn;
         sub {
                 return if warn_ignore(@_);
                 $cb->(@_);
         }
 }
 
+# v2+ only, XXX: maybe we can just rely on ->max_git_epoch and remove
+sub git_dir_latest {
+        my ($self, $max) = @_;
+        defined($$max = $self->max_git_epoch) ?
+                "$self->{inboxdir}/git/$$max.git" : undef;
+}
+
 1;
diff --git a/lib/PublicInbox/Isearch.pm b/lib/PublicInbox/Isearch.pm
new file mode 100644
index 00000000..342d7913
--- /dev/null
+++ b/lib/PublicInbox/Isearch.pm
@@ -0,0 +1,127 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Provides everything the PublicInbox::Search object does;
+# but uses global ExtSearch (->ALL) with an eidx_key query to
+# emulate per-Inbox search using ->ALL.
+package PublicInbox::Isearch;
+use strict;
+use v5.10.1;
+use PublicInbox::ExtSearch;
+use PublicInbox::Search;
+
+sub new {
+        my (undef, $ibx, $es) = @_;
+        bless { es => $es, eidx_key => $ibx->eidx_key }, __PACKAGE__;
+}
+
+sub _ibx_id ($) {
+        my ($self) = @_;
+        my $sth = $self->{es}->over->dbh->prepare_cached(<<'', undef, 1);
+SELECT ibx_id FROM inboxes WHERE eidx_key = ? LIMIT 1
+
+        $sth->execute($self->{eidx_key});
+        $sth->fetchrow_array //
+                die "E: `$self->{eidx_key}' not in $self->{es}->{topdir}\n";
+}
+
+
+sub mset {
+        my ($self, $str, $opt) = @_;
+        my %opt = $opt ? %$opt : ();
+        $opt{eidx_key} = $self->{eidx_key};
+        if (my $uid_range = $opt{uid_range}) {
+                my ($beg, $end) = @$uid_range;
+                my $ibx_id = $self->{-ibx_id} //= _ibx_id($self);
+                my $dbh = $self->{es}->{over}->dbh;
+                my $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT MIN(docid) FROM xref3 WHERE ibx_id = ? AND xnum >= ? AND xnum <= ?
+
+                $sth->execute($ibx_id, $beg, $end);
+                my @r = ($sth->fetchrow_array);
+
+                $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT MAX(docid) FROM xref3 WHERE ibx_id = ? AND xnum >= ? AND xnum <= ?
+
+                $sth->execute($ibx_id, $beg, $end);
+                $r[1] = $sth->fetchrow_array;
+                if (defined($r[1]) && defined($r[0])) {
+                        $opt{limit} = $r[1] - $r[0] + 1;
+                } else {
+                        $r[1] //= 0xffffffff;
+                        $r[0] //= 0;
+                }
+                $opt{uid_range} = \@r;
+        }
+        $self->{es}->mset($str, \%opt);
+}
+
+sub mset_to_artnums {
+        my ($self, $mset, $opt) = @_;
+        my $docids = PublicInbox::Search::mset_to_artnums($self->{es}, $mset);
+        my $ibx_id = $self->{-ibx_id} //= _ibx_id($self);
+        my $qmarks = join(',', map { '?' } @$docids);
+        if ($opt && ($opt->{relevance} // 0) == -1) { # -1 => ENQ_ASCENDING
+                my $range = '';
+                my @r;
+                if (my $r = $opt->{uid_range}) {
+                        $range = 'AND xnum >= ? AND xnum <= ?';
+                        @r = @$r;
+                }
+                my $rows = $self->{es}->over->dbh->
+                        selectall_arrayref(<<"", undef, $ibx_id, @$docids, @r);
+SELECT xnum FROM xref3 WHERE ibx_id = ? AND docid IN ($qmarks) $range
+ORDER BY xnum ASC
+
+                return [ map { $_->[0] } @$rows ];
+        }
+
+        my $rows = $self->{es}->over->dbh->
+                        selectall_arrayref(<<"", undef, $ibx_id, @$docids);
+SELECT docid,xnum FROM xref3 WHERE ibx_id = ? AND docid IN ($qmarks)
+
+        my $i = -1;
+        my %order = map { $_ => ++$i } @$docids;
+        my @xnums;
+        for my $row (@$rows) { # @row = ($docid, $xnum)
+                my $idx = delete($order{$row->[0]}) // next;
+                $xnums[$idx] = $row->[1];
+        }
+        if (scalar keys %order) {
+                warn "W: $self->{es}->{topdir} #",
+                        join(', ', sort { $a <=> $b } keys %order),
+                        " not mapped to `$self->{eidx_key}'\n";
+                warn "W: $self->{es}->{topdir} may need to be reindexed\n";
+                @xnums = grep { defined } @xnums;
+        }
+        \@xnums;
+}
+
+sub mset_to_smsg {
+        my ($self, $ibx, $mset) = @_; # $ibx is a real inbox, not eidx
+        my $xnums = mset_to_artnums($self, $mset);
+        my $i = -1;
+        my %order = map { $_ => ++$i } @$xnums;
+        my $unordered = $ibx->over->get_all(@$xnums);
+        my @msgs;
+        for my $smsg (@$unordered) {
+                my $idx = delete($order{$smsg->{num}}) // do {
+                        warn "W: $ibx->{inboxdir} #$smsg->{num}\n";
+                        next;
+                };
+                $msgs[$idx] = $smsg;
+        }
+        if (scalar keys %order) {
+                warn "W: $ibx->{inboxdir} #",
+                        join(', ', sort { $a <=> $b } keys %order),
+                        " no longer valid\n";
+                warn "W: $self->{es}->{topdir} may need to be reindexed\n";
+        }
+        wantarray ? ($mset->get_matches_estimated, \@msgs) : \@msgs;
+}
+
+sub has_threadid { 1 }
+
+sub help { $_[0]->{es}->help }
+
+1;
diff --git a/lib/PublicInbox/KQNotify.pm b/lib/PublicInbox/KQNotify.pm
index c7740df2..cfea6b1b 100644
--- a/lib/PublicInbox/KQNotify.pm
+++ b/lib/PublicInbox/KQNotify.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # implements the small subset of Linux::Inotify2 functionality we use
diff --git a/lib/PublicInbox/LEI.pm b/lib/PublicInbox/LEI.pm
new file mode 100644
index 00000000..378113e8
--- /dev/null
+++ b/lib/PublicInbox/LEI.pm
@@ -0,0 +1,1007 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Backend for `lei' (local email interface).  Unlike the C10K-oriented
+# PublicInbox::Daemon, this is designed exclusively to handle trusted
+# local clients with read/write access to the FS and use as many
+# system resources as the local user has access to.
+package PublicInbox::LEI;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::DS PublicInbox::LeiExternal
+        PublicInbox::LeiQuery);
+use Getopt::Long ();
+use Socket qw(AF_UNIX SOCK_SEQPACKET MSG_EOR pack_sockaddr_un);
+use Errno qw(EAGAIN EINTR ECONNREFUSED ENOENT ECONNRESET);
+use POSIX ();
+use IO::Handle ();
+use Fcntl qw(SEEK_SET);
+use Sys::Syslog qw(syslog openlog);
+use PublicInbox::Config;
+use PublicInbox::Syscall qw(SFD_NONBLOCK EPOLLIN EPOLLET);
+use PublicInbox::Sigfd;
+use PublicInbox::DS qw(now dwaitpid);
+use PublicInbox::Spawn qw(spawn popen_rd);
+use PublicInbox::OnDestroy;
+use Text::Wrap qw(wrap);
+use File::Path qw(mkpath);
+use File::Spec;
+our $quit = \&CORE::exit;
+our ($current_lei, $errors_log, $listener);
+my ($recv_cmd, $send_cmd);
+my $GLP = Getopt::Long::Parser->new;
+$GLP->configure(qw(gnu_getopt no_ignore_case auto_abbrev));
+my $GLP_PASS = Getopt::Long::Parser->new;
+$GLP_PASS->configure(qw(gnu_getopt no_ignore_case auto_abbrev pass_through));
+
+our %PATH2CFG; # persistent for socket daemon
+
+# TBD: this is a documentation mechanism to show a subcommand
+# (may) pass options through to another command:
+sub pass_through { $GLP_PASS }
+
+my $OPT;
+sub opt_dash ($$) {
+        my ($spec, $re_str) = @_; # 'limit|n=i', '([0-9]+)'
+        my ($key) = ($spec =~ m/\A([a-z]+)/g);
+        my $cb = sub { # Getopt::Long "<>" catch-all handler
+                my ($arg) = @_;
+                if ($arg =~ /\A-($re_str)\z/) {
+                        $OPT->{$key} = $1;
+                } elsif ($arg eq '--') { # "--" arg separator, ignore first
+                        push @{$OPT->{-argv}}, $arg if $OPT->{'--'}++;
+                # lone (single) dash is handled elsewhere
+                } elsif (substr($arg, 0, 1) eq '-') {
+                        if ($OPT->{'--'}) {
+                                push @{$OPT->{-argv}}, $arg;
+                        } else {
+                                die "bad argument: $arg\n";
+                        }
+                } else {
+                        push @{$OPT->{-argv}}, $arg;
+                }
+        };
+        ($spec, '<>' => $cb, $GLP_PASS) # for Getopt::Long
+}
+
+sub _store_path ($) {
+        my ($env) = @_;
+        File::Spec->rel2abs(($env->{XDG_DATA_HOME} //
+                ($env->{HOME} // '/nonexistent').'/.local/share')
+                .'/lei/store', $env->{PWD});
+}
+
+sub _config_path ($) {
+        my ($env) = @_;
+        File::Spec->rel2abs(($env->{XDG_CONFIG_HOME} //
+                ($env->{HOME} // '/nonexistent').'/.config')
+                .'/lei/config', $env->{PWD});
+}
+
+# TODO: generate shell completion + help using %CMD and %OPTDESC
+# command => [ positional_args, 1-line description, Getopt::Long option spec ]
+our %CMD = ( # sorted in order of importance/use:
+'q' => [ 'SEARCH_TERMS...', 'search for messages matching terms', qw(
+        save-as=s output|mfolder|o=s format|f=s dedupe|d=s thread|t augment|a
+        sort|s=s reverse|r offset=i remote! local! external! pretty mua-cmd=s
+        torsocks=s no-torsocks verbose|v since|after=s until|before=s),
+        PublicInbox::LeiQuery::curl_opt(), opt_dash('limit|n=i', '[0-9]+') ],
+
+'show' => [ 'MID|OID', 'show a given object (Message-ID or object ID)',
+        qw(type=s solve! format|f=s dedupe|d=s thread|t remote local!),
+        pass_through('git show') ],
+
+'add-external' => [ 'URL_OR_PATHNAME',
+        'add/set priority of a publicinbox|extindex for extra matches',
+        qw(boost=i quiet|q) ],
+'ls-external' => [ '[FILTER...]', 'list publicinbox|extindex locations',
+        qw(format|f=s z|0 local remote quiet|q) ],
+'forget-external' => [ 'URL_OR_PATHNAME...|--prune',
+        'exclude further results from a publicinbox|extindex',
+        qw(prune quiet|q) ],
+
+'ls-query' => [ '[FILTER...]', 'list saved search queries',
+                qw(name-only format|f=s z) ],
+'rm-query' => [ 'QUERY_NAME', 'remove a saved search' ],
+'mv-query' => [ qw(OLD_NAME NEW_NAME), 'rename a saved search' ],
+
+'plonk' => [ '--thread|--from=IDENT',
+        'exclude mail matching From: or thread from non-Message-ID searches',
+        qw(stdin| thread|t from|f=s mid=s oid=s) ],
+'mark' => [ 'MESSAGE_FLAGS...',
+        'set/unset flags on message(s) from stdin',
+        qw(stdin| oid=s exact by-mid|mid:s) ],
+'forget' => [ '[--stdin|--oid=OID|--by-mid=MID]',
+        "exclude message(s) on stdin from `q' search results",
+        qw(stdin| oid=s exact by-mid|mid:s quiet|q) ],
+
+'purge-mailsource' => [ 'URL_OR_PATHNAME|--all',
+        'remove imported messages from IMAP, Maildirs, and MH',
+        qw(exact! all jobs:i indexed) ],
+
+# code repos are used for `show' to solve blobs from patch mails
+'add-coderepo' => [ 'PATHNAME', 'add or set priority of a git code repo',
+        qw(boost=i) ],
+'ls-coderepo' => [ '[FILTER_TERMS...]',
+                'list known code repos', qw(format|f=s z) ],
+'forget-coderepo' => [ 'PATHNAME',
+        'stop using repo to solve blobs from patches',
+        qw(prune) ],
+
+'add-watch' => [ '[URL_OR_PATHNAME]',
+                'watch for new messages and flag changes',
+        qw(import! flags! interval=s recursive|r exclude=s include=s) ],
+'ls-watch' => [ '[FILTER...]', 'list active watches with numbers and status',
+                qw(format|f=s z) ],
+'pause-watch' => [ '[WATCH_NUMBER_OR_FILTER]', qw(all local remote) ],
+'resume-watch' => [ '[WATCH_NUMBER_OR_FILTER]', qw(all local remote) ],
+'forget-watch' => [ '{WATCH_NUMBER|--prune}', 'stop and forget a watch',
+        qw(prune) ],
+
+'import' => [ 'URL_OR_PATHNAME|--stdin',
+        'one-shot import/update from URL or filesystem',
+        qw(stdin| offset=i recursive|r exclude=s include=s !flags),
+        ],
+
+'config' => [ '[...]', sub {
+                'git-config(1) wrapper for '._config_path($_[0]);
+        }, qw(config-file|system|global|file|f=s), # for conflict detection
+        pass_through('git config') ],
+'init' => [ '[PATHNAME]', sub {
+                'initialize storage, default: '._store_path($_[0]);
+        }, qw(quiet|q) ],
+'daemon-kill' => [ '[-SIGNAL]', 'signal the lei-daemon',
+        opt_dash('signal|s=s', '[0-9]+|(?:[A-Z][A-Z0-9]+)') ],
+'daemon-pid' => [ '', 'show the PID of the lei-daemon' ],
+'help' => [ '[SUBCOMMAND]', 'show help' ],
+
+# XXX do we need this?
+# 'git' => [ '[ANYTHING...]', 'git(1) wrapper', pass_through('git') ],
+
+'reorder-local-store-and-break-history' => [ '[REFNAME]',
+        'rewrite git history in an attempt to improve compression',
+        'gc!' ],
+
+# internal commands are prefixed with '_'
+'_complete' => [ '[...]', 'internal shell completion helper',
+                pass_through('everything') ],
+); # @CMD
+
+# switch descriptions, try to keep consistent across commands
+# $spec: Getopt::Long option specification
+# $spec => [@ALLOWED_VALUES (default is first), $description],
+# $spec => $description
+# "$SUB_COMMAND TAB $spec" => as above
+my $stdin_formats = [ 'IN|auto|raw|mboxrd|mboxcl2|mboxcl|mboxo',
+                'specify message input format' ];
+my $ls_format = [ 'OUT|plain|json|null', 'listing output format' ];
+
+my %OPTDESC = (
+'help|h' => 'show this built-in help',
+'quiet|q' => 'be quiet',
+'solve!' => 'do not attempt to reconstruct blobs from emails',
+'save-as=s' => ['NAME', 'save a search terms by given name'],
+
+'type=s' => [ 'any|mid|git', 'disambiguate type' ],
+
+'dedupe|d=s' => ['STRAT|content|oid|mid|none',
+                'deduplication strategy'],
+'show        thread|t' => 'display entire thread a message belongs to',
+'q        thread|t' =>
+        'return all messages in the same thread as the actual match(es)',
+'augment|a' => 'augment --output destination instead of clobbering',
+
+'output|o=s' => [ 'DEST',
+        "destination (e.g. `/path/to/Maildir', or `-' for stdout)" ],
+'mua-cmd|mua=s' => [ 'COMMAND',
+        "MUA to run on --output Maildir or mbox (e.g. `mutt -f %f'" ],
+
+'show        format|f=s' => [ 'OUT|plain|raw|html|mboxrd|mboxcl2|mboxcl',
+                        'message/object output format' ],
+'mark        format|f=s' => $stdin_formats,
+'forget        format|f=s' => $stdin_formats,
+'q        format|f=s' => [ 'OUT|maildir|mboxrd|mboxcl2|mboxcl|html|oid|json',
+                'specify output format, default depends on --output'],
+'ls-query        format|f=s' => $ls_format,
+'ls-external        format|f=s' => $ls_format,
+
+'limit|n=i@' => ['NUM', 'limit on number of matches (default: 10000)' ],
+'offset=i' => ['OFF', 'search result offset (default: 0)'],
+
+'sort|s=s' => [ 'VAL|received,relevance,docid',
+                "order of results `--output'-dependent"],
+'reverse|r' => [ 'reverse search results' ], # like sort(1)
+
+'boost=i' => 'increase/decrease priority of results (default: 0)',
+
+'local' => 'limit operations to the local filesystem',
+'local!' => 'exclude results from the local filesystem',
+'remote' => 'limit operations to those requiring network access',
+'remote!' => 'prevent operations requiring network access',
+
+'mid=s' => 'specify the Message-ID of a message',
+'oid=s' => 'specify the git object ID of a message',
+
+'recursive|r' => 'scan directories/mailboxes/newsgroups recursively',
+'exclude=s' => 'exclude mailboxes/newsgroups based on pattern',
+'include=s' => 'include mailboxes/newsgroups based on pattern',
+
+'exact' => 'operate on exact header matches only',
+'exact!' => 'rely on content match instead of exact header matches',
+
+'by-mid|mid:s' => [ 'MID', 'match only by Message-ID, ignoring contents' ],
+'jobs:i' => 'set parallelism level',
+
+# xargs, env, use "-0", git(1) uses "-z".  We support z|0 everywhere
+'z|0' => 'use NUL \\0 instead of newline (CR) to delimit lines',
+
+'signal|s=s' => [ 'SIG', 'signal to send lei-daemon (default: TERM)' ],
+); # %OPTDESC
+
+my %CONFIG_KEYS = (
+        'leistore.dir' => 'top-level storage location',
+);
+
+# pronounced "exit": x_it(1 << 8) => exit(1); x_it(13) => SIGPIPE
+sub x_it ($$) {
+        my ($self, $code) = @_;
+        # make sure client sees stdout before exit
+        $self->{1}->autoflush(1) if $self->{1};
+        dump_and_clear_log();
+        if (my $sock = $self->{sock}) {
+                send($sock, "x_it $code", MSG_EOR);
+        } elsif (!($code & 127)) { # oneshot, ignore signals
+                # don't want to end up using $? from child processes
+                for my $f (qw(lxs l2m)) {
+                        my $wq = delete $self->{$f} or next;
+                        $wq->DESTROY;
+                }
+                $quit->($code >> 8);
+        }
+}
+
+sub puts ($;@) { print { shift->{1} } map { "$_\n" } @_ }
+
+sub out ($;@) { print { shift->{1} } @_ }
+
+sub err ($;@) {
+        my $self = shift;
+        my $err = $self->{2} // ($self->{pgr} // [])->[2] // *STDERR{IO};
+        print $err @_, (substr($_[-1], -1, 1) eq "\n" ? () : "\n");
+}
+
+sub qerr ($;@) { $_[0]->{opt}->{quiet} or err(shift, @_) }
+
+sub fail ($$;$) {
+        my ($self, $buf, $exit_code) = @_;
+        err($self, $buf);
+        x_it($self, ($exit_code // 1) << 8);
+        undef;
+}
+
+sub child_error { # passes non-fatal curl exit codes to user
+        my ($self, $child_error) = @_; # child_error is $?
+        if (my $sock = $self->{sock}) { # send to lei(1) client
+                send($sock, "child_error $child_error", MSG_EOR);
+        } else { # oneshot
+                $self->{child_error} = $child_error;
+        }
+        undef;
+}
+
+sub atfork_prepare_wq {
+        my ($self, $wq) = @_;
+        my $tcafc = $wq->{-ipc_atfork_child_close} //= [ $listener // () ];
+        if (my $sock = $self->{sock}) {
+                push @$tcafc, @$self{qw(0 1 2)}, $sock;
+        }
+        if (my $pgr = $self->{pgr}) {
+                push @$tcafc, @$pgr[1,2];
+        }
+        if (my $old_1 = $self->{old_1}) {
+                push @$tcafc, $old_1;
+        }
+        for my $f (qw(lxs l2m)) {
+                my $ipc = $self->{$f} or next;
+                push @$tcafc, grep { defined }
+                                @$ipc{qw(-wq_s1 -wq_s2 -ipc_req -ipc_res)};
+        }
+}
+
+# usage: my %sig = $lei->atfork_child_wq($wq);
+#         local @SIG{keys %sig} = values %sig;
+sub atfork_child_wq {
+        my ($self, $wq) = @_;
+        my ($sock, $l2m_wq_s1);
+        (@$self{qw(0 1 2)}, $sock, $l2m_wq_s1) = delete(@$wq{0..4});
+        $self->{sock} = $sock if -S $sock;
+        $self->{l2m}->{-wq_s1} = $l2m_wq_s1 if $l2m_wq_s1 && -S $l2m_wq_s1;
+        %PATH2CFG = ();
+        undef $errors_log;
+        $quit = \&CORE::exit;
+        (__WARN__ => sub { err($self, @_) },
+        PIPE => sub {
+                $self->x_it(13); # SIGPIPE = 13
+                # we need to close explicitly to avoid Perl warning on SIGPIPE
+                for my $i (1, 2) {
+                        next unless $self->{$i} && (-p $self->{$i} || -S _);
+                        close(delete $self->{$i});
+                }
+                # trigger the LeiXSearch $done OpPipe:
+                syswrite($self->{0}, '!') if $self->{0} && -p $self->{0};
+                $SIG{PIPE} = 'DEFAULT';
+                die bless(\"$_[0]", 'PublicInbox::SIGPIPE'),
+        });
+}
+
+# usage: ($lei, @io) = $lei->atfork_parent_wq($wq);
+sub atfork_parent_wq {
+        my ($self, $wq) = @_;
+        my $env = delete $self->{env}; # env is inherited at fork
+        my $ret = bless { %$self }, ref($self);
+        if (my $dedupe = delete $ret->{dedupe}) {
+                $ret->{dedupe} = $wq->deep_clone($dedupe);
+        }
+        $self->{env} = $env;
+        delete @$ret{qw(-lei_store cfg old_1 pgr lxs)}; # keep l2m
+        my @io = delete @$ret{0..2};
+        $io[3] = delete($ret->{sock}) // $io[2];
+        my $l2m = $ret->{l2m};
+        if ($l2m && $l2m != $wq) { # $wq == lxs
+                $io[4] = $l2m->{-wq_s1} if $l2m->{-wq_s1};
+                $l2m->wq_close(1);
+        }
+        ($ret, @io);
+}
+
+sub _help ($;$) {
+        my ($self, $errmsg) = @_;
+        my $cmd = $self->{cmd} // 'COMMAND';
+        my @info = @{$CMD{$cmd} // [ '...', '...' ]};
+        my @top = ($cmd, shift(@info) // ());
+        my $cmd_desc = shift(@info);
+        $cmd_desc = $cmd_desc->($self->{env}) if ref($cmd_desc) eq 'CODE';
+        my @opt_desc;
+        my $lpad = 2;
+        for my $sw (grep { !ref } @info) { # ("prio=s", "z", $GLP_PASS)
+                my $desc = $OPTDESC{"$cmd\t$sw"} // $OPTDESC{$sw} // next;
+                my $arg_vals = '';
+                ($arg_vals, $desc) = @$desc if ref($desc) eq 'ARRAY';
+
+                # lower-case is a keyword (e.g. `content', `oid'),
+                # ALL_CAPS is a string description (e.g. `PATH')
+                if ($desc !~ /default/ && $arg_vals =~ /\b([a-z]+)[,\|]/) {
+                        $desc .= "\ndefault: `$1'";
+                }
+                my (@vals, @s, @l);
+                my $x = $sw;
+                if ($x =~ s/!\z//) { # solve! => --no-solve
+                        $x = "no-$x";
+                } elsif ($x =~ s/:.+//) { # optional args: $x = "mid:s"
+                        @vals = (' [', undef, ']');
+                } elsif ($x =~ s/=.+//) { # required arg: $x = "type=s"
+                        @vals = (' ', undef);
+                } # else: no args $x = 'thread|t'
+                for (split(/\|/, $x)) { # help|h
+                        length($_) > 1 ? push(@l, "--$_") : push(@s, "-$_");
+                }
+                if (!scalar(@vals)) { # no args 'thread|t'
+                } elsif ($arg_vals =~ s/\A([A-Z_]+)\b//) { # "NAME"
+                        $vals[1] = $1;
+                } else {
+                        $vals[1] = uc(substr($l[0], 2)); # "--type" => "TYPE"
+                }
+                if ($arg_vals =~ /([,\|])/) {
+                        my $sep = $1;
+                        my @allow = split(/\Q$sep\E/, $arg_vals);
+                        my $must = $sep eq '|' ? 'Must' : 'Can';
+                        @allow = map { "`$_'" } @allow;
+                        my $last = pop @allow;
+                        $desc .= "\n$must be one of: " .
+                                join(', ', @allow) . " or $last";
+                }
+                my $lhs = join(', ', @s, @l) . join('', @vals);
+                if ($x =~ /\|\z/) { # "stdin|" or "clear|"
+                        $lhs =~ s/\A--/- , --/;
+                } else {
+                        $lhs =~ s/\A--/    --/; # pad if no short options
+                }
+                $lpad = length($lhs) if length($lhs) > $lpad;
+                push @opt_desc, $lhs, $desc;
+        }
+        my $msg = $errmsg ? "E: $errmsg\n" : '';
+        $msg .= <<EOF;
+usage: lei @top
+  $cmd_desc
+
+EOF
+        $lpad += 2;
+        local $Text::Wrap::columns = 78 - $lpad;
+        my $padding = ' ' x ($lpad + 2);
+        while (my ($lhs, $rhs) = splice(@opt_desc, 0, 2)) {
+                $msg .= '  '.pack("A$lpad", $lhs);
+                $rhs = wrap('', '', $rhs);
+                $rhs =~ s/\n/\n$padding/sg; # LHS pad continuation lines
+                $msg .= $rhs;
+                $msg .= "\n";
+        }
+        print { $self->{$errmsg ? 2 : 1} } $msg;
+        x_it($self, $errmsg ? 1 << 8 : 0); # stderr => failure
+        undef;
+}
+
+sub optparse ($$$) {
+        my ($self, $cmd, $argv) = @_;
+        $self->{cmd} = $cmd;
+        $OPT = $self->{opt} = {};
+        my $info = $CMD{$cmd} // [ '[...]' ];
+        my ($proto, undef, @spec) = @$info;
+        my $glp = ref($spec[-1]) eq ref($GLP) ? pop(@spec) : $GLP;
+        push @spec, qw(help|h);
+        my $lone_dash;
+        if ($spec[0] =~ s/\|\z//s) { # "stdin|" or "clear|" allows "-" alias
+                $lone_dash = $spec[0];
+                $OPT->{$spec[0]} = \(my $var);
+                push @spec, '' => \$var;
+        }
+        $glp->getoptionsfromarray($argv, $OPT, @spec) or
+                return _help($self, "bad arguments or options for $cmd");
+        return _help($self) if $OPT->{help};
+
+        push @$argv, @{$OPT->{-argv}} if defined($OPT->{-argv});
+
+        # "-" aliases "stdin" or "clear"
+        $OPT->{$lone_dash} = ${$OPT->{$lone_dash}} if defined $lone_dash;
+
+        my $i = 0;
+        my $POS_ARG = '[A-Z][A-Z0-9_]+';
+        my ($err, $inf);
+        my @args = split(/ /, $proto);
+        for my $var (@args) {
+                if ($var =~ /\A$POS_ARG\.\.\.\z/o) { # >= 1 args;
+                        $inf = defined($argv->[$i]) and last;
+                        $var =~ s/\.\.\.\z//;
+                        $err = "$var not supplied";
+                } elsif ($var =~ /\A$POS_ARG\z/o) { # required arg at $i
+                        $argv->[$i++] // ($err = "$var not supplied");
+                } elsif ($var =~ /\.\.\.\]\z/) { # optional args start
+                        $inf = 1;
+                        last;
+                } elsif ($var =~ /\A\[-?$POS_ARG\]\z/) { # one optional arg
+                        $i++;
+                } elsif ($var =~ /\A.+?\|/) { # required FOO|--stdin
+                        my @or = split(/\|/, $var);
+                        my $ok;
+                        for my $o (@or) {
+                                if ($o =~ /\A--([a-z0-9\-]+)/) {
+                                        $ok = defined($OPT->{$1});
+                                        last;
+                                } elsif (defined($argv->[$i])) {
+                                        $ok = 1;
+                                        $i++;
+                                        last;
+                                } # else continue looping
+                        }
+                        last if $ok;
+                        my $last = pop @or;
+                        $err = join(', ', @or) . " or $last must be set";
+                } else {
+                        warn "BUG: can't parse `$var' in $proto";
+                }
+                last if $err;
+        }
+        if (!$inf && scalar(@$argv) > scalar(@args)) {
+                $err //= 'too many arguments';
+        }
+        $err ? fail($self, "usage: lei $cmd $proto\nE: $err") : 1;
+}
+
+sub dispatch {
+        my ($self, $cmd, @argv) = @_;
+        local $current_lei = $self; # for __WARN__
+        dump_and_clear_log("from previous run\n");
+        return _help($self, 'no command given') unless defined($cmd);
+        my $func = "lei_$cmd";
+        $func =~ tr/-/_/;
+        if (my $cb = __PACKAGE__->can($func)) {
+                optparse($self, $cmd, \@argv) or return;
+                $cb->($self, @argv);
+        } elsif (grep(/\A-/, $cmd, @argv)) { # --help or -h only
+                my $opt = {};
+                $GLP->getoptionsfromarray([$cmd, @argv], $opt, qw(help|h)) or
+                        return _help($self, 'bad arguments or options');
+                _help($self);
+        } else {
+                fail($self, "`$cmd' is not an lei command");
+        }
+}
+
+sub _lei_cfg ($;$) {
+        my ($self, $creat) = @_;
+        my $f = _config_path($self->{env});
+        my @st = stat($f);
+        my $cur_st = @st ? pack('dd', $st[10], $st[7]) : ''; # 10:ctime, 7:size
+        if (my $cfg = $PATH2CFG{$f}) { # reuse existing object in common case
+                return ($self->{cfg} = $cfg) if $cur_st eq $cfg->{-st};
+        }
+        if (!@st) {
+                unless ($creat) {
+                        delete $self->{cfg};
+                        return;
+                }
+                my (undef, $cfg_dir, undef) = File::Spec->splitpath($f);
+                -d $cfg_dir or mkpath($cfg_dir) or die "mkpath($cfg_dir): $!\n";
+                open my $fh, '>>', $f or die "open($f): $!\n";
+                @st = stat($fh) or die "fstat($f): $!\n";
+                $cur_st = pack('dd', $st[10], $st[7]);
+                qerr($self, "I: $f created") if $self->{cmd} ne 'config';
+        }
+        my $cfg = PublicInbox::Config::git_config_dump($f);
+        $cfg->{-st} = $cur_st;
+        $cfg->{'-f'} = $f;
+        $self->{cfg} = $PATH2CFG{$f} = $cfg;
+}
+
+sub _lei_store ($;$) {
+        my ($self, $creat) = @_;
+        my $cfg = _lei_cfg($self, $creat);
+        $cfg->{-lei_store} //= do {
+                require PublicInbox::LeiStore;
+                my $dir = $cfg->{'leistore.dir'};
+                $dir //= _store_path($self->{env}) if $creat;
+                return unless $dir;
+                PublicInbox::LeiStore->new($dir, { creat => $creat });
+        };
+}
+
+sub lei_show {
+        my ($self, @argv) = @_;
+}
+
+sub lei_mark {
+        my ($self, @argv) = @_;
+}
+
+sub _config {
+        my ($self, @argv) = @_;
+        my $env = $self->{env};
+        delete local $env->{GIT_CONFIG};
+        delete local $ENV{GIT_CONFIG};
+        my $cfg = _lei_cfg($self, 1);
+        my $cmd = [ qw(git config -f), $cfg->{'-f'}, @argv ];
+        my %rdr = map { $_ => $self->{$_} } (0..2);
+        waitpid(spawn($cmd, $env, \%rdr), 0);
+}
+
+sub lei_config {
+        my ($self, @argv) = @_;
+        $self->{opt}->{'config-file'} and return fail $self,
+                "config file switches not supported by `lei config'";
+        _config(@_);
+        x_it($self, $?) if $?;
+}
+
+sub lei_init {
+        my ($self, $dir) = @_;
+        my $cfg = _lei_cfg($self, 1);
+        my $cur = $cfg->{'leistore.dir'};
+        my $env = $self->{env};
+        $dir //= _store_path($env);
+        $dir = File::Spec->rel2abs($dir, $env->{PWD}); # PWD is symlink-aware
+        my @cur = stat($cur) if defined($cur);
+        $cur = File::Spec->canonpath($cur // $dir);
+        my @dir = stat($dir);
+        my $exists = "I: leistore.dir=$cur already initialized" if @dir;
+        if (@cur) {
+                if ($cur eq $dir) {
+                        _lei_store($self, 1)->done;
+                        return qerr($self, $exists);
+                }
+
+                # some folks like symlinks and bind mounts :P
+                if (@dir && "$cur[0] $cur[1]" eq "$dir[0] $dir[1]") {
+                        lei_config($self, 'leistore.dir', $dir);
+                        _lei_store($self, 1)->done;
+                        return qerr($self, "$exists (as $cur)");
+                }
+                return fail($self, <<"");
+E: leistore.dir=$cur already initialized and it is not $dir
+
+        }
+        lei_config($self, 'leistore.dir', $dir);
+        _lei_store($self, 1)->done;
+        $exists //= "I: leistore.dir=$dir newly initialized";
+        return qerr($self, $exists);
+}
+
+sub lei_daemon_pid { puts shift, $$ }
+
+sub lei_daemon_kill {
+        my ($self) = @_;
+        my $sig = $self->{opt}->{signal} // 'TERM';
+        kill($sig, $$) or fail($self, "kill($sig, $$): $!");
+}
+
+sub lei_help { _help($_[0]) }
+
+# Shell completion helper.  Used by lei-completion.bash and hopefully
+# other shells.  Try to do as much here as possible to avoid redundancy
+# and improve maintainability.
+sub lei__complete {
+        my ($self, @argv) = @_; # argv = qw(lei and any other args...)
+        shift @argv; # ignore "lei", the entire command is sent
+        @argv or return puts $self, grep(!/^_/, keys %CMD), qw(--help -h);
+        my $cmd = shift @argv;
+        my $info = $CMD{$cmd} // do { # filter matching commands
+                @argv or puts $self, grep(/\A\Q$cmd\E/, keys %CMD);
+                return;
+        };
+        my ($proto, undef, @spec) = @$info;
+        my $cur = pop @argv;
+        my $re = defined($cur) ? qr/\A\Q$cur\E/ : qr/./;
+        if (substr($cur // '-', 0, 1) eq '-') { # --switches
+                # gross special case since the only git-config options
+                # Consider moving to a table if we need more special cases
+                # we use Getopt::Long for are the ones we reject, so these
+                # are the ones we don't reject:
+                if ($cmd eq 'config') {
+                        puts $self, grep(/$re/, keys %CONFIG_KEYS);
+                        @spec = qw(add z|null get get-all unset unset-all
+                                replace-all get-urlmatch
+                                remove-section rename-section
+                                name-only list|l edit|e
+                                get-color-name get-colorbool);
+                        # fall-through
+                }
+                # TODO: arg support
+                puts $self, grep(/$re/, map { # generate short/long names
+                        my $eq = '';
+                        if (s/=.+\z//) { # required arg, e.g. output|o=i
+                                $eq = '=';
+                        } elsif (s/:.+\z//) { # optional arg, e.g. mid:s
+                        } else { # negation: solve! => no-solve|solve
+                                s/\A(.+)!\z/no-$1|$1/;
+                        }
+                        map {
+                                length > 1 ? "--$_$eq" : "-$_"
+                        } split(/\|/, $_, -1) # help|h
+                } grep { $OPTDESC{"$cmd\t$_"} || $OPTDESC{$_} } @spec);
+        } elsif ($cmd eq 'config' && !@argv && !$CONFIG_KEYS{$cur}) {
+                puts $self, grep(/$re/, keys %CONFIG_KEYS);
+        }
+        $cmd =~ tr/-/_/;
+        if (my $sub = $self->can("_complete_$cmd")) {
+                puts $self, $sub->($self, @argv, $cur);
+        }
+        # TODO: URLs, pathnames, OIDs, MIDs, etc...  See optparse() for
+        # proto parsing.
+}
+
+sub reap_exec { # dwaitpid callback
+        my ($self, $pid) = @_;
+        x_it($self, $?);
+}
+
+sub lei_git { # support passing through random git commands
+        my ($self, @argv) = @_;
+        my %rdr = map { $_ => $self->{$_} } (0..2);
+        my $pid = spawn(['git', @argv], $self->{env}, \%rdr);
+        dwaitpid($pid, \&reap_exec, $self);
+}
+
+sub exec_buf ($$) {
+        my ($argv, $env) = @_;
+        my $argc = scalar @$argv;
+        my $buf = 'exec '.join("\0", scalar(@$argv), @$argv);
+        while (my ($k, $v) = each %$env) { $buf .= "\0$k=$v" };
+        $buf;
+}
+
+sub start_mua {
+        my ($self) = @_;
+        my $mua = $self->{opt}->{'mua-cmd'} // return;
+        my $mfolder = $self->{ovv}->{dst};
+        my (@cmd, $replaced);
+        if ($mua =~ /\A(?:mutt|mailx|mail|neomutt)\z/) {
+                @cmd = ($mua, '-f');
+        # TODO: help wanted: other common FOSS MUAs
+        } else {
+                require Text::ParseWords;
+                my @cmd = Text::ParseWords::shellwords($mua);
+                # mutt uses '%f' for open-hook with compressed mbox, we follow
+                @cmd = map { $_ eq '%f' ? ($replaced = $mfolder) : $_ } @cmd;
+        }
+        push @cmd, $mfolder unless defined($replaced);
+        if (my $sock = $self->{sock}) { # lei(1) client process runs it
+                send($sock, exec_buf(\@cmd, {}), MSG_EOR);
+        } else { # oneshot
+                $self->{"mua.pid.$self.$$"} = spawn(\@cmd);
+        }
+}
+
+# caller needs to "-t $self->{1}" to check if tty
+sub start_pager {
+        my ($self) = @_;
+        my $env = $self->{env};
+        my $fh = popen_rd([qw(git var GIT_PAGER)], $env);
+        chomp(my $pager = <$fh> // '');
+        close($fh) or warn "`git var PAGER' error: \$?=$?";
+        return if $pager eq 'cat' || $pager eq '';
+        # TODO TIOCGWINSZ
+        my $new_env = { LESS => 'FRX', LV => '-c', COLUMNS => 80 };
+        $new_env->{MORE} = 'FRX' if $^O eq 'freebsd';
+        pipe(my ($r, $wpager)) or return warn "pipe: $!";
+        my $rdr = { 0 => $r, 1 => $self->{1}, 2 => $self->{2} };
+        my $pgr = [ undef, @$rdr{1, 2}, $$ ];
+        if (my $sock = $self->{sock}) { # lei(1) process runs it
+                delete @$new_env{keys %$env}; # only set iff unset
+                my $fds = [ map { fileno($_) } @$rdr{0..2} ];
+                $send_cmd->($sock, $fds, exec_buf([$pager], $new_env), MSG_EOR);
+        } else {
+                $pgr->[0] = spawn([$pager], $new_env, $rdr);
+        }
+        $self->{1} = $wpager;
+        $self->{2} = $wpager if -t $self->{2};
+        $env->{GIT_PAGER_IN_USE} = 'true'; # we may spawn git
+        $self->{pgr} = $pgr;
+}
+
+sub stop_pager {
+        my ($self) = @_;
+        my $pgr = delete($self->{pgr}) or return;
+        $self->{2} = $pgr->[2];
+        # do not restore original stdout, just close it so we error out
+        close(delete($self->{1})) if $self->{1};
+        my $pid = $pgr->[0];
+        dwaitpid($pid, undef, $self->{sock}) if $pid && $pgr->[3] == $$;
+}
+
+sub accept_dispatch { # Listener {post_accept} callback
+        my ($sock) = @_; # ignore other
+        $sock->autoflush(1);
+        my $self = bless { sock => $sock }, __PACKAGE__;
+        vec(my $rvec = '', fileno($sock), 1) = 1;
+        select($rvec, undef, undef, 1) or
+                return send($sock, 'timed out waiting to recv FDs', MSG_EOR);
+        my @fds = $recv_cmd->($sock, my $buf, 4096 * 33); # >MAX_ARG_STRLEN
+        if (scalar(@fds) == 4) {
+                for my $i (0..3) {
+                        my $fd = shift(@fds);
+                        open($self->{$i}, '+<&=', $fd) and next;
+                        send($sock, "open(+<&=$fd) (FD=$i): $!", MSG_EOR);
+                }
+        } else {
+                return send($sock, "recv_cmd failed: $!", MSG_EOR);
+        }
+        $self->{2}->autoflush(1); # keep stdout buffered until x_it|DESTROY
+        # $ENV_STR = join('', map { "\0$_=$ENV{$_}" } keys %ENV);
+        # $buf = "$$\0$argc\0".join("\0", @ARGV).$ENV_STR."\0\0";
+        substr($buf, -2, 2, '') eq "\0\0" or  # s/\0\0\z//
+                return send($sock, 'request command truncated', MSG_EOR);
+        my ($argc, @argv) = split(/\0/, $buf, -1);
+        undef $buf;
+        my %env = map { split(/=/, $_, 2) } splice(@argv, $argc);
+        if (chdir(delete($self->{3}))) {
+                local %ENV = %env;
+                $self->{env} = \%env;
+                eval { dispatch($self, @argv) };
+                send($sock, $@, MSG_EOR) if $@;
+        } else {
+                send($sock, "fchdir: $!", MSG_EOR); # implicit close
+        }
+}
+
+sub dclose {
+        my ($self) = @_;
+        for my $f (qw(lxs l2m)) {
+                my $wq = delete $self->{$f} or next;
+                if ($wq->wq_kill) {
+                        $self->wq_close
+                } elsif ($wq->wq_kill_old) {
+                        $wq->wq_wait_old;
+                }
+        }
+        close(delete $self->{1}) if $self->{1}; # may reap_compress
+        $self->close if $self->{sock}; # PublicInbox::DS::close
+}
+
+# for long-running results
+sub event_step {
+        my ($self) = @_;
+        local %ENV = %{$self->{env}};
+        my $sock = $self->{sock};
+        local $current_lei = $self;
+        eval {
+                while (my @fds = $recv_cmd->($sock, my $buf, 4096)) {
+                        if (scalar(@fds) == 1 && !defined($fds[0])) {
+                                return if $! == EAGAIN;
+                                next if $! == EINTR;
+                                last if $! == ECONNRESET;
+                                die "recvmsg: $!";
+                        }
+                        for my $fd (@fds) {
+                                open my $rfh, '+<&=', $fd;
+                        }
+                        die "unrecognized client signal: $buf";
+                }
+                dclose($self);
+        };
+        if (my $err = $@) {
+                eval { $self->fail($err) };
+                dclose($self);
+        }
+}
+
+sub event_step_init {
+        my ($self) = @_;
+        if (my $sock = $self->{sock}) { # using DS->EventLoop
+                $sock->blocking(0);
+                $self->SUPER::new($sock, EPOLLIN|EPOLLET);
+        }
+}
+
+sub noop {}
+
+our $oldset; sub oldset { $oldset }
+
+sub dump_and_clear_log {
+        if (defined($errors_log) && -s STDIN && seek(STDIN, 0, SEEK_SET)) {
+                my @pfx = @_;
+                unshift(@pfx, "$errors_log ") if @pfx;
+                warn @pfx, do { local $/; <STDIN> };
+                truncate(STDIN, 0) or warn "ftruncate ($errors_log): $!";
+        }
+}
+
+# lei(1) calls this when it can't connect
+sub lazy_start {
+        my ($path, $errno, $narg) = @_;
+        if ($errno == ECONNREFUSED) {
+                unlink($path) or die "unlink($path): $!";
+        } elsif ($errno != ENOENT) {
+                $! = $errno; # allow interpolation to stringify in die
+                die "connect($path): $!";
+        }
+        umask(077) // die("umask(077): $!");
+        local $listener;
+        socket($listener, AF_UNIX, SOCK_SEQPACKET, 0) or die "socket: $!";
+        bind($listener, pack_sockaddr_un($path)) or die "bind($path): $!";
+        listen($listener, 1024) or die "listen: $!";
+        my @st = stat($path) or die "stat($path): $!";
+        my $dev_ino_expect = pack('dd', $st[0], $st[1]); # dev+ino
+        local $oldset = PublicInbox::DS::block_signals();
+        if ($narg == 5) {
+                $send_cmd = PublicInbox::Spawn->can('send_cmd4');
+                $recv_cmd = PublicInbox::Spawn->can('recv_cmd4') // do {
+                        require PublicInbox::CmdIPC4;
+                        $send_cmd = PublicInbox::CmdIPC4->can('send_cmd4');
+                        PublicInbox::CmdIPC4->can('recv_cmd4');
+                };
+        }
+        $recv_cmd or die <<"";
+(Socket::MsgHdr || Inline::C) missing/unconfigured (narg=$narg);
+
+        require PublicInbox::Listener;
+        require PublicInbox::EOFpipe;
+        (-p STDOUT) or die "E: stdout must be a pipe\n";
+        local $errors_log;
+        ($errors_log) = ($path =~ m!\A(.+?/)[^/]+\z!);
+        $errors_log .= 'errors.log';
+        open(STDIN, '+>>', $errors_log) or die "open($errors_log): $!";
+        STDIN->autoflush(1);
+        dump_and_clear_log("from previous daemon process:\n");
+        POSIX::setsid() > 0 or die "setsid: $!";
+        my $pid = fork // die "fork: $!";
+        return if $pid;
+        $0 = "lei-daemon $path";
+        local %PATH2CFG;
+        $listener->blocking(0);
+        my $exit_code;
+        my $pil = PublicInbox::Listener->new($listener, \&accept_dispatch);
+        local $quit = do {
+                pipe(my ($eof_r, $eof_w)) or die "pipe: $!";
+                PublicInbox::EOFpipe->new($eof_r, \&noop, undef);
+                sub {
+                        $exit_code //= shift;
+                        my $lis = $pil or exit($exit_code);
+                        # closing eof_w triggers \&noop wakeup
+                        $listener = $eof_w = $pil = $path = undef;
+                        $lis->close; # DS::close
+                        PublicInbox::DS->SetLoopTimeout(1000);
+                };
+        };
+        my $sig = {
+                CHLD => \&PublicInbox::DS::enqueue_reap,
+                QUIT => $quit,
+                INT => $quit,
+                TERM => $quit,
+                HUP => \&noop,
+                USR1 => \&noop,
+                USR2 => \&noop,
+        };
+        my $sigfd = PublicInbox::Sigfd->new($sig, SFD_NONBLOCK);
+        local @SIG{keys %$sig} = values(%$sig) unless $sigfd;
+        undef $sig;
+        local $SIG{PIPE} = 'IGNORE';
+        if ($sigfd) { # TODO: use inotify/kqueue to detect unlinked sockets
+                undef $sigfd;
+                PublicInbox::DS->SetLoopTimeout(5000);
+        } else {
+                # wake up every second to accept signals if we don't
+                # have signalfd or IO::KQueue:
+                PublicInbox::DS::sig_setmask($oldset);
+                PublicInbox::DS->SetLoopTimeout(1000);
+        }
+        PublicInbox::DS->SetPostLoopCallback(sub {
+                my ($dmap, undef) = @_;
+                if (@st = defined($path) ? stat($path) : ()) {
+                        if ($dev_ino_expect ne pack('dd', $st[0], $st[1])) {
+                                warn "$path dev/ino changed, quitting\n";
+                                $path = undef;
+                        }
+                } elsif (defined($path)) {
+                        warn "stat($path): $!, quitting ...\n";
+                        undef $path; # don't unlink
+                        $quit->();
+                }
+                return 1 if defined($path);
+                my $now = now();
+                my $n = 0;
+                for my $s (values %$dmap) {
+                        $s->can('busy') or next;
+                        if ($s->busy($now)) {
+                                ++$n;
+                        } else {
+                                $s->close;
+                        }
+                }
+                $n; # true: continue, false: stop
+        });
+
+        # STDIN was redirected to /dev/null above, closing STDERR and
+        # STDOUT will cause the calling `lei' client process to finish
+        # reading the <$daemon> pipe.
+        openlog($path, 'pid', 'user');
+        local $SIG{__WARN__} = sub {
+                $current_lei ? err($current_lei, @_) : syslog('warning', "@_");
+        };
+        my $on_destroy = PublicInbox::OnDestroy->new($$, sub {
+                syslog('crit', "$@") if $@;
+        });
+        open STDERR, '>&STDIN' or die "redirect stderr failed: $!";
+        open STDOUT, '>&STDIN' or die "redirect stdout failed: $!";
+        # $daemon pipe to `lei' closed, main loop begins:
+        PublicInbox::DS->EventLoop;
+        @$on_destroy = (); # cancel on_destroy if we get here
+        exit($exit_code // 0);
+}
+
+# for users w/o Socket::Msghdr installed or Inline::C enabled
+sub oneshot {
+        my ($main_pkg) = @_;
+        my $exit = $main_pkg->can('exit'); # caller may override exit()
+        local $quit = $exit if $exit;
+        local %PATH2CFG;
+        umask(077) // die("umask(077): $!");
+        my $self = bless {
+                0 => *STDIN{GLOB},
+                1 => *STDOUT{GLOB},
+                2 => *STDERR{GLOB},
+                env => \%ENV
+        }, __PACKAGE__;
+        dispatch($self, @ARGV);
+        x_it($self, $self->{child_error}) if $self->{child_error};
+}
+
+# ensures stdout hits the FS before sock disconnects so a client
+# can immediately reread it
+sub DESTROY {
+        my ($self) = @_;
+        $self->{1}->autoflush(1) if $self->{1};
+        stop_pager($self);
+        if (my $mua_pid = delete $self->{"mua.pid.$self.$$"}) {
+                waitpid($mua_pid, 0);
+        }
+}
+
+1;
diff --git a/lib/PublicInbox/LeiDedupe.pm b/lib/PublicInbox/LeiDedupe.pm
new file mode 100644
index 00000000..3f478aa4
--- /dev/null
+++ b/lib/PublicInbox/LeiDedupe.pm
@@ -0,0 +1,131 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+package PublicInbox::LeiDedupe;
+use strict;
+use v5.10.1;
+use PublicInbox::SharedKV;
+use PublicInbox::ContentHash qw(content_hash);
+
+# n.b. mutt sets most of these headers not sure about Bytes
+our @OID_IGNORE = qw(Status X-Status Content-Length Lines Bytes);
+
+# best-effort regeneration of OID when augmenting existing results
+sub _regen_oid ($) {
+        my ($eml) = @_;
+        my @stash; # stash away headers we shouldn't have in git
+        for my $k (@OID_IGNORE) {
+                my @v = $eml->header_raw($k) or next;
+                push @stash, [ $k, \@v ];
+                $eml->header_set($k); # restore below
+        }
+        my $dig = Digest::SHA->new(1); # XXX SHA256 later
+        my $buf = $eml->as_string;
+        $dig->add('blob '.length($buf)."\0");
+        $dig->add($buf);
+        undef $buf;
+
+        for my $kv (@stash) { # restore stashed headers
+                my ($k, @v) = @$kv;
+                $eml->header_set($k, @v);
+        }
+        $dig->digest;
+}
+
+sub _oidbin ($) { defined($_[0]) ? pack('H*', $_[0]) : undef }
+
+sub smsg_hash ($) {
+        my ($smsg) = @_;
+        my $dig = Digest::SHA->new(256);
+        my $x = join("\0", @$smsg{qw(from to cc ds subject references mid)});
+        utf8::encode($x);
+        $dig->add($x);
+        $dig->digest;
+}
+
+# the paranoid option
+sub dedupe_oid ($) {
+        my ($skv) = @_;
+        (sub { # may be called in a child process
+                my ($eml, $oid) = @_;
+                $skv->set_maybe(_oidbin($oid) // _regen_oid($eml), '');
+        }, sub {
+                my ($smsg) = @_;
+                $skv->set_maybe(_oidbin($smsg->{blob}), '');
+        });
+}
+
+# dangerous if there's duplicate messages with different Message-IDs
+sub dedupe_mid ($) {
+        my ($skv) = @_;
+        (sub { # may be called in a child process
+                my ($eml, $oid) = @_;
+                # TODO: lei will support non-public messages w/o Message-ID
+                my $mid = $eml->header_raw('Message-ID') // _oidbin($oid) //
+                        content_hash($eml);
+                $skv->set_maybe($mid, '');
+        }, sub {
+                my ($smsg) = @_;
+                my $mid = $smsg->{mid};
+                $mid = undef if $mid eq '';
+                $mid //= smsg_hash($smsg) // _oidbin($smsg->{blob});
+                $skv->set_maybe($mid, '');
+        });
+}
+
+# our default deduplication strategy (used by v2, also)
+sub dedupe_content ($) {
+        my ($skv) = @_;
+        (sub { # may be called in a child process
+                my ($eml) = @_; # oid = $_[1], ignored
+                $skv->set_maybe(content_hash($eml), '');
+        }, sub {
+                my ($smsg) = @_;
+                $skv->set_maybe(smsg_hash($smsg), '');
+        });
+}
+
+# no deduplication at all
+sub true { 1 }
+sub dedupe_none ($) { (\&true, \&true) }
+
+sub new {
+        my ($cls, $lei) = @_;
+        my $dd = $lei->{opt}->{dedupe} // 'content';
+        my $dst = $lei->{ovv}->{dst};
+
+        # allow "none" to bypass Eml->new if writing to directory:
+        return if ($dd eq 'none' && substr($dst // '', -1) eq '/');
+        my $m = "dedupe_$dd";
+        $cls->can($m) or die "unsupported dedupe strategy: $dd\n";
+        my $skv = $dd eq 'none' ? undef : PublicInbox::SharedKV->new;
+
+        # [ $skv, $eml_cb, $smsg_cb, "dedupe_$dd" ]
+        bless [ $skv, undef, undef, $m ], $cls;
+}
+
+# returns true on unseen messages according to the deduplication strategy,
+# returns false if seen
+sub is_dup {
+        my ($self, $eml, $oid) = @_;
+        !$self->[1]->($eml, $oid);
+}
+
+sub is_smsg_dup {
+        my ($self, $smsg) = @_;
+        !$self->[2]->($smsg);
+}
+
+sub prepare_dedupe {
+        my ($self) = @_;
+        my $skv = $self->[0];
+        $self->[1] or @$self[1,2] = $self->can($self->[3])->($skv);
+        $skv ? $skv->dbh : undef;
+}
+
+sub pause_dedupe {
+        my ($self) = @_;
+        my $skv = $self->[0];
+        delete($skv->{dbh}) if $skv;
+}
+
+1;
diff --git a/lib/PublicInbox/LeiExternal.pm b/lib/PublicInbox/LeiExternal.pm
new file mode 100644
index 00000000..bf07c41c
--- /dev/null
+++ b/lib/PublicInbox/LeiExternal.pm
@@ -0,0 +1,142 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# *-external commands of lei
+package PublicInbox::LeiExternal;
+use strict;
+use v5.10.1;
+use parent qw(Exporter);
+our @EXPORT = qw(lei_ls_external lei_add_external lei_forget_external);
+use PublicInbox::Config;
+
+sub _externals_each {
+        my ($self, $cb, @arg) = @_;
+        my $cfg = $self->_lei_cfg(0);
+        my %boost;
+        for my $sec (grep(/\Aexternal\./, @{$cfg->{-section_order}})) {
+                my $loc = substr($sec, length('external.'));
+                $boost{$loc} = $cfg->{"$sec.boost"};
+        }
+        return \%boost if !wantarray && !$cb;
+
+        # highest boost first, but stable for alphabetic tie break
+        use sort 'stable';
+        my @order = sort { $boost{$b} <=> $boost{$a} } sort keys %boost;
+        return @order if !$cb;
+        for my $loc (@order) {
+                $cb->(@arg, $loc, $boost{$loc});
+        }
+        @order; # scalar or array
+}
+
+sub lei_ls_external {
+        my ($self, @argv) = @_;
+        my $out = $self->{1};
+        my ($OFS, $ORS) = $self->{opt}->{z} ? ("\0", "\0\0") : (" ", "\n");
+        $self->_externals_each(sub {
+                my ($loc, $boost_val) = @_;
+                print $out $loc, $OFS, 'boost=', $boost_val, $ORS;
+        });
+}
+
+sub _canonicalize {
+        my ($location) = @_;
+        if ($location !~ m!\Ahttps?://!) {
+                PublicInbox::Config::rel2abs_collapsed($location);
+        } else {
+                require URI;
+                my $uri = URI->new($location)->canonical;
+                my $path = $uri->path . '/';
+                $path =~ tr!/!/!s; # squeeze redundant '/'
+                $uri->path($path);
+                $uri->as_string;
+        }
+}
+
+sub lei_add_external {
+        my ($self, $location) = @_;
+        my $cfg = $self->_lei_cfg(1);
+        my $new_boost = $self->{opt}->{boost} // 0;
+        $location = _canonicalize($location);
+        if ($location !~ m!\Ahttps?://! && !-d $location) {
+                return $self->fail("$location not a directory");
+        }
+        my $key = "external.$location.boost";
+        my $cur_boost = $cfg->{$key};
+        return if defined($cur_boost) && $cur_boost == $new_boost; # idempotent
+        $self->lei_config($key, $new_boost);
+        $self->_lei_store(1)->done; # just create the store
+}
+
+sub lei_forget_external {
+        my ($self, @locations) = @_;
+        my $cfg = $self->_lei_cfg(1);
+        my $quiet = $self->{opt}->{quiet};
+        my %seen;
+        for my $loc (@locations) {
+                my (@unset, @not_found);
+                for my $l ($loc, _canonicalize($loc)) {
+                        next if $seen{$l}++;
+                        my $key = "external.$l.boost";
+                        delete($cfg->{$key});
+                        $self->_config('--unset', $key);
+                        if ($? == 0) {
+                                push @unset, $l;
+                        } elsif (($? >> 8) == 5) {
+                                push @not_found, $l;
+                        } else {
+                                $self->err("# --unset $key error");
+                                return $self->x_it($?);
+                        }
+                }
+                if (@unset) {
+                        next if $quiet;
+                        $self->err("# $_ gone") for @unset;
+                } elsif (@not_found) {
+                        $self->err("# $_ not found") for @not_found;
+                } # else { already exited
+        }
+}
+
+# shell completion helper called by lei__complete
+sub _complete_forget_external {
+        my ($self, @argv) = @_;
+        my $cfg = $self->_lei_cfg(0);
+        my $cur = pop @argv;
+        # Workaround bash word-splitting URLs to ['https', ':', '//' ...]
+        # Maybe there's a better way to go about this in
+        # contrib/completion/lei-completion.bash
+        my $re = '';
+        if (@argv) {
+                my @x = @argv;
+                if ($cur eq ':' && @x) {
+                        push @x, $cur;
+                        $cur = '';
+                }
+                while (@x > 2 && $x[0] !~ /\Ahttps?\z/ && $x[1] ne ':') {
+                        shift @x;
+                }
+                if (@x >= 2) { # qw(https : hostname : 443) or qw(http :)
+                        $re = join('', @x);
+                } else { # just filter out the flags and hope for the best
+                        $re = join('', grep(!/^-/, @argv));
+                }
+                $re = quotemeta($re);
+        }
+        # FIXME: bash completion off "http:" or "https:" when the last
+        # character is a colon doesn't work properly even if we're
+        # returning "//$HTTP_HOST/$PATH_INFO/", not sure why, could
+        # be a bash issue.
+        map {
+                my $x = substr($_, length('external.'));
+                # only return the part specified on the CLI
+                if ($x =~ /\A$re(\Q$cur\E.*)/) {
+                        # don't duplicate if already 100% completed
+                        $cur eq $1 ? () : $1;
+                } else {
+                        ();
+                }
+        } grep(/\Aexternal\.$re\Q$cur/, @{$cfg->{-section_order}});
+}
+
+1;
diff --git a/lib/PublicInbox/LeiOverview.pm b/lib/PublicInbox/LeiOverview.pm
new file mode 100644
index 00000000..928d66cb
--- /dev/null
+++ b/lib/PublicInbox/LeiOverview.pm
@@ -0,0 +1,294 @@
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# per-mitem/smsg iterators for search results
+# "ovv" => "Overview viewer"
+package PublicInbox::LeiOverview;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::Lock);
+use POSIX qw(strftime);
+use Fcntl qw(F_GETFL O_APPEND);
+use File::Spec;
+use File::Temp ();
+use PublicInbox::MID qw($MID_EXTRACT);
+use PublicInbox::Address qw(pairs);
+use PublicInbox::Config;
+use PublicInbox::Search qw(get_pct);
+use PublicInbox::LeiDedupe;
+use PublicInbox::LeiToMail;
+
+# cf. https://en.wikipedia.org/wiki/JSON_streaming
+my $JSONL = 'ldjson|ndjson|jsonl'; # 3 names for the same thing
+
+sub _iso8601 ($) { strftime('%Y-%m-%dT%H:%M:%SZ', gmtime($_[0])) }
+
+# we open this in the parent process before ->wq_do handoff
+sub ovv_out_lk_init ($) {
+        my ($self) = @_;
+        $self->{tmp_lk_id} = "$self.$$";
+        my $tmp = File::Temp->new("lei-ovv.dst.$$.lock-XXXXXX",
+                                        TMPDIR => 1, UNLINK => 0);
+        $self->{lock_path} = $tmp->filename;
+}
+
+sub ovv_out_lk_cancel ($) {
+        my ($self) = @_;
+        ($self->{tmp_lk_id}//'') eq "$self.$$" and
+                unlink(delete($self->{lock_path}));
+}
+
+sub detect_fmt ($$) {
+        my ($lei, $dst) = @_;
+        if ($dst =~ m!\A([:/]+://)!) {
+                $lei->fail("$1 support not implemented, yet\n");
+        } elsif (!-e $dst || -d _) {
+                'maildir'; # the default TODO: MH?
+        } elsif (-f _ || -p _) {
+                $lei->fail("unable to determine mbox family of $dst\n");
+        } else {
+                $lei->fail("unable to determine format of $dst\n");
+        }
+}
+
+sub new {
+        my ($class, $lei) = @_;
+        my $opt = $lei->{opt};
+        my $dst = $opt->{output} // '-';
+        $dst = '/dev/stdout' if $dst eq '-';
+
+        my $fmt = $opt->{'format'};
+        $fmt = lc($fmt) if defined $fmt;
+        if ($dst =~ s/\A([a-z0-9]+)://is) { # e.g. Maildir:/home/user/Mail/
+                my $ofmt = lc $1;
+                $fmt //= $ofmt;
+                return $lei->fail(<<"") if $fmt ne $ofmt;
+--format=$fmt and --output=$ofmt conflict
+
+        }
+        $fmt //= 'json' if $dst eq '/dev/stdout';
+        $fmt //= detect_fmt($lei, $dst) or return;
+
+        if (index($dst, '://') < 0) { # not a URL, so assume path
+                 $dst = File::Spec->canonpath($dst);
+        } # else URL
+
+        my $self = bless { fmt => $fmt, dst => $dst }, $class;
+        $lei->{ovv} = $self;
+        my $json;
+        if ($fmt =~ /\A($JSONL|(?:concat)?json)\z/) {
+                $json = $self->{json} = ref(PublicInbox::Config->json);
+        }
+        my ($isatty, $seekable);
+        if ($dst eq '/dev/stdout') {
+                $isatty = -t $lei->{1};
+                $lei->start_pager if $isatty;
+                $opt->{pretty} //= $isatty;
+                if (!$isatty && -f _) {
+                        my $fl = fcntl($lei->{1}, F_GETFL, 0) //
+                                return $lei->fail("fcntl(stdout): $!");
+                        ovv_out_lk_init($self) unless ($fl & O_APPEND);
+                } else {
+                        ovv_out_lk_init($self);
+                }
+        }
+        if (!$json) {
+                # default to the cheapest sort since MUA usually resorts
+                $lei->{opt}->{'sort'} //= 'docid' if $dst ne '/dev/stdout';
+                $lei->{l2m} = eval { PublicInbox::LeiToMail->new($lei) };
+                return $lei->fail($@) if $@;
+        }
+        $lei->{dedupe} //= PublicInbox::LeiDedupe->new($lei);
+        $self;
+}
+
+# called once by parent
+sub ovv_begin {
+        my ($self, $lei) = @_;
+        if ($self->{fmt} eq 'json') {
+                print { $lei->{1} } '[';
+        } # TODO HTML/Atom/...
+}
+
+# called once by parent (via PublicInbox::EOFpipe)
+sub ovv_end {
+        my ($self, $lei) = @_;
+        my $out = $lei->{1} or return;
+        if ($self->{fmt} eq 'json') {
+                # JSON doesn't allow trailing commas, and preventing
+                # trailing commas is a PITA when parallelizing outputs
+                print $out "null]\n";
+        } elsif ($self->{fmt} eq 'concatjson') {
+                print $out "\n";
+        }
+}
+
+sub ovv_atfork_child {
+        my ($self) = @_;
+        # reopen dedupe here
+}
+
+# prepares an smsg for JSON
+sub _unbless_smsg {
+        my ($smsg, $mitem) = @_;
+
+        delete @$smsg{qw(lines bytes num tid)};
+        $smsg->{rt} = _iso8601(delete $smsg->{ts}); # JMAP receivedAt
+        $smsg->{dt} = _iso8601(delete $smsg->{ds}); # JMAP UTCDate
+        $smsg->{pct} = get_pct($mitem) if $mitem;
+        if (my $r = delete $smsg->{references}) {
+                $smsg->{refs} = [ map { "<$_>" } ($r =~ m/$MID_EXTRACT/go) ];
+        }
+        if (my $m = delete($smsg->{mid})) {
+                $smsg->{'m'} = "<$m>";
+        }
+        for my $f (qw(from to cc)) {
+                my $v = delete $smsg->{$f} or next;
+                $smsg->{substr($f, 0, 1)} = pairs($v);
+        }
+        $smsg->{'s'} = delete $smsg->{subject};
+        # can we be bothered to parse From/To/Cc into arrays?
+        scalar { %$smsg }; # unbless
+}
+
+sub ovv_atexit_child {
+        my ($self, $lei) = @_;
+        if (my $l2m = delete $lei->{l2m}) {
+                # gracefully stop lei2mail processes after all
+                # ->write_mail work is complete
+                delete $l2m->{-wq_s1};
+                if (my $rd = delete $l2m->{each_smsg_done}) {
+                        read($rd, my $buf, 1); # wait for EOF
+                }
+        }
+        # order matters, git->{-tmp}->DESTROY must not fire until
+        # {each_smsg_done} hits EOF above
+        if (my $git = delete $self->{git}) {
+                $git->async_wait_all;
+        }
+        if (my $bref = delete $lei->{ovv_buf}) {
+                my $out = $lei->{1} or return;
+                my $lk = $self->lock_for_scope;
+                print $out $$bref;
+        }
+}
+
+# JSON module ->pretty output wastes too much vertical white space,
+# this (IMHO) provides better use of screen real-estate while not
+# being excessively compact:
+sub _json_pretty {
+        my ($json, $k, $v) = @_;
+        if (ref $v eq 'ARRAY') {
+                if (@$v) {
+                        my $sep = ",\n" . (' ' x (length($k) + 7));
+                        if (ref($v->[0])) { # f/t/c
+                                $v = '[' . join($sep, map {
+                                        my $pair = $json->encode($_);
+                                        $pair =~ s/(null|"),"/$1, "/g;
+                                        $pair;
+                                } @$v) . ']';
+                        } else { # references
+                                $v = '[' . join($sep, map {
+                                        substr($json->encode([$_]), 1, -1);
+                                } @$v) . ']';
+                        }
+                } else {
+                        $v = '[]';
+                }
+        }
+        qq{  "$k": }.$v;
+}
+
+sub ovv_each_smsg_cb { # runs in wq worker usually
+        my ($self, $lei, $ibxish) = @_;
+        my $json;
+        $lei->{1}->autoflush(1);
+        if (my $pkg = $self->{json}) {
+                $json = $pkg->new;
+                $json->utf8->canonical;
+                $json->ascii(1) if $lei->{opt}->{ascii};
+        }
+        my $l2m = $lei->{l2m};
+        if ($l2m && !$ibxish) { # remote https?:// mboxrd
+                delete $l2m->{-wq_s1};
+                my $g2m = $l2m->can('git_to_mail');
+                my $wcb = $l2m->write_cb($lei);
+                sub {
+                        my ($smsg, undef, $eml) = @_; # no mitem in $_[1]
+                        $wcb->(undef, $smsg, $eml);
+                };
+        } elsif ($l2m && $l2m->{-wq_s1}) {
+                my ($lei_ipc, @io) = $lei->atfork_parent_wq($l2m);
+                # n.b. $io[0] = qry_status_wr, $io[1] = mbox|stdout,
+                # $io[4] becomes a notification pipe that triggers EOF
+                # in this wq worker when all outstanding ->write_mail
+                # calls are complete
+                die "BUG: \$io[4] $io[4] unexpected" if $io[4];
+                pipe($l2m->{each_smsg_done}, $io[4]) or die "pipe: $!";
+                fcntl($io[4], 1031, 4096) if $^O eq 'linux';
+                delete @$lei_ipc{qw(l2m opt mset_opt cmd)};
+                my $git = $ibxish->git; # (LeiXSearch|Inbox|ExtSearch)->git
+                $self->{git} = $git;
+                my $git_dir = $git->{git_dir};
+                sub {
+                        my ($smsg, $mitem) = @_;
+                        $smsg->{pct} = get_pct($mitem) if $mitem;
+                        $l2m->wq_do('write_mail', \@io, $git_dir, $smsg,
+                                        $lei_ipc);
+                }
+        } elsif ($l2m) {
+                my $wcb = $l2m->write_cb($lei);
+                my $git = $ibxish->git; # (LeiXSearch|Inbox|ExtSearch)->git
+                $self->{git} = $git; # for ovv_atexit_child
+                my $g2m = $l2m->can('git_to_mail');
+                sub {
+                        my ($smsg, $mitem) = @_;
+                        $smsg->{pct} = get_pct($mitem) if $mitem;
+                        $git->cat_async($smsg->{blob}, $g2m, [ $wcb, $smsg ]);
+                };
+        } elsif ($self->{fmt} =~ /\A(concat)?json\z/ && $lei->{opt}->{pretty}) {
+                my $EOR = ($1//'') eq 'concat' ? "\n}" : "\n},";
+                $lei->{ovv_buf} = \(my $buf = '');
+                sub { # DIY prettiness :P
+                        my ($smsg, $mitem) = @_;
+                        $smsg = _unbless_smsg($smsg, $mitem);
+                        $buf .= "{\n";
+                        $buf .= join(",\n", map {
+                                my $v = $smsg->{$_};
+                                if (ref($v)) {
+                                        _json_pretty($json, $_, $v);
+                                } else {
+                                        $v = $json->encode([$v]);
+                                        qq{  "$_": }.substr($v, 1, -1);
+                                }
+                        } sort keys %$smsg);
+                        $buf .= $EOR;
+                        if (length($buf) > 65536) {
+                                my $lk = $self->lock_for_scope;
+                                print { $lei->{1} } $buf;
+                                $buf = '';
+                        }
+                }
+        } elsif ($json) {
+                my $ORS = $self->{fmt} eq 'json' ? ",\n" : "\n"; # JSONL
+                $lei->{ovv_buf} = \(my $buf = '');
+                sub {
+                        my ($smsg, $mitem) = @_;
+                        $buf .= $json->encode(_unbless_smsg(@_)) . $ORS;
+                        if (length($buf) > 65536) {
+                                my $lk = $self->lock_for_scope;
+                                print { $lei->{1} } $buf;
+                                $buf = '';
+                        }
+                }
+        } elsif ($self->{fmt} eq 'oid') {
+                sub {
+                        my ($smsg, $mitem) = @_;
+                }
+        } # else { ...
+}
+
+no warnings 'once';
+*DESTROY = \&ovv_out_lk_cancel;
+
+1;
diff --git a/lib/PublicInbox/LeiQuery.pm b/lib/PublicInbox/LeiQuery.pm
new file mode 100644
index 00000000..953d1fc2
--- /dev/null
+++ b/lib/PublicInbox/LeiQuery.pm
@@ -0,0 +1,119 @@
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# handles lei <q|ls-query|rm-query|mv-query> commands
+package PublicInbox::LeiQuery;
+use strict;
+use v5.10.1;
+use PublicInbox::DS qw(dwaitpid);
+
+# the main "lei q SEARCH_TERMS" method
+sub lei_q {
+        my ($self, @argv) = @_;
+        require PublicInbox::LeiXSearch;
+        require PublicInbox::LeiOverview;
+        PublicInbox::Config->json; # preload before forking
+        my $opt = $self->{opt};
+        my $lxs = $self->{lxs} = PublicInbox::LeiXSearch->new;
+        # any number of LeiXSearch || LeiSearch || Inbox
+        if ($opt->{'local'} //= 1) { # --local is enabled by default
+                my $sto = $self->_lei_store(1);
+                $lxs->prepare_external($sto->search);
+        }
+
+        # --external is enabled by default, but allow --no-external
+        if ($opt->{external} //= 1) {
+                my $cb = $lxs->can('prepare_external');
+                my $ne = $self->_externals_each($cb, $lxs);
+                $opt->{remote} //= $ne == $lxs->remotes;
+                if ($opt->{'local'}) {
+                        delete($lxs->{remotes}) if !$opt->{remote};
+                } else {
+                        delete($lxs->{locals});
+                }
+        }
+        unless ($lxs->locals || $lxs->remotes) {
+                return $self->fail('no local or remote inboxes to search');
+        }
+        my $xj = $lxs->concurrency($opt);
+        my $ovv = PublicInbox::LeiOverview->new($self) or return;
+        $self->atfork_prepare_wq($lxs);
+        $lxs->wq_workers_start('lei_xsearch', $xj, $self->oldset);
+        delete $lxs->{-ipc_atfork_child_close};
+        if (my $l2m = $self->{l2m}) {
+                my $mj = 4; # TODO: configurable
+                $self->atfork_prepare_wq($l2m);
+                $l2m->wq_workers_start('lei2mail', $mj, $self->oldset);
+                delete $l2m->{-ipc_atfork_child_close};
+        }
+
+        # no forking workers after this
+
+        my %mset_opt = map { $_ => $opt->{$_} } qw(thread limit offset);
+        $mset_opt{asc} = $opt->{'reverse'} ? 1 : 0;
+        $mset_opt{qstr} = join(' ', map {;
+                # Consider spaces in argv to be for phrase search in Xapian.
+                # In other words, the users should need only care about
+                # normal shell quotes and not have to learn Xapian quoting.
+                /\s/ ? (s/\A(\w+:)// ? qq{$1"$_"} : qq{"$_"}) : $_
+        } @argv);
+        if (defined(my $sort = $opt->{'sort'})) {
+                if ($sort eq 'relevance') {
+                        $mset_opt{relevance} = 1;
+                } elsif ($sort eq 'docid') {
+                        $mset_opt{relevance} = $mset_opt{asc} ? -1 : -2;
+                } elsif ($sort =~ /\Areceived(?:-?[aA]t)?\z/) {
+                        # the default
+                } else {
+                        die "unrecognized --sort=$sort\n";
+                }
+        }
+        # descending docid order
+        $mset_opt{relevance} //= -2 if $opt->{thread};
+        $self->{mset_opt} = \%mset_opt;
+        $ovv->ovv_begin($self);
+        $lxs->do_query($self);
+}
+
+# Stuff we may pass through to curl (as of 7.64.0), see curl manpage for
+# details, so most options which make sense for HTTP/HTTPS (including proxy
+# support for Tor and other methods of getting past weird networks).
+# Most of these are untested by us, some may not make sense for our use case
+# and typos below are likely.
+# n.b. some short options (-$NUMBER) are not supported since they conflict
+# with other "lei q" switches.
+# FIXME: Getopt::Long doesn't easily let us support support options with
+# '.' in them (e.g. --http1.1)
+sub curl_opt { qw(
+        abstract-unix-socket=s anyauth basic cacert=s capath=s
+        cert-status cert-type cert|E=s ciphers=s config|K=s@
+        connect-timeout=s connect-to=s cookie-jar|c=s cookie|b=s crlfile=s
+        digest disable dns-interface=s dns-ipv4-addr=s dns-ipv6-addr=s
+        dns-servers=s doh-url=s egd-file=s engine=s false-start
+        happy-eyeballs-timeout-ms=s haproxy-protocol header|H=s@
+        http2-prior-knowledge http2 insecure|k
+        interface=s ipv4 ipv6 junk-session-cookies
+        key-type=s key=s limit-rate=s local-port=s location-trusted location|L
+        max-redirs=i max-time=s negotiate netrc-file=s netrc-optional netrc
+        no-alpn no-buffer|N no-npn no-sessionid noproxy=s ntlm-wb ntlm
+        pass=s pinnedpubkey=s post301 post302 post303 preproxy=s
+        proxy-anyauth proxy-basic proxy-cacert=s proxy-capath=s
+        proxy-cert-type=s proxy-cert=s proxy-ciphers=s proxy-crlfile=s
+        proxy-digest proxy-header=s@ proxy-insecure
+        proxy-key-type=s proxy-key proxy-negotiate proxy-ntlm proxy-pass=s
+        proxy-pinnedpubkey=s proxy-service-name=s proxy-ssl-allow-beast
+        proxy-tls13-ciphers=s proxy-tlsauthtype=s proxy-tlspassword=s
+        proxy-tlsuser=s proxy-tlsv1 proxy-user|U=s proxy=s
+        proxytunnel=s pubkey=s random-file=s referer=s resolve=s
+        retry-connrefused retry-delay=s retry-max-time=s retry=i
+        sasl-ir service-name=s socks4=s socks4a=s socks5-basic
+        socks5-gssapi-service-name=s socks5-gssapi socks5-hostname=s socks5=s
+        speed-limit|Y speed-type|y ssl-allow-beast sslv2 sslv3
+        suppress-connect-headers tcp-fastopen tls-max=s
+        tls13-ciphers=s tlsauthtype=s tlspassword=s tlsuser=s
+        tlsv1 trace-ascii=s trace-time trace=s
+        unix-socket=s user-agent|A=s user|u=s
+)
+}
+
+1;
diff --git a/lib/PublicInbox/LeiSearch.pm b/lib/PublicInbox/LeiSearch.pm
new file mode 100644
index 00000000..440bacf5
--- /dev/null
+++ b/lib/PublicInbox/LeiSearch.pm
@@ -0,0 +1,27 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+package PublicInbox::LeiSearch;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::ExtSearch);
+use PublicInbox::Search qw(xap_terms);
+
+# get combined docid from over.num:
+# (not generic Xapian, only works with our sharding scheme)
+sub num2docid ($$) {
+        my ($self, $num) = @_;
+        my $nshard = $self->{nshard};
+        ($num - 1) * $nshard + $num % $nshard + 1;
+}
+
+sub msg_keywords {
+        my ($self, $num) = @_; # num_or_mitem
+        my $xdb = $self->xdb; # set {nshard};
+        my $docid = ref($num) ? $num->get_docid : num2docid($self, $num);
+        my $kw = xap_terms('K', $xdb, $docid);
+        warn "E: #$docid ($num): $@\n" if $@;
+        wantarray ? sort(keys(%$kw)) : $kw;
+}
+
+1;
diff --git a/lib/PublicInbox/LeiStore.pm b/lib/PublicInbox/LeiStore.pm
new file mode 100644
index 00000000..a7d7d953
--- /dev/null
+++ b/lib/PublicInbox/LeiStore.pm
@@ -0,0 +1,240 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+#
+# Local storage (cache/memo) for lei(1), suitable for personal/private
+# mail iff on encrypted device/FS.  Based on v2, but only deduplicates
+# based on git OID.
+#
+# for xref3, the following are constant: $eidx_key = '.', $xnum = -1
+package PublicInbox::LeiStore;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::Lock PublicInbox::IPC);
+use PublicInbox::ExtSearchIdx;
+use PublicInbox::Import;
+use PublicInbox::InboxWritable;
+use PublicInbox::V2Writable;
+use PublicInbox::ContentHash qw(content_hash content_digest);
+use PublicInbox::MID qw(mids mids_in);
+use PublicInbox::LeiSearch;
+use List::Util qw(max);
+
+sub new {
+        my (undef, $dir, $opt) = @_;
+        my $eidx = PublicInbox::ExtSearchIdx->new($dir, $opt);
+        my $self = bless { priv_eidx => $eidx }, __PACKAGE__;
+        eidx_init($self)->done if $opt->{creat};
+        $self;
+}
+
+sub git { $_[0]->{priv_eidx}->git } # read-only
+
+sub packing_factor { $PublicInbox::V2Writable::PACKING_FACTOR }
+
+sub rotate_bytes {
+        $_[0]->{rotate_bytes} // ((1024 * 1024 * 1024) / $_[0]->packing_factor)
+}
+
+sub git_pfx { "$_[0]->{priv_eidx}->{topdir}/local" };
+
+sub git_epoch_max  {
+        my ($self) = @_;
+        if (opendir(my $dh, $self->git_pfx)) {
+                max(map {
+                        substr($_, 0, -4) + 0; # drop ".git" suffix
+                } grep(/\A[0-9]+\.git\z/, readdir($dh))) // 0;
+        } else {
+                $!{ENOENT} ? 0 : die("opendir ${\$self->git_pfx}: $!\n");
+        }
+}
+
+sub git_ident ($) {
+        my ($git) = @_;
+        chomp(my $i = $git->qx(qw(var GIT_COMMITTER_IDENT)));
+        warn "$git->{git_dir} GIT_COMMITTER_IDENT failed\n" if $?;
+        $i =~ /\A(.+) <([^>]+)> [0-9]+ [-\+]?[0-9]+$/ ? ($1, $2) :
+                ('lei user', 'x@example.com')
+}
+
+sub importer {
+        my ($self) = @_;
+        my $max;
+        my $im = $self->{im};
+        if ($im) {
+                return $im if $im->{bytes_added} < $self->rotate_bytes;
+
+                delete $self->{im};
+                $im->done;
+                undef $im;
+                $self->checkpoint;
+                $max = $self->git_epoch_max + 1;
+        }
+        my $pfx = $self->git_pfx;
+        $max //= $self->git_epoch_max;
+        while (1) {
+                my $latest = "$pfx/$max.git";
+                my $old = -e $latest;
+                PublicInbox::Import::init_bare($latest);
+                my $git = PublicInbox::Git->new($latest);
+                $git->qx(qw(config core.sharedRepository 0600)) if !$old;
+                my $packed_bytes = $git->packed_bytes;
+                my $unpacked_bytes = $packed_bytes / $self->packing_factor;
+                if ($unpacked_bytes >= $self->rotate_bytes) {
+                        $max++;
+                        next;
+                }
+                my ($n, $e) = git_ident($git);
+                $self->{im} = $im = PublicInbox::Import->new($git, $n, $e);
+                $im->{bytes_added} = int($packed_bytes / $self->packing_factor);
+                $im->{lock_path} = undef;
+                $im->{path_type} = 'v2';
+                return $im;
+        }
+}
+
+sub search {
+        PublicInbox::LeiSearch->new($_[0]->{priv_eidx}->{topdir});
+}
+
+sub eidx_init {
+        my ($self) = @_;
+        my $eidx = $self->{priv_eidx};
+        $eidx->idx_init({-private => 1});
+        $eidx;
+}
+
+# when a message has no Message-IDs at all, this is needed for
+# unsent Draft messages, at least
+sub _fake_mid_for ($$) {
+        my ($eml, $dig) = @_;
+        my $mids = mids_in($eml, qw(X-Alt-Message-ID Resent-Message-ID));
+        $eml->{-lei_fake_mid} =
+                $mids->[0] // PublicInbox::Import::digest2mid($dig, $eml);
+}
+
+sub _docids_for ($$) {
+        my ($self, $eml) = @_;
+        my %docids;
+        my $dig = content_digest($eml);
+        my $chash = $dig->clone->digest;
+        my $eidx = eidx_init($self);
+        my $oidx = $eidx->{oidx};
+        my $im = $self->{im};
+        my $mids = mids($eml);
+        $mids->[0] //= _fake_mid_for($eml, $dig);
+        for my $mid (@$mids) {
+                my ($id, $prev);
+                while (my $cur = $oidx->next_by_mid($mid, \$id, \$prev)) {
+                        my $oid = $cur->{blob};
+                        my $docid = $cur->{num};
+                        my $bref = $im ? $im->cat_blob($oid) : undef;
+                        $bref //= $eidx->git->cat_file($oid) // do {
+                                warn "W: $oid (#$docid) <$mid> not found\n";
+                                next;
+                        };
+                        local $self->{current_info} = $oid;
+                        my $x = PublicInbox::Eml->new($bref);
+                        $docids{$docid} = $docid if content_hash($x) eq $chash;
+                }
+        }
+        sort { $a <=> $b } values %docids;
+}
+
+sub set_eml_keywords {
+        my ($self, $eml, @kw) = @_;
+        my $eidx = eidx_init($self);
+        my @docids = _docids_for($self, $eml);
+        for my $docid (@docids) {
+                $eidx->idx_shard($docid)->ipc_do('set_keywords', $docid, @kw);
+        }
+        \@docids;
+}
+
+sub add_eml_keywords {
+        my ($self, $eml, @kw) = @_;
+        my $eidx = eidx_init($self);
+        my @docids = _docids_for($self, $eml);
+        for my $docid (@docids) {
+                $eidx->idx_shard($docid)->ipc_do('add_keywords', $docid, @kw);
+        }
+        \@docids;
+}
+
+sub remove_eml_keywords {
+        my ($self, $eml, @kw) = @_;
+        my $eidx = eidx_init($self);
+        my @docids = _docids_for($self, $eml);
+        for my $docid (@docids) {
+                $eidx->idx_shard($docid)->ipc_do('remove_keywords', $docid, @kw)
+        }
+        \@docids;
+}
+
+# cf: https://doc.dovecot.org/configuration_manual/mail_location/mbox/
+my %status2kw = (F => 'flagged', A => 'answered', R => 'seen', T => 'draft');
+# O (old/non-recent), and D (deleted) aren't in JMAP,
+# so probably won't be supported by us.
+sub mbox_keywords {
+        my $eml = $_[-1];
+        my $s = "@{[$eml->header_raw('X-Status'),$eml->header_raw('Status')]}";
+        my %kw;
+        $s =~ s/([FART])/$kw{$status2kw{$1}} = 1/sge;
+        sort(keys %kw);
+}
+
+# cf: https://cr.yp.to/proto/maildir.html
+my %c2kw = ('D' => 'draft', F => 'flagged', R => 'answered', S => 'seen');
+sub maildir_keywords {
+        $_[-1] =~ /:2,([A-Z]+)\z/i ?
+                sort(map { $c2kw{$_} // () } split(//, $1)) : ();
+}
+
+sub add_eml {
+        my ($self, $eml, @kw) = @_;
+        my $eidx = eidx_init($self);
+        my $oidx = $eidx->{oidx};
+        my $smsg = bless { -oidx => $oidx }, 'PublicInbox::Smsg';
+        my $im = $self->importer;
+        $im->add($eml, undef, $smsg) or return; # duplicate returns undef
+
+        local $self->{current_info} = $smsg->{blob};
+        if (my @docids = _docids_for($self, $eml)) {
+                for my $docid (@docids) {
+                        my $idx = $eidx->idx_shard($docid);
+                        $oidx->add_xref3($docid, -1, $smsg->{blob}, '.');
+                        # add_eidx_info for List-Id
+                        $idx->ipc_do('add_eidx_info', $docid, '.', $eml);
+                        $idx->ipc_do('add_keywords', $docid, @kw) if @kw;
+                }
+                \@docids;
+        } else {
+                $smsg->{num} = $oidx->adj_counter('eidx_docid', '+');
+                $oidx->add_overview($eml, $smsg);
+                $oidx->add_xref3($smsg->{num}, -1, $smsg->{blob}, '.');
+                my $idx = $eidx->idx_shard($smsg->{num});
+                $idx->index_eml($eml, $smsg);
+                $idx->ipc_do('add_keywords', $smsg->{num}, @kw) if @kw;
+                $smsg;
+        }
+}
+
+sub set_eml {
+        my ($self, $eml, @kw) = @_;
+        add_eml($self, $eml, @kw) // set_eml_keywords($self, $eml, @kw);
+}
+
+sub done {
+        my ($self) = @_;
+        my $err = '';
+        if (my $im = delete($self->{im})) {
+                eval { $im->done };
+                if ($@) {
+                        $err .= "import done: $@\n";
+                        warn $err;
+                }
+        }
+        $self->{priv_eidx}->done;
+        die $err if $err;
+}
+
+1;
diff --git a/lib/PublicInbox/LeiToMail.pm b/lib/PublicInbox/LeiToMail.pm
new file mode 100644
index 00000000..08a1570d
--- /dev/null
+++ b/lib/PublicInbox/LeiToMail.pm
@@ -0,0 +1,500 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Writes PublicInbox::Eml objects atomically to a mbox variant or Maildir
+package PublicInbox::LeiToMail;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::IPC);
+use PublicInbox::Eml;
+use PublicInbox::Lock;
+use PublicInbox::ProcessPipe;
+use PublicInbox::Spawn qw(which spawn popen_rd);
+use PublicInbox::LeiDedupe;
+use PublicInbox::OnDestroy;
+use Symbol qw(gensym);
+use IO::Handle; # ->autoflush
+use Fcntl qw(SEEK_SET SEEK_END O_CREAT O_EXCL O_WRONLY);
+use Errno qw(EEXIST ESPIPE ENOENT);
+use PublicInbox::Git;
+
+my %kw2char = ( # Maildir characters
+        draft => 'D',
+        flagged => 'F',
+        answered => 'R',
+        seen => 'S'
+);
+
+my %kw2status = (
+        flagged => [ 'X-Status' => 'F' ],
+        answered => [ 'X-Status' => 'A' ],
+        seen => [ 'Status' => 'R' ],
+        draft => [ 'X-Status' => 'T' ],
+);
+
+sub _mbox_hdr_buf ($$$) {
+        my ($eml, $type, $smsg) = @_;
+        $eml->header_set($_) for (qw(Lines Bytes Content-Length));
+
+        # Messages are always 'O' (non-\Recent in IMAP), it saves
+        # MUAs the trouble of rewriting the mbox if no other
+        # changes are made
+        my %hdr = (Status => [ 'O' ]); # set Status, X-Status
+        for my $k (@{$smsg->{kw} // []}) {
+                if (my $ent = $kw2status{$k}) {
+                        push @{$hdr{$ent->[0]}}, $ent->[1];
+                } else { # X-Label?
+                        warn "TODO: keyword `$k' not supported for mbox\n";
+                }
+        }
+        while (my ($name, $chars) = each %hdr) {
+                $eml->header_set($name, join('', sort @$chars));
+        }
+        my $buf = delete $eml->{hdr};
+
+        # fixup old bug from import (pre-a0c07cba0e5d8b6a)
+        $$buf =~ s/\A[\r\n]*From [^\r\n]*\r?\n//s;
+        my $ident = $smsg->{blob} // 'lei';
+        if (defined(my $pct = $smsg->{pct})) { $ident .= "=$pct" }
+
+        substr($$buf, 0, 0, # prepend From line
+                "From $ident\@$type Thu Jan  1 00:00:00 1970$eml->{crlf}");
+        $buf;
+}
+
+sub atomic_append { # for on-disk destinations (O_APPEND, or O_EXCL)
+        my ($fh, $buf) = @_;
+        defined(my $w = syswrite($fh, $$buf)) or die "write: $!";
+        $w == length($$buf) or die "short write: $w != ".length($$buf);
+}
+
+sub _print_full {
+        my ($fh, $buf) = @_;
+        print $fh $$buf or die "print: $!";
+}
+
+sub eml2mboxrd ($;$) {
+        my ($eml, $smsg) = @_;
+        my $buf = _mbox_hdr_buf($eml, 'mboxrd', $smsg);
+        if (my $bdy = delete $eml->{bdy}) {
+                $$bdy =~ s/^(>*From )/>$1/gm;
+                $$buf .= $eml->{crlf};
+                substr($$bdy, 0, 0, $$buf); # prepend header
+                $buf = $bdy;
+        }
+        $$buf .= $eml->{crlf};
+        $buf;
+}
+
+sub eml2mboxo {
+        my ($eml, $smsg) = @_;
+        my $buf = _mbox_hdr_buf($eml, 'mboxo', $smsg);
+        if (my $bdy = delete $eml->{bdy}) {
+                $$bdy =~ s/^From />From /gm;
+                $$buf .= $eml->{crlf};
+                substr($$bdy, 0, 0, $$buf); # prepend header
+                $buf = $bdy;
+        }
+        $$buf .= $eml->{crlf};
+        $buf;
+}
+
+sub _mboxcl_common ($$$) {
+        my ($buf, $bdy, $crlf) = @_;
+        # add Lines: so mutt won't have to add it on MUA close
+        my $lines = $$bdy =~ tr!\n!\n!;
+        $$buf .= 'Content-Length: '.length($$bdy).$crlf.
+                'Lines: '.$lines.$crlf.$crlf;
+        substr($$bdy, 0, 0, $$buf); # prepend header
+        $_[0] = $bdy;
+}
+
+# mboxcl still escapes "From " lines
+sub eml2mboxcl {
+        my ($eml, $smsg) = @_;
+        my $buf = _mbox_hdr_buf($eml, 'mboxcl', $smsg);
+        my $crlf = $eml->{crlf};
+        if (my $bdy = delete $eml->{bdy}) {
+                $$bdy =~ s/^From />From /gm;
+                _mboxcl_common($buf, $bdy, $crlf);
+        }
+        $$buf .= $crlf;
+        $buf;
+}
+
+# mboxcl2 has no "From " escaping
+sub eml2mboxcl2 {
+        my ($eml, $smsg) = @_;
+        my $buf = _mbox_hdr_buf($eml, 'mboxcl2', $smsg);
+        my $crlf = $eml->{crlf};
+        if (my $bdy = delete $eml->{bdy}) {
+                _mboxcl_common($buf, $bdy, $crlf);
+        }
+        $$buf .= $crlf;
+        $buf;
+}
+
+sub git_to_mail { # git->cat_async callback
+        my ($bref, $oid, $type, $size, $arg) = @_;
+        if ($type ne 'blob') {
+                if ($type eq 'missing') {
+                        warn "missing $oid\n";
+                } else {
+                        warn "unexpected type=$type for $oid\n";
+                }
+        }
+        my ($write_cb, $smsg) = @$arg;
+        if ($smsg->{blob} ne $oid) {
+                die "BUG: expected=$smsg->{blob} got=$oid";
+        }
+        $write_cb->($bref, $smsg) if $size > 0;
+}
+
+sub reap_compress { # dwaitpid callback
+        my ($lei, $pid) = @_;
+        my $cmd = delete $lei->{"pid.$pid"};
+        return if $? == 0;
+        $lei->fail("@$cmd failed", $? >> 8);
+}
+
+# all of these support -c for stdout and -d for decompression,
+# mutt is commonly distributed with hooks for gz, bz2 and xz, at least
+# { foo => '' } means "--foo" is passed to the command-line,
+# otherwise { foo => '--bar' } passes "--bar"
+our %zsfx2cmd = (
+        gz => [ qw(GZIP pigz gzip), { rsyncable => '', threads => '-p' } ],
+        bz2 => [ 'bzip2', {} ],
+        xz => [ 'xz', { threads => '-T' } ],
+        # XXX does anybody care for these?  I prefer zstd on entire FSes,
+        # so it's probably not necessary on a per-file basis
+        # zst => [ 'zstd', { -default => [ qw(-q) ], # it's noisy by default
+        #        rsyncable => '', threads => '-T' } ],
+        # zz => [ 'pigz', { -default => [ '--zlib' ],
+        #        rsyncable => '', threads => '-p' }],
+        # lzo => [ 'lzop', {} ],
+        # lzma => [ 'lzma', {} ],
+);
+
+sub zsfx2cmd ($$$) {
+        my ($zsfx, $decompress, $lei) = @_;
+        my $x = $zsfx2cmd{$zsfx} // die "no support for suffix=.$zsfx";
+        my @info = @$x;
+        my $cmd_opt = pop @info;
+        my @cmd = (undef, $decompress ? qw(-dc) : qw(-c));
+        for my $exe (@info) {
+                # I think respecting client's ENV{GZIP} is OK, not sure
+                # about ENV overrides for other, less-common compressors
+                if ($exe eq uc($exe)) {
+                        $exe = $lei->{env}->{$exe} or next;
+                }
+                $cmd[0] = which($exe) and last;
+        }
+        $cmd[0] // die join(' or ', @info)." missing for .$zsfx";
+        # push @cmd, @{$cmd_opt->{-default}} if $cmd_opt->{-default};
+        for my $bool (qw(rsyncable)) {
+                my $switch = $cmd_opt->{rsyncable} // next;
+                push @cmd, '--'.($switch || $bool);
+        }
+        for my $key (qw(threads)) { # support compression level?
+                my $switch = $cmd_opt->{$key} // next;
+                my $val = $lei->{opt}->{$key} // next;
+                push @cmd, $switch, $val;
+        }
+        \@cmd;
+}
+
+sub _post_augment_mbox { # open a compressor process
+        my ($self, $lei, $zpipe) = @_;
+        my $zsfx = $self->{zsfx} or return;
+        my $cmd = zsfx2cmd($zsfx, undef, $lei);
+        my ($r, $w) = splice(@$zpipe, 0, 2);
+        my $rdr = { 0 => $r, 1 => $lei->{1}, 2 => $lei->{2} };
+        my $pid = spawn($cmd, $lei->{env}, $rdr);
+        my $pp = gensym;
+        my $dup = bless { "pid.$pid" => $cmd }, ref($lei);
+        $dup->{$_} = $lei->{$_} for qw(2 sock);
+        tie *$pp, 'PublicInbox::ProcessPipe', $pid, $w, \&reap_compress, $dup;
+        $lei->{1} = $pp;
+        die 'BUG: unexpected {ovv}->{lock_path}' if $lei->{ovv}->{lock_path};
+        $lei->{ovv}->ovv_out_lk_init;
+}
+
+sub decompress_src ($$$) {
+        my ($in, $zsfx, $lei) = @_;
+        my $cmd = zsfx2cmd($zsfx, 1, $lei);
+        popen_rd($cmd, $lei->{env}, { 0 => $in, 2 => $lei->{2} });
+}
+
+sub dup_src ($) {
+        my ($in) = @_;
+        open my $dup, '+>>&', $in or die "dup: $!";
+        $dup;
+}
+
+# --augment existing output destination, with deduplication
+sub _augment { # MboxReader eml_cb
+        my ($eml, $lei) = @_;
+        # ignore return value, just populate the skv
+        $lei->{dedupe}->is_dup($eml);
+}
+
+sub _mbox_write_cb ($$) {
+        my ($self, $lei) = @_;
+        my $ovv = $lei->{ovv};
+        my $m = 'eml2'.$ovv->{fmt};
+        my $eml2mbox = $self->can($m) or die "$self->$m missing";
+        my $out = $lei->{1} // die "no stdout ($m, $ovv->{dst})"; # redirected earlier
+        $out->autoflush(1);
+        my $write = $ovv->{lock_path} ? \&_print_full : \&atomic_append;
+        my $dedupe = $lei->{dedupe};
+        $dedupe->prepare_dedupe;
+        sub { # for git_to_mail
+                my ($buf, $smsg, $eml) = @_;
+                return unless $out;
+                $eml //= PublicInbox::Eml->new($buf);
+                if (!$dedupe->is_dup($eml, $smsg->{blob})) {
+                        $buf = $eml2mbox->($eml, $smsg);
+                        my $lk = $ovv->lock_for_scope;
+                        eval { $write->($out, $buf) };
+                        if ($@) {
+                                die $@ if ref($@) ne 'PublicInbox::SIGPIPE';
+                                undef $out
+                        }
+                }
+        }
+}
+
+sub _maildir_each_file ($$;@) {
+        my ($dir, $cb, @arg) = @_;
+        for my $d (qw(new/ cur/)) {
+                my $pfx = $dir.$d;
+                opendir my $dh, $pfx or next;
+                while (defined(my $fn = readdir($dh))) {
+                        $cb->($pfx.$fn, @arg) if $fn =~ /:2,[A-Za-z]*\z/;
+                }
+        }
+}
+
+sub _augment_file { # _maildir_each_file cb
+        my ($f, $lei) = @_;
+        my $eml = PublicInbox::InboxWritable::eml_from_path($f) or return;
+        _augment($eml, $lei);
+}
+
+# _maildir_each_file callback, \&CORE::unlink doesn't work with it
+sub _unlink { unlink($_[0]) }
+
+sub _rand () {
+        state $seq = 0;
+        sprintf('%x,%x,%x,%x', rand(0xffffffff), time, $$, ++$seq);
+}
+
+sub _buf2maildir {
+        my ($dst, $buf, $smsg) = @_;
+        my $kw = $smsg->{kw} // [];
+        my $sfx = join('', sort(map { $kw2char{$_} // () } @$kw));
+        my $rand = ''; # chosen by die roll :P
+        my ($tmp, $fh, $final);
+        my $common = $smsg->{blob} // _rand;
+        if (defined(my $pct = $smsg->{pct})) { $common .= "=$pct" }
+        do {
+                $tmp = $dst.'tmp/'.$rand.$common;
+        } while (!sysopen($fh, $tmp, O_CREAT|O_EXCL|O_WRONLY) &&
+                $! == EEXIST && ($rand = _rand.','));
+        if (print $fh $$buf and close($fh)) {
+                # ignore new/ and write only to cur/, otherwise MUAs
+                # with R/W access to the Maildir will end up doing
+                # a mass rename which can take a while with thousands
+                # of messages.
+                $dst .= 'cur/';
+                $rand = '';
+                do {
+                        $final = $dst.$rand.$common.':2,'.$sfx;
+                } while (!link($tmp, $final) && $! == EEXIST &&
+                        ($rand = _rand.','));
+                unlink($tmp) or warn "W: failed to unlink $tmp: $!\n";
+        } else {
+                my $err = $!;
+                unlink($tmp);
+                die "Error writing $smsg->{blob} to $dst: $err";
+        }
+}
+
+sub _maildir_write_cb ($$) {
+        my ($self, $lei) = @_;
+        my $dedupe = $lei->{dedupe};
+        $dedupe->prepare_dedupe;
+        my $dst = $lei->{ovv}->{dst};
+        sub { # for git_to_mail
+                my ($buf, $smsg, $eml) = @_;
+                $buf //= \($eml->as_string);
+                return _buf2maildir($dst, $buf, $smsg) if !$dedupe;
+                $eml //= PublicInbox::Eml->new($$buf); # copy buf
+                return if $dedupe->is_dup($eml, $smsg->{blob});
+                undef $eml;
+                _buf2maildir($dst, $buf, $smsg);
+        }
+}
+
+sub write_cb { # returns a callback for git_to_mail
+        my ($self, $lei) = @_;
+        # _mbox_write_cb or _maildir_write_cb
+        my $m = "_$self->{base_type}_write_cb";
+        $self->$m($lei);
+}
+
+sub new {
+        my ($cls, $lei) = @_;
+        my $fmt = $lei->{ovv}->{fmt};
+        my $dst = $lei->{ovv}->{dst};
+        my $self = bless {}, $cls;
+        if ($fmt eq 'maildir') {
+                $self->{base_type} = 'maildir';
+                -e $dst && !-d _ and die
+                                "$dst exists and is not a directory\n";
+                $lei->{ovv}->{dst} = $dst .= '/' if substr($dst, -1) ne '/';
+        } elsif (substr($fmt, 0, 4) eq 'mbox') {
+                (-d $dst || (-e _ && !-w _)) and die
+                        "$dst exists and is not a writable file\n";
+                $self->can("eml2$fmt") or die "bad mbox --format=$fmt\n";
+                $self->{base_type} = 'mbox';
+        } else {
+                die "bad mail --format=$fmt\n";
+        }
+        $lei->{dedupe} = PublicInbox::LeiDedupe->new($lei);
+        $self;
+}
+
+sub _pre_augment_maildir {} # noop
+
+sub _do_augment_maildir {
+        my ($self, $lei) = @_;
+        my $dst = $lei->{ovv}->{dst};
+        if ($lei->{opt}->{augment}) {
+                my $dedupe = $lei->{dedupe};
+                if ($dedupe && $dedupe->prepare_dedupe) {
+                        require PublicInbox::InboxWritable; # eml_from_path
+                        _maildir_each_file($dst, \&_augment_file, $lei);
+                        $dedupe->pause_dedupe;
+                }
+        } else { # clobber existing Maildir
+                _maildir_each_file($dst, \&_unlink);
+        }
+}
+
+sub _post_augment_maildir {
+        my ($self, $lei) = @_;
+        my $dst = $lei->{ovv}->{dst};
+        for my $x (qw(tmp new cur)) {
+                my $d = $dst.$x;
+                next if -d $d;
+                require File::Path;
+                File::Path::mkpath($d);
+                -d $d or die "$d is not a directory";
+        }
+}
+
+sub _pre_augment_mbox {
+        my ($self, $lei) = @_;
+        my $dst = $lei->{ovv}->{dst};
+        if ($dst ne '/dev/stdout') {
+                my $mode = -p $dst ? '>' : '+>>';
+                if (-f _ && !$lei->{opt}->{augment} and !unlink($dst)) {
+                        $! == ENOENT or die "unlink($dst): $!";
+                }
+                open my $out, $mode, $dst or die "open($dst): $!";
+                $lei->{old_1} = $lei->{1};
+                $lei->{1} = $out;
+        }
+        # Perl does SEEK_END even with O_APPEND :<
+        $self->{seekable} = seek($lei->{1}, 0, SEEK_SET);
+        if (!$self->{seekable} && $! != ESPIPE && $dst ne '/dev/stdout') {
+                die "seek($dst): $!\n";
+        }
+        state $zsfx_allow = join('|', keys %zsfx2cmd);
+        ($self->{zsfx}) = ($dst =~ /\.($zsfx_allow)\z/) or return;
+        pipe(my ($r, $w)) or die "pipe: $!";
+        [ $r, $w ];
+}
+
+sub _do_augment_mbox {
+        my ($self, $lei) = @_;
+        return if !$lei->{opt}->{augment};
+        my $dedupe = $lei->{dedupe};
+        my $dst = $lei->{ovv}->{dst};
+        die "cannot augment $dst, not seekable\n" if !$self->{seekable};
+        my $out = $lei->{1};
+        if (-s $out && $dedupe && $dedupe->prepare_dedupe) {
+                my $zsfx = $self->{zsfx};
+                my $rd = $zsfx ? decompress_src($out, $zsfx, $lei) :
+                                dup_src($out);
+                my $fmt = $lei->{ovv}->{fmt};
+                require PublicInbox::MboxReader;
+                PublicInbox::MboxReader->$fmt($rd, \&_augment, $lei);
+        }
+        # maybe some systems don't honor O_APPEND, Perl does this:
+        seek($out, 0, SEEK_END) or die "seek $dst: $!";
+        $dedupe->pause_dedupe if $dedupe;
+}
+
+sub pre_augment { # fast (1 disk seek), runs in main daemon
+        my ($self, $lei) = @_;
+        # _pre_augment_maildir, _pre_augment_mbox
+        my $m = "_pre_augment_$self->{base_type}";
+        $self->$m($lei);
+}
+
+sub do_augment { # slow, runs in wq worker
+        my ($self, $lei) = @_;
+        # _do_augment_maildir, _do_augment_mbox
+        my $m = "_do_augment_$self->{base_type}";
+        $self->$m($lei);
+}
+
+sub post_augment { # fast (spawn compressor or mkdir), runs in main daemon
+        my ($self, $lei, @args) = @_;
+        # _post_augment_maildir, _post_augment_mbox
+        my $m = "_post_augment_$self->{base_type}";
+        $self->$m($lei, @args);
+}
+
+sub write_mail { # via ->wq_do
+        my ($self, $git_dir, $smsg, $lei) = @_;
+        my $not_done = delete $self->{4}; # write end of {each_smsg_done}
+        my $wcb = $self->{wcb} //= do { # first message
+                my %sig = $lei->atfork_child_wq($self);
+                @SIG{keys %sig} = values %sig; # not local
+                $lei->{dedupe}->prepare_dedupe;
+                $self->write_cb($lei);
+        };
+        my $git = $self->{"$$\0$git_dir"} //= PublicInbox::Git->new($git_dir);
+        $git->cat_async($smsg->{blob}, \&git_to_mail, [$wcb, $smsg, $not_done]);
+}
+
+sub ipc_atfork_prepare {
+        my ($self) = @_;
+        # FDs: (done_wr, stdout|mbox, stderr, 3: sock, 4: each_smsg_done_wr)
+        $self->SUPER::ipc_atfork_prepare; # PublicInbox::IPC
+}
+
+# We rely on OnDestroy to run this before ->DESTROY, since ->DESTROY
+# ordering is unstable at worker exit and may cause segfaults
+sub reap_gits {
+        my ($self) = @_;
+        delete $self->{wcb};
+        for my $git (delete @$self{grep(/\A$$\0/, keys %$self)}) {
+                $git->async_wait_all;
+        }
+}
+
+sub DESTROY { delete $_[0]->{wcb} }
+
+sub ipc_atfork_child { # runs after IPC::wq_worker_loop
+        my ($self) = @_;
+        $self->SUPER::ipc_atfork_child;
+        # reap_gits needs to run before $self->DESTROY,
+        # IPC.pm will ensure that.
+        PublicInbox::OnDestroy->new($$, \&reap_gits, $self);
+}
+
+1;
diff --git a/lib/PublicInbox/LeiXSearch.pm b/lib/PublicInbox/LeiXSearch.pm
new file mode 100644
index 00000000..fb608d00
--- /dev/null
+++ b/lib/PublicInbox/LeiXSearch.pm
@@ -0,0 +1,412 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# Combine any combination of PublicInbox::Search,
+# PublicInbox::ExtSearch, and PublicInbox::LeiSearch objects
+# into one Xapian DB
+package PublicInbox::LeiXSearch;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::LeiSearch PublicInbox::IPC);
+use PublicInbox::DS qw(dwaitpid);
+use PublicInbox::OpPipe;
+use PublicInbox::Import;
+use File::Temp 0.19 (); # 0.19 for ->newdir
+use File::Spec ();
+use PublicInbox::Search qw(xap_terms);
+use PublicInbox::Spawn qw(popen_rd);
+use PublicInbox::MID qw(mids);
+
+sub new {
+        my ($class) = @_;
+        PublicInbox::Search::load_xapian();
+        bless {
+                qp_flags => $PublicInbox::Search::QP_FLAGS |
+                                PublicInbox::Search::FLAG_PURE_NOT(),
+        }, $class
+}
+
+sub attach_external {
+        my ($self, $ibxish) = @_; # ibxish = ExtSearch or Inbox
+        my $desc = $ibxish->{inboxdir} // $ibxish->{topdir};
+        my $srch = $ibxish->search or
+                return warn("$desc not indexed for Xapian\n");
+        my @shards = $srch->xdb_shards_flat or
+                return warn("$desc has no Xapian shardsXapian\n");
+
+        if (delete $self->{xdb}) { # XXX: do we need this?
+                # clobber existing {xdb} if amending
+                my $expect = delete $self->{nshard};
+                my $shards = delete $self->{shards_flat};
+                scalar(@$shards) == $expect or die
+                        "BUG: {nshard}$expect != shards=".scalar(@$shards);
+
+                my $prev = {};
+                for my $old_ibxish (@{$self->{shard2ibx}}) {
+                        next if $prev == $old_ibxish;
+                        $prev = $old_ibxish;
+                        my @shards = $old_ibxish->search->xdb_shards_flat;
+                        push @{$self->{shards_flat}}, @shards;
+                }
+                my $nr = scalar(@{$self->{shards_flat}});
+                $nr == $expect or die
+                        "BUG: reloaded $nr shards, expected $expect"
+        }
+        push @{$self->{shards_flat}}, @shards;
+        push(@{$self->{shard2ibx}}, $ibxish) for (@shards);
+}
+
+# returns a list of local inboxes (or count in scalar context)
+sub locals { @{$_[0]->{locals} // []} }
+
+sub remotes { @{$_[0]->{remotes} // []} }
+
+# called by PublicInbox::Search::xdb
+sub xdb_shards_flat { @{$_[0]->{shards_flat} // []} }
+
+# like over->get_art
+sub smsg_for {
+        my ($self, $mitem) = @_;
+        # cf. https://trac.xapian.org/wiki/FAQ/MultiDatabaseDocumentID
+        my $nshard = $self->{nshard};
+        my $docid = $mitem->get_docid;
+        my $shard = ($docid - 1) % $nshard;
+        my $num = int(($docid - 1) / $nshard) + 1;
+        my $ibx = $self->{shard2ibx}->[$shard];
+        my $smsg = $ibx->over->get_art($num);
+        if (ref($ibx->can('msg_keywords'))) {
+                my $kw = xap_terms('K', $mitem->get_document);
+                $smsg->{kw} = [ sort keys %$kw ];
+        }
+        $smsg->{docid} = $docid;
+        $smsg;
+}
+
+sub recent {
+        my ($self, $qstr, $opt) = @_;
+        $opt //= {};
+        $opt->{relevance} //= -2;
+        $self->mset($qstr //= 'bytes:1..', $opt);
+}
+
+sub over {}
+
+sub _mset_more ($$) {
+        my ($mset, $mo) = @_;
+        my $size = $mset->size;
+        $size && (($mo->{offset} += $size) < ($mo->{limit} // 10000));
+}
+
+# $startq will EOF when query_prepare is done augmenting and allow
+# query_mset and query_thread_mset to proceed.
+sub wait_startq ($) {
+        my ($startq) = @_;
+        $_[0] = undef;
+        read($startq, my $query_prepare_done, 1);
+}
+
+sub query_thread_mset { # for --thread
+        my ($self, $lei, $ibxish) = @_;
+        local $0 = "$0 query_thread_mset";
+        my $startq = delete $self->{5};
+        my %sig = $lei->atfork_child_wq($self);
+        local @SIG{keys %sig} = values %sig;
+
+        my ($srch, $over) = ($ibxish->search, $ibxish->over);
+        unless ($srch && $over) {
+                my $desc = $ibxish->{inboxdir} // $ibxish->{topdir};
+                warn "$desc not indexed by Xapian\n";
+                return;
+        }
+        my $mo = { %{$lei->{mset_opt}} };
+        my $mset;
+        my $each_smsg = $lei->{ovv}->ovv_each_smsg_cb($lei, $ibxish);
+        do {
+                $mset = $srch->mset($mo->{qstr}, $mo);
+                my $ids = $srch->mset_to_artnums($mset, $mo);
+                my $ctx = { ids => $ids };
+                my $i = 0;
+                my %n2item = map { ($ids->[$i++], $_) } $mset->items;
+                while ($over->expand_thread($ctx)) {
+                        for my $n (@{$ctx->{xids}}) {
+                                my $smsg = $over->get_art($n) or next;
+                                wait_startq($startq) if $startq;
+                                my $mitem = delete $n2item{$smsg->{num}};
+                                $each_smsg->($smsg, $mitem);
+                        }
+                        @{$ctx->{xids}} = ();
+                }
+        } while (_mset_more($mset, $mo));
+        undef $each_smsg; # drops @io for l2m->{each_smsg_done}
+        $lei->{ovv}->ovv_atexit_child($lei);
+}
+
+sub query_mset { # non-parallel for non-"--thread" users
+        my ($self, $lei) = @_;
+        local $0 = "$0 query_mset";
+        my $startq = delete $self->{5};
+        my %sig = $lei->atfork_child_wq($self);
+        local @SIG{keys %sig} = values %sig;
+        my $mo = { %{$lei->{mset_opt}} };
+        my $mset;
+        for my $loc (locals($self)) {
+                attach_external($self, $loc);
+        }
+        my $each_smsg = $lei->{ovv}->ovv_each_smsg_cb($lei, $self);
+        do {
+                $mset = $self->mset($mo->{qstr}, $mo);
+                for my $mitem ($mset->items) {
+                        my $smsg = smsg_for($self, $mitem) or next;
+                        wait_startq($startq) if $startq;
+                        $each_smsg->($smsg, $mitem);
+                }
+        } while (_mset_more($mset, $mo));
+        undef $each_smsg; # drops @io for l2m->{each_smsg_done}
+        $lei->{ovv}->ovv_atexit_child($lei);
+}
+
+sub each_eml { # callback for MboxReader->mboxrd
+        my ($eml, $self, $lei, $each_smsg) = @_;
+        my $smsg = bless {}, 'PublicInbox::Smsg';
+        $smsg->populate($eml);
+        $smsg->parse_references($eml, mids($eml));
+        $smsg->{$_} //= '' for qw(from to cc ds subject references mid);
+        delete @$smsg{qw(From Subject -ds -ts)};
+        if (my $startq = delete($self->{5})) { wait_startq($startq) }
+        $each_smsg->($smsg, undef, $eml);
+}
+
+sub query_remote_mboxrd {
+        my ($self, $lei, $uris) = @_;
+        local $0 = "$0 query_remote_mboxrd";
+        my %sig = $lei->atfork_child_wq($self); # keep $self->{5} startq
+        local @SIG{keys %sig} = values %sig;
+        my ($opt, $env) = @$lei{qw(opt env)};
+        my @qform = (q => $lei->{mset_opt}->{qstr}, x => 'm');
+        push(@qform, t => 1) if $opt->{thread};
+        my @cmd = (qw(curl -sSf -d), '');
+        my $verbose = $opt->{verbose};
+        push @cmd, '-v' if $verbose;
+        for my $o ($lei->curl_opt) {
+                $o =~ s/\|[a-z0-9]\b//i; # remove single char short option
+                if ($o =~ s/=[is]@\z//) {
+                        my $ary = $opt->{$o} or next;
+                        push @cmd, map { ("--$o", $_) } @$ary;
+                } elsif ($o =~ s/=[is]\z//) {
+                        my $val = $opt->{$o} // next;
+                        push @cmd, "--$o", $val;
+                } elsif ($opt->{$o}) {
+                        push @cmd, "--$o";
+                }
+        }
+        $opt->{torsocks} = 'false' if $opt->{'no-torsocks'};
+        my $tor = $opt->{torsocks} //= 'auto';
+        my $each_smsg = $lei->{ovv}->ovv_each_smsg_cb($lei);
+        for my $uri (@$uris) {
+                $uri->query_form(@qform);
+                my $cmd = [ @cmd, $uri->as_string ];
+                if ($tor eq 'auto' && substr($uri->host, -6) eq '.onion' &&
+                                (($env->{LD_PRELOAD}//'') !~ /torsocks/)) {
+                        unshift @$cmd, 'torsocks';
+                } elsif (PublicInbox::Config::git_bool($tor)) {
+                        unshift @$cmd, 'torsocks';
+                }
+                $lei->err("# @$cmd") if $verbose;
+                $? = 0;
+                my $fh = popen_rd($cmd, $env, { 2 => $lei->{2} });
+                $fh = IO::Uncompress::Gunzip->new($fh);
+                eval {
+                        PublicInbox::MboxReader->mboxrd($fh, \&each_eml, $self,
+                                                        $lei, $each_smsg);
+                };
+                return $lei->fail("E: @$cmd: $@") if $@;
+                if (($? >> 8) == 22) { # HTTP 404 from curl(1)
+                        $uri->query_form(q => $lei->{mset_opt}->{qstr});
+                        $lei->err('# no results from '.$uri->as_string);
+                } elsif ($?) {
+                        $uri->query_form(q => $lei->{mset_opt}->{qstr});
+                        $lei->err('E: '.$uri->as_string);
+                        $lei->child_error($?);
+                }
+        }
+        undef $each_smsg;
+        $lei->{ovv}->ovv_atexit_child($lei);
+}
+
+sub git {
+        my ($self) = @_;
+        my (%seen, @dirs);
+        my $tmp = File::Temp->newdir('lei_xsrch_git-XXXXXXXX', TMPDIR => 1);
+        for my $ibx (@{$self->{shard2ibx} // []}) {
+                my $d = File::Spec->canonpath($ibx->git->{git_dir});
+                $seen{$d} //= push @dirs, "$d/objects\n"
+        }
+        my $git_dir = $tmp->dirname;
+        PublicInbox::Import::init_bare($git_dir);
+        my $f = "$git_dir/objects/info/alternates";
+        open my $alt, '>', $f or die "open($f): $!";
+        print $alt @dirs or die "print $f: $!";
+        close $alt or die "close $f: $!";
+        my $git = PublicInbox::Git->new($git_dir);
+        $git->{-tmp} = $tmp;
+        $git;
+}
+
+sub query_done { # EOF callback
+        my ($lei) = @_;
+        my $has_l2m = exists $lei->{l2m};
+        for my $f (qw(lxs l2m)) {
+                my $wq = delete $lei->{$f} or next;
+                $wq->wq_wait_old;
+        }
+        $lei->{ovv}->ovv_end($lei);
+        if ($has_l2m) { # close() calls LeiToMail reap_compress
+                if (my $out = delete $lei->{old_1}) {
+                        if (my $mbout = $lei->{1}) {
+                                close($mbout) or return $lei->fail(<<"");
+Error closing $lei->{ovv}->{dst}: $!
+
+                        }
+                        $lei->{1} = $out;
+                }
+                $lei->start_mua;
+        }
+        $lei->dclose;
+}
+
+sub do_post_augment {
+        my ($lei, $zpipe, $au_done) = @_;
+        my $l2m = $lei->{l2m} or die 'BUG: no {l2m}';
+        eval { $l2m->post_augment($lei, $zpipe) };
+        if (my $err = $@) {
+                if (my $lxs = delete $lei->{lxs}) {
+                        $lxs->wq_kill;
+                        $lxs->wq_close;
+                }
+                $lei->fail("$err");
+        }
+        close $au_done; # triggers wait_startq
+}
+
+my $MAX_PER_HOST = 4;
+sub MAX_PER_HOST { $MAX_PER_HOST }
+
+sub concurrency {
+        my ($self, $opt) = @_;
+        my $nl = $opt->{thread} ? locals($self) : 1;
+        my $nr = remotes($self);
+        $nr = $MAX_PER_HOST if $nr > $MAX_PER_HOST;
+        $nl + $nr;
+}
+
+sub start_query { # always runs in main (lei-daemon) process
+        my ($self, $io, $lei) = @_;
+        if ($lei->{opt}->{thread}) {
+                for my $ibxish (locals($self)) {
+                        $self->wq_do('query_thread_mset', $io, $lei, $ibxish);
+                }
+        } elsif (locals($self)) {
+                $self->wq_do('query_mset', $io, $lei);
+        }
+        my $i = 0;
+        my $q = [];
+        for my $uri (remotes($self)) {
+                push @{$q->[$i++ % $MAX_PER_HOST]}, $uri;
+        }
+        for my $uris (@$q) {
+                $self->wq_do('query_remote_mboxrd', $io, $lei, $uris);
+        }
+        @$io = ();
+}
+
+sub query_prepare { # called by wq_do
+        my ($self, $lei) = @_;
+        local $0 = "$0 query_prepare";
+        my %sig = $lei->atfork_child_wq($self);
+        -p $lei->{0} or die "BUG: \$done pipe expected";
+        local @SIG{keys %sig} = values %sig;
+        eval { $lei->{l2m}->do_augment($lei) };
+        $lei->fail($@) if $@;
+        syswrite($lei->{0}, '.') == 1 or die "do_post_augment trigger: $!";
+}
+
+sub sigpipe_handler { # handles SIGPIPE from l2m/lxs workers
+        my ($lei) = @_;
+        my $lxs = delete $lei->{lxs};
+        if ($lxs && $lxs->wq_kill_old) {
+                kill 'PIPE', $$;
+                $lxs->wq_wait_old;
+        }
+        close(delete $lei->{1}) if $lei->{1};
+}
+
+sub do_query {
+        my ($self, $lei_orig) = @_;
+        my ($lei, @io) = $lei_orig->atfork_parent_wq($self);
+        $io[0] = undef;
+        pipe(my $done, $io[0]) or die "pipe $!";
+        $lei_orig->{1}->autoflush(1);
+
+        $lei_orig->event_step_init; # wait for shutdowns
+        my $done_op = {
+                '' => [ \&query_done, $lei_orig ],
+                '!' => [ \&sigpipe_handler, $lei_orig ]
+        };
+        my $in_loop = exists $lei_orig->{sock};
+        $done = PublicInbox::OpPipe->new($done, $done_op, $in_loop);
+        my $l2m = $lei->{l2m};
+        if ($l2m) {
+                # may redirect $lei->{1} for mbox
+                my $zpipe = $l2m->pre_augment($lei_orig);
+                $io[1] = $lei_orig->{1};
+                pipe(my ($startq, $au_done)) or die "pipe: $!";
+                $done_op->{'.'} = [ \&do_post_augment, $lei_orig,
+                                        $zpipe, $au_done ];
+                local $io[4] = *STDERR{GLOB}; # don't send l2m->{-wq_s1}
+                die "BUG: unexpected \$io[5]: $io[5]" if $io[5];
+                $self->wq_do('query_prepare', \@io, $lei);
+                fcntl($startq, 1031, 4096) if $^O eq 'linux'; # F_SETPIPE_SZ
+                $io[5] = $startq;
+                $io[1] = $zpipe->[1] if $zpipe;
+        }
+        start_query($self, \@io, $lei);
+        $self->wq_close(1);
+        unless ($in_loop) {
+                # for the $lei->atfork_child_wq PIPE handler:
+                while ($done->{sock}) { $done->event_step }
+        }
+}
+
+sub ipc_atfork_prepare {
+        my ($self) = @_;
+        if (exists $self->{remotes}) {
+                require PublicInbox::MboxReader;
+                require IO::Uncompress::Gunzip;
+        }
+        # FDS: (0: done_wr, 1: stdout|mbox, 2: stderr,
+        #       3: sock, 4: $l2m->{-wq_s1}, 5: $startq)
+        $self->SUPER::ipc_atfork_prepare; # PublicInbox::IPC
+}
+
+sub prepare_external {
+        my ($self, $loc, $boost) = @_; # n.b. already ordered by boost
+        if (ref $loc) { # already a URI, or PublicInbox::Inbox-like object
+                return push(@{$self->{remotes}}, $loc) if $loc->can('scheme');
+        } elsif ($loc =~ m!\Ahttps?://!) {
+                require URI;
+                return push(@{$self->{remotes}}, URI->new($loc));
+        } elsif (-f "$loc/ei.lock") {
+                require PublicInbox::ExtSearch;
+                $loc = PublicInbox::ExtSearch->new($loc);
+        } elsif (-f "$loc/inbox.lock" || -d "$loc/public-inbox") {
+                require PublicInbox::Inbox; # v2, v1
+                $loc = bless { inboxdir => $loc }, 'PublicInbox::Inbox';
+        } else {
+                warn "W: ignoring $loc, unable to determine type\n";
+                return;
+        }
+        push @{$self->{locals}}, $loc;
+}
+
+
+1;
diff --git a/lib/PublicInbox/Linkify.pm b/lib/PublicInbox/Linkify.pm
index a02eafc4..2ac74e2a 100644
--- a/lib/PublicInbox/Linkify.pm
+++ b/lib/PublicInbox/Linkify.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # two-step linkification.
diff --git a/lib/PublicInbox/Listener.pm b/lib/PublicInbox/Listener.pm
index 2e0fc248..c8315810 100644
--- a/lib/PublicInbox/Listener.pm
+++ b/lib/PublicInbox/Listener.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used by -nntpd for listen sockets
diff --git a/lib/PublicInbox/Lock.pm b/lib/PublicInbox/Lock.pm
index b2c8227f..bb213de4 100644
--- a/lib/PublicInbox/Lock.pm
+++ b/lib/PublicInbox/Lock.pm
@@ -1,12 +1,14 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Base class for per-inbox locking
 package PublicInbox::Lock;
 use strict;
-use warnings;
+use v5.10.1;
 use Fcntl qw(:flock :DEFAULT);
 use Carp qw(croak);
+use PublicInbox::OnDestroy;
+use File::Temp ();
 
 # we only acquire the flock if creating or reindexing;
 # PublicInbox::Import already has the lock on its own.
@@ -32,4 +34,17 @@ sub lock_release {
         close $lockfh or croak "close $lock_path failed: $!\n";
 }
 
+# caller must use return value
+sub lock_for_scope {
+        my ($self, @single_pid) = @_;
+        lock_acquire($self) or return; # lock_path not set
+        PublicInbox::OnDestroy->new(@single_pid, \&lock_release, $self);
+}
+
+sub new_tmp {
+        my ($cls, $ident) = @_;
+        my $tmp = File::Temp->new("$ident.lock-XXXXXX", TMPDIR => 1);
+        bless { lock_path => $tmp->filename, tmp => $tmp }, $cls;
+}
+
 1;
diff --git a/lib/PublicInbox/MDA.pm b/lib/PublicInbox/MDA.pm
index fa4a2ad8..f82194a3 100644
--- a/lib/PublicInbox/MDA.pm
+++ b/lib/PublicInbox/MDA.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # For the -mda script (mail delivery agent)
@@ -83,7 +83,7 @@ sub set_list_headers {
 }
 
 sub inboxes_for_list_id ($$) {
-        my ($klass, $config, $simple) = @_;
+        my ($klass, $pi_cfg, $simple) = @_;
 
         # newer Email::Simple allows header_raw, as does Email::MIME:
         my @list_ids = $simple->can('header_raw') ?
@@ -92,7 +92,7 @@ sub inboxes_for_list_id ($$) {
         my @dests;
         for my $list_id (@list_ids) {
                 $list_id =~ /<[ \t]*(.+)?[ \t]*>/ or next;
-                if (my $ibx = $config->lookup_list_id($1)) {
+                if (my $ibx = $pi_cfg->lookup_list_id($1)) {
                         push @dests, $ibx;
                 }
         }
diff --git a/lib/PublicInbox/MID.pm b/lib/PublicInbox/MID.pm
index 5aeffb8c..35b517e0 100644
--- a/lib/PublicInbox/MID.pm
+++ b/lib/PublicInbox/MID.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Various Message-ID-related functions.
@@ -7,7 +7,7 @@ use strict;
 use warnings;
 use base qw/Exporter/;
 our @EXPORT_OK = qw(mid_clean id_compress mid2path mid_escape MID_ESC
-        mids references mids_for_index $MID_EXTRACT);
+        mids references mids_for_index mids_in $MID_EXTRACT);
 use URI::Escape qw(uri_escape_utf8);
 use Digest::SHA qw/sha1_hex/;
 require PublicInbox::Address;
@@ -73,14 +73,17 @@ sub mids ($) {
         uniq_mids(extract_mids(@mids));
 }
 
+# for Resent-Message-ID and maybe others
+sub mids_in ($@) {
+        my ($eml, @headers) = @_;
+        uniq_mids(extract_mids(map { ($eml->header_raw($_)) } @headers));
+}
+
 # we allow searching on X-Alt-Message-ID since PublicInbox::NNTP uses them
 # to placate some clients, and we want to ensure NNTP-only clients can
 # import and index without relying on HTTP endpoints
 sub mids_for_index ($) {
-        my ($hdr) = @_;
-        my @mids = $hdr->header_raw('Message-ID');
-        my @alts = $hdr->header_raw('X-Alt-Message-ID');
-        uniq_mids(extract_mids(@mids, @alts));
+        mids_in($_[0], qw(Message-ID X-Alt-Message-ID));
 }
 
 # last References should be IRT, but some mail clients do things
@@ -119,7 +122,7 @@ sub uniq_mids ($;$) {
                         warn "Message-ID: <$mid> too long, truncating\n";
                         $mid = substr($mid, 0, MAX_MID_SIZE);
                 }
-                push(@ret, $mid) unless $seen->{$mid}++;
+                $seen->{$mid} //= push(@ret, $mid);
         }
         \@ret;
 }
diff --git a/lib/PublicInbox/ManifestJsGz.pm b/lib/PublicInbox/ManifestJsGz.pm
index 74820fb5..31cf15dc 100644
--- a/lib/PublicInbox/ManifestJsGz.pm
+++ b/lib/PublicInbox/ManifestJsGz.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # generates manifest.js.gz for grokmirror(1)
@@ -6,21 +6,12 @@ package PublicInbox::ManifestJsGz;
 use strict;
 use v5.10.1;
 use parent qw(PublicInbox::WwwListing);
-use Digest::SHA ();
-use File::Spec ();
 use bytes (); # length
-use PublicInbox::Inbox;
-use PublicInbox::Git;
+use PublicInbox::Config;
 use IO::Compress::Gzip qw(gzip);
 use HTTP::Date qw(time2str);
-*try_cat = \&PublicInbox::Inbox::try_cat;
 
-our $json;
-for my $mod (qw(JSON::MaybeXS JSON JSON::PP)) {
-        eval "require $mod" or next;
-        # ->ascii encodes non-ASCII to "\uXXXX"
-        $json = $mod->new->ascii(1) and last;
-}
+my $json = PublicInbox::Config::json();
 
 # called by WwwListing
 sub url_regexp {
@@ -30,76 +21,29 @@ sub url_regexp {
         $ctx->SUPER::url_regexp('publicInbox.grokManifest', 'match=domain');
 }
 
-sub fingerprint ($) {
-        my ($git) = @_;
-        # TODO: convert to qspawn for fairness when there's
-        # thousands of repos
-        my ($fh, $pid) = $git->popen('show-ref');
-        my $dig = Digest::SHA->new(1);
-        while (read($fh, my $buf, 65536)) {
-                $dig->add($buf);
-        }
-        close $fh;
-        waitpid($pid, 0);
-        return if $?; # empty, uninitialized git repo
-        $dig->hexdigest;
+sub inject_entry ($$$;$) {
+        my ($ctx, $url_path, $ent, $git_dir) = @_;
+        $ctx->{-abs2urlpath}->{$git_dir // delete $ent->{git_dir}} = $url_path;
+        my $modified = $ent->{modified};
+        $ctx->{-mtime} = $modified if $modified > ($ctx->{-mtime} // 0);
+        $ctx->{manifest}->{$url_path} = $ent;
 }
 
 sub manifest_add ($$;$$) {
         my ($ctx, $ibx, $epoch, $default_desc) = @_;
         my $url_path = "/$ibx->{name}";
-        my $git_dir = $ibx->{inboxdir};
+        my $git;
         if (defined $epoch) {
-                $git_dir .= "/git/$epoch.git";
                 $url_path .= "/git/$epoch.git";
+                $git = $ibx->git_epoch($epoch) or return;
+        } else {
+                $git = $ibx->git;
         }
-        return unless -d $git_dir;
-        my $git = PublicInbox::Git->new($git_dir);
-        my $fingerprint = fingerprint($git) or return; # no empty repos
-
-        chomp(my $owner = $git->qx('config', 'gitweb.owner'));
-        chomp(my $desc = try_cat("$git_dir/description"));
-        utf8::decode($owner);
-        utf8::decode($desc);
-        $owner = undef if $owner eq '';
-        $desc = 'Unnamed repository' if $desc eq '';
-
-        # templates/hooks--update.sample and git-multimail in git.git
-        # only match "Unnamed repository", not the full contents of
-        # templates/this--description in git.git
-        if ($desc =~ /\AUnnamed repository/) {
-                $desc = "$default_desc [epoch $epoch]" if defined($epoch);
-        }
-
-        my $reference;
-        chomp(my $alt = try_cat("$git_dir/objects/info/alternates"));
-        if ($alt) {
-                # n.b.: GitPython doesn't seem to handle comments or C-quoted
-                # strings like native git does; and we don't for now, either.
-                my @alt = split(/\n+/, $alt);
-
-                # grokmirror only supports 1 alternate for "reference",
-                if (scalar(@alt) == 1) {
-                        my $objdir = "$git_dir/objects";
-                        $reference = File::Spec->rel2abs($alt[0], $objdir);
-                        $reference =~ s!/[^/]+/?\z!!; # basename
-                }
-        }
-        $ctx->{-abs2urlpath}->{$git_dir} = $url_path;
-        my $modified = $git->modified;
-        if ($modified > ($ctx->{-mtime} // 0)) {
-                $ctx->{-mtime} = $modified;
-        }
-        $ctx->{manifest}->{$url_path} = {
-                owner => $owner,
-                reference => $reference,
-                description => $desc,
-                modified => $modified,
-                fingerprint => $fingerprint,
-        };
+        my $ent = $git->manifest_entry($epoch, $default_desc) or return;
+        inject_entry($ctx, $url_path, $ent, $git->{git_dir});
 }
 
-sub ibx_entry {
+sub slow_manifest_add ($$) {
         my ($ctx, $ibx) = @_;
         eval {
                 if (defined(my $max = $ibx->max_git_epoch)) {
@@ -111,6 +55,29 @@ sub ibx_entry {
                         manifest_add($ctx, $ibx);
                 }
         };
+}
+
+sub eidx_manifest_add ($$$) {
+        my ($ctx, $ALL, $ibx) = @_;
+        if (my $data = $ALL->misc->inbox_data($ibx)) {
+                $data = $json->decode($data);
+                delete $data->{''}; # private
+                while (my ($url_path, $ent) = each %$data) {
+                        inject_entry($ctx, $url_path, $ent);
+                }
+        } else {
+                warn "E: `${\$ibx->eidx_key}' not indexed by $ALL->{topdir}\n";
+        }
+}
+
+sub ibx_entry {
+        my ($ctx, $ibx) = @_;
+        my $ALL = $ctx->{www}->{pi_cfg}->ALL;
+        if ($ALL) {
+                eidx_manifest_add($ctx, $ALL, $ibx);
+        } else {
+                slow_manifest_add($ctx, $ibx);
+        }
         warn "E: $@" if $@;
 }
 
@@ -134,7 +101,8 @@ sub psgi_triple {
 
 sub per_inbox {
         my ($ctx) = @_;
-        ibx_entry($ctx, $ctx->{-inbox});
+        # only one inbox, slow is probably OK
+        slow_manifest_add($ctx, $ctx->{ibx});
         psgi_triple($ctx);
 }
 
diff --git a/lib/PublicInbox/Mbox.pm b/lib/PublicInbox/Mbox.pm
index 47025891..964147fa 100644
--- a/lib/PublicInbox/Mbox.pm
+++ b/lib/PublicInbox/Mbox.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Streaming interface for mboxrd HTTP responses
@@ -17,10 +17,10 @@ use PublicInbox::Eml;
 sub getline {
         my ($ctx) = @_; # ctx
         my $smsg = $ctx->{smsg} or return;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $eml = $ibx->smsg_eml($smsg) or return;
         my $n = $ctx->{smsg} = $ibx->over->next_by_mid(@{$ctx->{next_arg}});
-        $ctx->zmore(msg_hdr($ctx, $eml, $smsg->{mid}));
+        $ctx->zmore(msg_hdr($ctx, $eml));
         if ($n) {
                 $ctx->translate(msg_body($eml));
         } else { # last message
@@ -44,9 +44,9 @@ sub async_eml { # for async_blob_cb
         my ($ctx, $eml) = @_;
         my $smsg = delete $ctx->{smsg};
         # next message
-        $ctx->{smsg} = $ctx->{-inbox}->over->next_by_mid(@{$ctx->{next_arg}});
+        $ctx->{smsg} = $ctx->{ibx}->over->next_by_mid(@{$ctx->{next_arg}});
 
-        $ctx->zmore(msg_hdr($ctx, $eml, $smsg->{mid}));
+        $ctx->zmore(msg_hdr($ctx, $eml));
         $ctx->{http_out}->write($ctx->translate(msg_body($eml)));
 }
 
@@ -56,7 +56,7 @@ sub res_hdr ($$) {
         $fn =~ s/^re:\s+//i;
         $fn = to_filename($fn) // 'no-subject';
         my @hdr = ('Content-Type');
-        if ($ctx->{-inbox}->{obfuscate}) {
+        if ($ctx->{ibx}->{obfuscate}) {
                 # obfuscation is stupid, but maybe scrapers are, too...
                 push @hdr, 'application/mbox';
                 $fn .= '.mbox';
@@ -71,17 +71,17 @@ sub res_hdr ($$) {
 # for rare cases where v1 inboxes aren't indexed w/ ->over at all
 sub no_over_raw ($) {
         my ($ctx) = @_;
-        my $mref = $ctx->{-inbox}->msg_by_mid($ctx->{mid}) or return;
+        my $mref = $ctx->{ibx}->msg_by_mid($ctx->{mid}) or return;
         my $eml = PublicInbox::Eml->new($mref);
         [ 200, res_hdr($ctx, $eml->header_str('Subject')),
-                [ msg_hdr($ctx, $eml, $ctx->{mid}) . msg_body($eml) ] ]
+                [ msg_hdr($ctx, $eml) . msg_body($eml) ] ]
 }
 
 # /$INBOX/$MESSAGE_ID/raw
 sub emit_raw {
         my ($ctx) = @_;
-        $ctx->{base_url} = $ctx->{-inbox}->base_url($ctx->{env});
-        my $over = $ctx->{-inbox}->over or return no_over_raw($ctx);
+        $ctx->{base_url} = $ctx->{ibx}->base_url($ctx->{env});
+        my $over = $ctx->{ibx}->over or return no_over_raw($ctx);
         my ($id, $prev);
         my $mip = $ctx->{next_arg} = [ $ctx->{mid}, \$id, \$prev ];
         my $smsg = $ctx->{smsg} = $over->next_by_mid(@$mip) or return;
@@ -90,8 +90,8 @@ sub emit_raw {
         $ctx->psgi_response(200, $res_hdr);
 }
 
-sub msg_hdr ($$;$) {
-        my ($ctx, $eml, $mid) = @_;
+sub msg_hdr ($$) {
+        my ($ctx, $eml) = @_;
         my $header_obj = $eml->header_obj;
 
         # drop potentially confusing headers, ssoma already should've dropped
@@ -99,34 +99,11 @@ sub msg_hdr ($$;$) {
         foreach my $d (qw(Lines Bytes Content-Length Status)) {
                 $header_obj->header_set($d);
         }
-        my $ibx = $ctx->{-inbox};
-        my $base = $ctx->{base_url};
-        $mid = $ctx->{mid} unless defined $mid;
-        $mid = mid_escape($mid);
-        my @append = (
-                'Archived-At', "<$base$mid/>",
-                'List-Archive', "<$base>",
-                'List-Post', "<mailto:$ibx->{-primary_address}>",
-        );
         my $crlf = $header_obj->crlf;
         my $buf = $header_obj->as_string;
         # fixup old bug from import (pre-a0c07cba0e5d8b6a)
         $buf =~ s/\A[\r\n]*From [^\r\n]*\r?\n//s;
-        $buf = "From mboxrd\@z Thu Jan  1 00:00:00 1970" . $crlf . $buf;
-
-        for (my $i = 0; $i < @append; $i += 2) {
-                my $k = $append[$i];
-                my $v = $append[$i + 1];
-                my @v = $header_obj->header_raw($k);
-                foreach (@v) {
-                        if ($v eq $_) {
-                                $v = undef;
-                                last;
-                        }
-                }
-                $buf .= "$k: $v$crlf" if defined $v;
-        }
-        $buf .= $crlf;
+        "From mboxrd\@z Thu Jan  1 00:00:00 1970" . $crlf . $buf . $crlf;
 }
 
 sub msg_body ($) {
@@ -190,7 +167,7 @@ sub all_ids_cb {
 
 sub mbox_all_ids {
         my ($ctx) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $prev = 0;
         my $mm = $ctx->{mm} = $ibx->mm;
         my $ids = $mm->ids_after(\$prev) or return
@@ -203,27 +180,33 @@ sub mbox_all_ids {
         PublicInbox::MboxGz::mbox_gz($ctx, \&all_ids_cb, 'all');
 }
 
+sub gone ($$) {
+        my ($ctx, $what) = @_;
+        warn "W: `$ctx->{ibx}->{inboxdir}' $what went away unexpectedly\n";
+        undef;
+}
+
 sub results_cb {
         my ($ctx) = @_;
-        my $over = $ctx->{-inbox}->over or return;
+        my $over = $ctx->{ibx}->over or return gone($ctx, 'over');
         while (1) {
                 while (defined(my $num = shift(@{$ctx->{ids}}))) {
                         my $smsg = $over->get_art($num) or next;
                         return $smsg;
                 }
                 # refill result set
-                my $srch = $ctx->{-inbox}->search(undef, $ctx) or return;
+                my $srch = $ctx->{ibx}->isrch or return gone($ctx, 'search');
                 my $mset = $srch->mset($ctx->{query}, $ctx->{qopts});
                 my $size = $mset->size or return;
                 $ctx->{qopts}->{offset} += $size;
-                $ctx->{ids} = $srch->mset_to_artnums($mset);
+                $ctx->{ids} = $srch->mset_to_artnums($mset, $ctx->{qopts});
         }
 }
 
 sub results_thread_cb {
         my ($ctx) = @_;
 
-        my $over = $ctx->{-inbox}->over or return;
+        my $over = $ctx->{ibx}->over or return gone($ctx, 'over');
         while (1) {
                 while (defined(my $num = shift(@{$ctx->{xids}}))) {
                         my $smsg = $over->get_art($num) or next;
@@ -234,11 +217,11 @@ sub results_thread_cb {
                 next if $over->expand_thread($ctx);
 
                 # refill result set
-                my $srch = $ctx->{-inbox}->search(undef, $ctx) or return;
+                my $srch = $ctx->{ibx}->isrch or return gone($ctx, 'search');
                 my $mset = $srch->mset($ctx->{query}, $ctx->{qopts});
                 my $size = $mset->size or return;
                 $ctx->{qopts}->{offset} += $size;
-                $ctx->{ids} = $srch->mset_to_artnums($mset);
+                $ctx->{ids} = $srch->mset_to_artnums($mset, $ctx->{qopts});
         }
 
 }
@@ -247,19 +230,19 @@ sub mbox_all {
         my ($ctx, $q) = @_;
         my $q_string = $q->{'q'};
         return mbox_all_ids($ctx) if $q_string !~ /\S/;
-        my $srch = $ctx->{-inbox}->search or
+        my $srch = $ctx->{ibx}->isrch or
                 return PublicInbox::WWW::need($ctx, 'Search');
-        my $over = $ctx->{-inbox}->over or
+        my $over = $ctx->{ibx}->over or
                 return PublicInbox::WWW::need($ctx, 'Overview');
 
-        my $qopts = $ctx->{qopts} = { mset => 2 }; # order by docid
+        my $qopts = $ctx->{qopts} = { relevance => -1 }; # ORDER BY docid ASC
         $qopts->{thread} = 1 if $q->{t};
         my $mset = $srch->mset($q_string, $qopts);
         $qopts->{offset} = $mset->size or
                         return [404, [qw(Content-Type text/plain)],
                                 ["No results found\n"]];
         $ctx->{query} = $q_string;
-        $ctx->{ids} = $srch->mset_to_artnums($mset);
+        $ctx->{ids} = $srch->mset_to_artnums($mset, $qopts);
         require PublicInbox::MboxGz;
         my $fn;
         if ($q->{t} && $srch->has_threadid) {
diff --git a/lib/PublicInbox/MboxGz.pm b/lib/PublicInbox/MboxGz.pm
index 913be6e4..3ed33867 100644
--- a/lib/PublicInbox/MboxGz.pm
+++ b/lib/PublicInbox/MboxGz.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::MboxGz;
 use strict;
@@ -22,7 +22,7 @@ sub async_next ($) {
 sub mbox_gz {
         my ($self, $cb, $fn) = @_;
         $self->{cb} = $cb;
-        $self->{base_url} = $self->{-inbox}->base_url($self->{env});
+        $self->{base_url} = $self->{ibx}->base_url($self->{env});
         $self->{gz} = PublicInbox::GzipFilter::gzip_or_die();
         $fn = to_filename($fn // '') // 'no-subject';
         # http://www.iana.org/assignments/media-types/application/gzip
@@ -37,8 +37,8 @@ sub getline {
         my ($self) = @_;
         my $cb = $self->{cb} or return;
         while (my $smsg = $cb->($self)) {
-                my $eml = $self->{-inbox}->smsg_eml($smsg) or next;
-                $self->zmore(msg_hdr($self, $eml, $smsg->{mid}));
+                my $eml = $self->{ibx}->smsg_eml($smsg) or next;
+                $self->zmore(msg_hdr($self, $eml));
                 return $self->translate(msg_body($eml));
         }
         # signal that we're done and can return undef next call:
diff --git a/lib/PublicInbox/MboxReader.pm b/lib/PublicInbox/MboxReader.pm
new file mode 100644
index 00000000..59ce4fb6
--- /dev/null
+++ b/lib/PublicInbox/MboxReader.pm
@@ -0,0 +1,124 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# reader for mbox variants we support
+package PublicInbox::MboxReader;
+use strict;
+use v5.10.1;
+use Data::Dumper;
+$Data::Dumper::Useqq = 1; # should've been the default, for bad data
+
+my $from_strict =
+        qr/^From \S+ +\S+ \S+ +\S+ [^\n:]+:[^\n:]+:[^\n:]+ [^\n:]+\n/sm;
+
+sub _mbox_from {
+        my ($mbfh, $from_re, $eml_cb, @arg) = @_;
+        my $buf = '';
+        my @raw;
+        while (defined(my $r = read($mbfh, $buf, 65536, length($buf)))) {
+                if ($r == 0) { # close here to check for "curl --fail"
+                        close($mbfh) or die "error closing mbox: \$?=$? $!";
+                        @raw = ($buf);
+                } else {
+                        @raw = split(/$from_strict/mos, $buf, -1);
+                        next if scalar(@raw) == 0;
+                        $buf = pop(@raw); # last bit may be incomplete
+                }
+                @raw = grep /[^ \t\r\n]/s, @raw; # skip empty messages
+                while (defined(my $raw = shift @raw)) {
+                        $raw =~ s/\r?\n\z//s;
+                        $raw =~ s/$from_re/$1/gms;
+                        my $eml = PublicInbox::Eml->new(\$raw);
+                        $eml_cb->($eml, @arg);
+                }
+                return if $r == 0; # EOF
+        }
+        die "error reading mboxo/mboxrd handle: $!";
+}
+
+sub mboxrd {
+        my (undef, $mbfh, $eml_cb, @arg) = @_;
+        _mbox_from($mbfh, qr/^>(>*From )/ms, $eml_cb, @arg);
+}
+
+sub mboxo {
+        my (undef, $mbfh, $eml_cb, @arg) = @_;
+        _mbox_from($mbfh, qr/^>(From )/ms, $eml_cb, @arg);
+}
+
+sub _cl_body {
+        my ($mbfh, $bref, $cl) = @_;
+        my $body = substr($$bref, 0, $cl, '');
+        my $need = $cl - length($body);
+        if ($need > 0) {
+                $mbfh or die "E: needed $need bytes after EOF";
+                defined(my $r = read($mbfh, $body, $need, length($body))) or
+                        die "E: read error: $!\n";
+                $r == $need or die "E: read $r of $need bytes\n";
+        }
+        \$body;
+}
+
+sub _extract_hdr {
+        my ($ref) = @_;
+        if (index($$ref, "\r\n") < 0 && (my $pos = index($$ref, "\n\n")) >= 0) {
+                # likely on *nix
+                \substr($$ref, 0, $pos + 2, ''); # sv_chop on $$ref
+        } elsif ($$ref =~ /\r?\n\r?\n/s) {
+                \substr($$ref, 0, $+[0], ''); # sv_chop on $$ref
+        } else {
+                undef
+        }
+}
+
+sub _mbox_cl ($$$;@) {
+        my ($mbfh, $uxs_from, $eml_cb, @arg) = @_;
+        my $buf = '';
+        while (defined(my $r = read($mbfh, $buf, 65536, length($buf)))) {
+                if ($r == 0) { # detect "curl --fail"
+                        close($mbfh) or
+                                die "error closing mboxcl/mboxcl2: \$?=$? $!";
+                        undef $mbfh;
+                }
+                while (my $hdr = _extract_hdr(\$buf)) {
+                        $$hdr =~ s/\A[\r\n]*From [^\n]*\n//s or
+                                die "E: no 'From ' line in:\n", Dumper($hdr);
+                        my $eml = PublicInbox::Eml->new($hdr);
+                        my @cl = $eml->header_raw('Content-Length');
+                        my $n = scalar(@cl);
+                        $n == 0 and die "E: Content-Length missing in:\n",
+                                        Dumper($eml->as_string);
+                        $n == 1 or die "E: multiple ($n) Content-Length in:\n",
+                                        Dumper($eml->as_string);
+                        $cl[0] =~ /\A[0-9]+\z/ or die
+                                "E: Content-Length `$cl[0]' invalid\n",
+                                        Dumper($eml->as_string);
+                        if (($eml->{bdy} = _cl_body($mbfh, \$buf, $cl[0]))) {
+                                $uxs_from and
+                                        ${$eml->{bdy}} =~ s/^>From /From /sgm;
+                        }
+                        $eml_cb->($eml, @arg);
+                }
+                if ($r == 0) {
+                        $buf =~ /[^ \r\n\t]/ and
+                                warn "W: leftover at end of mboxcl/mboxcl2:\n",
+                                        Dumper(\$buf);
+                        return;
+                }
+        }
+        die "error reading mboxcl/mboxcl2 handle: $!";
+}
+
+sub mboxcl {
+        my (undef, $mbfh, $eml_cb, @arg) = @_;
+        _mbox_cl($mbfh, 1, $eml_cb, @arg);
+}
+
+sub mboxcl2 {
+        my (undef, $mbfh, $eml_cb, @arg) = @_;
+        _mbox_cl($mbfh, undef, $eml_cb, @arg);
+}
+
+sub new { bless \(my $x), __PACKAGE__ }
+
+1;
diff --git a/lib/PublicInbox/MiscIdx.pm b/lib/PublicInbox/MiscIdx.pm
new file mode 100644
index 00000000..ab5e029a
--- /dev/null
+++ b/lib/PublicInbox/MiscIdx.pm
@@ -0,0 +1,151 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# like PublicInbox::SearchIdx, but for searching for non-mail messages.
+# Things indexed include:
+# * inboxes themselves
+# * epoch information
+# * (maybe) git code repository information
+# Expect ~100K-1M documents with no parallelism opportunities,
+# so no sharding, here.
+#
+# See MiscSearch for read-only counterpart
+package PublicInbox::MiscIdx;
+use strict;
+use v5.10.1;
+use PublicInbox::InboxWritable;
+use PublicInbox::Search; # for SWIG Xapian and Search::Xapian compat
+use PublicInbox::SearchIdx qw(index_text term_generator add_val);
+use PublicInbox::Spawn qw(nodatacow_dir);
+use Carp qw(croak);
+use File::Path ();
+use PublicInbox::MiscSearch;
+use PublicInbox::Config;
+my $json;
+
+sub new {
+        my ($class, $eidx) = @_;
+        PublicInbox::SearchIdx::load_xapian_writable();
+        my $mi_dir = "$eidx->{xpfx}/misc";
+        File::Path::mkpath($mi_dir);
+        nodatacow_dir($mi_dir);
+        my $flags = $PublicInbox::SearchIdx::DB_CREATE_OR_OPEN;
+        $flags |= $PublicInbox::SearchIdx::DB_NO_SYNC if $eidx->{-no_fsync};
+        $json //= PublicInbox::Config::json();
+        bless {
+                mi_dir => $mi_dir,
+                flags => $flags,
+                indexlevel => 'full', # small DB, no point in medium?
+        }, $class;
+}
+
+sub begin_txn {
+        my ($self) = @_;
+        croak 'BUG: already in txn' if $self->{xdb}; # XXX make lazy?
+        my $wdb = $PublicInbox::Search::X{WritableDatabase};
+        my $xdb = eval { $wdb->new($self->{mi_dir}, $self->{flags}) };
+        croak "Failed opening $self->{mi_dir}: $@" if $@;
+        $self->{xdb} = $xdb;
+        $xdb->begin_transaction;
+}
+
+sub commit_txn {
+        my ($self) = @_;
+        croak 'BUG: not in txn' unless $self->{xdb}; # XXX make lazy?
+        delete($self->{xdb})->commit_transaction;
+}
+
+sub remove_eidx_key {
+        my ($self, $eidx_key) = @_;
+        my $xdb = $self->{xdb};
+        my $head = $xdb->postlist_begin('Q'.$eidx_key);
+        my $tail = $xdb->postlist_end('Q'.$eidx_key);
+        my @docids; # only one, unless we had bugs
+        for (; $head != $tail; $head++) {
+                push @docids, $head->get_docid;
+        }
+        for my $docid (@docids) {
+                $xdb->delete_document($docid);
+                warn "I: remove inbox docid #$docid ($eidx_key)\n";
+        }
+}
+
+# adds or updates according to $eidx_key
+sub index_ibx {
+        my ($self, $ibx) = @_;
+        my $eidx_key = $ibx->eidx_key;
+        my $xdb = $self->{xdb};
+        # Q = uniQue in Xapian terminology
+        my $head = $xdb->postlist_begin('Q'.$eidx_key);
+        my $tail = $xdb->postlist_end('Q'.$eidx_key);
+        my ($docid, @drop);
+        for (; $head != $tail; $head++) {
+                if (defined $docid) {
+                        my $i = $head->get_docid;
+                        push @drop, $i;
+                        warn <<EOF;
+W: multiple inboxes keyed to `$eidx_key', deleting #$i
+EOF
+                } else {
+                        $docid = $head->get_docid;
+                }
+        }
+        $xdb->delete_document($_) for @drop; # just in case
+
+        my $doc = $PublicInbox::Search::X{Document}->new;
+        term_generator($self)->set_document($doc);
+
+        # allow sorting by modified and uidvalidity (created at)
+        add_val($doc, $PublicInbox::MiscSearch::MODIFIED, $ibx->modified);
+        add_val($doc, $PublicInbox::MiscSearch::UIDVALIDITY, $ibx->uidvalidity);
+
+        $doc->add_boolean_term('Q'.$eidx_key); # uniQue id
+        $doc->add_boolean_term('T'.'inbox'); # Type
+
+        if (defined($ibx->{newsgroup}) && $ibx->nntp_usable) {
+                $doc->add_boolean_term('T'.'newsgroup'); # additional Type
+        }
+
+        # force reread from disk, {description} could be loaded from {misc}
+        delete $ibx->{description};
+        my $desc = $ibx->description;
+
+        # description = S/Subject (or title)
+        # address = A/Author
+        index_text($self, $desc, 1, 'S');
+        index_text($self, $ibx->{name}, 1, 'XNAME');
+        my %map = (
+                address => 'A',
+                listid => 'XLISTID',
+                infourl => 'XINFOURL',
+                url => 'XURL'
+        );
+        while (my ($f, $pfx) = each %map) {
+                for my $v (@{$ibx->{$f} // []}) {
+                        index_text($self, $v, 1, $pfx);
+                }
+        }
+        my $data = {};
+        if (defined(my $max = $ibx->max_git_epoch)) { # v2
+                my $pfx = "/$ibx->{name}/git/";
+                for my $epoch (0..$max) {
+                        my $git = $ibx->git_epoch($epoch) or return;
+                        if (my $ent = $git->manifest_entry($epoch, $desc)) {
+                                $data->{"$pfx$epoch.git"} = $ent;
+                                $ent->{git_dir} = $git->{git_dir};
+                        }
+                        $git->cleanup; # ->modified starts cat-file --batch
+                }
+        } elsif (my $ent = $ibx->git->manifest_entry) { # v1
+                $ent->{git_dir} = $ibx->{inboxdir};
+                $data->{"/$ibx->{name}"} = $ent;
+        }
+        $doc->set_data($json->encode($data));
+        if (defined $docid) {
+                $xdb->replace_document($docid, $doc);
+        } else {
+                $xdb->add_document($doc);
+        }
+}
+
+1;
diff --git a/lib/PublicInbox/MiscSearch.pm b/lib/PublicInbox/MiscSearch.pm
new file mode 100644
index 00000000..ead9a278
--- /dev/null
+++ b/lib/PublicInbox/MiscSearch.pm
@@ -0,0 +1,191 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# read-only counterpart to MiscIdx
+package PublicInbox::MiscSearch;
+use strict;
+use v5.10.1;
+use PublicInbox::Search qw(retry_reopen int_val);
+my $json;
+
+# Xapian value columns:
+our $MODIFIED = 0;
+our $UIDVALIDITY = 1; # (created time)
+
+# avoid conflicting with message Search::prob_prefix for UI/UX reasons
+my %PROB_PREFIX = (
+        description => 'S', # $INBOX_DIR/description
+        address => 'A',
+        listid => 'XLISTID',
+        url => 'XURL',
+        infourl => 'XINFOURL',
+        name => 'XNAME',
+        '' => 'S A XLISTID XNAME XURL XINFOURL'
+);
+
+sub new {
+        my ($class, $dir) = @_;
+        PublicInbox::Search::load_xapian();
+        $json //= PublicInbox::Config::json();
+        bless {
+                xdb => $PublicInbox::Search::X{Database}->new($dir)
+        }, $class;
+}
+
+# read-only
+sub mi_qp_new ($) {
+        my ($self) = @_;
+        my $xdb = $self->{xdb};
+        my $qp = $PublicInbox::Search::X{QueryParser}->new;
+        $qp->set_default_op(PublicInbox::Search::OP_AND());
+        $qp->set_database($xdb);
+        $qp->set_stemmer(PublicInbox::Search::stemmer($self));
+        $qp->set_stemming_strategy(PublicInbox::Search::STEM_SOME());
+        my $cb = $qp->can('set_max_wildcard_expansion') //
+                $qp->can('set_max_expansion'); # Xapian 1.5.0+
+        $cb->($qp, 100);
+        $cb = $qp->can('add_valuerangeprocessor') //
+                $qp->can('add_rangeprocessor'); # Xapian 1.5.0+
+        while (my ($name, $prefix) = each %PROB_PREFIX) {
+                $qp->add_prefix($name, $_) for split(/ /, $prefix);
+        }
+        $qp->add_boolean_prefix('type', 'T');
+        $qp;
+}
+
+sub misc_enquire_once { # retry_reopen callback
+        my ($self, $qr, $opt) = @_;
+        my $eq = $PublicInbox::Search::X{Enquire}->new($self->{xdb});
+        $eq->set_query($qr);
+        my $desc = !$opt->{asc};
+        my $rel = $opt->{relevance} // 0;
+        if ($rel == -1) { # ORDER BY docid/UID
+                $eq->set_docid_order($PublicInbox::Search::ENQ_ASCENDING);
+                $eq->set_weighting_scheme($PublicInbox::Search::X{BoolWeight}->new);
+        } elsif ($rel) {
+                $eq->set_sort_by_relevance_then_value($MODIFIED, $desc);
+        } else {
+                $eq->set_sort_by_value_then_relevance($MODIFIED, $desc);
+        }
+        $eq->get_mset($opt->{offset} || 0, $opt->{limit} || 200);
+}
+
+sub mset {
+        my ($self, $qs, $opt) = @_;
+        $opt ||= {};
+        reopen($self);
+        my $qp = $self->{qp} //= mi_qp_new($self);
+        $qs = 'type:inbox' if $qs eq '';
+        my $qr = $qp->parse_query($qs, $PublicInbox::Search::QP_FLAGS);
+        $opt->{relevance} = 1 unless exists $opt->{relevance};
+        retry_reopen($self, \&misc_enquire_once, $qr, $opt);
+}
+
+sub ibx_matches_once { # retry_reopen callback
+        my ($self, $qr, $by_newsgroup) = @_;
+        # double in case no newsgroups are configured:
+        my $limit = scalar(keys %$by_newsgroup) * 2;
+        my $opt = { limit => $limit, offset => 0, relevance => -1 };
+        my $ret = {}; # newsgroup => $ibx of matches
+        while (1) {
+                my $mset = misc_enquire_once($self, $qr, $opt);
+                for my $mi ($mset->items) {
+                        my $doc = $mi->get_document;
+                        my $end = $doc->termlist_end;
+                        my $cur = $doc->termlist_begin;
+                        $cur->skip_to('Q');
+                        if ($cur != $end) {
+                                my $ng = $cur->get_termname; # eidx_key
+                                $ng =~ s/\AQ// or warn "BUG: no `Q': $ng";
+                                if (my $ibx = $by_newsgroup->{$ng}) {
+                                        $ret->{$ng} = $ibx;
+                                }
+                        } else {
+                                warn <<EOF;
+W: docid=${\$mi->get_docid} has no `Q' (eidx_key) term
+EOF
+                        }
+                }
+                my $nr = $mset->size;
+                return $ret if $nr < $limit;
+                $opt->{offset} += $nr;
+        }
+}
+
+# returns a newsgroup => PublicInbox::Inbox mapping
+sub newsgroup_matches {
+        my ($self, $qs, $pi_cfg) = @_;
+        my $qp = $self->{qp} //= mi_qp_new($self);
+        $qs .= ' type:inbox';
+        my $qr = $qp->parse_query($qs, $PublicInbox::Search::QP_FLAGS);
+        retry_reopen($self, \&ibx_matches_once, $qr, $pi_cfg->{-by_newsgroup});
+}
+
+sub ibx_data_once {
+        my ($self, $ibx) = @_;
+        my $xdb = $self->{xdb};
+        my $term = 'Q'.$ibx->eidx_key; # may be {inboxdir}, so private
+        my $head = $xdb->postlist_begin($term);
+        my $tail = $xdb->postlist_end($term);
+        if ($head != $tail) {
+                my $doc = $xdb->get_document($head->get_docid);
+                $ibx->{uidvalidity} //= int_val($doc, $UIDVALIDITY);
+                $ibx->{-modified} = int_val($doc, $MODIFIED);
+                $doc->get_data;
+        } else {
+                undef;
+        }
+}
+
+sub inbox_data {
+        my ($self, $ibx) = @_;
+        retry_reopen($self, \&ibx_data_once, $ibx);
+}
+
+sub ibx_cache_load {
+        my ($doc, $cache) = @_;
+        my $end = $doc->termlist_end;
+        my $cur = $doc->termlist_begin;
+        $cur->skip_to('Q');
+        return if $cur == $end;
+        my $eidx_key = $cur->get_termname;
+        $eidx_key =~ s/\AQ// or return; # expired
+        my $ce = $cache->{$eidx_key} = {};
+        $ce->{uidvalidity} = int_val($doc, $UIDVALIDITY);
+        $ce->{-modified} = int_val($doc, $MODIFIED);
+        $ce->{description} = do {
+                # extract description from manifest.js.gz epoch description
+                my $d;
+                my $data = $json->decode($doc->get_data);
+                for (values %$data) {
+                        $d = $_->{description} // next;
+                        $d =~ s/ \[epoch [0-9]+\]\z// or next;
+                        last;
+                }
+                $d;
+        }
+}
+
+sub _nntpd_cache_load { # retry_reopen callback
+        my ($self) = @_;
+        my $opt = { limit => $self->{xdb}->get_doccount * 10, relevance => -1 };
+        my $mset = mset($self, 'type:newsgroup type:inbox', $opt);
+        my $cache = {};
+        for my $it ($mset->items) {
+                ibx_cache_load($it->get_document, $cache);
+        }
+        $cache
+}
+
+# returns { newsgroup => $cache_entry } mapping, $cache_entry contains
+# anything which may trigger seeks at startup, currently: description,
+# -modified, and uidvalidity.
+sub nntpd_cache_load {
+        my ($self) = @_;
+        retry_reopen($self, \&_nntpd_cache_load);
+}
+
+no warnings 'once';
+*reopen = \&PublicInbox::Search::reopen;
+
+1;
diff --git a/lib/PublicInbox/MsgIter.pm b/lib/PublicInbox/MsgIter.pm
index bb1dfead..c503eb98 100644
--- a/lib/PublicInbox/MsgIter.pm
+++ b/lib/PublicInbox/MsgIter.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # read-only utilities for Email::MIME
diff --git a/lib/PublicInbox/MsgTime.pm b/lib/PublicInbox/MsgTime.pm
index 8596f01c..5ee087fd 100644
--- a/lib/PublicInbox/MsgTime.pm
+++ b/lib/PublicInbox/MsgTime.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Various date/time-related functions
diff --git a/lib/PublicInbox/Msgmap.pm b/lib/PublicInbox/Msgmap.pm
index f15875e3..826c4b30 100644
--- a/lib/PublicInbox/Msgmap.pm
+++ b/lib/PublicInbox/Msgmap.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # bidirectional Message-ID <-> Article Number mapping for the NNTP
@@ -36,8 +36,7 @@ sub new_file {
                 create_tables($dbh);
                 $self->created_at(time) unless $self->created_at;
 
-                my $max = $self->max // 0;
-                $self->num_highwater($max);
+                $self->num_highwater(max($self));
                 $dbh->commit;
         }
         $self;
@@ -144,7 +143,7 @@ sub max {
         my $sth = $_[0]->{dbh}->prepare_cached('SELECT MAX(num) FROM msgmap',
                                                 undef, 1);
         $sth->execute;
-        $sth->fetchrow_array;
+        $sth->fetchrow_array // 0;
 }
 
 sub minmax {
@@ -153,7 +152,7 @@ sub minmax {
         my $sth = $_[0]->{dbh}->prepare_cached('SELECT MIN(num) FROM msgmap',
                                                 undef, 1);
         $sth->execute;
-        ($sth->fetchrow_array, max($_[0]));
+        ($sth->fetchrow_array // 0, max($_[0]));
 }
 
 sub mid_delete {
diff --git a/lib/PublicInbox/NDC_PP.pm b/lib/PublicInbox/NDC_PP.pm
index 10a7ee2a..57abccbe 100644
--- a/lib/PublicInbox/NDC_PP.pm
+++ b/lib/PublicInbox/NDC_PP.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Pure-perl class for Linux non-Inline::C users to disable COW for btrfs
diff --git a/lib/PublicInbox/NNTP.pm b/lib/PublicInbox/NNTP.pm
index 2f821fa6..18822d3b 100644
--- a/lib/PublicInbox/NNTP.pm
+++ b/lib/PublicInbox/NNTP.pm
@@ -1,11 +1,11 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Each instance of this represents a NNTP client socket
 # fields:
 # nntpd: PublicInbox::NNTPD ref
 # article: per-session current article number
-# ng: PublicInbox::Inbox ref
+# ibx: PublicInbox::Inbox ref
 # long_cb: long_response private data
 package PublicInbox::NNTP;
 use strict;
@@ -17,6 +17,8 @@ use PublicInbox::DS qw(now);
 use Digest::SHA qw(sha1_hex);
 use Time::Local qw(timegm timelocal);
 use PublicInbox::GitAsyncCat;
+use PublicInbox::Address;
+
 use constant {
         LINE_MAX => 512, # RFC 977 section 2.3
         r501 => '501 command syntax error',
@@ -31,9 +33,9 @@ use Errno qw(EAGAIN);
 my $ONE_MSGID = qr/\A$MID_EXTRACT\z/;
 my @OVERVIEW = qw(Subject From Date Message-ID References);
 my $OVERVIEW_FMT = join(":\r\n", @OVERVIEW, qw(Bytes Lines), '') .
-                "Xref:full\r\n";
+                "Xref:full\r\n.";
 my $LIST_HEADERS = join("\r\n", @OVERVIEW,
-                        qw(:bytes :lines Xref To Cc)) . "\r\n";
+                        qw(:bytes :lines Xref To Cc)) . "\r\n.";
 my $CAPABILITIES = <<"";
 101 Capability list:\r
 VERSION 2\r
@@ -92,8 +94,7 @@ sub process_line ($$) {
                 err($self, 'error from: %s (%s)', $l, $err);
                 $res = '503 program fault - command not performed';
         }
-        return 0 unless defined $res;
-        res($self, $res);
+        defined($res) ? res($self, $res) : 0;
 }
 
 # The keyword argument is not used (rfc3977 5.2.2)
@@ -109,9 +110,7 @@ sub cmd_capabilities ($;$) {
 
 sub cmd_mode ($$) {
         my ($self, $arg) = @_;
-        $arg = uc $arg;
-        return r501 unless $arg eq 'READER';
-        '201 Posting prohibited';
+        uc($arg) eq 'READER' ? '201 Posting prohibited' : r501;
 }
 
 sub cmd_slave ($) { '202 slave status noted' }
@@ -120,46 +119,66 @@ sub cmd_xgtitle ($;$) {
         my ($self, $wildmat) = @_;
         more($self, '282 list of groups and descriptions follows');
         list_newsgroups($self, $wildmat);
-        '.'
 }
 
-sub list_overview_fmt ($) {
-        my ($self) = @_;
-        $self->msg_more($OVERVIEW_FMT);
-}
+sub list_overview_fmt ($) { $OVERVIEW_FMT }
 
-sub list_headers ($;$) {
-        my ($self) = @_;
-        $self->msg_more($LIST_HEADERS);
+sub list_headers ($;$) { $LIST_HEADERS }
+
+sub list_active_i { # "LIST ACTIVE" and also just "LIST" (no args)
+        my ($self, $groupnames) = @_;
+        my @window = splice(@$groupnames, 0, 100) or return 0;
+        my $ibx;
+        my $groups = $self->{nntpd}->{pi_cfg}->{-by_newsgroup};
+        for my $ngname (@window) {
+                $ibx = $groups->{$ngname} and group_line($self, $ibx);
+        }
+        scalar(@$groupnames); # continue if there's more
 }
 
-sub list_active ($;$) {
+sub list_active ($;$) { # called by cmd_list
         my ($self, $wildmat) = @_;
         wildmat2re($wildmat);
-        foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                $ng->{newsgroup} =~ $wildmat or next;
-                group_line($self, $ng);
+        long_response($self, \&list_active_i, [
+                grep(/$wildmat/, @{$self->{nntpd}->{groupnames}}) ]);
+}
+
+sub list_active_times_i {
+        my ($self, $groupnames) = @_;
+        my @window = splice(@$groupnames, 0, 100) or return 0;
+        my $groups = $self->{nntpd}->{pi_cfg}->{-by_newsgroup};
+        for my $ngname (@window) {
+                my $ibx = $groups->{$ngname} or next;
+                my $c = eval { $ibx->uidvalidity } // time;
+                more($self, "$ngname $c <$ibx->{-primary_address}>");
         }
+        scalar(@$groupnames); # continue if there's more
 }
 
-sub list_active_times ($;$) {
+sub list_active_times ($;$) { # called by cmd_list
         my ($self, $wildmat) = @_;
         wildmat2re($wildmat);
-        foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                $ng->{newsgroup} =~ $wildmat or next;
-                my $c = eval { $ng->mm->created_at } || time;
-                more($self, "$ng->{newsgroup} $c $ng->{-primary_address}");
+        long_response($self, \&list_active_times_i, [
+                grep(/$wildmat/, @{$self->{nntpd}->{groupnames}}) ]);
+}
+
+sub list_newsgroups_i {
+        my ($self, $groupnames) = @_;
+        my @window = splice(@$groupnames, 0, 100) or return 0;
+        my $groups = $self->{nntpd}->{pi_cfg}->{-by_newsgroup};
+        my $ibx;
+        for my $ngname (@window) {
+                $ibx = $groups->{$ngname} and
+                        more($self, "$ngname ".$ibx->description);
         }
+        scalar(@$groupnames); # continue if there's more
 }
 
-sub list_newsgroups ($;$) {
+sub list_newsgroups ($;$) { # called by cmd_list
         my ($self, $wildmat) = @_;
         wildmat2re($wildmat);
-        foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                $ng->{newsgroup} =~ $wildmat or next;
-                my $d = $ng->description;
-                more($self, "$ng->{newsgroup} $d");
-        }
+        long_response($self, \&list_newsgroups_i, [
+                grep(/$wildmat/, @{$self->{nntpd}->{groupnames}}) ]);
 }
 
 # LIST SUBSCRIPTIONS, DISTRIB.PATS are not supported
@@ -168,6 +187,7 @@ sub cmd_list ($;$$) {
         if (scalar @args) {
                 my $arg = shift @args;
                 $arg =~ tr/A-Z./a-z_/;
+                my $ret = $arg eq 'active';
                 $arg = "list_$arg";
                 $arg = $self->can($arg);
                 return r501 unless $arg && args_ok($arg, scalar @args);
@@ -175,24 +195,22 @@ sub cmd_list ($;$$) {
                 $arg->($self, @args);
         } else {
                 more($self, '215 list of newsgroups follows');
-                foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                        group_line($self, $ng);
-                }
+                long_response($self, \&list_active_i, [ # copy array
+                        @{$self->{nntpd}->{groupnames}} ]);
         }
-        '.'
 }
 
 sub listgroup_range_i {
         my ($self, $beg, $end) = @_;
-        my $r = $self->{ng}->mm->msg_range($beg, $end, 'num');
+        my $r = $self->{ibx}->mm->msg_range($beg, $end, 'num');
         scalar(@$r) or return;
-        more($self, join("\r\n", map { $_->[0] } @$r));
+        $self->msg_more(join('', map { "$_->[0]\r\n" } @$r));
         1;
 }
 
 sub listgroup_all_i {
         my ($self, $num) = @_;
-        my $ary = $self->{ng}->mm->ids_after($num);
+        my $ary = $self->{ibx}->mm->ids_after($num);
         scalar(@$ary) or return;
         more($self, join("\r\n", @$ary));
         1;
@@ -205,7 +223,7 @@ sub cmd_listgroup ($;$$) {
                 return $res if ($res !~ /\A211 /);
                 more($self, $res);
         }
-        $self->{ng} or return '412 no newsgroup selected';
+        $self->{ibx} or return '412 no newsgroup selected';
         if (defined $range) {
                 my $r = get_range($self, $range);
                 return $r unless ref $r;
@@ -242,9 +260,22 @@ sub parse_time ($$;$) {
 }
 
 sub group_line ($$) {
-        my ($self, $ng) = @_;
-        my ($min, $max) = $ng->mm->minmax;
-        more($self, "$ng->{newsgroup} $max $min n") if defined $min && defined $max;
+        my ($self, $ibx) = @_;
+        my ($min, $max) = $ibx->mm->minmax;
+        more($self, "$ibx->{newsgroup} $max $min n");
+}
+
+sub newgroups_i {
+        my ($self, $ts, $i, $groupnames) = @_;
+        my $end = $$i + 100;
+        my $groups = $self->{nntpd}->{pi_cfg}->{-by_newsgroup};
+        while ($$i < $end) {
+                my $ngname = $groupnames->[$$i++] // return;
+                my $ibx = $groups->{$ngname} or next; # expired on reload
+                next unless (eval { $ibx->uidvalidity } // 0) > $ts;
+                group_line($self, $ibx);
+        }
+        1;
 }
 
 sub cmd_newgroups ($$$;$$) {
@@ -254,12 +285,8 @@ sub cmd_newgroups ($$$;$$) {
 
         # TODO dists
         more($self, '231 list of new newsgroups follows');
-        foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                my $c = eval { $ng->mm->created_at } || 0;
-                next unless $c > $ts;
-                group_line($self, $ng);
-        }
-        '.'
+        long_response($self, \&newgroups_i, $ts, \(my $i = 0),
+                                $self->{nntpd}->{groupnames});
 }
 
 sub wildmat2re (;$) {
@@ -294,23 +321,27 @@ sub ngpat2re (;$) {
 }
 
 sub newnews_i {
-        my ($self, $overs, $ts, $prev) = @_;
-        my $over = $overs->[0];
-        my $msgs = $over->query_ts($ts, $$prev);
-        if (scalar @$msgs) {
-                more($self, '<' .
-                        join(">\r\n<", map { $_->{mid} } @$msgs ).
-                        '>');
-                $$prev = $msgs->[-1]->{num};
-        } else {
-                shift @$overs;
-                if (@$overs) { # continue onto next newsgroup
-                        $$prev = 0;
-                        return 1;
-                } else { # break out of the long response.
-                        return;
+        my ($self, $names, $ts, $prev) = @_;
+        my $ngname = $names->[0];
+        if (my $ibx = $self->{nntpd}->{pi_cfg}->{-by_newsgroup}->{$ngname}) {
+                if (my $over = $ibx->over) {
+                        my $msgs = $over->query_ts($ts, $$prev);
+                        if (scalar @$msgs) {
+                                $self->msg_more(join('', map {
+                                                        "<$_->{mid}>\r\n";
+                                                } @$msgs));
+                                $$prev = $msgs->[-1]->{num};
+                                return 1; # continue on current group
+                        }
                 }
         }
+        shift @$names;
+        if (@$names) { # continue onto next newsgroup
+                $$prev = 0;
+                1;
+        } else { # all done, break out of the long_response
+                undef;
+        }
 }
 
 sub cmd_newnews ($$$$;$$) {
@@ -321,30 +352,22 @@ sub cmd_newnews ($$$$;$$) {
         my ($keep, $skip) = split('!', $newsgroups, 2);
         ngpat2re($keep);
         ngpat2re($skip);
-        my @overs;
-        foreach my $ng (@{$self->{nntpd}->{grouplist}}) {
-                $ng->{newsgroup} =~ $keep or next;
-                $ng->{newsgroup} =~ $skip and next;
-                my $over = $ng->over or next;
-                push @overs, $over;
-        };
-        return '.' unless @overs;
-
+        my @names = grep(!/$skip/, grep(/$keep/,
+                                @{$self->{nntpd}->{groupnames}}));
+        return '.' unless scalar(@names);
         my $prev = 0;
-        long_response($self, \&newnews_i, \@overs, $ts, \$prev);
+        long_response($self, \&newnews_i, \@names, $ts, \$prev);
 }
 
 sub cmd_group ($$) {
         my ($self, $group) = @_;
-        my $no_such = '411 no such news group';
         my $nntpd = $self->{nntpd};
-        my $ng = $nntpd->{groups}->{$group} or return $no_such;
+        my $ibx = $nntpd->{pi_cfg}->{-by_newsgroup}->{$group} or
+                return '411 no such news group';
         $nntpd->idler_start;
 
-        $self->{ng} = $ng;
-        my ($min, $max) = $ng->mm->minmax;
-        $min ||= 0;
-        $max ||= 0;
+        $self->{ibx} = $ibx;
+        my ($min, $max) = $ibx->mm->minmax;
         $self->{article} = $min;
         my $est_size = $max - $min;
         "211 $est_size $min $max $group";
@@ -352,13 +375,13 @@ sub cmd_group ($$) {
 
 sub article_adj ($$) {
         my ($self, $off) = @_;
-        my $ng = $self->{ng} or return '412 no newsgroup selected';
+        my $ibx = $self->{ibx} or return '412 no newsgroup selected';
 
         my $n = $self->{article};
         defined $n or return '420 no current article has been selected';
 
         $n += $off;
-        my $mid = $ng->mm->mid_for($n);
+        my $mid = $ibx->mm->mid_for($n);
         unless ($mid) {
                 $n = $off > 0 ? 'next' : 'previous';
                 return "421 no $n article in this group";
@@ -374,8 +397,8 @@ sub cmd_last ($) { article_adj($_[0], -1) }
 # the single-point-of-failure a single server provides.
 sub cmd_post ($) {
         my ($self) = @_;
-        my $ng = $self->{ng};
-        $ng ? "440 mailto:$ng->{-primary_address} to post"
+        my $ibx = $self->{ibx};
+        $ibx ? "440 mailto:$ibx->{-primary_address} to post"
                 : '440 posting not allowed'
 }
 
@@ -395,19 +418,41 @@ sub header_append ($$$) {
         $hdr->header_set($k, @v, $v);
 }
 
-sub xref ($$$$) {
-        my ($self, $ng, $n, $mid) = @_;
-        my $ret = $self->{nntpd}->{servername} . " $ng->{newsgroup}:$n";
+sub xref_by_tc ($$$) {
+        my ($xref, $pi_cfg, $smsg) = @_;
+        my $by_addr = $pi_cfg->{-by_addr};
+        my $mid = $smsg->{mid};
+        for my $f (qw(to cc)) {
+                my @ibxs = map {
+                        $by_addr->{lc($_)} // ()
+                } (PublicInbox::Address::emails($smsg->{$f} // ''));
+                for my $ibx (@ibxs) {
+                        my $ngname = $ibx->{newsgroup} // next;
+                        next if defined $xref->{$ngname};
+                        $xref->{$ngname} = eval { $ibx->mm->num_for($mid) };
+                }
+        }
+}
 
-        # num_for is pretty cheap and sometimes we'll lookup the existence
-        # of an article without getting even the OVER info.  In other words,
-        # I'm not sure if its worth optimizing by scanning To:/Cc: and
-        # PublicInbox::ExtMsg on the PSGI end is just as expensive
-        foreach my $other (@{$self->{nntpd}->{grouplist}}) {
-                next if $ng eq $other;
-                my $num = eval { $other->mm->num_for($mid) } or next;
-                $ret .= " $other->{newsgroup}:$num";
+sub xref ($$$) {
+        my ($self, $cur_ibx, $smsg) = @_;
+        my $nntpd = $self->{nntpd};
+        my $cur_ng = $cur_ibx->{newsgroup};
+        my $xref;
+        if (my $ALL = $nntpd->{pi_cfg}->ALL) {
+                $xref = $ALL->nntp_xref_for($cur_ibx, $smsg);
+                xref_by_tc($xref, $nntpd->{pi_cfg}, $smsg);
+        } else { # slow path
+                $xref = { $cur_ng => $smsg->{num} };
+                my $mid = $smsg->{mid};
+                for my $ibx (values %{$nntpd->{pi_cfg}->{-by_newsgroup}}) {
+                        next if defined($xref->{$ibx->{newsgroup}});
+                        my $num = eval { $ibx->mm->num_for($mid) } // next;
+                        $xref->{$ibx->{newsgroup}} = $num;
+                }
         }
+        my $ret = "$nntpd->{servername} $cur_ng:".delete($xref->{$cur_ng});
+        $ret .= " $_:$xref->{$_}" for (sort keys %$xref);
         $ret;
 }
 
@@ -430,7 +475,7 @@ sub set_nntp_headers ($$) {
 
         # clobber some existing headers
         my $ibx = $smsg->{-ibx};
-        my $xref = xref($smsg->{nntp}, $ibx, $smsg->{num}, $mid);
+        my $xref = xref($smsg->{nntp}, $ibx, $smsg);
         $hdr->header_set('Xref', $xref);
 
         # RFC 5536 3.1.4
@@ -442,53 +487,34 @@ sub set_nntp_headers ($$) {
         # *something* here is required for leafnode, try to follow
         # RFC 5536 3.1.5...
         $hdr->header_set('Path', $server_name . '!not-for-mail');
-
-        header_append($hdr, 'List-Post', "<mailto:$ibx->{-primary_address}>");
-        if (my $url = $ibx->base_url) {
-                $mid = mid_escape($mid);
-                header_append($hdr, 'Archived-At', "<$url$mid/>");
-                header_append($hdr, 'List-Archive', "<$url>");
-        }
 }
 
 sub art_lookup ($$$) {
         my ($self, $art, $code) = @_;
-        my $ng = $self->{ng};
-        my ($n, $mid);
+        my ($ibx, $n);
         my $err;
         if (defined $art) {
                 if ($art =~ /\A[0-9]+\z/) {
                         $err = '423 no such article number in this group';
                         $n = int($art);
-                        goto find_mid;
+                        goto find_ibx;
                 } elsif ($art =~ $ONE_MSGID) {
-                        $mid = $1;
-                        $err = r430;
-                        $n = $ng->mm->num_for($mid) if $ng;
-                        goto found if defined $n;
-                        foreach my $g (values %{$self->{nntpd}->{groups}}) {
-                                $n = $g->mm->num_for($mid);
-                                if (defined $n) {
-                                        $ng = $g;
-                                        goto found;
-                                }
-                        }
-                        return $err;
+                        ($ibx, $n) = mid_lookup($self, $1);
+                        goto found if $ibx;
+                        return r430;
                 } else {
                         return r501;
                 }
         } else {
                 $err = '420 no current article has been selected';
-                $n = $self->{article};
-                defined $n or return $err;
-find_mid:
-                $ng or return '412 no newsgroup has been selected';
-                $mid = $ng->mm->mid_for($n);
-                defined $mid or return $err;
+                $n = $self->{article} // return $err;
+find_ibx:
+                $ibx = $self->{ibx} or
+                                return '412 no newsgroup has been selected';
         }
 found:
-        my $smsg = $ng->over->get_art($n) or return $err;
-        $smsg->{-ibx} = $ng;
+        my $smsg = $ibx->over->get_art($n) or return $err;
+        $smsg->{-ibx} = $ibx;
         if ($code == 223) { # STAT
                 set_art($self, $n);
                 "223 $n <$smsg->{mid}> article retrieved - " .
@@ -498,7 +524,7 @@ found:
                 $smsg->{nntp_code} = $code;
                 set_art($self, $art);
                 # this dereferences to `undef'
-                ${git_async_cat($ng->git, $smsg->{blob}, \&blob_cb, $smsg)};
+                ${git_async_cat($ibx->git, $smsg->{blob}, \&blob_cb, $smsg)};
         }
 }
 
@@ -598,10 +624,10 @@ sub cmd_help ($) {
 
 sub get_range ($$) {
         my ($self, $range) = @_;
-        my $ng = $self->{ng} or return '412 no news group has been selected';
+        my $ibx = $self->{ibx} or return '412 no news group has been selected';
         defined $range or return '420 No article(s) selected';
         my ($beg, $end);
-        my ($min, $max) = $ng->mm->minmax;
+        my ($min, $max) = $ibx->mm->minmax;
         if ($range =~ /\A([0-9]+)\z/) {
                 $beg = $end = $1;
         } elsif ($range =~ /\A([0-9]+)-\z/) {
@@ -671,9 +697,9 @@ sub long_response ($$;@) {
 
 sub hdr_msgid_range_i {
         my ($self, $beg, $end) = @_;
-        my $r = $self->{ng}->mm->msg_range($beg, $end);
+        my $r = $self->{ibx}->mm->msg_range($beg, $end);
         @$r or return;
-        more($self, join("\r\n", map { "$_->[0] <$_->[1]>" } @$r));
+        $self->msg_more(join('', map { "$_->[0] <$_->[1]>\r\n" } @$r));
         1;
 }
 
@@ -681,9 +707,9 @@ sub hdr_message_id ($$$) { # optimize XHDR Message-ID [range] for slrnpull.
         my ($self, $xhdr, $range) = @_;
 
         if (defined $range && $range =~ $ONE_MSGID) {
-                my ($ng, $n) = mid_lookup($self, $1);
+                my ($ibx, $n) = mid_lookup($self, $1);
                 return r430 unless $n;
-                hdr_mid_response($self, $xhdr, $ng, $n, $range, $range);
+                hdr_mid_response($self, $xhdr, $ibx, $n, $range, $range);
         } else { # numeric range
                 $range = $self->{article} unless defined $range;
                 my $r = get_range($self, $range);
@@ -695,28 +721,54 @@ sub hdr_message_id ($$$) { # optimize XHDR Message-ID [range] for slrnpull.
 
 sub mid_lookup ($$) {
         my ($self, $mid) = @_;
-        my $self_ng = $self->{ng};
-        if ($self_ng) {
-                my $n = $self_ng->mm->num_for($mid);
-                return ($self_ng, $n) if defined $n;
+        my $cur_ibx = $self->{ibx};
+        if ($cur_ibx) {
+                my $n = $cur_ibx->mm->num_for($mid);
+                return ($cur_ibx, $n) if defined $n;
         }
-        foreach my $ng (values %{$self->{nntpd}->{groups}}) {
-                next if defined $self_ng && $ng eq $self_ng;
-                my $n = $ng->mm->num_for($mid);
-                return ($ng, $n) if defined $n;
+        my $pi_cfg = $self->{nntpd}->{pi_cfg};
+        if (my $ALL = $pi_cfg->ALL) {
+                my ($id, $prev);
+                while (my $smsg = $ALL->over->next_by_mid($mid, \$id, \$prev)) {
+                        my $xr3 = $ALL->over->get_xref3($smsg->{num});
+                        if (my @x = grep(/:$smsg->{blob}\z/, @$xr3)) {
+                                my ($ngname, $xnum) = split(/:/, $x[0]);
+                                my $ibx = $pi_cfg->{-by_newsgroup}->{$ngname};
+                                return ($ibx, $xnum) if $ibx;
+                                # fall through to trying all xref3s
+                        } else {
+                                warn <<EOF;
+W: xref3 missing for <$mid> ($smsg->{blob}) in $ALL->{topdir}, -extindex bug?
+EOF
+                        }
+                        # try all xref3s
+                        for my $x (@$xr3) {
+                                my ($ngname, $xnum) = split(/:/, $x);
+                                my $ibx = $pi_cfg->{-by_newsgroup}->{$ngname};
+                                return ($ibx, $xnum) if $ibx;
+                                warn "W: `$ngname' does not exist for #$xnum\n";
+                        }
+                }
+                # no warning here, $mid is just invalid
+        } else { # slow path for non-ALL users
+                for my $ibx (values %{$pi_cfg->{-by_newsgroup}}) {
+                        next if defined $cur_ibx && $ibx eq $cur_ibx;
+                        my $n = $ibx->mm->num_for($mid);
+                        return ($ibx, $n) if defined $n;
+                }
         }
         (undef, undef);
 }
 
 sub xref_range_i {
         my ($self, $beg, $end) = @_;
-        my $ng = $self->{ng};
-        my $r = $ng->mm->msg_range($beg, $end);
-        @$r or return;
-        more($self, join("\r\n", map {
-                my $num = $_->[0];
-                "$num ".xref($self, $ng, $num, $_->[1]);
-        } @$r));
+        my $ibx = $self->{ibx};
+        my $msgs = $ibx->over->query_xover($$beg, $end);
+        scalar(@$msgs) or return;
+        $$beg = $msgs->[-1]->{num} + 1;
+        $self->msg_more(join('', map {
+                "$_->{num} ".xref($self, $ibx, $_) . "\r\n";
+        } @$msgs));
         1;
 }
 
@@ -725,10 +777,11 @@ sub hdr_xref ($$$) { # optimize XHDR Xref [range] for rtin
 
         if (defined $range && $range =~ $ONE_MSGID) {
                 my $mid = $1;
-                my ($ng, $n) = mid_lookup($self, $mid);
+                my ($ibx, $n) = mid_lookup($self, $mid);
                 return r430 unless $n;
-                hdr_mid_response($self, $xhdr, $ng, $n, $range,
-                                xref($self, $ng, $n, $mid));
+                my $smsg = $ibx->over->get_art($n) or return;
+                hdr_mid_response($self, $xhdr, $ibx, $n, $range,
+                                xref($self, $ibx, $smsg));
         } else { # numeric range
                 $range = $self->{article} unless defined $range;
                 my $r = get_range($self, $range);
@@ -747,7 +800,7 @@ sub over_header_for {
 
 sub smsg_range_i {
         my ($self, $beg, $end, $field) = @_;
-        my $over = $self->{ng}->over;
+        my $over = $self->{ibx}->over;
         my $msgs = $over->query_xover($$beg, $end);
         scalar(@$msgs) or return;
         my $tmp = '';
@@ -770,10 +823,10 @@ sub smsg_range_i {
 sub hdr_smsg ($$$$) {
         my ($self, $xhdr, $field, $range) = @_;
         if (defined $range && $range =~ $ONE_MSGID) {
-                my ($ng, $n) = mid_lookup($self, $1);
+                my ($ibx, $n) = mid_lookup($self, $1);
                 return r430 unless defined $n;
-                my $v = over_header_for($ng->over, $n, $field);
-                hdr_mid_response($self, $xhdr, $ng, $n, $range, $v);
+                my $v = over_header_for($ibx->over, $n, $field);
+                hdr_mid_response($self, $xhdr, $ibx, $n, $range, $v);
         } else { # numeric range
                 $range = $self->{article} unless defined $range;
                 my $r = get_range($self, $range);
@@ -813,26 +866,26 @@ sub cmd_xhdr ($$;$) {
 }
 
 sub hdr_mid_prefix ($$$$$) {
-        my ($self, $xhdr, $ng, $n, $mid) = @_;
+        my ($self, $xhdr, $ibx, $n, $mid) = @_;
         return $mid if $xhdr;
 
         # HDR for RFC 3977 users
-        if (my $self_ng = $self->{ng}) {
-                ($self_ng eq $ng) ? $n : '0';
+        if (my $cur_ibx = $self->{ibx}) {
+                ($cur_ibx eq $ibx) ? $n : '0';
         } else {
                 '0';
         }
 }
 
 sub hdr_mid_response ($$$$$$) {
-        my ($self, $xhdr, $ng, $n, $mid, $v) = @_;
+        my ($self, $xhdr, $ibx, $n, $mid, $v) = @_;
         my $res = '';
         if ($xhdr) {
                 $res .= r221 . "\r\n";
                 $res .= "$mid $v\r\n";
         } else {
                 $res .= r225 . "\r\n";
-                my $pfx = hdr_mid_prefix($self, $xhdr, $ng, $n, $mid);
+                my $pfx = hdr_mid_prefix($self, $xhdr, $ibx, $n, $mid);
                 $res .= "$pfx $v\r\n";
         }
         res($self, $res .= '.');
@@ -841,14 +894,14 @@ sub hdr_mid_response ($$$$$$) {
 
 sub xrover_i {
         my ($self, $beg, $end) = @_;
-        my $h = over_header_for($self->{ng}->over, $$beg, 'references');
+        my $h = over_header_for($self->{ibx}->over, $$beg, 'references');
         more($self, "$$beg $h") if defined($h);
         $$beg++ < $end;
 }
 
 sub cmd_xrover ($;$) {
         my ($self, $range) = @_;
-        my $ng = $self->{ng} or return '412 no newsgroup selected';
+        my $ibx = $self->{ibx} or return '412 no newsgroup selected';
         (defined $range && $range =~ /[<>]/) and
                 return '420 No article(s) selected'; # no message IDs
 
@@ -859,11 +912,11 @@ sub cmd_xrover ($;$) {
         long_response($self, \&xrover_i, @$r);
 }
 
-sub over_line ($$$$) {
-        my ($self, $ng, $num, $smsg) = @_;
+sub over_line ($$$) {
+        my ($self, $ibx, $smsg) = @_;
         # n.b. field access and procedural calls can be
         # 10%-15% faster than OO method calls:
-        my $s = join("\t", $num,
+        my $s = join("\t", $smsg->{num},
                 $smsg->{subject},
                 $smsg->{from},
                 PublicInbox::Smsg::date($smsg),
@@ -871,23 +924,28 @@ sub over_line ($$$$) {
                 $smsg->{references},
                 $smsg->{bytes},
                 $smsg->{lines},
-                "Xref: " . xref($self, $ng, $num, $smsg->{mid}));
+                "Xref: " . xref($self, $ibx, $smsg));
         utf8::encode($s);
-        $s
+        $s .= "\r\n";
 }
 
 sub cmd_over ($;$) {
         my ($self, $range) = @_;
         if ($range && $range =~ $ONE_MSGID) {
-                my ($ng, $n) = mid_lookup($self, $1);
+                my ($ibx, $n) = mid_lookup($self, $1);
                 defined $n or return r430;
-                my $smsg = $ng->over->get_art($n) or return r430;
+                my $smsg = $ibx->over->get_art($n) or return r430;
                 more($self, '224 Overview information follows (multi-line)');
 
                 # Only set article number column if it's the current group
-                my $self_ng = $self->{ng};
-                $n = 0 if (!$self_ng || $self_ng ne $ng);
-                more($self, over_line($self, $ng, $n, $smsg));
+                # (RFC 3977 8.3.2)
+                my $cur_ibx = $self->{ibx};
+                if (!$cur_ibx || $cur_ibx ne $ibx) {
+                        # set {-orig_num} for nntp_xref_for
+                        $smsg->{-orig_num} = $smsg->{num};
+                        $smsg->{num} = 0;
+                }
+                $self->msg_more(over_line($self, $ibx, $smsg));
                 '.';
         } else {
                 cmd_xover($self, $range);
@@ -896,13 +954,13 @@ sub cmd_over ($;$) {
 
 sub xover_i {
         my ($self, $beg, $end) = @_;
-        my $ng = $self->{ng};
-        my $msgs = $ng->over->query_xover($$beg, $end);
+        my $ibx = $self->{ibx};
+        my $msgs = $ibx->over->query_xover($$beg, $end);
         my $nr = scalar @$msgs or return;
 
         # OVERVIEW.FMT
-        more($self, join("\r\n", map {
-                over_line($self, $ng, $_->{num}, $_);
+        $self->msg_more(join('', map {
+                over_line($self, $ibx, $_);
                 } @$msgs));
         $$beg = $msgs->[-1]->{num} + 1;
 }
@@ -949,12 +1007,28 @@ sub cmd_xpath ($$) {
         return r501 unless $mid =~ $ONE_MSGID;
         $mid = $1;
         my @paths;
-        foreach my $ng (values %{$self->{nntpd}->{groups}}) {
-                my $n = $ng->mm->num_for($mid);
-                push @paths, "$ng->{newsgroup}/$n" if defined $n;
+        my $pi_cfg = $self->{nntpd}->{pi_cfg};
+        my $groups = $pi_cfg->{-by_newsgroup};
+        if (my $ALL = $pi_cfg->ALL) {
+                my ($id, $prev, %seen);
+                while (my $smsg = $ALL->over->next_by_mid($mid, \$id, \$prev)) {
+                        my $xr3 = $ALL->over->get_xref3($smsg->{num});
+                        for my $x (@$xr3) {
+                                my ($ngname, $n) = split(/:/, $x);
+                                $x = "$ngname/$n";
+                                if ($groups->{$ngname} && !$seen{$x}++) {
+                                        push(@paths, $x);
+                                }
+                        }
+                }
+        } else { # slow path, no point in using long_response
+                for my $ibx (values %$groups) {
+                        my $n = $ibx->mm->num_for($mid) // next;
+                        push @paths, "$ibx->{newsgroup}/$n";
+                }
         }
         return '430 no such article on server' unless @paths;
-        '223 '.join(' ', @paths);
+        '223 '.join(' ', sort(@paths));
 }
 
 sub res ($$) { do_write($_[0], $_[1] . "\r\n") }
diff --git a/lib/PublicInbox/NNTPD.pm b/lib/PublicInbox/NNTPD.pm
index 6b762d89..1e4ddd18 100644
--- a/lib/PublicInbox/NNTPD.pm
+++ b/lib/PublicInbox/NNTPD.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # represents an NNTPD (currently a singleton),
@@ -12,8 +12,8 @@ use PublicInbox::InboxIdle;
 
 sub new {
         my ($class) = @_;
-        my $pi_config = PublicInbox::Config->new;
-        my $name = $pi_config->{'publicinbox.nntpserver'};
+        my $pi_cfg = PublicInbox::Config->new;
+        my $name = $pi_cfg->{'publicinbox.nntpserver'};
         if (!defined($name) or $name eq '') {
                 $name = hostname;
         } elsif (ref($name) eq 'ARRAY') {
@@ -24,8 +24,7 @@ sub new {
                 groups => {},
                 err => \*STDERR,
                 out => \*STDOUT,
-                grouplist => [],
-                pi_config => $pi_config,
+                pi_cfg => $pi_cfg,
                 servername => $name,
                 greet => \"201 $name ready - post via email\r\n",
                 # accept_tls => { SSL_server => 1, ..., SSL_reuse_ctx => ... }
@@ -35,40 +34,33 @@ sub new {
 
 sub refresh_groups {
         my ($self, $sig) = @_;
-        my $pi_config = $sig ? PublicInbox::Config->new : $self->{pi_config};
-        my $new = {};
-        my @list;
-        $pi_config->each_inbox(sub {
-                my ($ng) = @_;
-                my $ngname = $ng->{newsgroup} or return;
-                if (ref $ngname) {
-                        warn 'multiple newsgroups not supported: '.
-                                join(', ', @$ngname). "\n";
-                # Newsgroup name needs to be compatible with RFC 3977
-                # wildmat-exact and RFC 3501 (IMAP) ATOM-CHAR.
-                # Leave out a few chars likely to cause problems or conflicts:
-                # '|', '<', '>', ';', '#', '$', '&',
-                } elsif ($ngname =~ m![^A-Za-z0-9/_\.\-\~\@\+\=:]!) {
-                        warn "newsgroup name invalid: `$ngname'\n";
-                } elsif ($ng->nntp_usable) {
-                        # Only valid if msgmap and search works
-                        $new->{$ngname} = $ng;
-                        push @list, $ng;
-
+        my $pi_cfg = $sig ? PublicInbox::Config->new : $self->{pi_cfg};
+        my $groups = $pi_cfg->{-by_newsgroup}; # filled during each_inbox
+        my $cache = eval { $pi_cfg->ALL->misc->nntpd_cache_load } // {};
+        $pi_cfg->each_inbox(sub {
+                my ($ibx) = @_;
+                my $ngname = $ibx->{newsgroup} // return;
+                my $ce = $cache->{$ngname};
+                if (($ce and (%$ibx = (%$ibx, %$ce))) || $ibx->nntp_usable) {
+                        # only valid if msgmap and over works
                         # preload to avoid fragmentation:
-                        $ng->description;
-                        $ng->base_url;
+                        $ibx->description;
+                        $ibx->base_url;
+                } else {
+                        delete $groups->{$ngname};
+                        delete $ibx->{newsgroup};
+                        # Note: don't be tempted to delete more for memory
+                        # savings just yet: NNTP, IMAP, and WWW may all
+                        # run in the same process someday.
                 }
         });
-        @list =        sort { $a->{newsgroup} cmp $b->{newsgroup} } @list;
-        $self->{grouplist} = \@list;
-        $self->{pi_config} = $pi_config;
+        $self->{groupnames} = [ sort(keys %$groups) ];
         # this will destroy old groups that got deleted
-        %{$self->{groups}} = %$new;
+        $self->{pi_cfg} = $pi_cfg;
 }
 
 sub idler_start {
-        $_[0]->{idler} //= PublicInbox::InboxIdle->new($_[0]->{pi_config});
+        $_[0]->{idler} //= PublicInbox::InboxIdle->new($_[0]->{pi_cfg});
 }
 
 1;
diff --git a/lib/PublicInbox/NNTPdeflate.pm b/lib/PublicInbox/NNTPdeflate.pm
index 02af935f..06b4499c 100644
--- a/lib/PublicInbox/NNTPdeflate.pm
+++ b/lib/PublicInbox/NNTPdeflate.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # RFC 8054 NNTP COMPRESS DEFLATE implementation
diff --git a/lib/PublicInbox/NewsWWW.pm b/lib/PublicInbox/NewsWWW.pm
index 6bed0103..d7dd637f 100644
--- a/lib/PublicInbox/NewsWWW.pm
+++ b/lib/PublicInbox/NewsWWW.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Plack app redirector for mapping /$NEWSGROUP requests to
@@ -13,9 +13,8 @@ use PublicInbox::MID qw(mid_escape);
 use PublicInbox::Hval qw(prurl);
 
 sub new {
-        my ($class, $pi_config) = @_;
-        $pi_config ||= PublicInbox::Config->new;
-        bless { pi_config => $pi_config }, $class;
+        my ($class, $pi_cfg) = @_;
+        bless { pi_cfg => $pi_cfg // PublicInbox::Config->new }, $class;
 }
 
 sub redirect ($$) {
@@ -47,8 +46,8 @@ sub call {
         # /inbox.foo.bar/123456
         my (undef, @parts) = split(m!/!, $env->{PATH_INFO});
         my ($ng, $article) = @parts;
-        my $pi_config = $self->{pi_config};
-        if (my $ibx = $pi_config->lookup_newsgroup($ng)) {
+        my $pi_cfg = $self->{pi_cfg};
+        if (my $ibx = $pi_cfg->lookup_newsgroup($ng)) {
                 my $url = prurl($env, $ibx->{url});
                 my $code = 301;
                 if (defined $article && $article =~ /\A[0-9]+\z/) {
@@ -63,7 +62,6 @@ sub call {
                 return redirect($code, $url);
         }
 
-        my $res;
         my @try = (join('/', @parts));
 
         # trailing slash is in the rest of our WWW, so maybe some users
@@ -72,13 +70,30 @@ sub call {
                 pop @parts;
                 push @try, join('/', @parts);
         }
-
-        foreach my $mid (@try) {
-                my $arg = [ $mid ];
-                $pi_config->each_inbox(\&try_inbox, $arg);
-                defined($res = $arg->[1]) and last;
+        my $ALL = $pi_cfg->ALL;
+        if (my $over = $ALL ? $ALL->over : undef) {
+                my $by_eidx_key = $pi_cfg->{-by_eidx_key};
+                for my $mid (@try) {
+                        my ($id, $prev);
+                        while (my $x = $over->next_by_mid($mid, \$id, \$prev)) {
+                                my $xr3 = $over->get_xref3($x->{num});
+                                for (@$xr3) {
+                                        s/:[0-9]+:$x->{blob}\z// or next;
+                                        my $ibx = $by_eidx_key->{$_} // next;
+                                        my $url = $ibx->base_url or next;
+                                        $url .= mid_escape($mid) . '/';
+                                        return redirect(302, $url);
+                                }
+                        }
+                }
+        } else { # slow path, scan every inbox
+                for my $mid (@try) {
+                        my $arg = [ $mid ]; # [1] => result
+                        $pi_cfg->each_inbox(\&try_inbox, $arg);
+                        return $arg->[1] if $arg->[1];
+                }
         }
-        $res || [ 404, [qw(Content-Type text/plain)], ["404 Not Found\n"] ];
+        [ 404, [qw(Content-Type text/plain)], ["404 Not Found\n"] ];
 }
 
 1;
diff --git a/lib/PublicInbox/OnDestroy.pm b/lib/PublicInbox/OnDestroy.pm
new file mode 100644
index 00000000..0ae4c4c9
--- /dev/null
+++ b/lib/PublicInbox/OnDestroy.pm
@@ -0,0 +1,21 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+package PublicInbox::OnDestroy;
+
+sub new {
+        shift; # ($class, $cb, @args)
+        bless [ @_ ], __PACKAGE__;
+}
+
+sub DESTROY {
+        my ($cb, @args) = @{$_[0]};
+        if (!ref($cb)) {
+                my $pid = $cb;
+                return if $pid != $$;
+                $cb = shift @args;
+        }
+        $cb->(@args) if $cb;
+}
+
+1;
diff --git a/lib/PublicInbox/OpPipe.pm b/lib/PublicInbox/OpPipe.pm
new file mode 100644
index 00000000..295a8aa5
--- /dev/null
+++ b/lib/PublicInbox/OpPipe.pm
@@ -0,0 +1,41 @@
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# bytecode dispatch pipe, reads a byte, runs a sub
+# byte => [ sub, @operands ]
+package PublicInbox::OpPipe;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::DS);
+use PublicInbox::Syscall qw(EPOLLIN);
+
+sub new {
+        my ($cls, $rd, $op_map, $in_loop) = @_;
+        my $self = bless { sock => $rd, op_map => $op_map }, $cls;
+        # 1031: F_SETPIPE_SZ, 4096: page size
+        fcntl($rd, 1031, 4096) if $^O eq 'linux';
+        if ($in_loop) { # iff using DS->EventLoop
+                $rd->blocking(0);
+                $self->SUPER::new($rd, EPOLLIN);
+        }
+        $self;
+}
+
+sub event_step {
+        my ($self) = @_;
+        my $rd = $self->{sock};
+        my $byte;
+        until (defined(sysread($rd, $byte, 1))) {
+                return if $!{EAGAIN};
+                next if $!{EINTR};
+                die "read \$rd: $!";
+        }
+        my $op = $self->{op_map}->{$byte} or die "BUG: unknown byte `$byte'";
+        if ($byte eq '') { # close on EOF
+                $rd->blocking ? delete($self->{sock}) : $self->close;
+        }
+        my ($sub, @args) = @$op;
+        $sub->(@args);
+}
+
+1;
diff --git a/lib/PublicInbox/Over.pm b/lib/PublicInbox/Over.pm
index 08112386..06ea439d 100644
--- a/lib/PublicInbox/Over.pm
+++ b/lib/PublicInbox/Over.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # for XOVER, OVER in NNTP, and feeds/homepage/threads in PSGI
@@ -260,6 +260,27 @@ SELECT num,tid,ds,ts,ddd FROM over WHERE num = ? LIMIT 1
         $smsg ? load_from_row($smsg) : undef;
 }
 
+sub get_xref3 {
+        my ($self, $num, $raw) = @_;
+        my $dbh = dbh($self);
+        my $sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT ibx_id,xnum,oidbin FROM xref3 WHERE docid = ? ORDER BY ibx_id,xnum ASC
+
+        $sth->execute($num);
+        my $rows = $sth->fetchall_arrayref;
+        return $rows if $raw;
+        my $eidx_key_sth = $dbh->prepare_cached(<<'', undef, 1);
+SELECT eidx_key FROM inboxes WHERE ibx_id = ?
+
+        [ map {
+                my $r = $_;
+                $eidx_key_sth->execute($r->[0]);
+                my $eidx_key = $eidx_key_sth->fetchrow_array;
+                $eidx_key //= "missing://ibx_id=$r->[0]";
+                "$eidx_key:$r->[1]:".unpack('H*', $r->[2]);
+        } @$rows ];
+}
+
 sub next_by_mid {
         my ($self, $mid, $id, $prev) = @_;
         my $dbh = dbh($self);
diff --git a/lib/PublicInbox/OverIdx.pm b/lib/PublicInbox/OverIdx.pm
index 840e2c2a..985c5473 100644
--- a/lib/PublicInbox/OverIdx.pm
+++ b/lib/PublicInbox/OverIdx.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # for XOVER, OVER in NNTP, and feeds/homepage/threads in PSGI
@@ -79,6 +79,11 @@ SELECT $id_col FROM $tbl WHERE $val_col = ? LIMIT 1
         }
 }
 
+sub ibx_id {
+        my ($self, $eidx_key) = @_;
+        id_for($self, 'inboxes', 'ibx_id', eidx_key => $eidx_key);
+}
+
 sub sid {
         my ($self, $path) = @_;
         return unless defined $path && $path ne '';
@@ -238,26 +243,6 @@ sub link_refs {
         $tid;
 }
 
-sub parse_references ($$$) {
-        my ($smsg, $hdr, $mids) = @_;
-        my $refs = references($hdr);
-        push(@$refs, @$mids) if scalar(@$mids) > 1;
-        return $refs if scalar(@$refs) == 0;
-
-        # prevent circular references here:
-        my %seen = ( $smsg->{mid} => 1 );
-        my @keep;
-        foreach my $ref (@$refs) {
-                if (length($ref) > PublicInbox::MID::MAX_MID_SIZE) {
-                        warn "References: <$ref> too long, ignoring\n";
-                        next;
-                }
-                push(@keep, $ref) unless $seen{$ref}++;
-        }
-        $smsg->{references} = '<'.join('> <', @keep).'>' if @keep;
-        \@keep;
-}
-
 # normalize subjects so they are suitable as pathnames for URLs
 # XXX: consider for removal
 sub subject_path ($) {
@@ -267,21 +252,27 @@ sub subject_path ($) {
         lc($subj);
 }
 
+sub ddd_for ($) {
+        my ($smsg) = @_;
+        my $dd = $smsg->to_doc_data;
+        utf8::encode($dd);
+        compress($dd);
+}
+
 sub add_overview {
         my ($self, $eml, $smsg) = @_;
         $smsg->{lines} = $eml->body_raw =~ tr!\n!\n!;
         my $mids = mids_for_index($eml);
-        my $refs = parse_references($smsg, $eml, $mids);
+        my $refs = $smsg->parse_references($eml, $mids);
+        $mids->[0] //= $smsg->{mid} //= $eml->{-lei_fake_mid};
+        $smsg->{mid} //= '';
         my $subj = $smsg->{subject};
         my $xpath;
         if ($subj ne '') {
                 $xpath = subject_path($subj);
                 $xpath = id_compress($xpath);
         }
-        my $dd = $smsg->to_doc_data;
-        utf8::encode($dd);
-        $dd = compress($dd);
-        add_over($self, $smsg, $mids, $refs, $xpath, $dd);
+        add_over($self, $smsg, $mids, $refs, $xpath, ddd_for($smsg));
 }
 
 sub _add_over {
@@ -385,13 +376,12 @@ sub create_tables {
 
         $dbh->do(<<'');
 CREATE TABLE IF NOT EXISTS over (
-        num INTEGER NOT NULL, /* NNTP article number == IMAP UID */
+        num INTEGER PRIMARY KEY NOT NULL, /* NNTP article number == IMAP UID */
         tid INTEGER NOT NULL, /* THREADID (IMAP REFERENCES threading, JMAP) */
         sid INTEGER, /* Subject ID (IMAP ORDEREDSUBJECT "threading") */
         ts INTEGER, /* IMAP INTERNALDATE (Received: header, git commit time) */
         ds INTEGER, /* RFC-2822 sent Date: header, git author time */
-        ddd VARBINARY, /* doc-data-deflated (->to_doc_data, ->load_from_data) */
-        UNIQUE (num)
+        ddd VARBINARY /* doc-data-deflated (->to_doc_data, ->load_from_data) */
 )
 
         $dbh->do('CREATE INDEX IF NOT EXISTS idx_tid ON over (tid)');
@@ -465,10 +455,14 @@ sub dbh_close {
 
 sub create {
         my ($self) = @_;
-        unless (-r $self->{filename}) {
+        my $fn = $self->{filename} // do {
+                Carp::confess('BUG: no {filename}') unless $self->{dbh};
+                return;
+        };
+        unless (-r $fn) {
                 require File::Path;
                 require File::Basename;
-                File::Path::mkpath(File::Basename::dirname($self->{filename}));
+                File::Path::mkpath(File::Basename::dirname($fn));
         }
         # create the DB:
         PublicInbox::Over::dbh($self);
@@ -518,4 +512,170 @@ EOM
         $pr->("I: rethread culled $total ghosts\n") if $pr && $total;
 }
 
+# used for cross-inbox search
+sub eidx_prep ($) {
+        my ($self) = @_;
+        $self->{-eidx_prep} //= do {
+                my $dbh = $self->dbh;
+                $dbh->do(<<'');
+INSERT OR IGNORE INTO counter (key) VALUES ('eidx_docid')
+
+                $dbh->do(<<'');
+CREATE TABLE IF NOT EXISTS inboxes (
+        ibx_id INTEGER PRIMARY KEY AUTOINCREMENT,
+        eidx_key VARCHAR(255) NOT NULL, /* {newsgroup} // {inboxdir} */
+        UNIQUE (eidx_key)
+)
+
+                $dbh->do(<<'');
+CREATE TABLE IF NOT EXISTS xref3 (
+        docid INTEGER NOT NULL, /* <=> over.num */
+        ibx_id INTEGER NOT NULL, /* <=> inboxes.ibx_id */
+        xnum INTEGER NOT NULL, /* NNTP article number in ibx */
+        oidbin VARBINARY NOT NULL, /* 20-byte SHA-1 or 32-byte SHA-256 */
+        UNIQUE (docid, ibx_id, xnum, oidbin)
+)
+
+        $dbh->do('CREATE INDEX IF NOT EXISTS idx_docid ON xref3 (docid)');
+
+        # performance critical, this is not UNIQUE since we may need to
+        # tolerate some old bugs from indexing mirrors
+        $dbh->do('CREATE INDEX IF NOT EXISTS idx_nntp ON '.
+                'xref3 (oidbin,xnum,ibx_id)');
+
+                $dbh->do(<<'');
+CREATE TABLE IF NOT EXISTS eidx_meta (
+        key VARCHAR(255) PRIMARY KEY,
+        val VARCHAR(255) NOT NULL
+)
+
+                # A queue of current docids which need reindexing.
+                # eidxq persists across aborted -extindex invocations
+                # Currently used for "-extindex --reindex" for Xapian
+                # data, but may be used in more places down the line.
+                $dbh->do(<<'');
+CREATE TABLE IF NOT EXISTS eidxq (docid INTEGER PRIMARY KEY NOT NULL)
+
+                1;
+        };
+}
+
+sub eidx_meta { # requires transaction
+        my ($self, $key, $val) = @_;
+
+        my $sql = 'SELECT val FROM eidx_meta WHERE key = ? LIMIT 1';
+        my $dbh = $self->{dbh};
+        defined($val) or return $dbh->selectrow_array($sql, undef, $key);
+
+        my $prev = $dbh->selectrow_array($sql, undef, $key);
+        if (defined $prev) {
+                $sql = 'UPDATE eidx_meta SET val = ? WHERE key = ?';
+                $dbh->do($sql, undef, $val, $key);
+        } else {
+                $sql = 'INSERT INTO eidx_meta (key,val) VALUES (?,?)';
+                $dbh->do($sql, undef, $key, $val);
+        }
+        $prev;
+}
+
+sub eidx_max {
+        my ($self) = @_;
+        get_counter($self->{dbh}, 'eidx_docid');
+}
+
+sub add_xref3 {
+        my ($self, $docid, $xnum, $oidhex, $eidx_key) = @_;
+        begin_lazy($self);
+        my $ibx_id = ibx_id($self, $eidx_key);
+        my $oidbin = pack('H*', $oidhex);
+        my $sth = $self->{dbh}->prepare_cached(<<'');
+INSERT OR IGNORE INTO xref3 (docid, ibx_id, xnum, oidbin) VALUES (?, ?, ?, ?)
+
+        $sth->bind_param(1, $docid);
+        $sth->bind_param(2, $ibx_id);
+        $sth->bind_param(3, $xnum);
+        $sth->bind_param(4, $oidbin, SQL_BLOB);
+        $sth->execute;
+}
+
+# returns remaining reference count to $docid
+sub remove_xref3 {
+        my ($self, $docid, $oidhex, $eidx_key, $rm_eidx_info) = @_;
+        begin_lazy($self);
+        my $oidbin = pack('H*', $oidhex);
+        my ($sth, $ibx_id);
+        if (defined $eidx_key) {
+                $ibx_id = ibx_id($self, $eidx_key);
+                $sth = $self->{dbh}->prepare_cached(<<'');
+DELETE FROM xref3 WHERE docid = ? AND ibx_id = ? AND oidbin = ?
+
+                $sth->bind_param(1, $docid);
+                $sth->bind_param(2, $ibx_id);
+                $sth->bind_param(3, $oidbin, SQL_BLOB);
+        } else {
+                $sth = $self->{dbh}->prepare_cached(<<'');
+DELETE FROM xref3 WHERE docid = ? AND oidbin = ?
+
+                $sth->bind_param(1, $docid);
+                $sth->bind_param(2, $oidbin, SQL_BLOB);
+        }
+        $sth->execute;
+        $sth = $self->{dbh}->prepare_cached(<<'', undef, 1);
+SELECT COUNT(*) FROM xref3 WHERE docid = ?
+
+        $sth->execute($docid);
+        my $nr = $sth->fetchrow_array;
+        if ($nr == 0) {
+                delete_by_num($self, $docid);
+        } elsif (defined($ibx_id) && $rm_eidx_info) {
+                # if deduplication rules in ContentHash change, it's
+                # possible a docid can have multiple rows with the
+                # same ibx_id.  This governs whether or not we call
+                # ->shard_remove_eidx_info in ExtSearchIdx.
+                $sth = $self->{dbh}->prepare_cached(<<'', undef, 1);
+SELECT COUNT(*) FROM xref3 WHERE docid = ? AND ibx_id = ?
+
+                $sth->execute($docid, $ibx_id);
+                my $count = $sth->fetchrow_array;
+                $$rm_eidx_info = ($count == 0);
+        }
+        $nr;
+}
+
+# for when an xref3 goes missing, this does NOT update {ts}
+sub update_blob {
+        my ($self, $smsg, $oidhex) = @_;
+        my $sth = $self->{dbh}->prepare(<<'');
+UPDATE over SET ddd = ? WHERE num = ?
+
+        $smsg->{blob} = $oidhex;
+        $sth->bind_param(1, ddd_for($smsg), SQL_BLOB);
+        $sth->bind_param(2, $smsg->{num});
+        $sth->execute;
+}
+
+sub eidxq_add {
+        my ($self, $docid) = @_;
+        $self->dbh->prepare_cached(<<'')->execute($docid);
+INSERT OR IGNORE INTO eidxq (docid) VALUES (?)
+
+}
+
+sub eidxq_del {
+        my ($self, $docid) = @_;
+        $self->dbh->prepare_cached(<<'')->execute($docid);
+DELETE FROM eidxq WHERE docid = ?
+
+}
+
+sub blob_exists {
+        my ($self, $oidhex) = @_;
+        my $sth = $self->dbh->prepare_cached(<<'', undef, 1);
+SELECT COUNT(*) FROM xref3 WHERE oidbin = ?
+
+        $sth->bind_param(1, pack('H*', $oidhex), SQL_BLOB);
+        $sth->execute;
+        $sth->fetchrow_array;
+}
+
 1;
diff --git a/lib/PublicInbox/ProcessPipe.pm b/lib/PublicInbox/ProcessPipe.pm
index 2ce7eb8f..97e9c268 100644
--- a/lib/PublicInbox/ProcessPipe.pm
+++ b/lib/PublicInbox/ProcessPipe.pm
@@ -1,43 +1,70 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # a tied handle for auto reaping of children tied to a pipe, see perltie(1)
 package PublicInbox::ProcessPipe;
 use strict;
-use warnings;
+use v5.10.1;
+use Carp qw(carp);
 
 sub TIEHANDLE {
-        my ($class, $pid, $fh) = @_;
-        bless { pid => $pid, fh => $fh }, $class;
+        my ($class, $pid, $fh, $cb, $arg) = @_;
+        bless { pid => $pid, fh => $fh, ppid => $$, cb => $cb, arg => $arg },
+                $class;
 }
 
+sub BINMODE { binmode(shift->{fh}) } # for IO::Uncompress::Gunzip
+
 sub READ { read($_[0]->{fh}, $_[1], $_[2], $_[3] || 0) }
 
 sub READLINE { readline($_[0]->{fh}) }
 
-sub CLOSE {
-        my $fh = delete($_[0]->{fh});
-        my $ret = defined $fh ? close($fh) : '';
-        my $pid = delete $_[0]->{pid};
-        if (defined $pid) {
-                # PublicInbox::DS may not be loaded
-                eval { PublicInbox::DS::dwaitpid($pid, undef, undef) };
+sub WRITE {
+        use bytes qw(length);
+        syswrite($_[0]->{fh}, $_[1], $_[2] // length($_[1]), $_[3] // 0);
+}
+
+sub PRINT {
+        my $self = shift;
+        print { $self->{fh} } @_;
+}
+
+sub FILENO { fileno($_[0]->{fh}) }
 
-                if ($@) { # ok, not in the event loop, work synchronously
-                        waitpid($pid, 0);
+sub _close ($;$) {
+        my ($self, $wait) = @_;
+        my $fh = delete $self->{fh};
+        my $ret = defined($fh) ? close($fh) : '';
+        my ($pid, $cb, $arg) = delete @$self{qw(pid cb arg)};
+        return $ret unless defined($pid) && $self->{ppid} == $$;
+        if ($wait) { # caller cares about the exit status:
+                my $wp = waitpid($pid, 0);
+                if ($wp == $pid) {
                         $ret = '' if $?;
+                        if ($cb) {
+                                eval { $cb->($arg, $pid) };
+                                carp "E: cb(arg, $pid): $@" if $@;
+                        }
+                } else {
+                        carp "waitpid($pid, 0) = $wp, \$!=$!, \$?=$?";
                 }
+        } else { # caller just undef-ed it, let event loop deal with it
+                require PublicInbox::DS;
+                PublicInbox::DS::dwaitpid($pid, $cb, $arg);
         }
         $ret;
 }
 
-sub FILENO { fileno($_[0]->{fh}) }
+# if caller uses close(), assume they want to check $? immediately so
+# we'll waitpid() synchronously.  n.b. wantarray doesn't seem to
+# propagate `undef' down to tied methods, otherwise I'd rely on that.
+sub CLOSE { _close($_[0], 1) }
 
+# if relying on DESTROY, assume the caller doesn't care about $? and
+# we can let the event loop call waitpid() whenever it gets SIGCHLD
 sub DESTROY {
-        CLOSE(@_);
+        _close($_[0]);
         undef;
 }
 
-sub pid { $_[0]->{pid} }
-
 1;
diff --git a/lib/PublicInbox/Qspawn.pm b/lib/PublicInbox/Qspawn.pm
index 88b6d390..7e50a59a 100644
--- a/lib/PublicInbox/Qspawn.pm
+++ b/lib/PublicInbox/Qspawn.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Like most Perl modules in public-inbox, this is internal and
@@ -12,12 +12,13 @@
 # operate in.  This can be useful to ensure smaller inboxes can
 # be cloned while cloning of large inboxes is maxed out.
 #
-# This does not depend on PublicInbox::DS or any other external
-# scheduling mechanism, you just need to call start() and finish()
-# appropriately. However, public-inbox-httpd (which uses PublicInbox::DS)
-# will be able to schedule this based on readability of stdout from
-# the spawned process.  See GitHTTPBackend.pm and SolverGit.pm for
-# usage examples.  It does not depend on any form of threading.
+# This does not depend on the PublicInbox::DS->EventLoop or any
+# other external scheduling mechanism, you just need to call
+# start() and finish() appropriately. However, public-inbox-httpd
+# (which uses PublicInbox::DS)  will be able to schedule this
+# based on readability of stdout from the spawned process.
+# See GitHTTPBackend.pm and SolverGit.pm for usage examples.
+# It does not depend on any form of threading.
 #
 # This is useful for scheduling CGI execution of both long-lived
 # git-http-backend(1) process (for "git clone") as well as short-lived
@@ -56,9 +57,9 @@ sub _do_spawn {
         $self->{cmd} = $o{quiet} ? undef : $cmd;
         eval {
                 # popen_rd may die on EMFILE, ENFILE
-                ($self->{rpipe}, $self->{pid}) = popen_rd($cmd, $cmd_env, \%o);
+                $self->{rpipe} = popen_rd($cmd, $cmd_env, \%o);
 
-                die "E: $!" unless defined($self->{pid});
+                die "E: $!" unless defined($self->{rpipe});
 
                 $limiter->{running}++;
                 $start_cb->($self); # EPOLL_CTL_ADD may ENOSPC/ENOMEM
@@ -115,41 +116,14 @@ sub finalize ($$) {
         }
 }
 
-# callback for dwaitpid
-sub waitpid_err ($$) {
-        my ($self, $pid) = @_;
-        my $xpid = delete $self->{pid};
-        my $err;
-        if (defined $pid) {
-                if ($pid > 0) { # success!
-                        $err = child_err($?);
-                } elsif ($pid < 0) { # ??? does this happen in our case?
-                        $err = "W: waitpid($xpid, 0) => $pid: $!";
-                } # else should not be called with pid == 0
-        }
-        finalize($self, $err);
-}
-
-sub do_waitpid ($) {
-        my ($self) = @_;
-        my $pid = $self->{pid};
-        # PublicInbox::DS may not be loaded
-        eval { PublicInbox::DS::dwaitpid($pid, \&waitpid_err, $self) };
-        # done if we're running in PublicInbox::DS::EventLoop
-        if ($@) {
-                # non public-inbox-{httpd,nntpd} callers may block:
-                my $ret = waitpid($pid, 0);
-                waitpid_err($self, $ret);
-        }
-}
+# callback for dwaitpid or ProcessPipe
+sub waitpid_err { finalize($_[0], child_err($?)) }
 
 sub finish ($;$) {
         my ($self, $err) = @_;
-        if (delete $self->{rpipe}) {
-                do_waitpid($self);
-        } else {
-                finalize($self, $err);
-        }
+        my $tied_pp = delete($self->{rpipe}) or return finalize($self, $err);
+        my PublicInbox::ProcessPipe $pp = tied *$tied_pp;
+        @$pp{qw(cb arg)} = (\&waitpid_err, $self); # for ->DESTROY
 }
 
 sub start ($$$) {
@@ -359,12 +333,12 @@ sub new {
 }
 
 sub setup_rlimit {
-        my ($self, $name, $config) = @_;
+        my ($self, $name, $cfg) = @_;
         foreach my $rlim (@PublicInbox::Spawn::RLIMITS) {
                 my $k = lc($rlim);
                 $k =~ tr/_//d;
                 $k = "publicinboxlimiter.$name.$k";
-                defined(my $v = $config->{$k}) or next;
+                defined(my $v = $cfg->{$k}) or next;
                 my @rlimit = split(/\s*,\s*/, $v);
                 if (scalar(@rlimit) == 1) {
                         push @rlimit, $rlimit[0];
diff --git a/lib/PublicInbox/Reply.pm b/lib/PublicInbox/Reply.pm
index 5058ff8c..8226fdc3 100644
--- a/lib/PublicInbox/Reply.pm
+++ b/lib/PublicInbox/Reply.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # For reply instructions and address generation in WWW UI
diff --git a/lib/PublicInbox/SaPlugin/ListMirror.pm b/lib/PublicInbox/SaPlugin/ListMirror.pm
index a2a54944..9acf86c0 100644
--- a/lib/PublicInbox/SaPlugin/ListMirror.pm
+++ b/lib/PublicInbox/SaPlugin/ListMirror.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # SpamAssassin rules useful for running a mailing list mirror.  We want to:
diff --git a/lib/PublicInbox/SaPlugin/ListMirror.pod b/lib/PublicInbox/SaPlugin/ListMirror.pod
index 3c4ec8c1..6fdcf8c1 100644
--- a/lib/PublicInbox/SaPlugin/ListMirror.pod
+++ b/lib/PublicInbox/SaPlugin/ListMirror.pod
@@ -105,7 +105,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright (C) 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright (C) 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<http://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/lib/PublicInbox/Search.pm b/lib/PublicInbox/Search.pm
index fb35b747..7c6a16be 100644
--- a/lib/PublicInbox/Search.pm
+++ b/lib/PublicInbox/Search.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # based on notmuch, but with no concept of folders, files or flags
 #
@@ -6,7 +6,7 @@
 package PublicInbox::Search;
 use strict;
 use parent qw(Exporter);
-our @EXPORT_OK = qw(mdocid);
+our @EXPORT_OK = qw(retry_reopen int_val get_pct xap_terms);
 use List::Util qw(max);
 
 # values for searching, changing the numeric value breaks
@@ -54,11 +54,15 @@ use constant {
 
 use PublicInbox::Smsg;
 use PublicInbox::Over;
-my $QP_FLAGS;
-our %X = map { $_ => 0 } qw(BoolWeight Database Enquire QueryParser Stem);
+our $QP_FLAGS;
+our %X = map { $_ => 0 } qw(BoolWeight Database Enquire QueryParser Stem Query);
 our $Xap; # 'Search::Xapian' or 'Xapian'
-my $NVRP; # '$Xap::'.('NumberValueRangeProcessor' or 'NumberRangeProcessor')
-my $ENQ_ASCENDING;
+our $NVRP; # '$Xap::'.('NumberValueRangeProcessor' or 'NumberRangeProcessor')
+
+# ENQ_DESCENDING and ENQ_ASCENDING weren't in SWIG Xapian.pm prior to 1.4.16,
+# let's hope the ABI is stable
+our $ENQ_DESCENDING = 0;
+our $ENQ_ASCENDING = 1;
 
 sub load_xapian () {
         return 1 if defined $Xap;
@@ -84,15 +88,8 @@ sub load_xapian () {
                         'NumberRangeProcessor' : 'NumberValueRangeProcessor');
                 $X{$_} = $Xap.'::'.$_ for (keys %X);
 
-                # ENQ_ASCENDING doesn't seem exported by SWIG Xapian.pm,
-                # so lets hope this part of the ABI is stable because it's
-                # just an integer:
-                $ENQ_ASCENDING = $x eq 'Xapian' ?
-                                1 : Search::Xapian::ENQ_ASCENDING();
-
-                # for Smsg:
-                *PublicInbox::Smsg::sortable_unserialise =
-                                                $Xap.'::sortable_unserialise';
+                *sortable_serialise = $x.'::sortable_serialise';
+                *sortable_unserialise = $x.'::sortable_unserialise';
                 # n.b. FLAG_PURE_NOT is expensive not suitable for a public
                 # website as it could become a denial-of-service vector
                 # FLAG_PHRASE also seems to cause performance problems chert
@@ -193,38 +190,29 @@ sub xdir ($;$) {
         }
 }
 
-sub _xdb ($) {
+# returns all shards as separate Xapian::Database objects w/o combining
+sub xdb_shards_flat ($) {
         my ($self) = @_;
-        my $dir = xdir($self, 1);
-        my ($xdb, $slow_phrase);
-        my $qpf = \($self->{qp_flags} ||= $QP_FLAGS);
-        if ($self->{ibx_ver} >= 2) {
-                my @xdb;
-                opendir(my $dh, $dir) or return; # not initialized yet
-
+        my $xpfx = $self->{xpfx};
+        my (@xdb, $slow_phrase);
+        load_xapian();
+        $self->{qp_flags} //= $QP_FLAGS;
+        if ($xpfx =~ m/xapian${\SCHEMA_VERSION}\z/) {
+                @xdb = ($X{Database}->new($xpfx));
+                $self->{qp_flags} |= FLAG_PHRASE() if !-f "$xpfx/iamchert";
+        } else {
+                opendir(my $dh, $xpfx) or return (); # not initialized yet
                 # We need numeric sorting so shard[0] is first for reading
                 # Xapian metadata, if needed
-                my $last = max(grep(/\A[0-9]+\z/, readdir($dh)));
-                return if !defined($last);
+                my $last = max(grep(/\A[0-9]+\z/, readdir($dh))) // return ();
                 for (0..$last) {
-                        my $shard_dir = "$dir/$_";
-                        if (-d $shard_dir && -r _) {
-                                push @xdb, $X{Database}->new($shard_dir);
-                                $slow_phrase ||= -f "$shard_dir/iamchert";
-                        } else { # gaps from missing epochs throw off mdocid()
-                                warn "E: $shard_dir missing or unreadable\n";
-                                return;
-                        }
+                        my $shard_dir = "$self->{xpfx}/$_";
+                        push @xdb, $X{Database}->new($shard_dir);
+                        $slow_phrase ||= -f "$shard_dir/iamchert";
                 }
-                $self->{nshard} = scalar(@xdb);
-                $xdb = shift @xdb;
-                $xdb->add_database($_) for @xdb;
-        } else {
-                $slow_phrase = -f "$dir/iamchert";
-                $xdb = $X{Database}->new($dir);
+                $self->{qp_flags} |= FLAG_PHRASE() if !$slow_phrase;
         }
-        $$qpf |= FLAG_PHRASE() unless $slow_phrase;
-        $xdb;
+        @xdb;
 }
 
 # v2 Xapian docids don't conflict, so they're identical to
@@ -238,37 +226,29 @@ sub mdocid {
 
 sub mset_to_artnums {
         my ($self, $mset) = @_;
-        my $nshard = $self->{nshard} // 1;
+        my $nshard = $self->{nshard};
         [ map { mdocid($nshard, $_) } $mset->items ];
 }
 
 sub xdb ($) {
         my ($self) = @_;
-        $self->{xdb} ||= do {
-                load_xapian();
-                _xdb($self);
+        $self->{xdb} //= do {
+                my @xdb = $self->xdb_shards_flat or return;
+                $self->{nshard} = scalar(@xdb);
+                my $xdb = shift @xdb;
+                $xdb->add_database($_) for @xdb;
+                $xdb;
         };
 }
 
-sub xpfx_init ($) {
-        my ($self) = @_;
-        if ($self->{ibx_ver} == 1) {
-                $self->{xpfx} .= '/public-inbox/xapian' . SCHEMA_VERSION;
-        } else {
-                $self->{xpfx} .= '/xap'.SCHEMA_VERSION;
-        }
-}
-
 sub new {
         my ($class, $ibx) = @_;
         ref $ibx or die "BUG: expected PublicInbox::Inbox object: $ibx";
-        my $self = bless {
-                xpfx => $ibx->{inboxdir}, # for xpfx_init
+        my $xap = $ibx->version > 1 ? 'xap' : 'public-inbox/xapian';
+        bless {
+                xpfx => "$ibx->{inboxdir}/$xap" . SCHEMA_VERSION,
                 altid => $ibx->{altid},
-                ibx_ver => $ibx->version,
         }, $class;
-        xpfx_init($self);
-        $self;
 }
 
 sub reopen {
@@ -285,20 +265,19 @@ sub mset {
         $opts ||= {};
         my $qp = $self->{qp} //= qparse_new($self);
         my $query = $qp->parse_query($query_string, $self->{qp_flags});
-        $opts->{relevance} = 1 unless exists $opts->{relevance};
         _do_enquire($self, $query, $opts);
 }
 
 sub retry_reopen {
-        my ($self, $cb, $arg) = @_;
+        my ($self, $cb, @arg) = @_;
         for my $i (1..10) {
                 if (wantarray) {
                         my @ret;
-                        eval { @ret = $cb->($arg) };
+                        eval { @ret = $cb->($self, @arg) };
                         return @ret unless $@;
                 } else {
                         my $ret;
-                        eval { $ret = $cb->($arg) };
+                        eval { $ret = $cb->($self, @arg) };
                         return $ret unless $@;
                 }
                 # Exception: The revision being read has been discarded -
@@ -318,7 +297,7 @@ sub retry_reopen {
 
 sub _do_enquire {
         my ($self, $query, $opts) = @_;
-        retry_reopen($self, \&_enquire_once, [ $self, $query, $opts ]);
+        retry_reopen($self, \&_enquire_once, $query, $opts);
 }
 
 # returns true if all docs have the THREADID value
@@ -328,19 +307,32 @@ sub has_threadid ($) {
 }
 
 sub _enquire_once { # retry_reopen callback
-        my ($self, $query, $opts) = @{$_[0]};
+        my ($self, $query, $opts) = @_;
         my $xdb = xdb($self);
+        if (defined(my $eidx_key = $opts->{eidx_key})) {
+                $query = $X{Query}->new(OP_FILTER(), $query, 'O'.$eidx_key);
+        }
+        if (defined(my $uid_range = $opts->{uid_range})) {
+                my $range = $X{Query}->new(OP_VALUE_RANGE(), UID,
+                                        sortable_serialise($uid_range->[0]),
+                                        sortable_serialise($uid_range->[1]));
+                $query = $X{Query}->new(OP_FILTER(), $query, $range);
+        }
         my $enquire = $X{Enquire}->new($xdb);
         $enquire->set_query($query);
         $opts ||= {};
         my $desc = !$opts->{asc};
-        if (($opts->{mset} || 0) == 2) { # mset == 2: ORDER BY docid/UID
+        my $rel = $opts->{relevance} // 0;
+        if ($rel == -1) { # ORDER BY docid/UID
+                $enquire->set_weighting_scheme($X{BoolWeight}->new);
                 $enquire->set_docid_order($ENQ_ASCENDING);
+        } elsif ($rel == 0) {
+                $enquire->set_sort_by_value_then_relevance(TS, $desc);
+        } elsif ($rel == -2) {
                 $enquire->set_weighting_scheme($X{BoolWeight}->new);
-        } elsif ($opts->{relevance}) {
+                $enquire->set_docid_order($ENQ_DESCENDING);
+        } else { # rel > 0
                 $enquire->set_sort_by_relevance_then_value(TS, $desc);
-        } else {
-                $enquire->set_sort_by_value_then_relevance(TS, $desc);
         }
 
         # `mairix -t / --threads' or JMAP collapseThreads
@@ -352,7 +344,7 @@ sub _enquire_once { # retry_reopen callback
 
 sub mset_to_smsg {
         my ($self, $ibx, $mset) = @_;
-        my $nshard = $self->{nshard} // 1;
+        my $nshard = $self->{nshard};
         my $i = 0;
         my %order = map { mdocid($nshard, $_) => ++$i } $mset->items;
         my @msgs = sort {
@@ -384,7 +376,7 @@ sub qparse_new ($) {
 
         # for IMAP, undocumented for WWW and may be split off go away
         $cb->($qp, $NVRP->new(BYTES, 'bytes:'));
-        $cb->($qp, $NVRP->new(TS, 'ts:'));
+        $cb->($qp, $NVRP->new(TS, 'rt:'));
         $cb->($qp, $NVRP->new(UID, 'uid:'));
 
         while (my ($name, $prefix) = each %bool_pfx_external) {
@@ -426,4 +418,36 @@ sub help {
         \@ret;
 }
 
+sub int_val ($$) {
+        my ($doc, $col) = @_;
+        my $val = $doc->get_value($col) or return; # undefined is '' in Xapian
+        sortable_unserialise($val) + 0; # PV => IV conversion
+}
+
+sub get_pct ($) { # mset item
+        # Capped at "99%" since "100%" takes an extra column in the
+        # thread skeleton view.  <xapian/mset.h> says the value isn't
+        # very meaningful, anyways.
+        my $n = $_[0]->get_percent;
+        $n > 99 ? 99 : $n;
+}
+
+sub xap_terms ($$;@) {
+        my ($pfx, $xdb_or_doc, @docid) = @_; # @docid may be empty ()
+        my %ret;
+        eval {
+                my $end = $xdb_or_doc->termlist_end(@docid);
+                my $cur = $xdb_or_doc->termlist_begin(@docid);
+                for (; $cur != $end; $cur++) {
+                        $cur->skip_to($pfx);
+                        last if $cur == $end;
+                        my $tn = $cur->get_termname;
+                        if (index($tn, $pfx) == 0) {
+                                $ret{substr($tn, length($pfx))} = undef;
+                        }
+                }
+        };
+        \%ret;
+}
+
 1;
diff --git a/lib/PublicInbox/SearchIdx.pm b/lib/PublicInbox/SearchIdx.pm
index c36fc6c7..826302de 100644
--- a/lib/PublicInbox/SearchIdx.pm
+++ b/lib/PublicInbox/SearchIdx.pm
@@ -1,6 +1,6 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
-# based on notmuch, but with no concept of folders, files or flags
+# based on notmuch, but with no concept of folders, files
 #
 # Indexes mail with Xapian and our (SQLite-based) ::Msgmap for use
 # with the web and NNTP interfaces.  This index maintains thread
@@ -15,15 +15,17 @@ use PublicInbox::InboxWritable;
 use PublicInbox::MID qw(mids_for_index mids);
 use PublicInbox::MsgIter;
 use PublicInbox::IdxStack;
-use Carp qw(croak);
+use Carp qw(croak carp);
 use POSIX qw(strftime);
+use Time::Local qw(timegm);
 use PublicInbox::OverIdx;
 use PublicInbox::Spawn qw(spawn nodatacow_dir);
 use PublicInbox::Git qw(git_unquote);
 use PublicInbox::MsgTime qw(msg_timestamp msg_datestamp);
-our @EXPORT_OK = qw(crlf_adjust log2stack is_ancestor check_size);
+our @EXPORT_OK = qw(log2stack is_ancestor check_size prepare_stack
+        index_text term_generator add_val is_bad_blob);
 my $X = \%PublicInbox::Search::X;
-my ($DB_CREATE_OR_OPEN, $DB_OPEN);
+our ($DB_CREATE_OR_OPEN, $DB_OPEN);
 our $DB_NO_SYNC = 0;
 our $BATCH_BYTES = $ENV{XAPIAN_FLUSH_THRESHOLD} ? 0x7fffffff : 1_000_000;
 use constant DEBUG => !!$ENV{DEBUG};
@@ -31,11 +33,11 @@ use constant DEBUG => !!$ENV{DEBUG};
 my $xapianlevels = qr/\A(?:full|medium)\z/;
 my $hex = '[a-f0-9]';
 my $OID = $hex .'{40,}';
+our $INDEXLEVELS = qr/\A(?:full|medium|basic)\z/;
 
 sub new {
         my ($class, $ibx, $creat, $shard) = @_;
         ref $ibx or die "BUG: expected PublicInbox::Inbox object: $ibx";
-        my $levels = qr/\A(?:full|medium|basic)\z/;
         my $inboxdir = $ibx->{inboxdir};
         my $version = $ibx->version;
         my $indexlevel = 'full';
@@ -45,27 +47,23 @@ sub new {
                 $altid = [ map { PublicInbox::AltId->new($ibx, $_); } @$altid ];
         }
         if ($ibx->{indexlevel}) {
-                if ($ibx->{indexlevel} =~ $levels) {
+                if ($ibx->{indexlevel} =~ $INDEXLEVELS) {
                         $indexlevel = $ibx->{indexlevel};
                 } else {
                         die("Invalid indexlevel $ibx->{indexlevel}\n");
                 }
         }
         $ibx = PublicInbox::InboxWritable->new($ibx);
-        my $self = bless {
-                ibx => $ibx,
-                xpfx => $inboxdir, # for xpfx_init
-                -altid => $altid,
-                ibx_ver => $version,
-                indexlevel => $indexlevel,
-        }, $class;
-        $self->xpfx_init;
+        my $self = PublicInbox::Search->new($ibx);
+        bless $self, $class;
+        $self->{ibx} = $ibx;
+        $self->{-altid} = $altid;
+        $self->{indexlevel} = $indexlevel;
         $self->{-set_indexlevel_once} = 1 if $indexlevel eq 'medium';
         if ($ibx->{-skip_docdata}) {
                 $self->{-set_skip_docdata_once} = 1;
                 $self->{-skip_docdata} = 1;
         }
-        $ibx->umask_prepare;
         if ($version == 1) {
                 $self->{lock_path} = "$inboxdir/ssoma.lock";
                 my $dir = $self->xdir;
@@ -107,8 +105,11 @@ sub load_xapian_writable () {
         $DB_CREATE_OR_OPEN = eval($xap.'::DB_CREATE_OR_OPEN()');
         $DB_OPEN = eval($xap.'::DB_OPEN()');
         my $ver = (eval($xap.'::major_version()') << 16) |
-                (eval($xap.'::minor_version()') << 8);
+                (eval($xap.'::minor_version()') << 8) |
+                eval($xap.'::revision()');
         $DB_NO_SYNC = 0x4 if $ver >= 0x10400;
+        # Xapian v1.2.21..v1.2.24 were missing close-on-exec on OFD locks
+        $X->{CLOEXEC_UNSET} = 1 if $ver >= 0x010215 && $ver <= 0x010218;
         1;
 }
 
@@ -135,7 +136,7 @@ sub idx_acquire {
                 }
         }
         return unless defined $flag;
-        $flag |= $DB_NO_SYNC if $self->{ibx}->{-no_fsync};
+        $flag |= $DB_NO_SYNC if ($self->{ibx} // $self->{eidx})->{-no_fsync};
         my $xdb = eval { ($X->{WritableDatabase})->new($dir, $flag) };
         croak "Failed opening $dir: $@" if $@;
         $self->{xdb} = $xdb;
@@ -152,7 +153,7 @@ sub term_generator ($) { # write-only
 
         $self->{term_generator} //= do {
                 my $tg = $X->{TermGenerator}->new;
-                $tg->set_stemmer($self->stemmer);
+                $tg->set_stemmer(PublicInbox::Search::stemmer($self));
                 $tg;
         }
 }
@@ -323,6 +324,16 @@ sub index_xapian { # msg_iter callback
         }
 }
 
+sub index_list_id ($$$) {
+        my ($self, $doc, $hdr) = @_;
+        for my $l ($hdr->header_raw('List-Id')) {
+                $l =~ /<([^>]+)>/ or next;
+                my $lid = lc $1;
+                $doc->add_boolean_term('G' . $lid);
+                index_text($self, $lid, 1, 'XL'); # probabilistic
+        }
+}
+
 sub index_ids ($$$$) {
         my ($self, $doc, $hdr, $mids) = @_;
         for my $mid (@$mids) {
@@ -336,16 +347,12 @@ sub index_ids ($$$$) {
                 }
         }
         $doc->add_boolean_term('Q' . $_) for @$mids;
-        for my $l ($hdr->header_raw('List-Id')) {
-                $l =~ /<([^>]+)>/ or next;
-                my $lid = lc $1;
-                $doc->add_boolean_term('G' . $lid);
-                index_text($self, $lid, 1, 'XL'); # probabilistic
-        }
+        index_list_id($self, $doc, $hdr);
 }
 
-sub add_xapian ($$$$) {
+sub eml2doc ($$$;$) {
         my ($self, $eml, $smsg, $mids) = @_;
+        $mids //= mids_for_index($eml);
         my $doc = $X->{Document}->new;
         add_val($doc, PublicInbox::Search::TS(), $smsg->{ts});
         my @ds = gmtime($smsg->{ds});
@@ -361,6 +368,9 @@ sub add_xapian ($$$$) {
         $tg->set_document($doc);
         index_headers($self, $smsg);
 
+        if (defined(my $eidx_key = $smsg->{eidx_key})) {
+                $doc->add_boolean_term('O'.$eidx_key) if $eidx_key ne '.';
+        }
         msg_iter($eml, \&index_xapian, [ $self, $doc ]);
         index_ids($self, $doc, $eml, $mids);
 
@@ -370,7 +380,7 @@ sub add_xapian ($$$$) {
         if (!$self->{-skip_docdata}) {
                 # WWW doesn't need {to} or {cc}, only NNTP
                 $smsg->{to} = $smsg->{cc} = '';
-                PublicInbox::OverIdx::parse_references($smsg, $eml, $mids);
+                $smsg->parse_references($eml, $mids);
                 my $data = $smsg->to_doc_data;
                 $doc->set_data($data);
         }
@@ -385,12 +395,19 @@ sub add_xapian ($$$$) {
                         }
                 }
         }
+        $doc;
+}
+
+sub add_xapian ($$$$) {
+        my ($self, $eml, $smsg, $mids) = @_;
+        begin_txn_lazy($self);
+        my $doc = eml2doc($self, $eml, $smsg, $mids);
         $self->{xdb}->replace_document($smsg->{num}, $doc);
 }
 
 sub _msgmap_init ($) {
         my ($self) = @_;
-        die "BUG: _msgmap_init is only for v1\n" if $self->{ibx_ver} != 1;
+        die "BUG: _msgmap_init is only for v1\n" if $self->{ibx}->version != 1;
         $self->{mm} //= eval {
                 require PublicInbox::Msgmap;
                 my $rw = $self->{ibx}->{-no_fsync} ? 2 : 1;
@@ -401,6 +418,7 @@ sub _msgmap_init ($) {
 sub add_message {
         # mime = PublicInbox::Eml or Email::MIME object
         my ($self, $mime, $smsg, $sync) = @_;
+        begin_txn_lazy($self);
         my $mids = mids_for_index($mime);
         $smsg //= bless { blob => '' }, 'PublicInbox::Smsg'; # test-only compat
         $smsg->{mid} //= $mids->[0]; # v1 compatibility
@@ -434,32 +452,116 @@ sub add_message {
         $smsg->{num};
 }
 
-sub xdb_remove {
-        my ($self, $oid, @removed) = @_;
-        my $xdb = $self->{xdb} or return;
-        for my $num (@removed) {
-                my $doc = eval { $xdb->get_document($num) };
-                unless ($doc) {
-                        warn "E: $@\n" if $@;
-                        warn "E: #$num $oid missing in Xapian\n";
-                        next;
-                }
-                my $smsg = bless {}, 'PublicInbox::Smsg';
-                $smsg->load_expand($doc);
-                my $blob = $smsg->{blob} // '(unset)';
-                if ($blob eq $oid) {
-                        $xdb->delete_document($num);
-                } else {
-                        warn "E: #$num $oid != $blob in Xapian\n";
-                }
+sub _get_doc ($$) {
+        my ($self, $docid) = @_;
+        my $doc = eval { $self->{xdb}->get_document($docid) };
+        $doc // do {
+                warn "E: $@\n" if $@;
+                warn "E: #$docid missing in Xapian\n";
+                undef;
+        }
+}
+
+sub add_eidx_info {
+        my ($self, $docid, $eidx_key, $eml) = @_;
+        begin_txn_lazy($self);
+        my $doc = _get_doc($self, $docid) or return;
+        term_generator($self)->set_document($doc);
+        $doc->add_boolean_term('O'.$eidx_key) if $eidx_key ne '.';
+        index_list_id($self, $doc, $eml);
+        $self->{xdb}->replace_document($docid, $doc);
+}
+
+sub remove_eidx_info {
+        my ($self, $docid, $eidx_key, $eml) = @_;
+        begin_txn_lazy($self);
+        my $doc = _get_doc($self, $docid) or return;
+        eval { $doc->remove_term('O'.$eidx_key) };
+        warn "W: ->remove_term O$eidx_key: $@\n" if $@;
+        for my $l ($eml ? $eml->header_raw('List-Id') : ()) {
+                $l =~ /<([^>]+)>/ or next;
+                my $lid = lc $1;
+                eval { $doc->remove_term('G' . $lid) };
+                warn "W: ->remove_term G$lid: $@\n" if $@;
+
+                # nb: we don't remove the XL probabilistic terms
+                # since terms may overlap if cross-posted.
+                #
+                # IOW, a message which has both <foo.example.com>
+                # and <bar.example.com> would have overlapping
+                # "XLexample" and "XLcom" as terms and which we
+                # wouldn't know if they're safe to remove if we just
+                # unindex <foo.example.com> while preserving
+                # <bar.example.com>.
+                #
+                # In any case, this entire sub is will likely never
+                # be needed and users using the "l:" prefix are probably
+                # rarer.
+        }
+        $self->{xdb}->replace_document($docid, $doc);
+}
+
+sub set_keywords {
+        my ($self, $docid, @kw) = @_;
+        begin_txn_lazy($self);
+        my $doc = _get_doc($self, $docid) or return;
+        my %keep = map { $_ => 1 } @kw;
+        my %add = %keep;
+        my @rm;
+        my $end = $doc->termlist_end;
+        for (my $cur = $doc->termlist_begin; $cur != $end; $cur++) {
+                $cur->skip_to('K');
+                last if $cur == $end;
+                my $kw = $cur->get_termname;
+                $kw =~ s/\AK//s or next;
+                $keep{$kw} ? delete($add{$kw}) : push(@rm, $kw);
         }
+        return unless (scalar(@rm) + scalar(keys %add));
+        $doc->remove_term('K'.$_) for @rm;
+        $doc->add_boolean_term('K'.$_) for (keys %add);
+        $self->{xdb}->replace_document($docid, $doc);
 }
 
-sub remove_by_oid {
-        my ($self, $oid, $num) = @_;
-        die "BUG: remove_by_oid is v2-only\n" if $self->{oidx};
+sub add_keywords {
+        my ($self, $docid, @kw) = @_;
+        begin_txn_lazy($self);
+        my $doc = _get_doc($self, $docid) or return;
+        $doc->add_boolean_term('K'.$_) for @kw;
+        $self->{xdb}->replace_document($docid, $doc);
+}
+
+sub remove_keywords {
+        my ($self, $docid, @kw) = @_;
+        begin_txn_lazy($self);
+        my $doc = _get_doc($self, $docid) or return;
+        my $replace;
+        eval {
+                $doc->remove_term('K'.$_);
+                $replace = 1
+        } for @kw;
+        $self->{xdb}->replace_document($docid, $doc) if $replace;
+}
+
+sub smsg_from_doc ($) {
+        my ($doc) = @_;
+        my $data = $doc->get_data or return;
+        my $smsg = bless {}, 'PublicInbox::Smsg';
+        $smsg->{ts} = int_val($doc, PublicInbox::Search::TS());
+        my $dt = int_val($doc, PublicInbox::Search::DT());
+        my ($yyyy, $mon, $dd, $hh, $mm, $ss) = unpack('A4A2A2A2A2A2', $dt);
+        $smsg->{ds} = timegm($ss, $mm, $hh, $dd, $mon - 1, $yyyy);
+        $smsg->load_from_data($data);
+        $smsg;
+}
+
+sub xdb_remove {
+        my ($self, @docids) = @_;
         $self->begin_txn_lazy;
-        xdb_remove($self, $oid, $num) if need_xapian($self);
+        my $xdb = $self->{xdb} or return;
+        for my $docid (@docids) {
+                eval { $xdb->delete_document($docid) };
+                warn "E: #$docid not in in Xapian? $@\n" if $@;
+        }
 }
 
 sub index_git_blob_id {
@@ -484,8 +586,8 @@ sub unindex_eml {
                 $tmp{$_}++ for @removed;
         }
         if (!$nr) {
-                $mids = join('> <', @$mids);
-                warn "W: <$mids> missing for removal from overview\n";
+                my $m = join('> <', @$mids);
+                warn "W: <$m> missing for removal from overview\n";
         }
         while (my ($num, $nr) = each %tmp) {
                 warn "BUG: $num appears >1 times ($nr) for $oid\n" if $nr != 1;
@@ -495,7 +597,7 @@ sub unindex_eml {
         } else { # just in case msgmap and over.sqlite3 become desynched:
                 $self->{mm}->mid_delete($mids->[0]);
         }
-        xdb_remove($self, $oid, keys %tmp) if need_xapian($self);
+        xdb_remove($self, keys %tmp) if need_xapian($self);
 }
 
 sub index_mm {
@@ -515,45 +617,63 @@ sub index_mm {
         }
 }
 
-# returns the number of bytes to add if given a non-CRLF arg
-sub crlf_adjust ($) {
-        if (index($_[0], "\r\n") < 0) {
-                # common case is LF-only, every \n needs an \r;
-                # so favor a cheap tr// over an expensive m//g
-                $_[0] =~ tr/\n/\n/;
-        } else { # count number of '\n' w/o '\r', expensive:
-                scalar(my @n = ($_[0] =~ m/(?<!\r)\n/g));
+sub is_bad_blob ($$$$) {
+        my ($oid, $type, $size, $expect_oid) = @_;
+        if ($type ne 'blob') {
+                carp "W: $expect_oid is not a blob (type=$type)";
+                return 1;
         }
+        croak "BUG: $oid != $expect_oid" if $oid ne $expect_oid;
+        $size == 0 ? 1 : 0; # size == 0 means purged
 }
 
 sub index_both { # git->cat_async callback
         my ($bref, $oid, $type, $size, $sync) = @_;
+        return if is_bad_blob($oid, $type, $size, $sync->{oid});
         my ($nr, $max) = @$sync{qw(nr max)};
         ++$$nr;
         $$max -= $size;
-        $size += crlf_adjust($$bref);
-        my $smsg = bless { bytes => $size, blob => $oid }, 'PublicInbox::Smsg';
+        my $smsg = bless { blob => $oid }, 'PublicInbox::Smsg';
+        $smsg->set_bytes($$bref, $size);
         my $self = $sync->{sidx};
+        local $self->{current_info} = "$self->{current_info}: $oid";
         my $eml = PublicInbox::Eml->new($bref);
         $smsg->{num} = index_mm($self, $eml, $oid, $sync) or
                 die "E: could not generate NNTP article number for $oid";
         add_message($self, $eml, $smsg, $sync);
+        ++$self->{nidx};
+        my $cur_cmt = $sync->{cur_cmt} // die 'BUG: {cur_cmt} missing';
+        ${$sync->{latest_cmt}} = $cur_cmt;
 }
 
 sub unindex_both { # git->cat_async callback
-        my ($bref, $oid, $type, $size, $self) = @_;
+        my ($bref, $oid, $type, $size, $sync) = @_;
+        return if is_bad_blob($oid, $type, $size, $sync->{oid});
+        my $self = $sync->{sidx};
+        local $self->{current_info} = "$self->{current_info}: $oid";
         unindex_eml($self, $oid, PublicInbox::Eml->new($bref));
+        # may be undef if leftover
+        if (defined(my $cur_cmt = $sync->{cur_cmt})) {
+                ${$sync->{latest_cmt}} = $cur_cmt;
+        }
+        ++$self->{nidx};
+}
+
+sub with_umask {
+        my $self = shift;
+        ($self->{ibx} // $self->{eidx})->with_umask(@_);
 }
 
 # called by public-inbox-index
 sub index_sync {
         my ($self, $opt) = @_;
         delete $self->{lock_path} if $opt->{-skip_lock};
-        $self->{ibx}->with_umask(\&_index_sync, $self, $opt);
-        if ($opt->{reindex}) {
+        $self->with_umask(\&_index_sync, $self, $opt);
+        if ($opt->{reindex} && !$opt->{quit}) {
                 my %again = %$opt;
                 delete @again{qw(rethread reindex)};
                 index_sync($self, \%again);
+                $opt->{quit} = $again{quit}; # propagate to caller
         }
 }
 
@@ -569,46 +689,44 @@ sub check_size { # check_async cb for -index --max-size=...
 
 sub v1_checkpoint ($$;$) {
         my ($self, $sync, $stk) = @_;
-        $self->{ibx}->git->check_async_wait;
-        $self->{ibx}->git->cat_async_wait;
+        $self->{ibx}->git->async_wait_all;
 
-        # latest_cmt may be undef
-        my $newest = $stk ? $stk->{latest_cmt} : undef;
-        if ($newest) {
+        # $newest may be undef
+        my $newest = $stk ? $stk->{latest_cmt} : ${$sync->{latest_cmt}};
+        if (defined($newest)) {
                 my $cur = $self->{mm}->last_commit || '';
                 if (need_update($self, $cur, $newest)) {
                         $self->{mm}->last_commit($newest);
                 }
-        } else {
-                ${$sync->{max}} = $self->{batch_bytes};
         }
+        ${$sync->{max}} = $self->{batch_bytes};
 
         $self->{mm}->{dbh}->commit;
-        if ($newest && need_xapian($self)) {
-                my $xdb = $self->{xdb};
+        my $xdb = need_xapian($self) ? $self->{xdb} : undef;
+        if ($newest && $xdb) {
                 my $cur = $xdb->get_metadata('last_commit');
                 if (need_update($self, $cur, $newest)) {
                         $xdb->set_metadata('last_commit', $newest);
                 }
-
+        }
+        if ($stk) { # all done if $stk is passed
                 # let SearchView know a full --reindex was done so it can
                 # generate ->has_threadid-dependent links
-                if ($sync->{reindex} && !ref($sync->{reindex})) {
+                if ($xdb && $sync->{reindex} && !ref($sync->{reindex})) {
                         my $n = $xdb->get_metadata('has_threadid');
                         $xdb->set_metadata('has_threadid', '1') if $n ne '1';
                 }
+                $self->{oidx}->rethread_done($sync->{-opt}); # all done
         }
-
-        $self->{oidx}->rethread_done($sync->{-opt}) if $newest; # all done
         commit_txn_lazy($self);
-        $self->{ibx}->git->cleanup;
+        $sync->{ibx}->git->cleanup;
         my $nr = ${$sync->{nr}};
         idx_release($self, $nr);
         # let another process do some work...
         if (my $pr = $sync->{-opt}->{-progress}) {
                 $pr->("indexed $nr/$sync->{ntodo}\n") if $nr;
         }
-        if (!$stk) { # more to come
+        if (!$stk && !$sync->{quit}) { # more to come
                 begin_txn_lazy($self);
                 $self->{mm}->{dbh}->begin_work;
         }
@@ -617,27 +735,32 @@ sub v1_checkpoint ($$;$) {
 # only for v1
 sub process_stack {
         my ($self, $sync, $stk) = @_;
-        my $git = $self->{ibx}->git;
+        my $git = $sync->{ibx}->git;
         my $max = $self->{batch_bytes};
         my $nr = 0;
         $sync->{nr} = \$nr;
         $sync->{max} = \$max;
         $sync->{sidx} = $self;
+        $sync->{latest_cmt} = \(my $latest_cmt);
 
         $self->{mm}->{dbh}->begin_work;
         if (my @leftovers = keys %{delete($sync->{D}) // {}}) {
                 warn('W: unindexing '.scalar(@leftovers)." leftovers\n");
                 for my $oid (@leftovers) {
+                        last if $sync->{quit};
                         $oid = unpack('H*', $oid);
-                        $git->cat_async($oid, \&unindex_both, $self);
+                        $git->cat_async($oid, \&unindex_both, $sync);
                 }
         }
         if ($sync->{max_size} = $sync->{-opt}->{max_size}) {
                 $sync->{index_oid} = \&index_both;
         }
-        while (my ($f, $at, $ct, $oid) = $stk->pop_rec) {
+        while (my ($f, $at, $ct, $oid, $cur_cmt) = $stk->pop_rec) {
+                my $arg = { %$sync, cur_cmt => $cur_cmt, oid => $oid };
+                last if $sync->{quit};
                 if ($f eq 'm') {
-                        my $arg = { %$sync, autime => $at, cotime => $ct };
+                        $arg->{autime} = $at;
+                        $arg->{cotime} = $ct;
                         if ($sync->{max_size}) {
                                 $git->check_async($oid, \&check_size, $arg);
                         } else {
@@ -645,17 +768,17 @@ sub process_stack {
                         }
                         v1_checkpoint($self, $sync) if $max <= 0;
                 } elsif ($f eq 'd') {
-                        $git->cat_async($oid, \&unindex_both, $self);
+                        $git->cat_async($oid, \&unindex_both, $arg);
                 }
         }
-        v1_checkpoint($self, $sync, $stk);
+        v1_checkpoint($self, $sync, $sync->{quit} ? undef : $stk);
 }
 
-sub log2stack ($$$$) {
-        my ($sync, $git, $range, $ibx) = @_;
+sub log2stack ($$$) {
+        my ($sync, $git, $range) = @_;
         my $D = $sync->{D}; # OID_BIN => NR (if reindexing, undef otherwise)
         my ($add, $del);
-        if ($ibx->version == 1) {
+        if ($sync->{ibx}->version == 1) {
                 my $path = $hex.'{2}/'.$hex.'{38}';
                 $add = qr!\A:000000 100644 \S+ ($OID) A\t$path$!;
                 $del = qr!\A:100644 000000 ($OID) \S+ D\t$path$!;
@@ -669,17 +792,18 @@ sub log2stack ($$$$) {
         my $fh = $git->popen(qw(log --raw -r --pretty=tformat:%at-%ct-%H
                                 --no-notes --no-color --no-renames --no-abbrev),
                                 $range);
-        my ($at, $ct, $stk);
+        my ($at, $ct, $stk, $cmt);
         while (<$fh>) {
+                return if $sync->{quit};
                 if (/\A([0-9]+)-([0-9]+)-($OID)$/o) {
-                        ($at, $ct) = ($1 + 0, $2 + 0);
-                        $stk //= PublicInbox::IdxStack->new($3);
+                        ($at, $ct, $cmt) = ($1 + 0, $2 + 0, $3);
+                        $stk //= PublicInbox::IdxStack->new($cmt);
                 } elsif (/$del/) {
                         my $oid = $1;
                         if ($D) { # reindex case
                                 $D->{pack('H*', $oid)}++;
                         } else { # non-reindex case:
-                                $stk->push_rec('d', $at, $ct, $oid);
+                                $stk->push_rec('d', $at, $ct, $oid, $cmt);
                         }
                 } elsif (/$add/) {
                         my $oid = $1;
@@ -687,12 +811,10 @@ sub log2stack ($$$$) {
                                 my $oid_bin = pack('H*', $oid);
                                 my $nr = --$D->{$oid_bin};
                                 delete($D->{$oid_bin}) if $nr <= 0;
-
                                 # nr < 0 (-1) means it never existed
-                                $stk->push_rec('m', $at, $ct, $oid) if $nr < 0;
-                        } else {
-                                $stk->push_rec('m', $at, $ct, $oid);
+                                next if $nr >= 0;
                         }
+                        $stk->push_rec('m', $at, $ct, $oid, $cmt);
                 }
         }
         close $fh or die "git log failed: \$?=$?";
@@ -700,9 +822,9 @@ sub log2stack ($$$$) {
         $stk->read_prepare;
 }
 
-sub prepare_stack ($$$) {
-        my ($self, $sync, $range) = @_;
-        my $git = $self->{ibx}->git;
+sub prepare_stack ($$) {
+        my ($sync, $range) = @_;
+        my $git = $sync->{ibx}->git;
 
         if (index($range, '..') < 0) {
                 # don't show annoying git errors to users who run -index
@@ -711,7 +833,7 @@ sub prepare_stack ($$$) {
                 return PublicInbox::IdxStack->new->read_prepare if $?;
         }
         $sync->{D} = $sync->{reindex} ? {} : undef; # OID_BIN => NR
-        log2stack($sync, $git, $range, $self->{ibx});
+        log2stack($sync, $git, $range);
 }
 
 # --is-ancestor requires git 1.8.0+
@@ -759,15 +881,30 @@ sub reindex_from ($$) {
         ref($reindex) eq 'HASH' ? $reindex->{from} : '';
 }
 
+sub quit_cb ($) {
+        my ($sync) = @_;
+        sub {
+                # we set {-opt}->{quit} too, so ->index_sync callers
+                # can abort multi-inbox loops this way
+                $sync->{quit} = $sync->{-opt}->{quit} = 1;
+                warn "gracefully quitting\n";
+        }
+}
+
 # indexes all unindexed messages (v1 only)
 sub _index_sync {
         my ($self, $opt) = @_;
         my $tip = $opt->{ref} || 'HEAD';
-        my $git = $self->{ibx}->git;
+        my $ibx = $self->{ibx};
+        local $self->{current_info} = "$ibx->{inboxdir}";
         $self->{batch_bytes} = $opt->{batch_size} // $BATCH_BYTES;
-        $git->batch_prepare;
+        $ibx->git->batch_prepare;
         my $pr = $opt->{-progress};
-        my $sync = { reindex => $opt->{reindex}, -opt => $opt };
+        my $sync = { reindex => $opt->{reindex}, -opt => $opt, ibx => $ibx };
+        my $quit = quit_cb($sync);
+        local $SIG{QUIT} = $quit;
+        local $SIG{INT} = $quit;
+        local $SIG{TERM} = $quit;
         my $xdb = $self->begin_txn_lazy;
         $self->{oidx}->rethread_prepare($opt);
         my $mm = _msgmap_init($self);
@@ -785,10 +922,10 @@ sub _index_sync {
         my $lx = reindex_from($sync->{reindex}, $last_commit);
         my $range = $lx eq '' ? $tip : "$lx..$tip";
         $pr->("counting changes\n\t$range ... ") if $pr;
-        my $stk = prepare_stack($self, $sync, $range);
+        my $stk = prepare_stack($sync, $range);
         $sync->{ntodo} = $stk ? $stk->num_records : 0;
         $pr->("$sync->{ntodo}\n") if $pr; # continue previous line
-        process_stack($self, $sync, $stk);
+        process_stack($self, $sync, $stk) if !$sync->{quit};
 }
 
 sub DESTROY {
@@ -808,7 +945,7 @@ sub _begin_txn {
 
 sub begin_txn_lazy {
         my ($self) = @_;
-        $self->{ibx}->with_umask(\&_begin_txn, $self) if !$self->{txn};
+        $self->with_umask(\&_begin_txn, $self) if !$self->{txn};
 }
 
 # store 'indexlevel=medium' in v2 shard=0 and v1 (only one shard)
@@ -836,6 +973,10 @@ sub set_metadata_once {
 
 sub _commit_txn {
         my ($self) = @_;
+        if (my $eidx = $self->{eidx}) {
+                $eidx->git->async_wait_all;
+                $eidx->{transact_bytes} = 0;
+        }
         if (my $xdb = $self->{xdb}) {
                 set_metadata_once($self);
                 $xdb->commit_transaction;
@@ -846,15 +987,42 @@ sub _commit_txn {
 sub commit_txn_lazy {
         my ($self) = @_;
         delete($self->{txn}) and
-                $self->{ibx}->with_umask(\&_commit_txn, $self);
+                $self->with_umask(\&_commit_txn, $self);
 }
 
-sub worker_done {
-        my ($self) = @_;
-        if (need_xapian($self)) {
-                die "$$ $0 xdb not released\n" if $self->{xdb};
+sub eidx_shard_new {
+        my ($class, $eidx, $shard) = @_;
+        my $self = bless {
+                eidx => $eidx,
+                xpfx => $eidx->{xpfx},
+                indexlevel => $eidx->{indexlevel},
+                -skip_docdata => 1,
+                shard => $shard,
+                creat => 1,
+        }, $class;
+        $self->{-set_indexlevel_once} = 1 if $self->{indexlevel} eq 'medium';
+        $self;
+}
+
+# ensure there's no stale Xapian docs by treating $over as canonical
+sub over_check {
+        my ($self, $over) = @_;
+        begin_txn_lazy($self);
+        my $sth = $over->dbh->prepare(<<'');
+SELECT COUNT(*) FROM over WHERE num = ?
+
+        my $xdb = $self->{xdb};
+        my $cur = $xdb->postlist_begin('');
+        my $end = $xdb->postlist_end('');
+        my $xdir = $self->xdir;
+        for (; $cur != $end; $cur++) {
+                my $docid = $cur->get_docid;
+                $sth->execute($docid);
+                my $x = $sth->fetchrow_array;
+                next if $x > 0;
+                warn "I: removing $xdir #$docid, not in `over'\n";
+                $xdb->delete_document($docid);
         }
-        die "$$ $0 still in transaction\n" if $self->{txn};
 }
 
 1;
diff --git a/lib/PublicInbox/SearchIdxShard.pm b/lib/PublicInbox/SearchIdxShard.pm
index f23d23d0..1598faeb 100644
--- a/lib/PublicInbox/SearchIdxShard.pm
+++ b/lib/PublicInbox/SearchIdxShard.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Internal interface for a single Xapian shard in V2 inboxes.
@@ -6,150 +6,82 @@
 package PublicInbox::SearchIdxShard;
 use strict;
 use v5.10.1;
-use parent qw(PublicInbox::SearchIdx);
-use IO::Handle (); # autoflush
-use PublicInbox::Eml;
+use parent qw(PublicInbox::SearchIdx PublicInbox::IPC);
+use PublicInbox::OnDestroy;
 
 sub new {
-        my ($class, $v2w, $shard) = @_;
+        my ($class, $v2w, $shard) = @_; # v2w may be ExtSearchIdx
         my $ibx = $v2w->{ibx};
-        my $self = $class->SUPER::new($ibx, 1, $shard);
+        my $self = $ibx ? $class->SUPER::new($ibx, 1, $shard)
+                        : $class->eidx_shard_new($v2w, $shard);
         # create the DB before forking:
         $self->idx_acquire;
         $self->set_metadata_once;
         $self->idx_release;
-        $self->spawn_worker($v2w, $shard) if $v2w->{parallel};
+        if ($v2w->{parallel}) {
+                local $self->{-v2w_afc} = $v2w;
+                $self->ipc_worker_spawn("shard[$shard]");
+                # F_SETPIPE_SZ = 1031 on Linux; increasing the pipe size for
+                # inputs speeds V2Writable batch imports across 8 cores by
+                # nearly 20%.  Since any of our responses are small, make
+                # the response pipe as small as possible
+                if ($^O eq 'linux') {
+                        fcntl($self->{-ipc_req}, 1031, 1048576);
+                        fcntl($self->{-ipc_res}, 1031, 4096);
+                }
+        }
         $self;
 }
 
-sub spawn_worker {
-        my ($self, $v2w, $shard) = @_;
-        my ($r, $w);
-        pipe($r, $w) or die "pipe failed: $!\n";
-        $w->autoflush(1);
-        my $pid = fork;
-        defined $pid or die "fork failed: $!\n";
-        if ($pid == 0) {
-                my $bnote = $v2w->atfork_child;
-                close $w or die "failed to close: $!";
-
-                # F_SETPIPE_SZ = 1031 on Linux; increasing the pipe size here
-                # speeds V2Writable batch imports across 8 cores by nearly 20%
-                fcntl($r, 1031, 1048576) if $^O eq 'linux';
-
-                eval { shard_worker_loop($self, $v2w, $r, $shard, $bnote) };
-                die "worker $shard died: $@\n" if $@;
-                die "unexpected MM $self->{mm}" if $self->{mm};
-                exit;
+sub _worker_done {
+        my ($self) = @_;
+        if ($self->need_xapian) {
+                die "$$ $0 xdb not released\n" if $self->{xdb};
         }
-        $self->{pid} = $pid;
-        $self->{w} = $w;
-        close $r or die "failed to close: $!";
+        die "$$ $0 still in transaction\n" if $self->{txn};
 }
 
-# this reads all the writes to $self->{w} from the parent process
-sub shard_worker_loop ($$$$$) {
-        my ($self, $v2w, $r, $shard, $bnote) = @_;
-        $0 = "pi-v2-shard[$shard]";
+sub ipc_atfork_child { # called automatically before ipc_worker_loop
+        my ($self) = @_;
+        my $v2w = delete $self->{-v2w_afc} or die 'BUG: {-v2w_afc} missing';
+        $v2w->atfork_child; # calls ipc_sibling_atfork_child on our siblings
+        $v2w->{current_info} = "[$self->{shard}]"; # for $SIG{__WARN__}
         $self->begin_txn_lazy;
-        while (my $line = readline($r)) {
-                $v2w->{current_info} = "[$shard] $line";
-                if ($line eq "commit\n") {
-                        $self->commit_txn_lazy;
-                } elsif ($line eq "close\n") {
-                        $self->idx_release;
-                } elsif ($line eq "barrier\n") {
-                        $self->commit_txn_lazy;
-                        # no need to lock < 512 bytes is atomic under POSIX
-                        print $bnote "barrier $shard\n" or
-                                        die "write failed for barrier $!\n";
-                } elsif ($line =~ /\AD ([a-f0-9]{40,}) ([0-9]+)\n\z/s) {
-                        $self->remove_by_oid($1, $2 + 0);
-                } else {
-                        chomp $line;
-                        # n.b. $mid may contain spaces(!)
-                        my ($to_read, $bytes, $num, $blob, $ds, $ts, $tid, $mid)
-                                = split(/ /, $line, 8);
-                        $self->begin_txn_lazy;
-                        my $n = read($r, my $msg, $to_read) or die "read: $!\n";
-                        $n == $to_read or die "short read: $n != $to_read\n";
-                        my $mime = PublicInbox::Eml->new(\$msg);
-                        my $smsg = bless {
-                                bytes => $bytes,
-                                num => $num + 0,
-                                blob => $blob,
-                                mid => $mid,
-                                tid => $tid,
-                                ds => $ds,
-                                ts => $ts,
-                        }, 'PublicInbox::Smsg';
-                        $self->add_message($mime, $smsg);
-                }
-        }
-        $self->worker_done;
+        # caller must capture this:
+        PublicInbox::OnDestroy->new($$, \&_worker_done, $self);
 }
 
-sub index_raw {
-        my ($self, $msgref, $eml, $smsg) = @_;
-        if (my $w = $self->{w}) {
-                # mid must be last, it can contain spaces (but not LF)
-                print $w join(' ', @$smsg{qw(raw_bytes bytes
-                                                num blob ds ts tid mid)}),
-                        "\n", $$msgref or die "failed to write shard $!\n";
-        } else {
-                if ($eml) {
-                        undef $$msgref;
-                } else { # --xapian-only + --sequential-shard:
-                        $eml = PublicInbox::Eml->new($msgref);
-                }
-                $self->begin_txn_lazy;
-                $self->add_message($eml, $smsg);
-        }
-}
-
-sub atfork_child {
-        close $_[0]->{w} or die "failed to close write pipe: $!\n";
+sub index_eml {
+        my ($self, $eml, $smsg, $eidx_key) = @_;
+        $smsg->{eidx_key} = $eidx_key if defined $eidx_key;
+        $self->ipc_do('add_xapian', $eml, $smsg);
 }
 
-sub shard_barrier {
-        my ($self) = @_;
-        if (my $w = $self->{w}) {
-                print $w "barrier\n" or die "failed to print: $!";
-        } else {
-                $self->commit_txn_lazy;
-        }
+# wait for return to determine when ipc_do('commit_txn_lazy') is done
+sub echo {
+        shift;
+        "@_";
 }
 
-sub shard_commit {
+sub idx_close {
         my ($self) = @_;
-        if (my $w = $self->{w}) {
-                print $w "commit\n" or die "failed to write commit: $!";
-        } else {
-                $self->commit_txn_lazy;
-        }
+        die "transaction in progress $self\n" if $self->{txn};
+        $self->idx_release if $self->{xdb};
 }
 
 sub shard_close {
         my ($self) = @_;
-        if (my $w = delete $self->{w}) {
-                my $pid = delete $self->{pid} or die "no process to wait on\n";
-                print $w "close\n" or die "failed to write to pid:$pid: $!\n";
-                close $w or die "failed to close pipe for pid:$pid: $!\n";
-                waitpid($pid, 0) == $pid or die "remote process did not finish";
-                $? == 0 or die ref($self)." pid:$pid exited with: $?";
-        } else {
-                die "transaction in progress $self\n" if $self->{txn};
-                $self->idx_release if $self->{xdb};
-        }
+        $self->ipc_do('idx_close');
+        $self->ipc_worker_stop;
 }
 
-sub shard_remove {
-        my ($self, $oid, $num) = @_;
-        if (my $w = $self->{w}) { # triggers remove_by_oid in a shard child
-                print $w "D $oid $num\n" or die "failed to write remove $!";
-        } else { # same process
-                $self->remove_by_oid($oid, $num);
+sub shard_over_check {
+        my ($self, $over) = @_;
+        if ($self->{-ipc_req} && $over->{dbh}) {
+                # can't send DB handles over IPC
+                $over = ref($over)->new($over->{dbh}->sqlite_db_filename);
         }
+        $self->ipc_do('over_check', $over);
 }
 
 1;
diff --git a/lib/PublicInbox/SearchQuery.pm b/lib/PublicInbox/SearchQuery.pm
index 6724ae39..0f360500 100644
--- a/lib/PublicInbox/SearchQuery.pm
+++ b/lib/PublicInbox/SearchQuery.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # used by PublicInbox::SearchView
diff --git a/lib/PublicInbox/SearchThread.pm b/lib/PublicInbox/SearchThread.pm
index 60f692b2..8fb3a030 100644
--- a/lib/PublicInbox/SearchThread.pm
+++ b/lib/PublicInbox/SearchThread.pm
@@ -42,7 +42,7 @@ sub thread {
         # We'll trust the client Date: header here instead of the Received:
         # time since this is for display (and not retrieval)
         _set_parent(\%id_table, $_) for sort { $a->{ds} <=> $b->{ds} } @$msgs;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $rootset = [ grep {
                         !delete($_->{parent}) && $_->visible($ibx)
                 } values %id_table ];
@@ -166,7 +166,7 @@ sub order_children {
 
         my %seen = ($cur => 1); # self-referential loop prevention
         my @q = ($cur);
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         while (defined($cur = shift @q)) {
                 my $c = $cur->{children}; # The hashref here...
 
diff --git a/lib/PublicInbox/SearchView.pm b/lib/PublicInbox/SearchView.pm
index c482f1c9..d50d3cf6 100644
--- a/lib/PublicInbox/SearchView.pm
+++ b/lib/PublicInbox/SearchView.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Displays search results for the web interface
@@ -14,7 +14,7 @@ use PublicInbox::WwwAtomStream;
 use PublicInbox::WwwStream qw(html_oneshot);
 use PublicInbox::SearchThread;
 use PublicInbox::SearchQuery;
-use PublicInbox::Search qw(mdocid);
+use PublicInbox::Search qw(get_pct);
 my %rmap_inc;
 
 sub mbox_results {
@@ -30,7 +30,7 @@ sub mbox_results {
 
 sub sres_top_html {
         my ($ctx) = @_;
-        my $srch = $ctx->{-inbox}->search or
+        my $srch = $ctx->{ibx}->isrch or
                 return PublicInbox::WWW::need($ctx, 'Search');
         my $q = PublicInbox::SearchQuery->new($ctx->{qp});
         my $x = $q->{x};
@@ -93,9 +93,9 @@ sub mset_summary {
         my $pad = length("$total");
         my $pfx = ' ' x $pad;
         my $res = \($ctx->{-html_tip});
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $obfs_ibx = $ibx->{obfuscate} ? $ibx : undef;
-        my @nums = @{$ibx->search->mset_to_artnums($mset)};
+        my @nums = @{$ibx->isrch->mset_to_artnums($mset)};
         my %num2msg = map { $_->{num} => $_ } @{$ibx->over->get_all(@nums)};
         my ($min, $max);
 
@@ -156,7 +156,7 @@ sub path2inc ($) {
 
 sub err_txt {
         my ($ctx, $err) = @_;
-        my $u = $ctx->{-inbox}->base_url($ctx->{env}) . '_/text/help/';
+        my $u = $ctx->{ibx}->base_url($ctx->{env}) . '_/text/help/';
         $err =~ s/^\s*Exception:\s*//; # bad word to show users :P
         $err =~ s!(\S+)!path2inc($1)!sge;
         $err = ascii_html($err);
@@ -201,7 +201,7 @@ sub search_nav_top {
         }
         my $A = $q->qs_html(x => 'A', r => undef);
         $rv .= qq{|<a\nhref="?$A">Atom feed</a>]};
-        if ($ctx->{-inbox}->search->has_threadid) {
+        if ($ctx->{ibx}->isrch->has_threadid) {
                 $rv .= qq{\n\t\t\tdownload mbox.gz: } .
                         # we set name=z w/o using it since it seems required for
                         # lynx (but works fine for w3m).
@@ -276,24 +276,15 @@ sub sort_relevance {
         } @{$_[0]} ]
 }
 
-sub get_pct ($) {
-        # Capped at "99%" since "100%" takes an extra column in the
-        # thread skeleton view.  <xapian/mset.h> says the value isn't
-        # very meaningful, anyways.
-        my $n = $_[0]->get_percent;
-        $n > 99 ? 99 : $n;
-}
-
 sub mset_thread {
         my ($ctx, $mset, $q) = @_;
-        my $ibx = $ctx->{-inbox};
-        my $nshard = $ibx->search->{nshard} // 1;
-        my %pct = map { mdocid($nshard, $_) => get_pct($_) } $mset->items;
-        my $msgs = $ibx->over->get_all(keys %pct);
-        $_->{pct} = $pct{$_->{num}} for @$msgs;
+        my $ibx = $ctx->{ibx};
+        my @pct = map { get_pct($_) } $mset->items;
+        my $msgs = $ibx->isrch->mset_to_smsg($ibx, $mset);
+        my $i = 0;
+        $_->{pct} = $pct[$i++] for @$msgs;
         my $r = $q->{r};
         if ($r) { # for descriptions in search_nav_bot
-                my @pct = values %pct;
                 $q->{-min_pct} = min(@pct);
                 $q->{-max_pct} = max(@pct);
         }
@@ -354,7 +345,7 @@ sub ctx_prepare {
 
 sub adump {
         my ($cb, $mset, $q, $ctx) = @_;
-        $ctx->{ids} = $ctx->{-inbox}->search->mset_to_artnums($mset);
+        $ctx->{ids} = $ctx->{ibx}->isrch->mset_to_artnums($mset);
         $ctx->{search_query} = $q; # used by WwwAtomStream::atom_header
         PublicInbox::WwwAtomStream->response($ctx, 200, \&adump_i);
 }
@@ -363,7 +354,7 @@ sub adump {
 sub adump_i {
         my ($ctx) = @_;
         while (my $num = shift @{$ctx->{ids}}) {
-                my $smsg = eval { $ctx->{-inbox}->over->get_art($num) } or next;
+                my $smsg = eval { $ctx->{ibx}->over->get_art($num) } or next;
                 return $smsg;
         }
 }
diff --git a/lib/PublicInbox/SharedKV.pm b/lib/PublicInbox/SharedKV.pm
new file mode 100644
index 00000000..072c94ca
--- /dev/null
+++ b/lib/PublicInbox/SharedKV.pm
@@ -0,0 +1,154 @@
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+
+# fork()-friendly key-value store.  Will be used for making
+# augmenting Maildirs and mboxes less expensive, maybe.
+# We use flock(2) to avoid SQLite lock problems (busy timeouts, backoff)
+package PublicInbox::SharedKV;
+use strict;
+use v5.10.1;
+use parent qw(PublicInbox::Lock);
+use File::Temp qw(tempdir);
+use DBI ();
+use PublicInbox::Spawn;
+use File::Path qw(rmtree);
+
+sub dbh {
+        my ($self, $lock) = @_;
+        $self->{dbh} //= do {
+                my $f = $self->{filename};
+                $lock //= $self->lock_for_scope;
+                my $dbh = DBI->connect("dbi:SQLite:dbname=$f", '', '', {
+                        AutoCommit => 1,
+                        RaiseError => 1,
+                        PrintError => 0,
+                        sqlite_use_immediate_transaction => 1,
+                        # no sqlite_unicode here, this is for binary data
+                });
+                my $opt = $self->{opt} // {};
+                $dbh->do('PRAGMA synchronous = OFF') if !$opt->{fsync};
+                $dbh->do('PRAGMA cache_size = '.($opt->{cache_size} || 80000));
+                $dbh->do('PRAGMA journal_mode = '.
+                                ($opt->{journal_mode} // 'WAL'));
+                $dbh->do(<<'');
+CREATE TABLE IF NOT EXISTS kv (
+        k VARBINARY PRIMARY KEY NOT NULL,
+        v VARBINARY NOT NULL,
+        UNIQUE (k)
+)
+
+                $dbh;
+        }
+}
+
+sub new {
+        my ($cls, $dir, $base, $opt) = @_;
+        my $self = bless { opt => $opt }, $cls;
+        unless (defined $dir) {
+                $self->{tmpdir} = $dir = tempdir('skv-XXXXXX', TMPDIR => 1);
+                $self->{tmpid} = "$$.$self";
+        }
+        -d $dir or mkdir($dir) or die "mkdir($dir): $!";
+        $base //= '';
+        my $f = $self->{filename} = "$dir/$base.sqlite3";
+        $self->{lock_path} = $opt->{lock_path} // "$dir/$base.flock";
+        unless (-f $f) {
+                open my $fh, '+>>', $f or die "failed to open $f: $!";
+                PublicInbox::Spawn::nodatacow_fd(fileno($fh));
+        }
+        $self;
+}
+
+sub index_values {
+        my ($self) = @_;
+        my $lock = $self->lock_for_scope;
+        $self->dbh($lock)->do('CREATE INDEX IF NOT EXISTS idx_v ON kv (v)');
+}
+
+sub set_maybe {
+        my ($self, $key, $val, $lock) = @_;
+        $lock //= $self->lock_for_scope;
+        my $e = $self->{dbh}->prepare_cached(<<'')->execute($key, $val);
+INSERT OR IGNORE INTO kv (k,v) VALUES (?, ?)
+
+        $e == 0 ? undef : $e;
+}
+
+# caller calls sth->fetchrow_array
+sub each_kv_iter {
+        my ($self) = @_;
+        my $sth = $self->{dbh}->prepare_cached(<<'', undef, 1);
+SELECT k,v FROM kv
+
+        $sth->execute;
+        $sth
+}
+
+sub delete_by_val {
+        my ($self, $val, $lock) = @_;
+        $lock //= $self->lock_for_scope;
+        $self->{dbh}->prepare_cached(<<'')->execute($val) + 0;
+DELETE FROM kv WHERE v = ?
+
+}
+
+sub replace_values {
+        my ($self, $oldval, $newval, $lock) = @_;
+        $lock //= $self->lock_for_scope;
+        $self->{dbh}->prepare_cached(<<'')->execute($newval, $oldval) + 0;
+UPDATE kv SET v = ? WHERE v = ?
+
+}
+
+sub set {
+        my ($self, $key, $val) = @_;
+        if (defined $val) {
+                my $e = $self->{dbh}->prepare_cached(<<'')->execute($key, $val);
+INSERT OR REPLACE INTO kv (k,v) VALUES (?,?)
+
+                $e == 0 ? undef : $e;
+        } else {
+                $self->{dbh}->prepare_cached(<<'')->execute($key);
+DELETE FROM kv WHERE k = ?
+
+        }
+}
+
+sub get {
+        my ($self, $key) = @_;
+        my $sth = $self->{dbh}->prepare_cached(<<'', undef, 1);
+SELECT v FROM kv WHERE k = ?
+
+        $sth->execute($key);
+        $sth->fetchrow_array;
+}
+
+sub xchg {
+        my ($self, $key, $newval, $lock) = @_;
+        $lock //= $self->lock_for_scope;
+        my $oldval = get($self, $key);
+        if (defined $newval) {
+                set($self, $key, $newval);
+        } else {
+                $self->{dbh}->prepare_cached(<<'')->execute($key);
+DELETE FROM kv WHERE k = ?
+
+        }
+        $oldval;
+}
+
+sub count {
+        my ($self) = @_;
+        my $sth = $self->{dbh}->prepare_cached(<<'');
+SELECT COUNT(k) FROM kv
+
+        $sth->execute;
+        $sth->fetchrow_array;
+}
+
+sub DESTROY {
+        my ($self) = @_;
+        rmtree($self->{tmpdir}) if ($self->{tmpid} // '') eq "$$.$self";
+}
+
+1;
diff --git a/lib/PublicInbox/Sigfd.pm b/lib/PublicInbox/Sigfd.pm
index 5d61e630..a4d1b3bb 100644
--- a/lib/PublicInbox/Sigfd.pm
+++ b/lib/PublicInbox/Sigfd.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Wraps a signalfd (or similar) for PublicInbox::DS
@@ -6,8 +6,8 @@
 package PublicInbox::Sigfd;
 use strict;
 use parent qw(PublicInbox::DS);
-use PublicInbox::Syscall qw(signalfd EPOLLIN EPOLLET $SFD_NONBLOCK);
-use POSIX qw(:signal_h);
+use PublicInbox::Syscall qw(signalfd EPOLLIN EPOLLET SFD_NONBLOCK);
+use POSIX ();
 use IO::Handle ();
 
 # returns a coderef to unblock signals if neither signalfd or kqueue
@@ -33,7 +33,7 @@ sub new {
         } else {
                 return; # wake up every second to check for signals
         }
-        if ($flags & $SFD_NONBLOCK) { # it can go into the event loop
+        if ($flags & SFD_NONBLOCK) { # it can go into the event loop
                 $self->SUPER::new($io, EPOLLIN | EPOLLET);
         } else { # master main loop
                 $self->{sock} = $io;
@@ -63,14 +63,4 @@ sub event_step {
         while (wait_once($_[0])) {} # non-blocking
 }
 
-sub sig_setmask { sigprocmask(SIG_SETMASK, @_) or die "sigprocmask: $!" }
-
-sub block_signals () {
-        my $oldset = POSIX::SigSet->new;
-        my $newset = POSIX::SigSet->new;
-        $newset->fillset or die "fillset: $!";
-        sig_setmask($newset, $oldset);
-        $oldset;
-}
-
 1;
diff --git a/lib/PublicInbox/Smsg.pm b/lib/PublicInbox/Smsg.pm
index 171e0a00..b4cc2ecb 100644
--- a/lib/PublicInbox/Smsg.pm
+++ b/lib/PublicInbox/Smsg.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # A small/skeleton/slim representation of a message.
@@ -12,16 +12,9 @@ use strict;
 use warnings;
 use base qw(Exporter);
 our @EXPORT_OK = qw(subject_normalized);
-use PublicInbox::MID qw(mids);
+use PublicInbox::MID qw(mids references);
 use PublicInbox::Address;
 use PublicInbox::MsgTime qw(msg_timestamp msg_datestamp);
-use Time::Local qw(timegm);
-
-sub get_val ($$) {
-        my ($doc, $col) = @_;
-        # sortable_unserialise is defined by PublicInbox::Search::load_xapian()
-        sortable_unserialise($doc->get_value($col));
-}
 
 sub to_doc_data {
         my ($self) = @_;
@@ -61,17 +54,6 @@ sub load_from_data ($$) {
         ) = split(/\n/, $_[1]);
 }
 
-sub load_expand {
-        my ($self, $doc) = @_;
-        my $data = $doc->get_data or return;
-        $self->{ts} = get_val($doc, PublicInbox::Search::TS());
-        my $dt = get_val($doc, PublicInbox::Search::DT());
-        my ($yyyy, $mon, $dd, $hh, $mm, $ss) = unpack('A4A2A2A2A2A2', $dt);
-        $self->{ds} = timegm($ss, $mm, $hh, $dd, $mon - 1, $yyyy);
-        load_from_data($self, $data);
-        $self;
-}
-
 sub psgi_cull ($) {
         my ($self) = @_;
 
@@ -87,7 +69,27 @@ sub psgi_cull ($) {
         $self;
 }
 
-# for Import and v1 non-SQLite WWW code paths
+sub parse_references ($$$) {
+        my ($smsg, $hdr, $mids) = @_;
+        my $refs = references($hdr);
+        push(@$refs, @$mids) if scalar(@$mids) > 1;
+        return $refs if scalar(@$refs) == 0;
+
+        # prevent circular references here:
+        my %seen = ( $smsg->{mid} => 1 );
+        my @keep;
+        foreach my $ref (@$refs) {
+                if (length($ref) > PublicInbox::MID::MAX_MID_SIZE) {
+                        warn "References: <$ref> too long, ignoring\n";
+                        next;
+                }
+                $seen{$ref} //= push(@keep, $ref);
+        }
+        $smsg->{references} = '<'.join('> <', @keep).'>' if @keep;
+        \@keep;
+}
+
+# used for v2, Import and v1 non-SQLite WWW code paths
 sub populate {
         my ($self, $hdr, $sync) = @_;
         for my $f (qw(From To Cc Subject)) {
@@ -118,9 +120,7 @@ sub populate {
         $self->{-ts} = [ my @ts = msg_timestamp($hdr, $sync->{cotime}) ];
         $self->{ds} //= $ds[0]; # no zone
         $self->{ts} //= $ts[0];
-
-        # for v1 users w/o SQLite
-        $self->{mid} //= eval { mids($hdr)->[0] } // '';
+        $self->{mid} //= mids($hdr)->[0];
 }
 
 # no strftime, that is locale-dependent and not for RFC822
@@ -155,4 +155,17 @@ sub subject_normalized ($) {
         $subj;
 }
 
+# returns the number of bytes to add if given a non-CRLF arg
+sub crlf_adjust ($) {
+        if (index($_[0], "\r\n") < 0) {
+                # common case is LF-only, every \n needs an \r;
+                # so favor a cheap tr// over an expensive m//g
+                $_[0] =~ tr/\n/\n/;
+        } else { # count number of '\n' w/o '\r', expensive:
+                scalar(my @n = ($_[0] =~ m/(?<!\r)\n/g));
+        }
+}
+
+sub set_bytes { $_[0]->{bytes} = $_[2] + crlf_adjust($_[1]) }
+
 1;
diff --git a/lib/PublicInbox/SolverGit.pm b/lib/PublicInbox/SolverGit.pm
index 83f7a4ee..1d70975e 100644
--- a/lib/PublicInbox/SolverGit.pm
+++ b/lib/PublicInbox/SolverGit.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # "Solve" blobs which don't exist in git code repositories by
@@ -216,7 +216,7 @@ sub filename_query ($) {
 
 sub find_smsgs ($$$) {
         my ($self, $ibx, $want) = @_;
-        my $srch = $ibx->search or return;
+        my $srch = $ibx->isrch or return;
 
         my $post = $want->{oid_b} or die 'BUG: no {oid_b}';
         $post =~ /\A[a-f0-9]+\z/ or die "BUG: oid_b not hex: $post";
diff --git a/lib/PublicInbox/Spamcheck.pm b/lib/PublicInbox/Spamcheck.pm
index ffebb3cf..d8fa80c8 100644
--- a/lib/PublicInbox/Spamcheck.pm
+++ b/lib/PublicInbox/Spamcheck.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Spamchecking used by -watch and -mda tools
@@ -7,8 +7,8 @@ use strict;
 use warnings;
 
 sub get {
-        my ($config, $key, $default) = @_;
-        my $spamcheck = $config->{$key};
+        my ($cfg, $key, $default) = @_;
+        my $spamcheck = $cfg->{$key};
         $spamcheck = $default unless $spamcheck;
 
         return if !$spamcheck || $spamcheck eq 'none';
diff --git a/lib/PublicInbox/Spamcheck/Spamc.pm b/lib/PublicInbox/Spamcheck/Spamc.pm
index 3ba2c3c9..d2b6429c 100644
--- a/lib/PublicInbox/Spamcheck/Spamc.pm
+++ b/lib/PublicInbox/Spamcheck/Spamc.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Default spam filter class for wrapping spamc(1)
diff --git a/lib/PublicInbox/Spawn.pm b/lib/PublicInbox/Spawn.pm
index cb16fcf6..376d2190 100644
--- a/lib/PublicInbox/Spawn.pm
+++ b/lib/PublicInbox/Spawn.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # This allows vfork to be used for spawning subprocesses if
@@ -19,7 +19,7 @@ use strict;
 use parent qw(Exporter);
 use Symbol qw(gensym);
 use PublicInbox::ProcessPipe;
-our @EXPORT_OK = qw/which spawn popen_rd nodatacow_dir/;
+our @EXPORT_OK = qw(which spawn popen_rd run_die nodatacow_dir);
 our @RLIMITS = qw(RLIMIT_CPU RLIMIT_CORE RLIMIT_DATA);
 
 my $vfork_spawn = <<'VFORK_SPAWN';
@@ -201,12 +201,103 @@ void nodatacow_dir(const char *dir)
 }
 SET_NODATACOW
 
+# last choice for script/lei, 1st choice for lei internals
+# compatible with PublicInbox::CmdIPC4
+my $fdpass = <<'FDPASS';
+#include <sys/types.h>
+#include <sys/uio.h>
+#include <sys/socket.h>
+
+#if defined(CMSG_SPACE) && defined(CMSG_LEN)
+#define SEND_FD_CAPA 6
+#define SEND_FD_SPACE (SEND_FD_CAPA * sizeof(int))
+union my_cmsg {
+        struct cmsghdr hdr;
+        char pad[sizeof(struct cmsghdr) + 16 + SEND_FD_SPACE];
+};
+
+SV *send_cmd4(PerlIO *s, SV *svfds, SV *data, int flags)
+{
+        struct msghdr msg = { 0 };
+        union my_cmsg cmsg = { 0 };
+        STRLEN dlen = 0;
+        struct iovec iov;
+        ssize_t sent;
+        AV *fds = (AV *)SvRV(svfds);
+        I32 i, nfds = av_len(fds) + 1;
+        int *fdp;
+
+        if (SvOK(data)) {
+                iov.iov_base = SvPV(data, dlen);
+                iov.iov_len = dlen;
+        }
+        if (!dlen) { /* must be non-zero */
+                iov.iov_base = &msg.msg_namelen; /* whatever */
+                iov.iov_len = 1;
+        }
+        msg.msg_iov = &iov;
+        msg.msg_iovlen = 1;
+        if (nfds) {
+                if (nfds > SEND_FD_CAPA) {
+                        fprintf(stderr, "FIXME: bump SEND_FD_CAPA=%d\n", nfds);
+                        nfds = SEND_FD_CAPA;
+                }
+                msg.msg_control = &cmsg.hdr;
+                msg.msg_controllen = CMSG_SPACE(nfds * sizeof(int));
+                cmsg.hdr.cmsg_level = SOL_SOCKET;
+                cmsg.hdr.cmsg_type = SCM_RIGHTS;
+                cmsg.hdr.cmsg_len = CMSG_LEN(nfds * sizeof(int));
+                fdp = (int *)CMSG_DATA(&cmsg.hdr);
+                for (i = 0; i < nfds; i++) {
+                        SV **fd = av_fetch(fds, i, 0);
+                        *fdp++ = SvIV(*fd);
+                }
+        }
+        sent = sendmsg(PerlIO_fileno(s), &msg, flags);
+        return sent >= 0 ? newSViv(sent) : &PL_sv_undef;
+}
+
+void recv_cmd4(PerlIO *s, SV *buf, STRLEN n)
+{
+        union my_cmsg cmsg = { 0 };
+        struct msghdr msg = { 0 };
+        struct iovec iov;
+        ssize_t i;
+        Inline_Stack_Vars;
+        Inline_Stack_Reset;
+
+        if (!SvOK(buf))
+                sv_setpvn(buf, "", 0);
+        iov.iov_base = SvGROW(buf, n + 1);
+        iov.iov_len = n;
+        msg.msg_iov = &iov;
+        msg.msg_iovlen = 1;
+        msg.msg_control = &cmsg.hdr;
+        msg.msg_controllen = CMSG_SPACE(SEND_FD_SPACE);
+
+        i = recvmsg(PerlIO_fileno(s), &msg, 0);
+        if (i < 0)
+                Inline_Stack_Push(&PL_sv_undef);
+        else
+                SvCUR_set(buf, i);
+        if (i > 0 && cmsg.hdr.cmsg_level == SOL_SOCKET &&
+                        cmsg.hdr.cmsg_type == SCM_RIGHTS) {
+                size_t len = cmsg.hdr.cmsg_len;
+                int *fdp = (int *)CMSG_DATA(&cmsg.hdr);
+                for (i = 0; CMSG_LEN((i + 1) * sizeof(int)) <= len; i++)
+                        Inline_Stack_Push(sv_2mortal(newSViv(*fdp++)));
+        }
+        Inline_Stack_Done;
+}
+#endif /* defined(CMSG_SPACE) && defined(CMSG_LEN) */
+FDPASS
+
 my $inline_dir = $ENV{PERL_INLINE_DIRECTORY} //= (
                 $ENV{XDG_CACHE_HOME} //
                 ( ($ENV{HOME} // '/nonexistent').'/.cache' )
         ).'/public-inbox/inline-c';
 
-$set_nodatacow = $vfork_spawn = undef unless -d $inline_dir && -w _;
+$set_nodatacow = $vfork_spawn = $fdpass = undef unless -d $inline_dir && -w _;
 if (defined $vfork_spawn) {
         # Inline 0.64 or later has locking in multi-process env,
         # but we support 0.5 on Debian wheezy
@@ -215,13 +306,14 @@ if (defined $vfork_spawn) {
                 my $f = "$inline_dir/.public-inbox.lock";
                 open my $fh, '>', $f or die "failed to open $f: $!\n";
                 flock($fh, LOCK_EX) or die "LOCK_EX failed on $f: $!\n";
-                eval 'use Inline C => $vfork_spawn . $set_nodatacow';
+                eval 'use Inline C => $vfork_spawn.$fdpass.$set_nodatacow';
+                        # . ', BUILD_NOISY => 1';
                 my $err = $@;
                 my $ndc_err;
                 if ($err && $set_nodatacow) { # missing Linux kernel headers
                         $ndc_err = $err;
                         undef $set_nodatacow;
-                        eval 'use Inline C => $vfork_spawn';
+                        eval 'use Inline C => $vfork_spawn . $fdpass';
                 }
                 flock($fh, LOCK_UN) or die "LOCK_UN failed on $f: $!\n";
                 die $err if $err;
@@ -229,7 +321,7 @@ if (defined $vfork_spawn) {
         };
         if ($@) {
                 warn "Inline::C failed for vfork: $@\n";
-                $set_nodatacow = $vfork_spawn = undef;
+                $set_nodatacow = $vfork_spawn = $fdpass = undef;
         }
 }
 
@@ -243,8 +335,10 @@ unless ($set_nodatacow) {
         *nodatacow_fd = \&PublicInbox::NDC_PP::nodatacow_fd;
         *nodatacow_dir = \&PublicInbox::NDC_PP::nodatacow_dir;
 }
+
 undef $set_nodatacow;
 undef $vfork_spawn;
+undef $fdpass;
 
 sub which ($) {
         my ($file) = @_;
@@ -295,15 +389,22 @@ sub spawn ($;$$) {
 }
 
 sub popen_rd {
-        my ($cmd, $env, $opts) = @_;
+        my ($cmd, $env, $opt) = @_;
         pipe(my ($r, $w)) or die "pipe: $!\n";
-        $opts ||= {};
-        $opts->{1} = fileno($w);
-        my $pid = spawn($cmd, $env, $opts);
+        $opt ||= {};
+        $opt->{1} = fileno($w);
+        my $pid = spawn($cmd, $env, $opt);
         return ($r, $pid) if wantarray;
         my $ret = gensym;
-        tie *$ret, 'PublicInbox::ProcessPipe', $pid, $r;
+        tie *$ret, 'PublicInbox::ProcessPipe', $pid, $r, @$opt{qw(cb arg)};
         $ret;
 }
 
+sub run_die ($;$$) {
+        my ($cmd, $env, $rdr) = @_;
+        my $pid = spawn($cmd, $env, $rdr);
+        waitpid($pid, 0) == $pid or die "@$cmd did not finish";
+        $? == 0 or die "@$cmd failed: \$?=$?\n";
+}
+
 1;
diff --git a/lib/PublicInbox/SpawnPP.pm b/lib/PublicInbox/SpawnPP.pm
index a72d5a2d..b0ad4da5 100644
--- a/lib/PublicInbox/SpawnPP.pm
+++ b/lib/PublicInbox/SpawnPP.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Pure-Perl implementation of "spawn".  This can't take advantage
diff --git a/lib/PublicInbox/Syscall.pm b/lib/PublicInbox/Syscall.pm
index e4f00a2a..5ff1d65f 100644
--- a/lib/PublicInbox/Syscall.pm
+++ b/lib/PublicInbox/Syscall.pm
@@ -5,7 +5,7 @@
 # This license differs from the rest of public-inbox
 #
 # This module is Copyright (c) 2005 Six Apart, Ltd.
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 #
 # All rights reserved.
 #
@@ -22,7 +22,7 @@ our @EXPORT_OK = qw(epoll_ctl epoll_create epoll_wait
                   EPOLLIN EPOLLOUT EPOLLET
                   EPOLL_CTL_ADD EPOLL_CTL_DEL EPOLL_CTL_MOD
                   EPOLLONESHOT EPOLLEXCLUSIVE
-                  signalfd $SFD_NONBLOCK);
+                  signalfd SFD_NONBLOCK);
 our %EXPORT_TAGS = (epoll => [qw(epoll_ctl epoll_create epoll_wait
                              EPOLLIN EPOLLOUT
                              EPOLL_CTL_ADD EPOLL_CTL_DEL EPOLL_CTL_MOD
@@ -67,7 +67,7 @@ our (
      );
 
 my $SFD_CLOEXEC = 02000000; # Perl does not expose O_CLOEXEC
-our $SFD_NONBLOCK = O_NONBLOCK;
+sub SFD_NONBLOCK () { O_NONBLOCK }
 our $no_deprecated = 0;
 
 if ($^O eq "linux") {
@@ -224,41 +224,49 @@ sub epoll_ctl_mod8 {
 # epoll_wait wrapper
 # ARGS: (epfd, maxevents, timeout (milliseconds), arrayref)
 #  arrayref: values modified to be [$fd, $event]
-our $epoll_wait_events;
+our $epoll_wait_events = '';
 our $epoll_wait_size = 0;
 sub epoll_wait_mod4 {
-    # resize our static buffer if requested size is bigger than we've ever done
-    if ($_[1] > $epoll_wait_size) {
-        $epoll_wait_size = $_[1];
-        $epoll_wait_events = "\0" x 12 x $epoll_wait_size;
-    }
-    my $ct = syscall($SYS_epoll_wait, $_[0]+0, $epoll_wait_events, $_[1]+0, $_[2]+0);
-    for (0..$ct-1) {
-        @{$_[3]->[$_]}[1,0] = unpack("LL", substr($epoll_wait_events, 12*$_, 8));
-    }
-    return $ct;
+        my ($epfd, $maxevents, $timeout_msec, $events) = @_;
+        # resize our static buffer if maxevents bigger than we've ever done
+        if ($maxevents > $epoll_wait_size) {
+                $epoll_wait_size = $maxevents;
+                vec($epoll_wait_events, $maxevents * 12 * 8 - 1, 1) = 0;
+        }
+        @$events = ();
+        my $ct = syscall($SYS_epoll_wait, $epfd, $epoll_wait_events,
+                        $maxevents, $timeout_msec);
+        for (0..$ct - 1) {
+                # 12-byte struct epoll_event
+                # 4 bytes uint32_t events mask (skipped, useless to us)
+                # 8 bytes: epoll_data_t union (first 4 bytes are the fd)
+                # So we skip the first 4 bytes and take the middle 4:
+                $events->[$_] = unpack('L', substr($epoll_wait_events,
+                                                        12 * $_ + 4, 4));
+        }
 }
 
 sub epoll_wait_mod8 {
-    # resize our static buffer if requested size is bigger than we've ever done
-    if ($_[1] > $epoll_wait_size) {
-        $epoll_wait_size = $_[1];
-        $epoll_wait_events = "\0" x 16 x $epoll_wait_size;
-    }
-    my $ct;
-    if ($no_deprecated) {
-        $ct = syscall($SYS_epoll_wait, $_[0]+0, $epoll_wait_events, $_[1]+0, $_[2]+0, undef);
-    } else {
-        $ct = syscall($SYS_epoll_wait, $_[0]+0, $epoll_wait_events, $_[1]+0, $_[2]+0);
-    }
-    for (0..$ct-1) {
-        # 16 byte epoll_event structs, with format:
-        #    4 byte mask [idx 1]
-        #    4 byte padding (we put it into idx 2, useless)
-        #    8 byte data (first 4 bytes are fd, into idx 0)
-        @{$_[3]->[$_]}[1,2,0] = unpack("LLL", substr($epoll_wait_events, 16*$_, 12));
-    }
-    return $ct;
+        my ($epfd, $maxevents, $timeout_msec, $events) = @_;
+
+        # resize our static buffer if maxevents bigger than we've ever done
+        if ($maxevents > $epoll_wait_size) {
+                $epoll_wait_size = $maxevents;
+                vec($epoll_wait_events, $maxevents * 16 * 8 - 1, 1) = 0;
+        }
+        @$events = ();
+        my $ct = syscall($SYS_epoll_wait, $epfd, $epoll_wait_events,
+                        $maxevents, $timeout_msec,
+                        $no_deprecated ? undef : ());
+        for (0..$ct - 1) {
+                # 16-byte struct epoll_event
+                # 4 bytes uint32_t events mask (skipped, useless to us)
+                # 4 bytes padding (skipped, useless)
+                # 8 bytes epoll_data_t union (first 4 bytes are the fd)
+                # So skip the first 8 bytes, take 4, and ignore the last 4:
+                $events->[$_] = unpack('L', substr($epoll_wait_events,
+                                                        16 * $_ + 8, 4));
+        }
 }
 
 sub signalfd ($$$) {
diff --git a/lib/PublicInbox/TLS.pm b/lib/PublicInbox/TLS.pm
index 86e6331d..3fe16a62 100644
--- a/lib/PublicInbox/TLS.pm
+++ b/lib/PublicInbox/TLS.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # IO::Socket::SSL support code
diff --git a/lib/PublicInbox/TestCommon.pm b/lib/PublicInbox/TestCommon.pm
index 299b9c6a..16ae2650 100644
--- a/lib/PublicInbox/TestCommon.pm
+++ b/lib/PublicInbox/TestCommon.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # internal APIs used only for tests
@@ -10,8 +10,14 @@ use Fcntl qw(FD_CLOEXEC F_SETFD F_GETFD :seek);
 use POSIX qw(dup2);
 use IO::Socket::INET;
 our @EXPORT = qw(tmpdir tcp_server tcp_connect require_git require_mods
-        run_script start_script key2sub xsys xqx eml_load tick
+        run_script start_script key2sub xsys xsys_e xqx eml_load tick
         have_xapian_compact);
+BEGIN {
+        require Test::More;
+        *BAIL_OUT = \&Test::More::BAIL_OUT;
+        *plan = \&Test::More::plan;
+        *skip = \&Test::More::skip;
+}
 
 sub eml_load ($) {
         my ($path, $cb) = @_;
@@ -38,7 +44,7 @@ sub tcp_server () {
                 Type => Socket::SOCK_STREAM(),
                 Listen => 1024,
                 Blocking => 0,
-        ) or Test::More::BAIL_OUT("failed to create TCP server: $!");
+        ) or BAIL_OUT "failed to create TCP server: $!";
 }
 
 sub tcp_connect {
@@ -49,7 +55,7 @@ sub tcp_connect {
                 Type => Socket::SOCK_STREAM(),
                 PeerAddr => $addr,
                 %opt,
-        ) or Test::More::BAIL_OUT("failed to connect to $addr: $!");
+        ) or BAIL_OUT "failed to connect to $addr: $!";
         $s->autoflush(1);
         $s;
 }
@@ -64,8 +70,8 @@ sub require_git ($;$) {
         my $cur_int = ($cur_maj << 24) | ($cur_min << 16) | ($cur_sub // 0);
         if ($cur_int < $req_int) {
                 return 0 if $maybe;
-                Test::More::plan(skip_all =>
-                        "git $req+ required, have $cur_maj.$cur_min.$cur_sub");
+                plan skip_all =>
+                        "git $req+ required, have $cur_maj.$cur_min.$cur_sub";
         }
         1;
 }
@@ -75,6 +81,10 @@ sub require_mods {
         my $maybe = pop @mods if $mods[-1] =~ /\A[0-9]+\z/;
         my @need;
         while (my $mod = shift(@mods)) {
+                if ($mod eq 'json') {
+                        $mod = 'Cpanel::JSON::XS||JSON::MaybeXS||'.
+                                'JSON||JSON::PP'
+                }
                 if ($mod eq 'Search::Xapian') {
                         if (eval { require PublicInbox::Search } &&
                                 PublicInbox::Search::load_xapian()) {
@@ -109,8 +119,8 @@ sub require_mods {
         }
         return unless @need;
         my $m = join(', ', @need)." missing for $0";
-        Test::More::skip($m, $maybe) if $maybe;
-        Test::More::plan(skip_all => $m)
+        skip($m, $maybe) if $maybe;
+        plan(skip_all => $m)
 }
 
 sub key2script ($) {
@@ -131,9 +141,9 @@ sub _prepare_redirects ($) {
         for (my $fd = 0; $fd <= $#io_mode; $fd++) {
                 my $fh = $fhref->[$fd] or next;
                 my ($oldfh, $mode) = @{$io_mode[$fd]};
-                open my $orig, $mode, $oldfh or die "$$oldfh $mode stash: $!";
+                open my $orig, $mode, $oldfh or die "$oldfh $mode stash: $!";
                 $orig_io->[$fd] = $orig;
-                open $oldfh, $mode, $fh or die "$$oldfh $mode redirect: $!";
+                open $oldfh, $mode, $fh or die "$oldfh $mode redirect: $!";
         }
         $orig_io;
 }
@@ -164,7 +174,7 @@ sub run_script_exit {
         die RUN_SCRIPT_EXIT;
 }
 
-my %cached_scripts;
+our %cached_scripts;
 sub key2sub ($) {
         my ($key) = @_;
         $cached_scripts{$key} //= do {
@@ -257,6 +267,7 @@ sub run_script ($;$$) {
                 my $orig_io = _prepare_redirects($fhref);
                 _run_sub($sub, $key, \@argv);
                 _undo_redirects($orig_io);
+                select STDOUT;
         }
 
         # slurp the redirects back into user-supplied strings
@@ -318,6 +329,11 @@ sub xsys {
         $? >> 8
 }
 
+sub xsys_e { # like "/bin/sh -e"
+        xsys(@_) == 0 or
+                BAIL_OUT (ref $_[0] ? "@{$_[0]}" : "@_"). " failed \$?=$?"
+}
+
 # like `backtick` or qx{} op, but uses spawn() for env/rdr + vfork
 sub xqx {
         my ($cmd, $env, $rdr) = @_;
diff --git a/lib/PublicInbox/Tmpfile.pm b/lib/PublicInbox/Tmpfile.pm
index 25bb3a52..3040dd77 100644
--- a/lib/PublicInbox/Tmpfile.pm
+++ b/lib/PublicInbox/Tmpfile.pm
@@ -1,9 +1,9 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::Tmpfile;
 use strict;
-use warnings;
-use base qw(Exporter);
+use v5.10.1;
+use parent qw(Exporter);
 our @EXPORT = qw(tmpfile);
 use Fcntl qw(:DEFAULT);
 use Errno qw(EEXIST);
@@ -13,6 +13,9 @@ use File::Spec;
 # unlinked filename which makes sense when viewed with lsof
 # (at least on Linux)
 # And if we ever stop caring to have debuggable filenames, O_TMPFILE :)
+#
+# This is also for Perl <5.32 which lacks: open(..., '+>>', undef)
+# <https://rt.perl.org/Ticket/Display.html?id=134221>
 sub tmpfile ($;$$) {
         my ($id, $sock, $append) = @_;
         if (defined $sock) {
diff --git a/lib/PublicInbox/URIimap.pm b/lib/PublicInbox/URIimap.pm
index 56b6002a..ab0908b7 100644
--- a/lib/PublicInbox/URIimap.pm
+++ b/lib/PublicInbox/URIimap.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # cf. RFC 5092, which the `URI' package doesn't support
 #
diff --git a/lib/PublicInbox/Unsubscribe.pm b/lib/PublicInbox/Unsubscribe.pm
index 945e7ae7..621a7e0f 100644
--- a/lib/PublicInbox/Unsubscribe.pm
+++ b/lib/PublicInbox/Unsubscribe.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Standalone PSGI app to handle HTTP(s) unsubscribe links generated
@@ -12,7 +12,8 @@ use warnings;
 use Crypt::CBC;
 use Plack::Util;
 use MIME::Base64 qw(decode_base64url);
-my $CODE_URL = 'https://public-inbox.org/public-inbox.git';
+my @CODE_URL = qw(http://ou63pmih66umazou.onion/public-inbox.git
+        https://public-inbox.org/public-inbox.git);
 my @CT_HTML = ('Content-Type', 'text/html; charset=UTF-8');
 
 sub new {
@@ -38,13 +39,15 @@ sub new {
         my $unsubscribe = $opt{unsubscribe} or
                 die "`unsubscribe' callback not given\n";
 
+        my $code_url = $opt{code_url} || \@CODE_URL;
+        $code_url = [ $code_url ] if ref($code_url) ne 'ARRAY';
         bless {
-                pi_config => $opt{pi_config}, # PublicInbox::Config
+                pi_cfg => $opt{pi_config}, # PublicInbox::Config
                 owner_email => $opt{owner_email},
                 cipher => $cipher,
                 unsubscribe => $unsubscribe,
                 contact => qq(<a\nhref="mailto:$e">$e</a>),
-                code_url => $opt{code_url} || $CODE_URL,
+                code_url => $code_url,
                 confirm => $opt{confirm},
         }, $class;
 }
@@ -138,7 +141,7 @@ sub r {
                 "<html><head><title>$title</title></head><body><pre>".
                 join("\n", "<b>$title</b>\n", @body) . '</pre><hr>'.
                 "<pre>This page is available under AGPL-3.0+\n" .
-                "git clone $self->{code_url}\n" .
+                join('', map { "git clone $_\n" } @{$self->{code_url}}) .
                 qq(Email $self->{contact} if you have any questions).
                 '</pre></body></html>'
         ] ];
@@ -149,9 +152,9 @@ sub archive_info {
         my $archive_url = $self->{archive_urls}->{$list_addr};
 
         unless ($archive_url) {
-                if (my $config = $self->{pi_config}) {
+                if (my $cfg = $self->{pi_cfg}) {
                         # PublicInbox::Config::lookup
-                        my $ibx = $config->lookup($list_addr);
+                        my $ibx = $cfg->lookup($list_addr);
                         # PublicInbox::Inbox::base_url
                         $archive_url = $ibx->base_url if $ibx;
                 }
diff --git a/lib/PublicInbox/UserContent.pm b/lib/PublicInbox/UserContent.pm
index 789da2f1..b63d0617 100644
--- a/lib/PublicInbox/UserContent.pm
+++ b/lib/PublicInbox/UserContent.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Self-updating module containing a sample CSS for client-side
diff --git a/lib/PublicInbox/V2Writable.pm b/lib/PublicInbox/V2Writable.pm
index b8abfa94..0104f87a 100644
--- a/lib/PublicInbox/V2Writable.pm
+++ b/lib/PublicInbox/V2Writable.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # This interface wraps and mimics PublicInbox::Import
@@ -16,14 +16,15 @@ use PublicInbox::ContentHash qw(content_hash content_digest);
 use PublicInbox::InboxWritable;
 use PublicInbox::OverIdx;
 use PublicInbox::Msgmap;
-use PublicInbox::Spawn qw(spawn popen_rd);
-use PublicInbox::SearchIdx qw(log2stack crlf_adjust is_ancestor check_size);
+use PublicInbox::Spawn qw(spawn popen_rd run_die);
+use PublicInbox::Search;
+use PublicInbox::SearchIdx qw(log2stack is_ancestor check_size is_bad_blob);
 use IO::Handle; # ->autoflush
 use File::Temp ();
 
 my $OID = qr/[a-f0-9]{40,}/;
 # an estimate of the post-packed size to the raw uncompressed size
-my $PACKING_FACTOR = 0.4;
+our $PACKING_FACTOR = 0.4;
 
 # SATA storage lags behind what CPUs are capable of, so relying on
 # nproc(1) can be misleading and having extra Xapian shards is a
@@ -65,11 +66,15 @@ sub nproc_shards ($) {
 
 sub count_shards ($) {
         my ($self) = @_;
-        # always load existing shards in case core count changes:
-        # Also, shard count may change while -watch is running
-        my $srch = $self->{ibx}->search or return 0;
-        delete $self->{ibx}->{search};
-        $srch->{nshard} // 0
+        if (my $ibx = $self->{ibx}) {
+                # always load existing shards in case core count changes:
+                # Also, shard count may change while -watch is running
+                my $srch = $ibx->search or return 0;
+                delete $ibx->{search};
+                $srch->{nshard} // 0
+        } else { # ExtSearchIdx
+                $self->{nshard} ||= scalar($self->xdb_shards_flat);
+        }
 }
 
 sub new {
@@ -86,8 +91,6 @@ sub new {
                         die "$dir does not exist\n";
                 }
         }
-        $v2ibx->umask_prepare;
-
         my $xpfx = "$dir/xap" . PublicInbox::Search::SCHEMA_VERSION;
         my $self = {
                 ibx => $v2ibx,
@@ -117,12 +120,9 @@ sub init_inbox {
         }
         $self->idx_init;
         $self->{mm}->skip_artnum($skip_artnum) if defined $skip_artnum;
-        my $epoch_max = -1;
-        git_dir_latest($self, \$epoch_max);
-        if (defined $skip_epoch && $epoch_max == -1) {
-                $epoch_max = $skip_epoch;
-        }
-        $self->git_init($epoch_max >= 0 ? $epoch_max : 0);
+        my $max = $self->{ibx}->max_git_epoch;
+        $max = $skip_epoch if (defined($skip_epoch) && !defined($max));
+        $self->git_init($max // 0);
         $self->done;
 }
 
@@ -133,14 +133,20 @@ sub add {
         $self->{ibx}->with_umask(\&_add, $self, $eml, $check_cb);
 }
 
+sub idx_shard ($$) {
+        my ($self, $num) = @_;
+        $self->{idx_shards}->[$num % scalar(@{$self->{idx_shards}})];
+}
+
 # indexes a message, returns true if checkpointing is needed
-sub do_idx ($$$$) {
-        my ($self, $msgref, $mime, $smsg) = @_;
-        $smsg->{bytes} = $smsg->{raw_bytes} + crlf_adjust($$msgref);
-        $self->{oidx}->add_overview($mime, $smsg);
-        my $idx = idx_shard($self, $smsg->{num} % $self->{shards});
-        $idx->index_raw($msgref, $mime, $smsg);
-        my $n = $self->{transact_bytes} += $smsg->{raw_bytes};
+sub do_idx ($$$) {
+        my ($self, $eml, $smsg) = @_;
+        $self->{oidx}->add_overview($eml, $smsg);
+        if ($self->{-need_xapian}) {
+                my $idx = idx_shard($self, $smsg->{num});
+                $idx->index_eml($eml, $smsg);
+        }
+        my $n = $self->{transact_bytes} += $smsg->{bytes};
         $n >= $self->{batch_bytes};
 }
 
@@ -168,8 +174,7 @@ sub _add {
         $cmt = $im->get_mark($cmt);
         $self->{last_commit}->[$self->{epoch_max}] = $cmt;
 
-        my $msgref = delete $smsg->{-raw_email};
-        if (do_idx($self, $msgref, $mime, $smsg)) {
+        if (do_idx($self, $mime, $smsg)) {
                 $self->checkpoint;
         }
 
@@ -249,11 +254,6 @@ sub v2_num_for_harder {
         ($num, $mid0);
 }
 
-sub idx_shard {
-        my ($self, $shard_i) = @_;
-        $self->{idx_shards}->[$shard_i];
-}
-
 sub _idx_init { # with_umask callback
         my ($self, $opt) = @_;
         $self->lock_acquire unless $opt && $opt->{-skip_lock};
@@ -264,22 +264,33 @@ sub _idx_init { # with_umask callback
         $self->{shards} = $nshards if $nshards && $nshards != $self->{shards};
         $self->{batch_bytes} = $opt->{batch_size} //
                                 $PublicInbox::SearchIdx::BATCH_BYTES;
-        $self->{batch_bytes} *= $self->{shards} if $self->{parallel};
 
         # need to create all shards before initializing msgmap FD
         # idx_shards must be visible to all forked processes
         my $max = $self->{shards} - 1;
         my $idx = $self->{idx_shards} = [];
         push @$idx, PublicInbox::SearchIdxShard->new($self, $_) for (0..$max);
+        $self->{-need_xapian} = $idx->[0]->need_xapian;
+
+        # SearchIdxShard may do their own flushing, so don't scale
+        # until after forking
+        $self->{batch_bytes} *= $self->{shards} if $self->{parallel};
+
+        my $ibx = $self->{ibx} or return; # ExtIdxSearch
 
         # Now that all subprocesses are up, we can open the FDs
         # for SQLite:
         my $mm = $self->{mm} = PublicInbox::Msgmap->new_file(
-                                "$self->{ibx}->{inboxdir}/msgmap.sqlite3",
-                                $self->{ibx}->{-no_fsync} ? 2 : 1);
+                                "$ibx->{inboxdir}/msgmap.sqlite3",
+                                $ibx->{-no_fsync} ? 2 : 1);
         $mm->{dbh}->begin_work;
 }
 
+sub parallel_init ($$) {
+        my ($self, $indexlevel) = @_;
+        $self->{parallel} = 0 if ($indexlevel // 'full') eq 'basic';
+}
+
 # idempotent
 sub idx_init {
         my ($self, $opt) = @_;
@@ -292,17 +303,7 @@ sub idx_init {
         delete @$ibx{qw(mm search)};
         $ibx->git->cleanup;
 
-        $self->{parallel} = 0 if ($ibx->{indexlevel}//'') eq 'basic';
-        if ($self->{parallel}) {
-                pipe(my ($r, $w)) or die "pipe failed: $!";
-                # pipe for barrier notifications doesn't need to be big,
-                # 1031: F_SETPIPE_SZ
-                fcntl($w, 1031, 4096) if $^O eq 'linux';
-                $self->{bnote} = [ $r, $w ];
-                $w->autoflush(1);
-        }
-
-        $ibx->umask_prepare;
+        parallel_init($self, $ibx->{indexlevel});
         $ibx->with_umask(\&_idx_init, $self, $opt);
 }
 
@@ -312,14 +313,10 @@ sub idx_init {
 sub _replace_oids ($$$) {
         my ($self, $mime, $replace_map) = @_;
         $self->done;
-        my $pfx = "$self->{ibx}->{inboxdir}/git";
+        my $ibx = $self->{ibx};
+        my $pfx = "$ibx->{inboxdir}/git";
         my $rewrites = []; # epoch => commit
-        my $max = $self->{epoch_max};
-
-        unless (defined($max)) {
-                defined(my $latest = git_dir_latest($self, \$max)) or return;
-                $self->{epoch_max} = $max;
-        }
+        my $max = $self->{epoch_max} //= $ibx->max_git_epoch // return;
 
         foreach my $i (0..$max) {
                 my $git_dir = "$pfx/$i.git";
@@ -414,7 +411,7 @@ sub rewrite_internal ($$;$$$) {
                         } else { # ->purge or ->remove
                                 $self->{mm}->num_delete($num);
                         }
-                        unindex_oid_remote($self, $oid, $mid);
+                        unindex_oid_aux($self, $oid, $mid);
                 }
         }
 
@@ -467,7 +464,7 @@ sub git_hash_raw ($$) {
         my ($self, $raw) = @_;
         # grab the expected OID we have to reindex:
         pipe(my($in, $w)) or die "pipe: $!";
-        my $git_dir = $self->{ibx}->git->{git_dir};
+        my $git_dir = $self->git->{git_dir};
         my $cmd = ['git', "--git-dir=$git_dir", qw(hash-object --stdin)];
         my $r = popen_rd($cmd, undef, { 0 => $in });
         print $w $$raw or die "print \$w: $!";
@@ -531,23 +528,23 @@ W: $list
         }
 
         # make sure we really got the OID:
-        my ($blob, $type, $bytes) = $self->{ibx}->git->check($expect_oid);
+        my ($blob, $type, $bytes) = $self->git->check($expect_oid);
         $blob eq $expect_oid or die "BUG: $expect_oid not found after replace";
 
         # don't leak FDs to Xapian:
-        $self->{ibx}->git->cleanup;
+        $self->git->cleanup;
 
         # reindex modified messages:
         for my $smsg (@$need_reindex) {
                 my $new_smsg = bless {
                         blob => $blob,
-                        raw_bytes => $bytes,
                         num => $smsg->{num},
                         mid => $smsg->{mid},
                 }, 'PublicInbox::Smsg';
                 my $sync = { autime => $smsg->{ds}, cotime => $smsg->{ts} };
                 $new_smsg->populate($new_mime, $sync);
-                do_idx($self, \$raw, $new_mime, $new_smsg);
+                $new_smsg->set_bytes($raw, $bytes);
+                do_idx($self, $new_mime, $new_smsg);
         }
         $rewritten->{rewrites};
 }
@@ -558,7 +555,7 @@ sub last_epoch_commit ($$;$) {
         $self->{mm}->last_commit_xap($v, $i, $cmt);
 }
 
-sub set_last_commits ($) {
+sub set_last_commits ($) { # this is NOT for ExtSearchIdx
         my ($self) = @_;
         defined(my $epoch_max = $self->{epoch_max}) or return;
         my $last_commit = $self->{last_commit};
@@ -569,24 +566,6 @@ sub set_last_commits ($) {
         }
 }
 
-sub barrier_init {
-        my ($self, $n) = @_;
-        $self->{bnote} or return;
-        --$n;
-        my $barrier = { map { $_ => 1 } (0..$n) };
-}
-
-sub barrier_wait {
-        my ($self, $barrier) = @_;
-        my $bnote = $self->{bnote} or return;
-        my $r = $bnote->[0];
-        while (scalar keys %$barrier) {
-                defined(my $l = readline($r)) or die "EOF on barrier_wait: $!";
-                $l =~ /\Abarrier (\d+)/ or die "bad line on barrier_wait: $l";
-                delete $barrier->{$1} or die "bad shard[$1] on barrier wait";
-        }
-}
-
 # public
 sub checkpoint ($;$) {
         my ($self, $wait) = @_;
@@ -600,34 +579,54 @@ sub checkpoint ($;$) {
         }
         my $shards = $self->{idx_shards};
         if ($shards) {
-                my $dbh = $self->{mm}->{dbh};
+                my $mm = $self->{mm};
+                my $dbh = $mm->{dbh} if $mm;
 
                 # SQLite msgmap data is second in importance
-                $dbh->commit;
+                $dbh->commit if $dbh;
 
                 # SQLite overview is third
                 $self->{oidx}->commit_lazy;
 
                 # Now deal with Xapian
-                if ($wait) {
-                        my $barrier = $self->barrier_init(scalar @$shards);
 
-                        # each shard needs to issue a barrier command
-                        $_->shard_barrier for @$shards;
+                # start commit_txn_lazy asynchronously on all parallel shards
+                # (non-parallel waits here)
+                $_->ipc_do('commit_txn_lazy') for @$shards;
+
+                # transactions started on parallel shards,
+                # wait for them by issuing an echo command (echo can only
+                # run after commit_txn_lazy is done)
+                if ($wait && $self->{parallel}) {
+                        my $i = 0;
+                        for my $shard (@$shards) {
+                                my $echo = $shard->ipc_do('echo', $i);
+                                $echo == $i or die <<"";
+shard[$i] bad echo:$echo != $i waiting for txn commit
+
+                                ++$i;
+                        }
+                }
 
-                        # wait for each Xapian shard
-                        $self->barrier_wait($barrier);
-                } else {
-                        $_->shard_commit for @$shards;
+                my $midx = $self->{midx}; # misc index
+                if ($midx) {
+                        $midx->commit_txn;
+                        $PublicInbox::Search::X{CLOEXEC_UNSET} and
+                                $self->git->cleanup;
                 }
 
                 # last_commit is special, don't commit these until
-                # remote shards are done:
-                $dbh->begin_work;
+                # Xapian shards are done:
+                $dbh->begin_work if $dbh;
                 set_last_commits($self);
-                $dbh->commit;
-
-                $dbh->begin_work;
+                if ($dbh) {
+                        $dbh->commit;
+                        $dbh->begin_work;
+                }
+                if ($midx) {
+                        $self->git->batch_prepare;
+                        $midx->begin_txn;
+                }
         }
         $self->{total_bytes} += $self->{transact_bytes};
         $self->{transact_bytes} = 0;
@@ -667,14 +666,26 @@ sub done {
         }
         eval { $self->{oidx}->dbh_close };
         $err .= "over close: $@\n" if $@;
-        delete $self->{bnote};
+        delete $self->{midx};
         my $nbytes = $self->{total_bytes};
         $self->{total_bytes} = 0;
         $self->lock_release(!!$nbytes) if $shards;
-        $self->{ibx}->git->cleanup;
+        $self->git->cleanup;
         die $err if $err;
 }
 
+sub write_alternates ($$$) {
+        my ($info_dir, $mode, $out) = @_;
+        my $fh = File::Temp->new(TEMPLATE => 'alt-XXXXXXXX', DIR => $info_dir);
+        my $tmp = $fh->filename;
+        print $fh @$out or die "print $tmp: $!\n";
+        chmod($mode, $fh) or die "fchmod $tmp: $!\n";
+        close $fh or die "close $tmp $!\n";
+        my $alt = "$info_dir/alternates";
+        rename($tmp, $alt) or die "rename $tmp => $alt: $!\n";
+        $fh->unlink_on_destroy(0);
+}
+
 sub fill_alternates ($$) {
         my ($self, $epoch) = @_;
 
@@ -713,45 +724,20 @@ sub fill_alternates ($$) {
                 }
         }
         return unless $new;
-
-        my $fh = File::Temp->new(TEMPLATE => 'alt-XXXXXXXX', DIR => $info_dir);
-        my $tmp = $fh->filename;
-        print $fh join("\n", sort { $alt{$b} <=> $alt{$a} } keys %alt), "\n"
-                or die "print $tmp: $!\n";
-        chmod($mode, $fh) or die "fchmod $tmp: $!\n";
-        close $fh or die "close $tmp $!\n";
-        rename($tmp, $alt) or die "rename $tmp => $alt: $!\n";
-        $fh->unlink_on_destroy(0);
+        write_alternates($info_dir, $mode,
+                [join("\n", sort { $alt{$b} <=> $alt{$a} } keys %alt), "\n"]);
 }
 
 sub git_init {
         my ($self, $epoch) = @_;
         my $git_dir = "$self->{ibx}->{inboxdir}/git/$epoch.git";
         PublicInbox::Import::init_bare($git_dir);
-        my @cmd = (qw/git config/, "--file=$git_dir/config",
-                        'include.path', '../../all.git/config');
-        PublicInbox::Import::run_die(\@cmd);
+        run_die([qw(git config), "--file=$git_dir/config",
+                qw(include.path ../../all.git/config)]);
         fill_alternates($self, $epoch);
         $git_dir
 }
 
-sub git_dir_latest {
-        my ($self, $max) = @_;
-        $$max = -1;
-        my $pfx = "$self->{ibx}->{inboxdir}/git";
-        return unless -d $pfx;
-        my $latest;
-        opendir my $dh, $pfx or die "opendir $pfx: $!\n";
-        while (defined(my $git_dir = readdir($dh))) {
-                $git_dir =~ m!\A([0-9]+)\.git\z! or next;
-                if ($1 > $$max) {
-                        $$max = $1;
-                        $latest = "$pfx/$git_dir";
-                }
-        }
-        $latest;
-}
-
 sub importer {
         my ($self) = @_;
         my $im = $self->{im};
@@ -770,7 +756,7 @@ sub importer {
         }
         my $epoch = 0;
         my $max;
-        my $latest = git_dir_latest($self, \$max);
+        my $latest = $self->{ibx}->git_dir_latest(\$max);
         if (defined $latest) {
                 my $git = PublicInbox::Git->new($latest);
                 my $packed_bytes = $git->packed_bytes;
@@ -847,43 +833,62 @@ sub content_exists ($$$) {
 
 sub atfork_child {
         my ($self) = @_;
-        if (my $shards = $self->{idx_shards}) {
-                $_->atfork_child foreach @$shards;
+        if (my $older_siblings = $self->{idx_shards}) {
+                $_->ipc_sibling_atfork_child for @$older_siblings;
         }
         if (my $im = $self->{im}) {
                 $im->atfork_child;
         }
-        die "unexpected mm" if $self->{mm};
-        close $self->{bnote}->[0] or die "close bnote[0]: $!\n";
-        $self->{bnote}->[1];
+        die "BUG: unexpected mm" if $self->{mm};
 }
 
 sub reindex_checkpoint ($$) {
         my ($self, $sync) = @_;
 
-        $self->{ibx}->git->cleanup; # *async_wait
+        $self->git->async_wait_all;
+        $self->update_last_commit($sync);
         ${$sync->{need_checkpoint}} = 0;
         my $mm_tmp = $sync->{mm_tmp};
         $mm_tmp->atfork_prepare if $mm_tmp;
-        $self->done; # release lock
+        die 'BUG: {im} during reindex' if $self->{im};
+        if ($self->{ibx_map} && !$sync->{checkpoint_unlocks}) {
+                checkpoint($self, 1); # no need to release lock on pure index
+        } else {
+                $self->done; # release lock
+        }
 
-        if (my $pr = $sync->{-opt}->{-progress}) {
+        if (my $pr = $sync->{-regen_fmt} ? $sync->{-opt}->{-progress} : undef) {
                 $pr->(sprintf($sync->{-regen_fmt}, ${$sync->{nr}}));
         }
 
         # allow -watch or -mda to write...
         $self->idx_init($sync->{-opt}); # reacquire lock
+        if (my $intvl = $sync->{check_intvl}) { # eidx
+                $sync->{next_check} = PublicInbox::DS::now() + $intvl;
+        }
         $mm_tmp->atfork_parent if $mm_tmp;
 }
 
+sub index_finalize ($$) {
+        my ($arg, $index) = @_;
+        ++$arg->{self}->{nidx};
+        if (defined(my $cur = $arg->{cur_cmt})) {
+                ${$arg->{latest_cmt}} = $cur;
+        } elsif ($index) {
+                die 'BUG: {cur_cmt} missing';
+        } # else { unindexing @leftovers doesn't set {cur_cmt}
+}
+
 sub index_oid { # cat_async callback
         my ($bref, $oid, $type, $size, $arg) = @_;
-        return if $size == 0; # purged
+        is_bad_blob($oid, $type, $size, $arg->{oid}) and
+                return index_finalize($arg, 1); # size == 0 purged returns here
+        my $self = $arg->{self};
+        local $self->{current_info} = "$self->{current_info} $oid";
         my ($num, $mid0);
         my $eml = PublicInbox::Eml->new($$bref);
         my $mids = mids($eml);
         my $chash = content_hash($eml);
-        my $self = $arg->{v2w};
 
         if (scalar(@$mids) == 0) {
                 warn "E: $oid has no Message-ID, skipping\n";
@@ -891,12 +896,16 @@ sub index_oid { # cat_async callback
         }
 
         # {unindexed} is unlikely
-        if ((my $unindexed = $arg->{unindexed}) && scalar(@$mids) == 1) {
-                $num = delete($unindexed->{$mids->[0]});
+        if (my $unindexed = $arg->{unindexed}) {
+                my $oidbin = pack('H*', $oid);
+                my $u = $unindexed->{$oidbin};
+                ($num, $mid0) = splice(@$u, 0, 2) if $u;
                 if (defined $num) {
-                        $mid0 = $mids->[0];
                         $self->{mm}->mid_set($num, $mid0);
-                        delete($arg->{unindexed}) if !keys(%$unindexed);
+                        if (scalar(@$u) == 0) { # done with current OID
+                                delete $unindexed->{$oidbin};
+                                delete($arg->{unindexed}) if !keys(%$unindexed);
+                        }
                 }
         }
         if (!defined($num)) { # reuse if reindexing (or duplicates)
@@ -941,45 +950,48 @@ sub index_oid { # cat_async callback
         }
         ++${$arg->{nr}};
         my $smsg = bless {
-                raw_bytes => $size,
                 num => $num,
                 blob => $oid,
                 mid => $mid0,
         }, 'PublicInbox::Smsg';
         $smsg->populate($eml, $arg);
-        if (do_idx($self, $bref, $eml, $smsg)) {
+        $smsg->set_bytes($$bref, $size);
+        if (do_idx($self, $eml, $smsg)) {
                 ${$arg->{need_checkpoint}} = 1;
         }
+        index_finalize($arg, 1);
 }
 
 # only update last_commit for $i on reindex iff newer than current
-sub update_last_commit ($$$$) {
-        my ($self, $git, $i, $cmt) = @_;
-        my $last = last_epoch_commit($self, $i);
-        if (defined $last && is_ancestor($git, $last, $cmt)) {
-                my @cmd = (qw(rev-list --count), "$last..$cmt");
-                chomp(my $n = $git->qx(@cmd));
+sub update_last_commit {
+        my ($self, $sync, $stk) = @_;
+        my $unit = $sync->{unit} // return;
+        my $latest_cmt = $stk ? $stk->{latest_cmt} : ${$sync->{latest_cmt}};
+        defined($latest_cmt) or return;
+        my $last = last_epoch_commit($self, $unit->{epoch});
+        if (defined $last && is_ancestor($self->git, $last, $latest_cmt)) {
+                my @cmd = (qw(rev-list --count), "$last..$latest_cmt");
+                chomp(my $n = $unit->{git}->qx(@cmd));
                 return if $n ne '' && $n == 0;
         }
-        last_epoch_commit($self, $i, $cmt);
+        last_epoch_commit($self, $unit->{epoch}, $latest_cmt);
 }
 
-sub git_dir_n ($$) { "$_[0]->{ibx}->{inboxdir}/git/$_[1].git" }
-
-sub last_commits ($$) {
-        my ($self, $epoch_max) = @_;
+sub last_commits {
+        my ($self, $sync) = @_;
         my $heads = [];
-        for (my $i = $epoch_max; $i >= 0; $i--) {
+        for (my $i = $sync->{epoch_max}; $i >= 0; $i--) {
                 $heads->[$i] = last_epoch_commit($self, $i);
         }
         $heads;
 }
 
 # returns a revision range for git-log(1)
-sub log_range ($$$$$) {
-        my ($self, $sync, $git, $i, $tip) = @_;
+sub log_range ($$$) {
+        my ($sync, $unit, $tip) = @_;
         my $opt = $sync->{-opt};
         my $pr = $opt->{-progress} if (($opt->{verbose} || 0) > 1);
+        my $i = $unit->{epoch};
         my $cur = $sync->{ranges}->[$i] or do {
                 $pr->("$i.git indexing all of $tip\n") if $pr;
                 return $tip; # all of it
@@ -993,7 +1005,8 @@ sub log_range ($$$$$) {
 
         my $range = "$cur..$tip";
         $pr->("$i.git checking contiguity... ") if $pr;
-        if (is_ancestor($git, $cur, $tip)) { # common case
+        my $git = $unit->{git};
+        if (is_ancestor($sync->{self}->git, $cur, $tip)) { # common case
                 $pr->("OK\n") if $pr;
                 my $n = $git->qx(qw(rev-list --count), $range);
                 chomp($n);
@@ -1018,63 +1031,103 @@ Rewritten history? (in $git->{git_dir})
                         warn "discarding history at $cur\n";
                 }
                 warn <<"";
-reindexing $git->{git_dir} starting at
-$range
-
-                $sync->{unindex_range}->{$i} = "$base..$cur";
+reindexing $git->{git_dir}
+starting at $range
+
+                # $cur^0 may no longer exist if pruned by git
+                if ($git->qx(qw(rev-parse -q --verify), "$cur^0")) {
+                        $unit->{unindex_range} = "$base..$cur";
+                } elsif ($base && $git->qx(qw(rev-parse -q --verify), $base)) {
+                        $unit->{unindex_range} = "$base..";
+                } else {
+                        warn "W: unable to unindex before $range\n";
+                }
         }
         $range;
 }
 
-sub sync_prepare ($$$) {
-        my ($self, $sync, $epoch_max) = @_;
+# overridden by ExtSearchIdx
+sub artnum_max { $_[0]->{mm}->num_highwater }
+
+sub sync_prepare ($$) {
+        my ($self, $sync) = @_;
+        $sync->{ranges} = sync_ranges($self, $sync);
         my $pr = $sync->{-opt}->{-progress};
         my $regen_max = 0;
-        my $head = $self->{ibx}->{ref_head} || 'refs/heads/master';
-
-        # reindex stops at the current heads and we later rerun index_sync
-        # without {reindex}
-        my $reindex_heads = last_commits($self, $epoch_max) if $sync->{reindex};
-
-        for (my $i = $epoch_max; $i >= 0; $i--) {
-                my $git_dir = git_dir_n($self, $i);
+        my $head = $sync->{ibx}->{ref_head} || 'HEAD';
+        my $pfx;
+        if ($pr) {
+                ($pfx) = ($sync->{ibx}->{inboxdir} =~ m!([^/]+)\z!g);
+                $pfx //= $sync->{ibx}->{inboxdir};
+        }
+
+        my $reindex_heads;
+        if ($self->{ibx_map}) {
+                # ExtSearchIdx won't index messages unless they're in
+                # over.sqlite3 for a given inbox, so don't read beyond
+                # what's in the per-inbox index.
+                $reindex_heads = [];
+                my $v = PublicInbox::Search::SCHEMA_VERSION;
+                my $mm = $sync->{ibx}->mm;
+                for my $i (0..$sync->{epoch_max}) {
+                        $reindex_heads->[$i] = $mm->last_commit_xap($v, $i);
+                }
+        } elsif ($sync->{reindex}) { # V2 inbox
+                # reindex stops at the current heads and we later
+                # rerun index_sync without {reindex}
+                $reindex_heads = $self->last_commits($sync);
+        }
+        if ($sync->{max_size} = $sync->{-opt}->{max_size}) {
+                $sync->{index_oid} = $self->can('index_oid');
+        }
+        my $git_pfx = "$sync->{ibx}->{inboxdir}/git";
+        for (my $i = $sync->{epoch_max}; $i >= 0; $i--) {
+                my $git_dir = "$git_pfx/$i.git";
                 -d $git_dir or next; # missing epochs are fine
                 my $git = PublicInbox::Git->new($git_dir);
+                my $unit = { git => $git, epoch => $i };
+                my $tip;
                 if ($reindex_heads) {
-                        $head = $reindex_heads->[$i] or next;
+                        $tip = $head = $reindex_heads->[$i] or next;
+                } else {
+                        $tip = $git->qx(qw(rev-parse -q --verify), $head);
+                        next if $?; # new repo
+                        chomp $tip;
                 }
-                chomp(my $tip = $git->qx(qw(rev-parse -q --verify), $head));
-
-                next if $?; # new repo
-                my $range = log_range($self, $sync, $git, $i, $tip) or next;
+                my $range = log_range($sync, $unit, $tip) or next;
                 # can't use 'rev-list --count' if we use --diff-filter
-                $pr->("$i.git counting $range ... ") if $pr;
+                $pr->("$pfx $i.git counting $range ... ") if $pr;
                 # Don't bump num_highwater on --reindex by using {D}.
                 # We intentionally do NOT use {D} in the non-reindex case
                 # because we want NNTP article number gaps from unindexed
                 # messages to show up in mirrors, too.
                 $sync->{D} //= $sync->{reindex} ? {} : undef; # OID_BIN => NR
-                my $stk = log2stack($sync, $git, $range, $self->{ibx});
+                my $stk = log2stack($sync, $git, $range);
+                return 0 if $sync->{quit};
                 my $nr = $stk ? $stk->num_records : 0;
                 $pr->("$nr\n") if $pr;
-                $sync->{stacks}->[$i] = $stk if $stk;
+                $unit->{stack} = $stk; # may be undef
+                unshift @{$sync->{todo}}, $unit;
                 $regen_max += $nr;
         }
+        return 0 if $sync->{quit};
 
         # XXX this should not happen unless somebody bypasses checks in
         # our code and blindly injects "d" file history into git repos
         if (my @leftovers = keys %{delete($sync->{D}) // {}}) {
                 warn('W: unindexing '.scalar(@leftovers)." leftovers\n");
-                my $arg = { v2w => $self };
-                my $all = $self->{ibx}->git;
+                local $self->{current_info} = 'leftover ';
+                my $unindex_oid = $self->can('unindex_oid');
                 for my $oid (@leftovers) {
+                        last if $sync->{quit};
                         $oid = unpack('H*', $oid);
-                        $self->{current_info} = "leftover $oid";
-                        $all->cat_async($oid, \&unindex_oid, $arg);
+                        my $req = { %$sync, oid => $oid };
+                        $self->git->cat_async($oid, $unindex_oid, $req);
                 }
-                $all->cat_async_wait;
+                $self->git->cat_async_wait;
         }
-        if (!$regen_max && !keys(%{$self->{unindex_range}})) {
+        return 0 if $sync->{quit};
+        if (!$regen_max) {
                 $sync->{-regen_fmt} = "%u/?\n";
                 return 0;
         }
@@ -1085,22 +1138,25 @@ sub sync_prepare ($$$) {
         $sync->{-regen_fmt} = "% ${pad}u/$regen_max\n";
         $sync->{nr} = \(my $nr = 0);
         return -1 if $sync->{reindex};
-        $regen_max + $self->{mm}->num_highwater() || 0;
+        $regen_max + $self->artnum_max || 0;
 }
 
-sub unindex_oid_remote ($$$) {
+sub unindex_oid_aux ($$$) {
         my ($self, $oid, $mid) = @_;
         my @removed = $self->{oidx}->remove_oid($oid, $mid);
+        return unless $self->{-need_xapian};
         for my $num (@removed) {
-                my $idx = idx_shard($self, $num % $self->{shards});
-                $idx->shard_remove($oid, $num);
+                idx_shard($self, $num)->ipc_do('xdb_remove', $num);
         }
 }
 
 sub unindex_oid ($$;$) { # git->cat_async callback
-        my ($bref, $oid, $type, $size, $sync) = @_;
-        my $self = $sync->{v2w};
-        my $unindexed = $sync->{in_unindex} ? $sync->{unindexed} : undef;
+        my ($bref, $oid, $type, $size, $arg) = @_;
+        is_bad_blob($oid, $type, $size, $arg->{oid}) and
+                return index_finalize($arg, 0);
+        my $self = $arg->{self};
+        local $self->{current_info} = "$self->{current_info} $oid";
+        my $unindexed = $arg->{in_unindex} ? $arg->{unindexed} : undef;
         my $mm = $self->{mm};
         my $mids = mids(PublicInbox::Eml->new($bref));
         undef $$bref;
@@ -1116,50 +1172,55 @@ sub unindex_oid ($$;$) { # git->cat_async callback
                         warn "BUG: multiple articles linked to $oid\n",
                                 join(',',sort keys %gone), "\n";
                 }
-                foreach my $num (keys %gone) {
+                # reuse (num => mid) mapping in ascending numeric order
+                for my $num (sort { $a <=> $b } keys %gone) {
+                        $num += 0;
                         if ($unindexed) {
                                 my $mid0 = $mm->mid_for($num);
-                                $unindexed->{$mid0} = $num;
+                                my $oidbin = pack('H*', $oid);
+                                push @{$unindexed->{$oidbin}}, $num, $mid0;
                         }
                         $mm->num_delete($num);
                 }
-                unindex_oid_remote($self, $oid, $mid);
+                unindex_oid_aux($self, $oid, $mid);
         }
+        index_finalize($arg, 0);
 }
 
+sub git { $_[0]->{ibx}->git }
+
 # this is rare, it only happens when we get discontiguous history in
 # a mirror because the source used -purge or -edit
-sub unindex ($$$$) {
-        my ($self, $sync, $git, $unindex_range) = @_;
-        my $unindexed = $sync->{unindexed} //= {}; # $mid0 => $num
+sub unindex_todo ($$$) {
+        my ($self, $sync, $unit) = @_;
+        my $unindex_range = delete($unit->{unindex_range}) // return;
+        my $unindexed = $sync->{unindexed} //= {}; # $oidbin => [$num, $mid0]
         my $before = scalar keys %$unindexed;
         # order does not matter, here:
-        my @cmd = qw(log --raw -r
-                        --no-notes --no-color --no-abbrev --no-renames);
-        my $fh = $git->popen(@cmd, $unindex_range);
-        my $all = $self->{ibx}->git;
+        my $fh = $unit->{git}->popen(qw(log --raw -r --no-notes --no-color
+                                --no-abbrev --no-renames), $unindex_range);
         local $sync->{in_unindex} = 1;
+        my $unindex_oid = $self->can('unindex_oid');
         while (<$fh>) {
                 /\A:\d{6} 100644 $OID ($OID) [AM]\tm$/o or next;
-                $all->cat_async($1, \&unindex_oid, $sync);
+                $self->git->cat_async($1, $unindex_oid, { %$sync, oid => $1 });
         }
         close $fh or die "git log failed: \$?=$?";
-        $all->cat_async_wait;
+        $self->git->cat_async_wait;
 
         return unless $sync->{-opt}->{prune};
         my $after = scalar keys %$unindexed;
         return if $before == $after;
 
         # ensure any blob can not longer be accessed via dumb HTTP
-        PublicInbox::Import::run_die(['git', "--git-dir=$git->{git_dir}",
+        run_die(['git', "--git-dir=$unit->{git}->{git_dir}",
                 qw(-c gc.reflogExpire=now gc --prune=all --quiet)]);
 }
 
-sub sync_ranges ($$$) {
-        my ($self, $sync, $epoch_max) = @_;
+sub sync_ranges ($$) {
+        my ($self, $sync) = @_;
         my $reindex = $sync->{reindex};
-
-        return last_commits($self, $epoch_max) unless $reindex;
+        return $self->last_commits($sync) unless $reindex;
         return [] if ref($reindex) ne 'HASH';
 
         my $ranges = $reindex->{from}; # arrayref;
@@ -1171,11 +1232,10 @@ sub sync_ranges ($$$) {
 
 sub index_xap_only { # git->cat_async callback
         my ($bref, $oid, $type, $size, $smsg) = @_;
-        my $self = $smsg->{v2w};
-        my $idx = idx_shard($self, $smsg->{num} % $self->{shards});
-        $smsg->{raw_bytes} = $size;
-        $idx->index_raw($bref, undef, $smsg);
-        $self->{transact_bytes} += $size;
+        my $self = $smsg->{self};
+        my $idx = idx_shard($self, $smsg->{num});
+        $idx->index_eml(PublicInbox::Eml->new($bref), $smsg);
+        $self->{transact_bytes} += $smsg->{bytes};
 }
 
 sub index_xap_step ($$$;$) {
@@ -1190,8 +1250,9 @@ sub index_xap_step ($$$;$) {
                         "$beg..$end (% $step)\n");
         }
         for (my $num = $beg; $num <= $end; $num += $step) {
+                last if $sync->{quit};
                 my $smsg = $ibx->over->get_art($num) or next;
-                $smsg->{v2w} = $self;
+                $smsg->{self} = $self;
                 $ibx->git->cat_async($smsg->{blob}, \&index_xap_only, $smsg);
                 if ($self->{transact_bytes} >= $self->{batch_bytes}) {
                         ${$sync->{nr}} = $num;
@@ -1200,37 +1261,53 @@ sub index_xap_step ($$$;$) {
         }
 }
 
-sub index_epoch ($$$) {
-        my ($self, $sync, $i) = @_;
-
-        my $git_dir = git_dir_n($self, $i);
-        -d $git_dir or return; # missing epochs are fine
-        my $git = PublicInbox::Git->new($git_dir);
-        if (my $unindex_range = delete $sync->{unindex_range}->{$i}) { # rare
-                unindex($self, $sync, $git, $unindex_range);
-        }
-        defined(my $stk = $sync->{stacks}->[$i]) or return;
-        $sync->{stacks}->[$i] = undef;
-        my $all = $self->{ibx}->git;
-        while (my ($f, $at, $ct, $oid) = $stk->pop_rec) {
-                $self->{current_info} = "$i.git $oid";
+sub index_todo ($$$) {
+        my ($self, $sync, $unit) = @_;
+        return if $sync->{quit};
+        unindex_todo($self, $sync, $unit);
+        my $stk = delete($unit->{stack}) or return;
+        my $all = $self->git;
+        my $index_oid = $self->can('index_oid');
+        my $unindex_oid = $self->can('unindex_oid');
+        my $pfx;
+        if ($unit->{git}->{git_dir} =~ m!/([^/]+)/git/([0-9]+\.git)\z!) {
+                $pfx = "$1 $2"; # v2
+        } else { # v1
+                ($pfx) = ($unit->{git}->{git_dir} =~ m!/([^/]+)\z!g);
+                $pfx //= $unit->{git}->{git_dir};
+        }
+        local $self->{current_info} = "$pfx ";
+        local $sync->{latest_cmt} = \(my $latest_cmt);
+        local $sync->{unit} = $unit;
+        while (my ($f, $at, $ct, $oid, $cmt) = $stk->pop_rec) {
+                if ($sync->{quit}) {
+                        warn "waiting to quit...\n";
+                        $all->async_wait_all;
+                        $self->update_last_commit($sync);
+                        return;
+                }
+                my $req = {
+                        %$sync,
+                        autime => $at,
+                        cotime => $ct,
+                        oid => $oid,
+                        cur_cmt => $cmt
+                };
                 if ($f eq 'm') {
-                        my $arg = { %$sync, autime => $at, cotime => $ct };
                         if ($sync->{max_size}) {
-                                $all->check_async($oid, \&check_size, $arg);
+                                $all->check_async($oid, \&check_size, $req);
                         } else {
-                                $all->cat_async($oid, \&index_oid, $arg);
+                                $all->cat_async($oid, $index_oid, $req);
                         }
                 } elsif ($f eq 'd') {
-                        $all->cat_async($oid, \&unindex_oid, $sync);
+                        $all->cat_async($oid, $unindex_oid, $req);
                 }
                 if (${$sync->{need_checkpoint}}) {
                         reindex_checkpoint($self, $sync);
                 }
         }
-        $all->check_async_wait;
-        $all->cat_async_wait;
-        update_last_commit($self, $git, $i, $stk->{latest_cmt});
+        $all->async_wait_all;
+        $self->update_last_commit($sync, $stk);
 }
 
 sub xapian_only {
@@ -1243,7 +1320,7 @@ sub xapian_only {
                 $sync //= {
                         need_checkpoint => \(my $bool = 0),
                         -opt => $opt,
-                        v2w => $self,
+                        self => $self,
                         nr => \(my $nr = 0),
                         -regen_fmt => "%u/?\n",
                 };
@@ -1251,6 +1328,7 @@ sub xapian_only {
                 if ($seq || !$self->{parallel}) {
                         my $shard_end = $self->{shards} - 1;
                         for my $i (0..$shard_end) {
+                                last if $sync->{quit};
                                 index_xap_step($self, $sync, $art_beg + $i);
                                 if ($i != $shard_end) {
                                         reindex_checkpoint($self, $sync);
@@ -1260,7 +1338,7 @@ sub xapian_only {
                         index_xap_step($self, $sync, $art_beg, 1);
                 }
         }
-        $self->{ibx}->git->cat_async_wait;
+        $self->git->cat_async_wait;
         $self->done;
 }
 
@@ -1270,11 +1348,19 @@ sub index_sync {
         $opt //= {};
         return xapian_only($self, $opt) if $opt->{xapian_only};
 
-        my $pr = $opt->{-progress};
         my $epoch_max;
-        my $latest = git_dir_latest($self, \$epoch_max);
-        return unless defined $latest;
+        my $latest = $self->{ibx}->git_dir_latest(\$epoch_max) // return;
+        if ($opt->{'fast-noop'}) { # nanosecond (st_ctim) comparison
+                use Time::HiRes qw(stat);
+                if (my @mm = stat("$self->{ibx}->{inboxdir}/msgmap.sqlite3")) {
+                        my $c = $mm[10]; # 10 = ctime (nsec NV)
+                        my @hd = stat("$latest/refs/heads");
+                        my @pr = stat("$latest/packed-refs");
+                        return if $c > ($hd[10] // 0) && $c > ($pr[10] // 0);
+                }
+        }
 
+        my $pr = $opt->{-progress};
         my $seq = $opt->{sequential_shard};
         my $art_beg; # the NNTP article number we start xapian_only at
         my $idxlevel = $self->{ibx}->{indexlevel};
@@ -1285,13 +1371,18 @@ sub index_sync {
         $self->{oidx}->rethread_prepare($opt);
         my $sync = {
                 need_checkpoint => \(my $bool = 0),
-                unindex_range => {}, # EPOCH => oid_old..oid_new
                 reindex => $opt->{reindex},
                 -opt => $opt,
-                v2w => $self,
+                self => $self,
+                ibx => $self->{ibx},
+                epoch_max => $epoch_max,
         };
-        $sync->{ranges} = sync_ranges($self, $sync, $epoch_max);
-        if (sync_prepare($self, $sync, $epoch_max)) {
+        my $quit = PublicInbox::SearchIdx::quit_cb($sync);
+        local $SIG{QUIT} = $quit;
+        local $SIG{INT} = $quit;
+        local $SIG{TERM} = $quit;
+
+        if (sync_prepare($self, $sync)) {
                 # tmp_clone seems to fail if inside a transaction, so
                 # we rollback here (because we opened {mm} for reading)
                 # Note: we do NOT rely on DBI transactions for atomicity;
@@ -1303,16 +1394,13 @@ sub index_sync {
 
                 # xapian_only works incrementally w/o --reindex
                 if ($seq && !$opt->{reindex}) {
-                        $art_beg = $sync->{mm_tmp}->max;
-                        $art_beg++ if defined($art_beg);
+                        $art_beg = $sync->{mm_tmp}->max || -1;
+                        $art_beg++;
                 }
         }
-        if ($sync->{max_size} = $opt->{max_size}) {
-                $sync->{index_oid} = \&index_oid;
-        }
         # work forwards through history
-        index_epoch($self, $sync, $_) for (0..$epoch_max);
-        $self->{oidx}->rethread_done($opt);
+        index_todo($self, $sync, $_) for @{delete($sync->{todo}) // []};
+        $self->{oidx}->rethread_done($opt) unless $sync->{quit};
         $self->done;
 
         if (my $nr = $sync->{nr}) {
@@ -1320,14 +1408,21 @@ sub index_sync {
                 $pr->('all.git '.sprintf($sync->{-regen_fmt}, $$nr)) if $pr;
         }
 
+        my $quit_warn;
         # deal with Xapian shards sequentially
         if ($seq && delete($sync->{mm_tmp})) {
-                $self->{ibx}->{indexlevel} = $idxlevel;
-                xapian_only($self, $opt, $sync, $art_beg);
+                if ($sync->{quit}) {
+                        $quit_warn = 1;
+                } else {
+                        $self->{ibx}->{indexlevel} = $idxlevel;
+                        xapian_only($self, $opt, $sync, $art_beg);
+                        $quit_warn = 1 if $sync->{quit};
+                }
         }
 
         # --reindex on the command-line
-        if ($opt->{reindex} && !ref($opt->{reindex}) && $idxlevel ne 'basic') {
+        if (!$sync->{quit} && $opt->{reindex} &&
+                        !ref($opt->{reindex}) && $idxlevel ne 'basic') {
                 $self->lock_acquire;
                 my $s0 = PublicInbox::SearchIdx->new($self->{ibx}, 0, 0);
                 if (my $xdb = $s0->idx_acquire) {
@@ -1339,12 +1434,16 @@ sub index_sync {
         }
 
         # reindex does not pick up new changes, so we rerun w/o it:
-        if ($opt->{reindex}) {
+        if ($opt->{reindex} && !$sync->{quit}) {
                 my %again = %$opt;
                 $sync = undef;
                 delete @again{qw(rethread reindex -skip_lock)};
                 index_sync($self, \%again);
+                $opt->{quit} = $again{quit}; # propagate to caller
         }
+        warn <<EOF if $quit_warn;
+W: interrupted, --xapian-only --reindex required upon restart
+EOF
 }
 
 1;
diff --git a/lib/PublicInbox/View.pm b/lib/PublicInbox/View.pm
index 1d5119cd..eee6ae33 100644
--- a/lib/PublicInbox/View.pm
+++ b/lib/PublicInbox/View.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used for displaying the HTML web interface.
@@ -48,7 +48,7 @@ sub msg_page_i {
 # /$INBOX/$MSGID/ for unindexed v1 inboxes
 sub no_over_html ($) {
         my ($ctx) = @_;
-        my $bref = $ctx->{-inbox}->msg_by_mid($ctx->{mid}) or return; # 404
+        my $bref = $ctx->{ibx}->msg_by_mid($ctx->{mid}) or return; # 404
         my $eml = PublicInbox::Eml->new($bref);
         $ctx->{mhref} = '';
         PublicInbox::WwwStream::init($ctx);
@@ -64,7 +64,7 @@ sub no_over_html ($) {
 
 sub msg_page {
         my ($ctx) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         $ctx->{-obfs_ibx} = $ibx->{obfuscate} ? $ibx : undef;
         my $over = $ctx->{over} = $ibx->over or return no_over_html($ctx);
         my ($id, $prev);
@@ -88,7 +88,7 @@ sub msg_reply ($$) {
          'https://en.wikipedia.org/wiki/Posting_style#Interleaved_style';
 
         my $info = '';
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         if (my $url = $ibx->{infourl}) {
                 $url = prurl($ctx->{env}, $url);
                 $info = qq(\n  List information: <a\nhref="$url">$url</a>\n);
@@ -421,7 +421,7 @@ sub stream_thread ($$) {
 sub thread_html {
         my ($ctx) = @_;
         my $mid = $ctx->{mid};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my ($nr, $msgs) = $ibx->over->get_thread($mid);
         return missing_thread($ctx) if $nr == 0;
 
@@ -554,7 +554,7 @@ EOF
 sub add_text_body { # callback for each_part
         my ($p, $ctx) = @_;
         my $upfx = $ctx->{mhref};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $l = $ctx->{-linkify} //= PublicInbox::Linkify->new;
         # $p - from each_part: [ Email::MIME-like, depth, $idx ]
         my ($part, $depth, $idx) = @$p;
@@ -639,7 +639,7 @@ sub add_text_body { # callback for each_part
 
 sub _msg_page_prepare_obuf {
         my ($eml, $ctx) = @_;
-        my $over = $ctx->{-inbox}->over;
+        my $over = $ctx->{ibx}->over;
         my $obfs_ibx = $ctx->{-obfs_ibx};
         my $rv = '';
         my $mids = mids_for_index($eml);
@@ -729,7 +729,7 @@ sub SKEL_EXPAND () {
 sub thread_skel ($$$) {
         my ($skel, $ctx, $hdr) = @_;
         my $mid = mids($hdr)->[0];
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my ($nr, $msgs) = $ibx->over->get_thread($mid);
         my $parent = in_reply_to($hdr);
         $$skel .= "\n<b>Thread overview: </b>";
@@ -800,7 +800,7 @@ sub _parent_headers {
 # returns a string buffer
 sub html_footer {
         my ($ctx, $hdr) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $upfx = '../';
         my $skel;
         my $rv = '<pre>';
@@ -1072,7 +1072,7 @@ sub acc_topic { # walk_thread callback
         my ($ctx, $level, $smsg) = @_;
         my $mid = $smsg->{mid};
         my $has_blob = $smsg->{blob} // do {
-                if (my $by_mid = $ctx->{-inbox}->smsg_by_mid($mid)) {
+                if (my $by_mid = $ctx->{ibx}->smsg_by_mid($mid)) {
                         %$smsg = (%$smsg, %$by_mid);
                         1;
                 }
@@ -1116,7 +1116,7 @@ sub dump_topics {
         }
 
         my @out;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $obfs_ibx = $ibx->{obfuscate} ? $ibx : undef;
 
         # sort by recency, this allows new posts to "bump" old topics...
@@ -1194,7 +1194,7 @@ sub paginate_recent ($$) {
         $t =~ s/\A([0-9]{8,14})-// and $after = str2ts($1);
         $t =~ /\A([0-9]{8,14})\z/ and $before = str2ts($1);
 
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $msgs = $ibx->recent($opts, $after, $before);
         my $nr = scalar @$msgs;
         if ($nr < $lim && defined($after)) {
diff --git a/lib/PublicInbox/ViewDiff.pm b/lib/PublicInbox/ViewDiff.pm
index 7ec57d8d..8fe7261f 100644
--- a/lib/PublicInbox/ViewDiff.pm
+++ b/lib/PublicInbox/ViewDiff.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # used by PublicInbox::View
diff --git a/lib/PublicInbox/ViewVCS.pm b/lib/PublicInbox/ViewVCS.pm
index 87927d5e..702a075d 100644
--- a/lib/PublicInbox/ViewVCS.pm
+++ b/lib/PublicInbox/ViewVCS.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # show any VCS object, similar to "git show"
@@ -197,7 +197,7 @@ sub show ($$;$) {
 
         $ctx->{'log'} = tmpfile("solve.$oid_b");
         $ctx->{fn} = $fn;
-        my $solver = PublicInbox::SolverGit->new($ctx->{-inbox},
+        my $solver = PublicInbox::SolverGit->new($ctx->{ibx},
                                                 \&solve_result, $ctx);
         # PSGI server will call this immediately and give us a callback (-wcb)
         sub {
diff --git a/lib/PublicInbox/WWW.pm b/lib/PublicInbox/WWW.pm
index 37f55347..500021d4 100644
--- a/lib/PublicInbox/WWW.pm
+++ b/lib/PublicInbox/WWW.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Main web interface for mailing list archives
@@ -32,9 +32,8 @@ our $ATTACH_RE = qr!([0-9][0-9\.]*)-($PublicInbox::Hval::FN)!;
 our $OID_RE = qr![a-f0-9]{7,}!;
 
 sub new {
-        my ($class, $pi_config) = @_;
-        $pi_config ||= PublicInbox::Config->new;
-        bless { pi_config => $pi_config }, $class;
+        my ($class, $pi_cfg) = @_;
+        bless { pi_cfg => $pi_cfg // PublicInbox::Config->new }, $class;
 }
 
 # backwards compatibility, do not use
@@ -169,14 +168,14 @@ sub preload {
                 eval "require PublicInbox::$_;";
         }
         if (ref($self)) {
-                my $pi_config = $self->{pi_config};
-                if (defined($pi_config->{'publicinbox.cgitrc'})) {
-                        $pi_config->limiter('-cgit');
+                my $pi_cfg = $self->{pi_cfg};
+                if (defined($pi_cfg->{'publicinbox.cgitrc'})) {
+                        $pi_cfg->limiter('-cgit');
                 }
                 $self->cgit;
                 $self->stylesheets_prepare($_) for ('', '../', '../../');
                 $self->news_www;
-                $pi_config->each_inbox(\&preload_inbox);
+                $pi_cfg->each_inbox(\&preload_inbox);
         }
 }
 
@@ -210,9 +209,10 @@ sub news_cgit_fallback ($) {
 # returns undef if valid, array ref response if invalid
 sub invalid_inbox ($$) {
         my ($ctx, $inbox) = @_;
-        my $ibx = $ctx->{www}->{pi_config}->lookup_name($inbox);
+        my $ibx = $ctx->{www}->{pi_cfg}->lookup_name($inbox) //
+                        $ctx->{www}->{pi_cfg}->lookup_ei($inbox);
         if (defined $ibx) {
-                $ctx->{-inbox} = $ibx;
+                $ctx->{ibx} = $ibx;
                 return;
         }
 
@@ -230,11 +230,11 @@ sub invalid_inbox_mid {
         return $ret if $ret;
 
         my $mid = $ctx->{mid} = uri_unescape($mid_ue);
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         if ($mid =~ m!\A([a-f0-9]{2})([a-f0-9]{38})\z!) {
                 my ($x2, $x38) = ($1, $2);
                 # this is horrifically wasteful for legacy URLs:
-                my $str = $ctx->{-inbox}->msg_by_path("$x2/$x38") or return;
+                my $str = $ctx->{ibx}->msg_by_path("$x2/$x38") or return;
                 my $s = PublicInbox::Eml->new($str);
                 $mid = PublicInbox::MID::mid_clean($s->header_raw('Message-ID'));
                 return r301($ctx, $inbox, mid_escape($mid));
@@ -285,7 +285,7 @@ sub get_mid_html {
 # /$INBOX/$MESSAGE_ID/t/
 sub get_thread {
         my ($ctx, $flat) = @_;
-        $ctx->{-inbox}->over or return need($ctx, 'Overview');
+        $ctx->{ibx}->over or return need($ctx, 'Overview');
         $ctx->{flat} = $flat;
         require PublicInbox::View;
         PublicInbox::View::thread_html($ctx);
@@ -338,7 +338,7 @@ EOF
 # especially on older systems.  Stick to zlib since that's what git uses.
 sub get_thread_mbox {
         my ($ctx, $sfx) = @_;
-        my $over = $ctx->{-inbox}->over or return need($ctx, 'Overview');
+        my $over = $ctx->{ibx}->over or return need($ctx, 'Overview');
         require PublicInbox::Mbox;
         PublicInbox::Mbox::thread_mbox($ctx, $over, $sfx);
 }
@@ -347,7 +347,7 @@ sub get_thread_mbox {
 # /$INBOX/$MESSAGE_ID/t.atom                  -> thread as Atom feed
 sub get_thread_atom {
         my ($ctx) = @_;
-        $ctx->{-inbox}->over or return need($ctx, 'Overview');
+        $ctx->{ibx}->over or return need($ctx, 'Overview');
         require PublicInbox::Feed;
         PublicInbox::Feed::generate_thread_atom($ctx);
 }
@@ -412,11 +412,11 @@ sub legacy_redirects {
 
 sub r301 {
         my ($ctx, $inbox, $mid_ue, $suffix) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         unless ($ibx) {
                 my $r404 = invalid_inbox($ctx, $inbox);
                 return $r404 if $r404;
-                $ibx = $ctx->{-inbox};
+                $ibx = $ctx->{ibx};
         }
         my $url = $ibx->base_url($ctx->{env});
         my $qs = $ctx->{env}->{QUERY_STRING};
@@ -453,7 +453,7 @@ sub msg_page {
 sub serve_git {
         my ($ctx, $epoch, $path) = @_;
         my $env = $ctx->{env};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $git = defined $epoch ? $ibx->git_epoch($epoch) : $ibx->git;
         $git ? PublicInbox::GitHTTPBackend::serve($env, $git, $path) : r404();
 }
@@ -461,7 +461,7 @@ sub serve_git {
 sub mbox_results {
         my ($ctx) = @_;
         if ($ctx->{env}->{QUERY_STRING} =~ /(?:\A|[&;])q=/) {
-                $ctx->{-inbox}->search or return need($ctx, 'search');
+                $ctx->{ibx}->isrch or return need($ctx, 'search');
                 require PublicInbox::SearchView;
                 return PublicInbox::SearchView::mbox_results($ctx);
         }
@@ -480,18 +480,18 @@ sub news_www {
         my ($self) = @_;
         $self->{news_www} ||= do {
                 require PublicInbox::NewsWWW;
-                PublicInbox::NewsWWW->new($self->{pi_config});
+                PublicInbox::NewsWWW->new($self->{pi_cfg});
         }
 }
 
 sub cgit {
         my ($self) = @_;
         $self->{cgit} ||= do {
-                my $pi_config = $self->{pi_config};
+                my $pi_cfg = $self->{pi_cfg};
 
-                if (defined($pi_config->{'publicinbox.cgitrc'})) {
+                if (defined($pi_cfg->{'publicinbox.cgitrc'})) {
                         require PublicInbox::Cgit;
-                        PublicInbox::Cgit->new($pi_config);
+                        PublicInbox::Cgit->new($pi_cfg);
                 } else {
                         require Plack::Util;
                         Plack::Util::inline_object(call => sub { r404() });
@@ -537,7 +537,7 @@ sub stylesheets_prepare ($$) {
         } || sub { $_[0] };
 
         my $css_map = {};
-        my $stylesheets = $self->{pi_config}->{css} || [];
+        my $stylesheets = $self->{pi_cfg}->{css} || [];
         my $links = [];
         my $inline_ok = 1;
 
@@ -641,7 +641,7 @@ sub get_css ($$$) {
         my $css = $css_map->{$key};
         if (!defined($css) && $key eq 'userContent') {
                 my $env = $ctx->{env};
-                $css = PublicInbox::UserContent::sample($ctx->{-inbox}, $env);
+                $css = PublicInbox::UserContent::sample($ctx->{ibx}, $env);
         }
         defined $css or return r404();
         my $h = [ 'Content-Length', bytes::length($css),
@@ -653,7 +653,7 @@ sub get_css ($$$) {
 sub get_description {
         my ($ctx, $inbox) = @_;
         invalid_inbox($ctx, $inbox) || do {
-                my $d = $ctx->{-inbox}->description . "\n";
+                my $d = $ctx->{ibx}->description . "\n";
                 [ 200, [ 'Content-Length', bytes::length($d),
                         'Content-Type', 'text/plain' ], [ $d ] ];
         };
diff --git a/lib/PublicInbox/WWW.pod b/lib/PublicInbox/WWW.pod
index 30fe602d..276dfc4c 100644
--- a/lib/PublicInbox/WWW.pod
+++ b/lib/PublicInbox/WWW.pod
@@ -47,7 +47,7 @@ and L<http://hjrcffqmbrq6wope.onion/meta/>
 
 =head1 COPYRIGHT
 
-Copyright (C) 2016-2020 all contributors L<mailto:meta@public-inbox.org>
+Copyright (C) 2016-2021 all contributors L<mailto:meta@public-inbox.org>
 
 License: AGPL-3.0+ L<http://www.gnu.org/licenses/agpl-3.0.txt>
 
diff --git a/lib/PublicInbox/Watch.pm b/lib/PublicInbox/Watch.pm
index 8bbce929..1de5018d 100644
--- a/lib/PublicInbox/Watch.pm
+++ b/lib/PublicInbox/Watch.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # ref: https://cr.yp.to/proto/maildir.html
@@ -41,7 +41,7 @@ sub compile_watchheaders ($) {
 }
 
 sub new {
-        my ($class, $config) = @_;
+        my ($class, $cfg) = @_;
         my (%mdmap, $spamc);
         my (%imap, %nntp); # url => [inbox objects] or 'watchspam'
 
@@ -50,7 +50,7 @@ sub new {
         # indefinitely...
         foreach my $pfx (qw(publicinboxwatch publicinboxlearn)) {
                 my $k = "$pfx.watchspam";
-                defined(my $dirs = $config->{$k}) or next;
+                defined(my $dirs = $cfg->{$k}) or next;
                 $dirs = PublicInbox::Config::_array($dirs);
                 for my $dir (@$dirs) {
                         my $url;
@@ -69,10 +69,10 @@ sub new {
 
         my $k = 'publicinboxwatch.spamcheck';
         my $default = undef;
-        my $spamcheck = PublicInbox::Spamcheck::get($config, $k, $default);
+        my $spamcheck = PublicInbox::Spamcheck::get($cfg, $k, $default);
         $spamcheck = _spamcheck_cb($spamcheck) if $spamcheck;
 
-        $config->each_inbox(sub {
+        $cfg->each_inbox(sub {
                 # need to make all inboxes writable for spam removal:
                 my $ibx = $_[0] = PublicInbox::InboxWritable->new($_[0]);
 
@@ -113,7 +113,7 @@ sub new {
                 spamcheck => $spamcheck,
                 mdmap => \%mdmap,
                 mdre => $mdre,
-                config => $config,
+                pi_cfg => $cfg,
                 imap => scalar keys %imap ? \%imap : undef,
                 nntp => scalar keys %nntp? \%nntp : undef,
                 importers => {},
@@ -175,7 +175,7 @@ sub _remove_spam {
         $path =~ /:2,[A-R]*S[T-Za-z]*\z/ or return;
         my $eml = eml_from_path($path) or return;
         local $SIG{__WARN__} = warn_ignore_cb();
-        $self->{config}->each_inbox(\&remove_eml_i, $self, $eml, $path);
+        $self->{pi_cfg}->each_inbox(\&remove_eml_i, $self, $eml, $path);
 }
 
 sub import_eml ($$$) {
@@ -217,7 +217,7 @@ sub _try_path {
                 warn "unmappable dir: $1\n";
                 return;
         }
-        my $warn_cb = $SIG{__WARN__} || sub { print STDERR @_ };
+        my $warn_cb = $SIG{__WARN__} || \&CORE::warn;
         local $SIG{__WARN__} = sub {
                 my $pfx = ($_[0] // '') =~ /^([A-Z]: )/g ? $1 : '';
                 $warn_cb->($pfx, "path: $path\n", @_);
@@ -316,7 +316,7 @@ sub cfg_bool ($$$) {
 # flesh out common IMAP-specific data structures
 sub imap_common_init ($) {
         my ($self) = @_;
-        my $cfg = $self->{config};
+        my $cfg = $self->{pi_cfg};
         my $mic_args = {}; # scheme://authority => Mail:IMAPClient arg
         for my $url (sort keys %{$self->{imap}}) {
                 my $uri = PublicInbox::URIimap->new($url);
@@ -418,7 +418,7 @@ sub imap_import_msg ($$$$$) {
                 if ($flags =~ /\\Seen\b/) {
                         local $SIG{__WARN__} = warn_ignore_cb();
                         my $eml = PublicInbox::Eml->new($raw);
-                        $self->{config}->each_inbox(\&remove_eml_i,
+                        $self->{pi_cfg}->each_inbox(\&remove_eml_i,
                                                 $self, $eml, "$url UID:$uid");
                 }
         } else {
@@ -467,7 +467,7 @@ sub imap_fetch_all ($$$) {
         my $key = $req;
         $key =~ s/\.PEEK//;
         my ($uids, $batch);
-        my $warn_cb = $SIG{__WARN__} || sub { print STDERR @_ };
+        my $warn_cb = $SIG{__WARN__} || \&CORE::warn;
         local $SIG{__WARN__} = sub {
                 my $pfx = ($_[0] // '') =~ /^([A-Z]: )/g ? $1 : '';
                 $batch //= '?';
@@ -583,13 +583,13 @@ sub watch_atfork_child ($) {
         delete $self->{opendirs};
         PublicInbox::DS->Reset;
         %SIG = (%SIG, %{$self->{sig}}, CHLD => 'DEFAULT');
-        PublicInbox::Sigfd::sig_setmask($self->{oldset});
+        PublicInbox::DS::sig_setmask($self->{oldset});
 }
 
 sub watch_atfork_parent ($) {
         my ($self) = @_;
         _done_for_now($self);
-        PublicInbox::Sigfd::block_signals();
+        PublicInbox::DS::block_signals();
 }
 
 sub imap_idle_requeue ($) { # DS::add_timer callback
@@ -625,8 +625,11 @@ sub imap_idle_fork ($$) {
         my ($self, $url_intvl) = @_;
         my ($url, $intvl) = @$url_intvl;
         pipe(my ($r, $w)) or die "pipe: $!";
+        my $seed = rand(0xffffffff);
         defined(my $pid = fork) or die "fork: $!";
         if ($pid == 0) {
+                srand($seed);
+                eval { Net::SSLeay::randomize() };
                 close $r;
                 watch_atfork_child($self);
                 watch_imap_idle_1($self, $url, $intvl);
@@ -648,7 +651,7 @@ sub event_step {
                                 imap_idle_fork($self, $url_intvl);
                         }
                 };
-                PublicInbox::Sigfd::sig_setmask($oldset);
+                PublicInbox::DS::sig_setmask($oldset);
                 die $@ if $@;
         }
         fs_scan_step($self) if $self->{mdre};
@@ -704,8 +707,11 @@ sub poll_fetch_fork ($) { # DS::add_timer callback
         return if $self->{quit};
         pipe(my ($r, $w)) or die "pipe: $!";
         my $oldset = watch_atfork_parent($self);
+        my $seed = rand(0xffffffff);
         my $pid = fork;
         if (defined($pid) && $pid == 0) {
+                srand($seed);
+                eval { Net::SSLeay::randomize() };
                 close $r;
                 watch_atfork_child($self);
                 if ($urls->[0] =~ m!\Aimaps?://!i) {
@@ -716,7 +722,7 @@ sub poll_fetch_fork ($) { # DS::add_timer callback
                 close $w;
                 _exit(0);
         }
-        PublicInbox::Sigfd::sig_setmask($oldset);
+        PublicInbox::DS::sig_setmask($oldset);
         die "fork: $!"  unless defined $pid;
         $self->{poll_pids}->{$pid} = [ $intvl, $urls ];
         PublicInbox::EOFpipe->new($r, \&reap, [$pid, \&poll_fetch_reap, $self]);
@@ -775,7 +781,7 @@ sub watch_imap_init ($$) {
 # flesh out common NNTP-specific data structures
 sub nntp_common_init ($) {
         my ($self) = @_;
-        my $cfg = $self->{config};
+        my $cfg = $self->{pi_cfg};
         my $nn_args = {}; # scheme://authority => Net::NNTP->new arg
         for my $url (sort keys %{$self->{nntp}}) {
                 my $sec = uri_section(uri_new($url));
@@ -929,7 +935,7 @@ sub nntp_fetch_all ($$$) {
         $beg = $l_art + 1;
 
         warn "I: $url fetching ARTICLE $beg..$end\n";
-        my $warn_cb = $SIG{__WARN__} || sub { print STDERR @_ };
+        my $warn_cb = $SIG{__WARN__} || \&CORE::warn;
         my ($err, $art);
         local $SIG{__WARN__} = sub {
                 my $pfx = ($_[0] // '') =~ /^([A-Z]: )/g ? $1 : '';
@@ -966,7 +972,7 @@ sub nntp_fetch_all ($$$) {
                         }
                 } elsif ($inboxes eq 'watchspam') {
                         my $eml = PublicInbox::Eml->new(\$raw);
-                        $self->{config}->each_inbox(\&remove_eml_i,
+                        $self->{pi_cfg}->each_inbox(\&remove_eml_i,
                                         $self, $eml, "$url ARTICLE $art");
                 } else {
                         die "BUG: destination unknown $inboxes";
diff --git a/lib/PublicInbox/WwwAltId.pm b/lib/PublicInbox/WwwAltId.pm
index 2818400e..b90819a2 100644
--- a/lib/PublicInbox/WwwAltId.pm
+++ b/lib/PublicInbox/WwwAltId.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # dumps using the ".dump" command of sqlite3(1)
@@ -30,7 +30,7 @@ sub check_output {
 sub sqldump ($$) {
         my ($ctx, $altid_pfx) = @_;
         my $env = $ctx->{env};
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $altid_map = $ibx->altid_map;
         my $fn = $altid_map->{$altid_pfx};
         unless (defined $fn) {
diff --git a/lib/PublicInbox/WwwAtomStream.pm b/lib/PublicInbox/WwwAtomStream.pm
index 388def12..361e61f6 100644
--- a/lib/PublicInbox/WwwAtomStream.pm
+++ b/lib/PublicInbox/WwwAtomStream.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Atom body stream for HTTP responses
@@ -15,7 +15,7 @@ use PublicInbox::MsgTime qw(msg_timestamp);
 
 sub new {
         my ($class, $ctx, $cb) = @_;
-        $ctx->{feed_base_url} = $ctx->{-inbox}->base_url($ctx->{env});
+        $ctx->{feed_base_url} = $ctx->{ibx}->base_url($ctx->{env});
         $ctx->{cb} = $cb || \&PublicInbox::GzipFilter::close;
         $ctx->{emit_header} = 1;
         bless $ctx, $class;
@@ -53,7 +53,7 @@ sub getline {
         my ($self) = @_;
         my $cb = $self->{cb} or return;
         while (my $smsg = $cb->($self)) {
-                my $eml = $self->{-inbox}->smsg_eml($smsg) or next;
+                my $eml = $self->{ibx}->smsg_eml($smsg) or next;
                 return $self->translate(feed_entry($self, $smsg, $eml));
         }
         delete $self->{cb};
@@ -82,7 +82,7 @@ sub to_uuid ($) {
 
 sub atom_header {
         my ($ctx, $title) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $base_url = $ctx->{feed_base_url};
         my $search_q = $ctx->{search_query};
         my $self_url = $base_url;
@@ -136,10 +136,10 @@ sub feed_entry {
         $title = title_tag($title);
 
         my $from = $eml->header('From') // $eml->header('Sender') //
-                $ctx->{-inbox}->{-primary_address};
+                $ctx->{ibx}->{-primary_address};
         my ($email) = PublicInbox::Address::emails($from);
         my $name = ascii_html(join(', ', PublicInbox::Address::names($from)));
-        $email = ascii_html($email // $ctx->{-inbox}->{-primary_address});
+        $email = ascii_html($email // $ctx->{ibx}->{-primary_address});
 
         my $s = delete($ctx->{emit_header}) ? atom_header($ctx, $title) : '';
         $s .= "<entry><author><name>$name</name><email>$email</email>" .
diff --git a/lib/PublicInbox/WwwAttach.pm b/lib/PublicInbox/WwwAttach.pm
index 09c66d02..93c43af8 100644
--- a/lib/PublicInbox/WwwAttach.pm
+++ b/lib/PublicInbox/WwwAttach.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # For retrieving attachments from messages in the WWW interface
@@ -16,7 +16,7 @@ sub referer_match ($) {
         return 1 if $referer eq ''; # no referer is always OK for wget/curl
 
         # prevent deep-linking from other domains on some browsers (Firefox)
-        # n.b.: $ctx->{-inbox}->base_url($env) with INBOX_URL won't work
+        # n.b.: $ctx->{ibx}->base_url($env) with INBOX_URL won't work
         # with dillo, we can only match "$url_scheme://$HTTP_HOST/" without
         # path components
         my $base_url = $env->{'psgi.url_scheme'} . '://' .
@@ -88,15 +88,15 @@ sub get_attach ($$$) {
         $ctx->{idx} = $idx;
         bless $ctx, __PACKAGE__;
         my $eml;
-        if ($ctx->{smsg} = $ctx->{-inbox}->smsg_by_mid($ctx->{mid})) {
+        if ($ctx->{smsg} = $ctx->{ibx}->smsg_by_mid($ctx->{mid})) {
                 return sub { # public-inbox-httpd-only
                         $ctx->{wcb} = $_[0];
                         scan_attach($ctx);
                 } if $ctx->{env}->{'pi-httpd.async'};
                 # generic PSGI:
-                $eml = $ctx->{-inbox}->smsg_eml($ctx->{smsg});
-        } elsif (!$ctx->{-inbox}->over) {
-                if (my $bref = $ctx->{-inbox}->msg_by_mid($ctx->{mid})) {
+                $eml = $ctx->{ibx}->smsg_eml($ctx->{smsg});
+        } elsif (!$ctx->{ibx}->over) {
+                if (my $bref = $ctx->{ibx}->msg_by_mid($ctx->{mid})) {
                         $eml = PublicInbox::Eml->new($bref);
                 }
         }
diff --git a/lib/PublicInbox/WwwHighlight.pm b/lib/PublicInbox/WwwHighlight.pm
index 170bfcaa..6fed2fed 100644
--- a/lib/PublicInbox/WwwHighlight.pm
+++ b/lib/PublicInbox/WwwHighlight.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Standalone PSGI app to provide syntax highlighting as-a-service
diff --git a/lib/PublicInbox/WwwListing.pm b/lib/PublicInbox/WwwListing.pm
index bda2761c..d58618cc 100644
--- a/lib/PublicInbox/WwwListing.pm
+++ b/lib/PublicInbox/WwwListing.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Provide an HTTP-accessible listing of inboxes.
@@ -44,7 +44,7 @@ sub url_regexp {
         my ($ctx, $key, $default) = @_;
         $key //= 'publicInbox.wwwListing';
         $default //= '404';
-        my $v = $ctx->{www}->{pi_config}->{lc $key} // $default;
+        my $v = $ctx->{www}->{pi_cfg}->{lc $key} // $default;
 again:
         if ($v eq 'match=domain') {
                 my $h = $ctx->{env}->{HTTP_HOST} // $ctx->{env}->{SERVER_NAME};
@@ -69,8 +69,11 @@ sub hide_key { 'www' }
 sub response {
         my ($class, $ctx) = @_;
         bless $ctx, $class;
+        if (my $ALL = $ctx->{www}->{pi_cfg}->ALL) {
+                $ALL->misc->reopen;
+        }
         my $re = $ctx->url_regexp or return $ctx->psgi_triple;
-        my $iter = PublicInbox::ConfigIter->new($ctx->{www}->{pi_config},
+        my $iter = PublicInbox::ConfigIter->new($ctx->{www}->{pi_cfg},
                                                 \&list_match_i, $re, $ctx);
         sub {
                 $ctx->{-wcb} = $_[0]; # HTTP server callback
diff --git a/lib/PublicInbox/WwwStatic.pm b/lib/PublicInbox/WwwStatic.pm
index 051d2e03..29e4819d 100644
--- a/lib/PublicInbox/WwwStatic.pm
+++ b/lib/PublicInbox/WwwStatic.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # This package can either be a PSGI response body for a static file
diff --git a/lib/PublicInbox/WwwStream.pm b/lib/PublicInbox/WwwStream.pm
index 638f4e27..bcf2ecec 100644
--- a/lib/PublicInbox/WwwStream.pm
+++ b/lib/PublicInbox/WwwStream.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # HTML body stream for which yields getline+close methods for
@@ -12,11 +12,12 @@ our @EXPORT_OK = qw(html_oneshot);
 use bytes (); # length
 use PublicInbox::Hval qw(ascii_html prurl ts2str);
 our $TOR_URL = 'https://www.torproject.org/';
-our $CODE_URL = 'https://public-inbox.org/public-inbox.git';
+our $CODE_URL = [ qw(http://ou63pmih66umazou.onion/public-inbox.git
+        https://public-inbox.org/public-inbox.git) ];
 
 sub base_url ($) {
         my $ctx = shift;
-        my $base_url = $ctx->{-inbox}->base_url($ctx->{env});
+        my $base_url = $ctx->{ibx}->base_url($ctx->{env});
         chop $base_url; # no trailing slash for clone
         $base_url;
 }
@@ -35,7 +36,7 @@ sub async_eml { # for async_blob_cb
 
 sub html_top ($) {
         my ($ctx) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $desc = ascii_html($ibx->description);
         my $title = delete($ctx->{-title_html}) // $desc;
         my $upfx = $ctx->{-upfx} || '';
@@ -54,7 +55,7 @@ sub html_top ($) {
                         qq(<a\nhref="$color">color</a> / ).
                         qq(<a\nhref=#mirror>mirror</a> / ).
                         qq(<a\nhref="$atom">Atom feed</a>);
-        if ($ibx->search) {
+        if ($ibx->isrch) {
                 my $q_val = delete($ctx->{-q_value_html}) // '';
                 $q_val = qq(\nvalue="$q_val") if $q_val ne '';
                 # XXX gross, for SearchView.pm
@@ -78,22 +79,24 @@ sub html_top ($) {
 
 sub coderepos ($) {
         my ($ctx) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $cr = $ctx->{ibx}->{coderepo} // return ();
+        my $cfg = $ctx->{www}->{pi_cfg};
+        my $upfx = ($ctx->{-upfx} // ''). '../';
         my @ret;
-        if (defined(my $cr = $ibx->{coderepo})) {
-                my $cfg = $ctx->{www}->{pi_config};
-                my $env = $ctx->{env};
-                for my $cr_name (@$cr) {
-                        my $urls = $cfg->{"coderepo.$cr_name.cgiturl"};
-                        if ($urls) {
-                                $ret[0] //= <<EOF;
+        for my $cr_name (@$cr) {
+                my $urls = $cfg->{"coderepo.$cr_name.cgiturl"} // next;
+                $ret[0] //= <<EOF;
 code repositories for the project(s) associated with this inbox:
 EOF
-                                $ret[0] .= "\n\t".prurl($env, $_) for @$urls;
-                        }
+                for (@$urls) {
+                        # relative or absolute URL?, prefix relative "foo.git"
+                        # with appropriate number of "../"
+                        my $u = m!\A(?:[a-z\+]+:)?//! ? $_ : $upfx.$_;
+                        $u = ascii_html(prurl($ctx->{env}, $u));
+                        $ret[0] .= qq(\n\t<a\nhref="$u">$u</a>);
                 }
         }
-        @ret; # may be empty
+        @ret; # may be empty, this sub is called as an arg for join()
 }
 
 sub code_footer ($) {
@@ -109,7 +112,7 @@ sub _html_end {
 id=mirror>This inbox may be cloned and mirrored by anyone:</a>
 EOF
 
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $desc = ascii_html($ibx->description);
 
         my @urls;
@@ -143,10 +146,10 @@ EOF
         }
 
         $urls .= "\n" . join('', map { "\tgit clone --mirror $_\n" } @urls);
-        my $addrs = $ibx->{address};
-        $addrs = join(' ', @$addrs) if ref($addrs) eq 'ARRAY';
-        my $v = defined $max ? '-V2' : '-V1';
-        $urls .= <<EOF;
+        if (my $addrs = $ibx->{address}) {
+                $addrs = join(' ', @$addrs) if ref($addrs) eq 'ARRAY';
+                my $v = defined $max ? '-V2' : '-V1';
+                $urls .= <<EOF;
 
         # If you have public-inbox 1.1+ installed, you may
         # initialize and index your mirror using the following commands:
@@ -154,6 +157,7 @@ EOF
                 $addrs
         public-inbox-index $dir
 EOF
+        }
         my $cfg_link = ($ctx->{-upfx} // '').'_/text/config/raw';
         $urls .= <<EOF;
 
@@ -184,7 +188,7 @@ sub getline {
         my $cb = $ctx->{cb} or return;
         while (defined(my $x = $cb->($ctx))) { # x = smsg or scalar non-ref
                 if (ref($x)) { # smsg
-                        my $eml = $ctx->{-inbox}->smsg_eml($x) or next;
+                        my $eml = $ctx->{ibx}->smsg_eml($x) or next;
                         $ctx->{smsg} = $x;
                         return $ctx->translate($cb->($ctx, $eml));
                 } else { # scalar
diff --git a/lib/PublicInbox/WwwText.pm b/lib/PublicInbox/WwwText.pm
index 04c9b1c4..817d032c 100644
--- a/lib/PublicInbox/WwwText.pm
+++ b/lib/PublicInbox/WwwText.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # used for displaying help texts and other non-mail content
@@ -49,7 +49,7 @@ sub get_text {
 
         # enforce trailing slash for "wget -r" compatibility
         if (!$have_tslash && $code == 200) {
-                my $url = $ctx->{-inbox}->base_url($env);
+                my $url = $ctx->{ibx}->base_url($env);
                 $url .= "_/text/$key/";
 
                 return [ 302, [ 'Content-Type', 'text/plain',
@@ -100,7 +100,7 @@ sub _srch_prefix ($$) {
 
 sub _colors_help ($$) {
         my ($ctx, $txt) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $env = $ctx->{env};
         my $base_url = $ibx->base_url($env);
         $$txt .= "color customization for $base_url\n";
@@ -135,7 +135,7 @@ sub URI_PATH () { '^A-Za-z0-9\-\._~/' }
 # n.b. this is a perfect candidate for memoization
 sub inbox_config ($$$) {
         my ($ctx, $hdr, $txt) = @_;
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         push @$hdr, 'Content-Disposition', 'inline; filename=inbox.config';
         my $name = dq_escape($ibx->{name});
         my $inboxdir = '/path/to/top-level-inbox';
@@ -189,9 +189,9 @@ EOF
 ; line number ranges in `[PATCH]' emails link to /$INBOX_NAME/$OID/s/,
 ; an HTTP endpoint which reconstructs git blobs via git-apply(1).
 EOF
-                my $pi_config = $ctx->{www}->{pi_config};
+                my $pi_cfg = $ctx->{www}->{pi_cfg};
                 for my $cr_name (@$cr) {
-                        my $urls = $pi_config->{"coderepo.$cr_name.cgiturl"};
+                        my $urls = $pi_cfg->{"coderepo.$cr_name.cgiturl"};
                         my $path = "/path/to/$cr_name";
                         $cr_name = dq_escape($cr_name);
 
@@ -221,7 +221,7 @@ sub _default_text ($$$$) {
         return inbox_config($ctx, $hdr, $txt) if $key eq 'config';
         return if $key ne 'help'; # TODO more keys?
 
-        my $ibx = $ctx->{-inbox};
+        my $ibx = $ctx->{ibx};
         my $base_url = $ibx->base_url($ctx->{env});
         $$txt .= "public-inbox help for $base_url\n";
         $$txt .= <<EOF;
@@ -250,7 +250,7 @@ EOF
 
         # n.b. we use the Xapian DB for any regeneratable,
         # order-of-arrival-independent data.
-        my $srch = $ibx->search;
+        my $srch = $ibx->isrch;
         if ($srch) {
                 $$txt .= <<EOF;
 search
diff --git a/lib/PublicInbox/Xapcmd.pm b/lib/PublicInbox/Xapcmd.pm
index 6a74daf9..269aa99a 100644
--- a/lib/PublicInbox/Xapcmd.pm
+++ b/lib/PublicInbox/Xapcmd.pm
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 package PublicInbox::Xapcmd;
 use strict;
@@ -89,8 +89,10 @@ sub commit_changes ($$$$) {
 
 sub cb_spawn {
         my ($cb, $args, $opt) = @_; # $cb = cpdb() or compact()
-        defined(my $pid = fork) or die "fork: $!";
+        my $seed = rand(0xffffffff);
+        my $pid = fork // die "fork: $!";
         return $pid if $pid > 0;
+        srand($seed);
         $cb->($args, $opt);
         POSIX::_exit(0);
 }
@@ -109,8 +111,7 @@ sub prepare_reindex ($$$) {
                         $opt->{reindex}->{from} = $lc;
                 }
         } else { # v2
-                my $max;
-                $im->git_dir_latest(\$max) or return;
+                my $max = $ibx->max_git_epoch // return;
                 my $from = $opt->{reindex}->{from};
                 my $mm = $ibx->mm;
                 my $v = PublicInbox::Search::SCHEMA_VERSION();
@@ -271,7 +272,6 @@ sub run {
 
         local %SIG = %SIG;
         setup_signals();
-        $ibx->umask_prepare;
         $ibx->with_umask(\&_run, $ibx, $cb, $opt);
 }
 
diff --git a/lib/PublicInbox/gcf2_libgit2.h b/lib/PublicInbox/gcf2_libgit2.h
new file mode 100644
index 00000000..e1f0ef39
--- /dev/null
+++ b/lib/PublicInbox/gcf2_libgit2.h
@@ -0,0 +1,142 @@
+/*
+ * Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+ * License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+ *
+ * libgit2 for Inline::C
+ * Avoiding Git::Raw since it doesn't guarantee a stable API,
+ * while libgit2 itself seems reasonably stable.
+ */
+#include <git2.h>
+#include <sys/uio.h>
+#include <errno.h>
+#include <poll.h>
+
+static void croak_if_err(int rc, const char *msg)
+{
+        if (rc != GIT_OK) {
+                const git_error *e = giterr_last();
+
+                croak("%d %s (%s)", rc, msg, e ? e->message : "unknown");
+        }
+}
+
+SV *new()
+{
+        git_odb *odb;
+        SV *ref, *self;
+        int rc = git_odb_new(&odb);
+        croak_if_err(rc, "git_odb_new");
+
+        ref = newSViv((IV)odb);
+        self = newRV_noinc(ref);
+        sv_bless(self, gv_stashpv("PublicInbox::Gcf2", GV_ADD));
+        SvREADONLY_on(ref);
+
+        return self;
+}
+
+static git_odb *odb_ptr(SV *self)
+{
+        return (git_odb *)SvIV(SvRV(self));
+}
+
+void DESTROY(SV *self)
+{
+        git_odb_free(odb_ptr(self));
+}
+
+/* needs "$GIT_DIR/objects", not $GIT_DIR */
+void add_alternate(SV *self, const char *objects_path)
+{
+        int rc = git_odb_add_disk_alternate(odb_ptr(self), objects_path);
+        croak_if_err(rc, "git_odb_add_disk_alternate");
+}
+
+#define CAPA(v) (sizeof(v) / sizeof((v)[0]))
+
+/*
+ * returns true on success, false on failure
+ * this requires an unabbreviated git OID
+ */
+int cat_oid(SV *self, int fd, SV *oidsv)
+{
+        /*
+         * adjust when libgit2 gets SHA-256 support, we return the
+         * same header as git-cat-file --batch "$OID $TYPE $SIZE\n"
+         */
+        char hdr[GIT_OID_HEXSZ + sizeof(" commit 18446744073709551615")];
+        struct iovec vec[3];
+        size_t nvec = CAPA(vec);
+        git_oid oid;
+        git_odb_object *object = NULL;
+        int rc, err = 0;
+        STRLEN oidlen;
+        char *oidptr = SvPV(oidsv, oidlen);
+
+        /* same trailer as git-cat-file --batch */
+        vec[2].iov_len = 1;
+        vec[2].iov_base = "\n";
+
+        rc = git_oid_fromstrn(&oid, oidptr, oidlen);
+        if (rc == GIT_OK)
+                rc = git_odb_read(&object, odb_ptr(self), &oid);
+        if (rc == GIT_OK) {
+                vec[0].iov_base = hdr;
+                vec[1].iov_base = (void *)git_odb_object_data(object);
+                vec[1].iov_len = git_odb_object_size(object);
+
+                git_oid_nfmt(hdr, GIT_OID_HEXSZ, git_odb_object_id(object));
+                vec[0].iov_len = GIT_OID_HEXSZ +
+                                snprintf(hdr + GIT_OID_HEXSZ,
+                                        sizeof(hdr) - GIT_OID_HEXSZ,
+                                        " %s %zu\n",
+                                        git_object_type2string(
+                                                git_odb_object_type(object)),
+                                        vec[1].iov_len);
+        } else { /* caller retries */
+                nvec = 0;
+        }
+        while (nvec && !err) {
+                ssize_t w = writev(fd, vec + CAPA(vec) - nvec, nvec);
+
+                if (w > 0) {
+                        size_t done = 0;
+                        size_t i;
+
+                        for (i = CAPA(vec) - nvec; i < CAPA(vec); i++) {
+                                if (w >= vec[i].iov_len) {
+                                        /* fully written vec */
+                                        w -= vec[i].iov_len;
+                                        done++;
+                                } else { /* partially written vec */
+                                        char *p = vec[i].iov_base;
+                                        vec[i].iov_base = p + w;
+                                        vec[i].iov_len -= w;
+                                        break;
+                                }
+                        }
+                        nvec -= done;
+                } else if (w < 0) {
+                        err = errno;
+                        switch (err) {
+                        case EAGAIN: {
+                                struct pollfd pfd;
+                                pfd.events = POLLOUT;
+                                pfd.fd = fd;
+                                poll(&pfd, 1, -1);
+                        }
+                                /* fall-through */
+                        case EINTR:
+                                err = 0;
+                        }
+                } else { /* w == 0 */
+                        err = ENOSPC;
+                }
+        }
+        if (object)
+                git_odb_object_free(object);
+        if (err)
+                croak("writev error: %s", strerror(err));
+
+        return rc == GIT_OK;
+}
diff --git a/script/lei b/script/lei
new file mode 100755
index 00000000..006c1180
--- /dev/null
+++ b/script/lei
@@ -0,0 +1,114 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Socket qw(AF_UNIX SOCK_SEQPACKET MSG_EOR pack_sockaddr_un);
+use Errno qw(EINTR ECONNRESET);
+use PublicInbox::CmdIPC4;
+my $narg = 5;
+my ($sock, $pwd);
+my $recv_cmd = PublicInbox::CmdIPC4->can('recv_cmd4');
+my $send_cmd = PublicInbox::CmdIPC4->can('send_cmd4') // do {
+        require PublicInbox::Spawn; # takes ~50ms even if built *sigh*
+        $recv_cmd = PublicInbox::Spawn->can('recv_cmd4');
+        PublicInbox::Spawn->can('send_cmd4');
+};
+
+sub sigchld {
+        my ($sig) = @_;
+        my $flags = $sig ? POSIX::WNOHANG() : 0;
+        while (waitpid(-1, $flags) > 0) {}
+}
+
+sub exec_cmd {
+        my ($fds, $argc, @argv) = @_;
+        my @old = (*STDIN{IO}, *STDOUT{IO}, *STDERR{IO});
+        my @rdr;
+        for my $fd (@$fds) {
+                open(my $tmpfh, '+<&=', $fd) or die "open +<&=$fd: $!";
+                push @rdr, shift(@old), $tmpfh;
+        }
+        require POSIX; # WNOHANG
+        $SIG{CHLD} = \&sigchld;
+        my $pid = fork // die "fork: $!";
+        if ($pid == 0) {
+                my %env = map { split(/=/, $_, 2) } splice(@argv, $argc);
+                while (my ($old_io, $tmpfh) = splice(@rdr, 0, 2)) {
+                        open $old_io, '+<&', $tmpfh or die "open +<&=: $!";
+                }
+                %ENV = (%ENV, %env);
+                exec(@argv);
+                die "exec: @argv: $!";
+        }
+}
+
+if ($send_cmd && eval {
+        my $path = do {
+                my $runtime_dir = ($ENV{XDG_RUNTIME_DIR} // '') . '/lei';
+                if ($runtime_dir eq '/lei') {
+                        require File::Spec;
+                        $runtime_dir = File::Spec->tmpdir."/lei-$<";
+                }
+                unless (-d $runtime_dir) {
+                        require File::Path;
+                        File::Path::mkpath($runtime_dir, 0, 0700);
+                }
+                "$runtime_dir/$narg.seq.sock";
+        };
+        my $addr = pack_sockaddr_un($path);
+        socket($sock, AF_UNIX, SOCK_SEQPACKET, 0) or die "socket: $!";
+        unless (connect($sock, $addr)) { # start the daemon if not started
+                local $ENV{PERL5LIB} = join(':', @INC);
+                open(my $daemon, '-|', $^X, qw[-MPublicInbox::LEI
+                        -E PublicInbox::LEI::lazy_start(@ARGV)],
+                        $path, $! + 0, $narg) or die "popen: $!";
+                while (<$daemon>) { warn $_ } # EOF when STDERR is redirected
+                close($daemon) or warn <<"";
+lei-daemon could not start, exited with \$?=$?
+
+                # try connecting again anyways, unlink+bind may be racy
+                connect($sock, $addr) or die <<"";
+connect($path): $! (after attempted daemon start)
+Falling back to (slow) one-shot mode
+
+        }
+        1;
+}) { # (Socket::MsgHdr|Inline::C), $sock, $pwd are all available:
+        open my $dh, '<', '.' or die "open(.) $!";
+        my $buf = join("\0", scalar(@ARGV), @ARGV);
+        while (my ($k, $v) = each %ENV) { $buf .= "\0$k=$v" }
+        $buf .= "\0\0";
+        $send_cmd->($sock, [ 0, 1, 2, fileno($dh) ], $buf, MSG_EOR);
+        my $x_it_code = 0;
+        while (1) {
+                my (@fds) = $recv_cmd->($sock, $buf, 4096 * 33);
+                if (scalar(@fds) == 1 && !defined($fds[0])) {
+                        last if $! == ECONNRESET;
+                        next if $! == EINTR;
+                        die "recvmsg: $!";
+                }
+                last if $buf eq '';
+                if ($buf =~ /\Ax_it ([0-9]+)\z/) {
+                        $x_it_code = $1 + 0;
+                        last;
+                } elsif ($buf =~ /\Achild_error ([0-9]+)\z/) {
+                        $x_it_code = $1 + 0;
+                } elsif ($buf =~ /\Aexec (.+)\z/) {
+                        exec_cmd(\@fds, split(/\0/, $1));
+                } else {
+                        sigchld();
+                        die $buf;
+                }
+        }
+        sigchld();
+        if (my $sig = ($x_it_code & 127)) {
+                kill $sig, $$;
+                sleep;
+        }
+        exit($x_it_code >> 8);
+} else { # for systems lacking Socket::MsgHdr or Inline::C
+        warn $@ if $@;
+        require PublicInbox::LEI;
+        PublicInbox::LEI::oneshot(__PACKAGE__);
+}
diff --git a/script/public-inbox-compact b/script/public-inbox-compact
index dfebac1c..ab1d1e5e 100755
--- a/script/public-inbox-compact
+++ b/script/public-inbox-compact
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
diff --git a/script/public-inbox-convert b/script/public-inbox-convert
index b61c743f..3c627b79 100755
--- a/script/public-inbox-convert
+++ b/script/public-inbox-convert
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <http://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
@@ -47,34 +47,21 @@ die $help if (scalar(@ARGV) || $new_dir eq '' || $old_dir eq '');
 die "$new_dir exists\n" if -d $new_dir;
 die "$old_dir not a directory\n" unless -d $old_dir;
 
-require Cwd;
-Cwd->import('abs_path');
+require PublicInbox::Admin;
 require PublicInbox::Config;
 require PublicInbox::InboxWritable;
 
-my $abs = abs_path($old_dir);
-die "failed to resolve $old_dir: $!\n" if (!defined($abs));
-
 my $cfg = PublicInbox::Config->new;
-my $old;
-$cfg->each_inbox(sub {
-        $old = $_[0] if abs_path($_[0]->{inboxdir}) eq $old_dir;
-});
-if ($old) {
-        $old = PublicInbox::InboxWritable->new($old);
-} else {
+my @old = PublicInbox::Admin::resolve_inboxes([$old_dir], undef, $cfg);
+@old > 1 and die "BUG: resolved several inboxes from $old_dir:\n",
+                map { "\t$_->{inboxdir}\n" } @old;
+my $old = PublicInbox::InboxWritable->new($old[0]);
+if (delete $old->{-unconfigured}) {
         warn "W: $old_dir not configured in " .
                 PublicInbox::Config::default_file() . "\n";
-        $old = PublicInbox::InboxWritable->new({
-                inboxdir => $old_dir,
-                name => 'ignored',
-                -primary_address => 'old@example.com',
-                address => [ 'old@example.com' ],
-        });
 }
 die "Only conversion from v1 inboxes is supported\n" if $old->version >= 2;
 
-require File::Spec;
 require PublicInbox::Admin;
 my $detected = PublicInbox::Admin::detect_indexlevel($old);
 $old->{indexlevel} //= $detected;
@@ -88,12 +75,11 @@ if ($opt->{'index'}) {
 }
 local %ENV = (%$env, %ENV) if $env;
 my $new = { %$old };
-$new->{inboxdir} = File::Spec->canonpath($new_dir);
+$new->{inboxdir} = $cfg->rel2abs_collapsed($new_dir);
 $new->{version} = 2;
 $new = PublicInbox::InboxWritable->new($new, { nproc => $opt->{jobs} });
 $new->{-no_fsync} = 1 if !$opt->{fsync};
 my $v2w;
-$old->umask_prepare;
 
 sub link_or_copy ($$) {
         my ($src, $dst) = @_;
diff --git a/script/public-inbox-edit b/script/public-inbox-edit
index a70614fc..1c6c4e4a 100755
--- a/script/public-inbox-edit
+++ b/script/public-inbox-edit
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used for editing messages in a public-inbox.
@@ -183,7 +183,8 @@ retry_edit:
         # rename/relink $edit_fn
         open my $new_fh, '<', $edit_fn or
                 die "can't read edited file ($edit_fn): $!\n";
-        my $new_raw = do { local $/; <$new_fh> };
+        defined(my $new_raw = do { local $/; <$new_fh> }) or die
+                "read $edit_fn: $!\n";
 
         if (!$opt->{raw}) {
                 # get rid of the From we added
diff --git a/script/public-inbox-extindex b/script/public-inbox-extindex
new file mode 100644
index 00000000..15ac20eb
--- /dev/null
+++ b/script/public-inbox-extindex
@@ -0,0 +1,81 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+# Basic tool to create a Xapian search index for a public-inbox.
+use strict;
+use v5.10.1;
+use Getopt::Long qw(:config gnu_getopt no_ignore_case auto_abbrev);
+my $help = <<EOF; # the following should fit w/o scrolling in 80x24 term:
+usage: public-inbox-extindex [options] [EXTINDEX_DIR] [INBOX_DIR...]
+
+  Create and update external (detached) search indices
+
+  --no-fsync          speed up indexing, risk corruption on power outage
+  --watch             run persistently and watch for inbox updates
+  -L LEVEL            `medium', or `full' (default: full)
+  --all               index all configured inboxes
+  --jobs=NUM          set or disable parallelization (NUM=0)
+  --batch-size=BYTES  flush changes to OS after a given number of bytes
+  --max-size=BYTES    do not index messages larger than the given size
+  --gc                perform garbage collection instead of indexing
+  --verbose | -v      increase verbosity (may be repeated)
+
+BYTES may use `k', `m', and `g' suffixes (e.g. `10m' for 10 megabytes)
+See public-inbox-extindex(1) man page for full documentation.
+EOF
+my $opt = { quiet => -1, compact => 0, fsync => 1, scan => 1 };
+GetOptions($opt, qw(verbose|v+ reindex rethread compact|c+ jobs|j=i
+                fsync|sync!
+                indexlevel|index-level|L=s max_size|max-size=s
+                batch_size|batch-size=s
+                gc commit-interval=i watch scan!
+                all help|h))
+        or die $help;
+if ($opt->{help}) { print $help; exit 0 };
+die "--jobs must be >= 0\n" if defined $opt->{jobs} && $opt->{jobs} < 0;
+require IO::Handle;
+STDOUT->autoflush(1);
+STDERR->autoflush(1);
+local $SIG{USR1} = 'IGNORE'; # to be overridden in eidx_sync
+# require lazily to speed up --help
+require PublicInbox::Admin;
+my $cfg = PublicInbox::Config->new;
+my $eidx_dir = shift(@ARGV);
+unless (defined $eidx_dir) {
+        if ($opt->{all} && $cfg->ALL) {
+                $eidx_dir = $cfg->ALL->{topdir};
+        } else {
+                die "E: $help";
+        }
+}
+my @ibxs;
+if ($opt->{gc}) {
+        die "E: inbox paths must not be specified with --gc\n" if @ARGV;
+        die "E: --all not compatible with --gc\n" if $opt->{all};
+        die "E: --watch is not compatible with --gc\n" if $opt->{watch};
+} else {
+        @ibxs = PublicInbox::Admin::resolve_inboxes(\@ARGV, $opt, $cfg);
+}
+PublicInbox::Admin::require_or_die(qw(-search));
+PublicInbox::Config::json() or die "Cpanel::JSON::XS or similar missing\n";
+PublicInbox::Admin::progress_prepare($opt);
+my $env = PublicInbox::Admin::index_prepare($opt, $cfg);
+local %ENV = (%ENV, %$env) if $env;
+require PublicInbox::ExtSearchIdx;
+my $eidx = PublicInbox::ExtSearchIdx->new($eidx_dir, $opt);
+if ($opt->{gc}) {
+        $eidx->attach_config($cfg);
+        $eidx->eidx_gc($opt);
+} else {
+        if ($opt->{all}) {
+                $eidx->attach_config($cfg);
+        } else {
+                $eidx->attach_inbox($_) for @ibxs;
+        }
+        if ($opt->{watch}) {
+                $cfg = undef; # save memory only after SIGHUP
+                $eidx->eidx_watch($opt);
+        } else {
+                $eidx->eidx_sync($opt);
+        }
+}
diff --git a/script/public-inbox-httpd b/script/public-inbox-httpd
index b8159f3a..b31b896d 100755
--- a/script/public-inbox-httpd
+++ b/script/public-inbox-httpd
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Standalone HTTP server for public-inbox.
@@ -13,6 +13,7 @@ BEGIN {
         require PublicInbox::HTTP;
         require PublicInbox::HTTPD;
 }
+
 my %httpds;
 my $app;
 my $refresh = sub {
diff --git a/script/public-inbox-imapd b/script/public-inbox-imapd
index 60f2e6d8..6b755938 100755
--- a/script/public-inbox-imapd
+++ b/script/public-inbox-imapd
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Standalone read-only IMAP server for public-inbox.
diff --git a/script/public-inbox-index b/script/public-inbox-index
index 5dad6ecb..33169bd0 100755
--- a/script/public-inbox-index
+++ b/script/public-inbox-index
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Basic tool to create a Xapian search index for a public-inbox.
 # Usage with libeatmydata <https://www.flamingspork.com/projects/libeatmydata/>
@@ -11,12 +11,13 @@ use Getopt::Long qw(:config gnu_getopt no_ignore_case auto_abbrev);
 my $help = <<EOF; # the following should fit w/o scrolling in 80x24 term:
 usage: public-inbox-index [options] INBOX_DIR
 
-  Create and update search indices
+  Create and update per-inbox search indices
 
 options:
 
   --no-fsync          speed up indexing, risk corruption on power outage
   -L LEVEL            `basic', `medium', or `full' (default: full)
+  -E EXTINDEX         update extindex (default: `all')
   --all               index all configured inboxes
   --compact | -c      run public-inbox-compact(1) after indexing
   --sequential-shard  index Xapian shards sequentially for slow storage
@@ -31,30 +32,65 @@ options:
 BYTES may use `k', `m', and `g' suffixes (e.g. `10m' for 10 megabytes)
 See public-inbox-index(1) man page for full documentation.
 EOF
-my $opt = { quiet => -1, compact => 0, max_size => undef, fsync => 1 };
+my $opt = {
+        quiet => -1, compact => 0, max_size => undef, fsync => 1,
+        'update-extindex' => [], # ":s@" optional arg sets '' if no arg given
+};
 GetOptions($opt, qw(verbose|v+ reindex rethread compact|c+ jobs|j=i prune
                 fsync|sync! xapian_only|xapian-only
                 indexlevel|index-level|L=s max_size|max-size=s
                 batch_size|batch-size=s
                 sequential_shard|seq-shard|sequential-shard
-                skip-docdata all help|h))
+                no-update-extindex update-extindex|E=s@
+                fast-noop|F skip-docdata all help|h))
         or die $help;
 if ($opt->{help}) { print $help; exit 0 };
 die "--jobs must be >= 0\n" if defined $opt->{jobs} && $opt->{jobs} < 0;
 if ($opt->{xapian_only} && !$opt->{reindex}) {
         die "--xapian-only requires --reindex\n";
 }
+if ($opt->{reindex} && delete($opt->{'fast-noop'})) {
+        warn "--fast-noop ignored with --reindex\n";
+}
 
 # require lazily to speed up --help
 require PublicInbox::Admin;
 PublicInbox::Admin::require_or_die('-index');
 
 my $cfg = PublicInbox::Config->new; # Config is loaded by Admin
+$opt->{-use_cwd} = 1;
 my @ibxs = PublicInbox::Admin::resolve_inboxes(\@ARGV, $opt, $cfg);
 PublicInbox::Admin::require_or_die('-index');
 unless (@ibxs) { print STDERR $help; exit 1 }
 
+my (@eidx, %eidx_seen);
+my $update_extindex = $opt->{'update-extindex'};
+if (!scalar(@$update_extindex) && (my $ALL = $cfg->ALL)) {
+        # extindex and normal inboxes may have different owners
+        push(@$update_extindex, 'all') if -w $ALL->{topdir};
+}
+@$update_extindex = () if $opt->{'no-update-extindex'};
+if (scalar @$update_extindex) {
+        PublicInbox::Admin::require_or_die('-search');
+        require PublicInbox::ExtSearchIdx;
+}
+for my $ei_name (@$update_extindex) {
+        my $es = $cfg->lookup_ei($ei_name);
+        my $topdir;
+        if (!$es && -d $ei_name) { # allow dirname or config section name
+                $topdir = $ei_name;
+        } elsif ($es) {
+                $topdir = $es->{topdir};
+        } else {
+                die "extindex `$ei_name' not configured or found\n";
+        }
+        my $o = { %$opt };
+        delete $o->{indexlevel} if ($o->{indexlevel}//'') eq 'basic';
+        $eidx_seen{$topdir} //=
+                push(@eidx, PublicInbox::ExtSearchIdx->new($topdir, $o));
+}
 my $mods = {};
+my @eidx_unconfigured;
 foreach my $ibx (@ibxs) {
         # detect_indexlevel may also set $ibx->{-skip_docdata}
         my $detected = PublicInbox::Admin::detect_indexlevel($ibx);
@@ -62,7 +98,14 @@ foreach my $ibx (@ibxs) {
         $ibx->{indexlevel} //= $opt->{indexlevel} // ($opt->{xapian_only} ?
                         'full' : $detected);
         PublicInbox::Admin::scan_ibx_modules($mods, $ibx);
+        if (@eidx && $ibx->{-unconfigured}) {
+                push @eidx_unconfigured, "  $ibx->{inboxdir}\n";
+        }
 }
+warn <<EOF if @eidx_unconfigured;
+The following inboxes are unconfigured and will not be updated in
+@$update_extindex:\n@eidx_unconfigured
+EOF
 
 # "Search::Xapian" includes SWIG "Xapian", too:
 $opt->{compact} = 0 if !$mods->{'Search::Xapian'};
@@ -88,9 +131,21 @@ publicInbox.$ibx->{name}.indexSequentialShard not boolean
 EOL
                 $ibx_opt = { %$opt, sequential_shard => $v };
         }
-        PublicInbox::Admin::index_inbox($ibx, undef, $ibx_opt);
+        my $nidx = PublicInbox::Admin::index_inbox($ibx, undef, $ibx_opt);
+        last if $ibx_opt->{quit};
         if (my $copt = $opt->{compact_opt}) {
                 local $copt->{jobs} = 0 if $ibx_opt->{sequential_shard};
                 PublicInbox::Xapcmd::run($ibx, 'compact', $copt);
         }
+        last if $ibx_opt->{quit};
+        next if $ibx->{-unconfigured} || !$nidx;
+        for my $eidx (@eidx) {
+                $eidx->attach_inbox($ibx);
+        }
+}
+my $pr = $opt->{-progress};
+for my $eidx (@eidx) {
+        $pr->("indexing $eidx->{topdir} ...\n") if $pr;
+        $eidx->eidx_sync($opt);
+        last if $opt->{quit};
 }
diff --git a/script/public-inbox-init b/script/public-inbox-init
index c775eb31..6a867a22 100755
--- a/script/public-inbox-init
+++ b/script/public-inbox-init
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
@@ -91,7 +91,8 @@ sysopen($lockfh, $lockfile, O_RDWR|O_CREAT|O_EXCL) or do {
         warn "could not open config file: $lockfile: $!\n";
         exit(255);
 };
-my $auto_unlink = UnlinkMe->new($lockfile);
+require PublicInbox::OnDestroy;
+my $auto_unlink = PublicInbox::OnDestroy->new($$, sub { unlink $lockfile });
 my ($perm, %seen);
 if (-e $pi_config) {
         open(my $oh, '<', $pi_config) or die "unable to read $pi_config: $!\n";
@@ -100,11 +101,7 @@ if (-e $pi_config) {
         defined $perm or die "(f)stat failed on $pi_config: $!\n";
         chmod($perm & 07777, $fh) or
                 die "(f)chmod failed on future $pi_config: $!\n";
-        my $old;
-        {
-                local $/;
-                $old = <$oh>;
-        }
+        defined(my $old = do { local $/; <$oh> }) or die "read $pi_config: $!\n";
         print $fh $old or die "failed to write: $!\n";
         close $oh or die "failed to close $pi_config: $!\n";
 
@@ -138,10 +135,9 @@ close($fh) or die "failed to close $pi_config_tmp: $!\n";
 my $pfx = "publicinbox.$name";
 my @x = (qw/git config/, "--file=$pi_config_tmp");
 
-require File::Spec;
-$inboxdir = File::Spec->canonpath($inboxdir);
+$inboxdir = PublicInbox::Config::rel2abs_collapsed($inboxdir);
+die "`\\n' not allowed in `$inboxdir'\n" if index($inboxdir, "\n") >= 0;
 
-die "`\\n' not allowed in `$inboxdir'\n" if $inboxdir =~ /\n/s;
 if (-f "$inboxdir/inbox.lock") {
         if (!defined $version) {
                 $version = 2;
@@ -186,26 +182,24 @@ if ($skip_docdata) {
         $ibx->{-skip_docdata} = $skip_docdata;
 }
 $ibx->init_inbox(0, $skip_epoch, $skip_artnum);
-require Cwd;
-my $tmp = Cwd::abs_path($inboxdir);
-defined($tmp) or die "failed to resolve $inboxdir: $!\n";
-$inboxdir = $tmp;
-die "`\\n' not allowed in `$inboxdir'\n" if $inboxdir =~ /\n/s;
 
 # needed for git prior to v2.1.0
 umask(0077) if defined $perm;
 
+require PublicInbox::Spawn;
+PublicInbox::Spawn->import(qw(run_die));
+
 foreach my $addr (@address) {
         next if $seen{lc($addr)};
-        PublicInbox::Import::run_die([@x, "--add", "$pfx.address", $addr]);
+        run_die([@x, "--add", "$pfx.address", $addr]);
 }
-PublicInbox::Import::run_die([@x, "$pfx.url", $http_url]);
-PublicInbox::Import::run_die([@x, "$pfx.inboxdir", $inboxdir]);
+run_die([@x, "$pfx.url", $http_url]);
+run_die([@x, "$pfx.inboxdir", $inboxdir]);
 
 if (defined($indexlevel)) {
-        PublicInbox::Import::run_die([@x, "$pfx.indexlevel", $indexlevel]);
+        run_die([@x, "$pfx.indexlevel", $indexlevel]);
 }
-PublicInbox::Import::run_die([@x, "$pfx.newsgroup", $ng]) if $ng ne '';
+run_die([@x, "$pfx.newsgroup", $ng]) if $ng ne '';
 
 # needed for git prior to v2.1.0
 if (defined $perm) {
@@ -215,18 +209,4 @@ if (defined $perm) {
 
 rename $pi_config_tmp, $pi_config or
         die "failed to rename `$pi_config_tmp' to `$pi_config': $!\n";
-$auto_unlink->DESTROY;
-
-package UnlinkMe;
-use strict;
-
-sub new {
-        my ($klass, $file) = @_;
-        bless { file => $file }, $klass;
-}
-
-sub DESTROY {
-        my $f = delete($_[0]->{file});
-        unlink($f) if defined($f);
-}
-1;
+undef $auto_unlink; # trigger ->DESTROY
diff --git a/script/public-inbox-learn b/script/public-inbox-learn
index fb2d86ec..8b8e1b77 100755
--- a/script/public-inbox-learn
+++ b/script/public-inbox-learn
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used for training spam (via SpamAssassin) and removing messages from a
@@ -36,11 +36,10 @@ if ($train !~ /\A(?:ham|spam|rm)\z/) {
 die "--all only works with `rm'\n" if $opt{all} && $train ne 'rm';
 
 my $spamc = PublicInbox::Spamcheck::Spamc->new;
-my $pi_config = PublicInbox::Config->new;
+my $pi_cfg = PublicInbox::Config->new;
 my $err;
 my $mime = PublicInbox::Eml->new(do{
-        local $/;
-        my $data = <STDIN>;
+        defined(my $data = do { local $/; <STDIN> }) or die "read STDIN: $!\n";
         $data =~ s/\A[\r\n]*From [^\r\n]*\r?\n//s;
 
         if ($train ne 'rm') {
@@ -87,7 +86,7 @@ sub remove_or_add ($$$$) {
 
 # spam is removed from all known inboxes since it is often Bcc:-ed
 if ($train eq 'spam' || ($train eq 'rm' && $opt{all})) {
-        $pi_config->each_inbox(sub {
+        $pi_cfg->each_inbox(sub {
                 my ($ibx) = @_;
                 $ibx = PublicInbox::InboxWritable->new($ibx);
                 my $im = $ibx->importer(0);
@@ -102,7 +101,7 @@ if ($train eq 'spam' || ($train eq 'rm' && $opt{all})) {
         for ($mime->header('Cc'), $mime->header('To')) {
                 foreach my $addr (PublicInbox::Address::emails($_)) {
                         $addr = lc($addr);
-                        $dests{$addr} //= $pi_config->lookup($addr) // 0;
+                        $dests{$addr} //= $pi_cfg->lookup($addr) // 0;
                 }
         }
 
@@ -113,7 +112,7 @@ if ($train eq 'spam' || ($train eq 'rm' && $opt{all})) {
                 next if $seen{"$ibx"}++;
                 remove_or_add($ibx, $train, $mime, $addr);
         }
-        my $dests = PublicInbox::MDA->inboxes_for_list_id($pi_config, $mime);
+        my $dests = PublicInbox::MDA->inboxes_for_list_id($pi_cfg, $mime);
         for my $ibx (@$dests) {
                 next if $seen{"$ibx"}++;
                 remove_or_add($ibx, $train, $mime, $ibx->{-primary_address});
diff --git a/script/public-inbox-mda b/script/public-inbox-mda
index 3ed5abb6..7e2bee92 100755
--- a/script/public-inbox-mda
+++ b/script/public-inbox-mda
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Mail delivery agent for public-inbox, run from your MTA upon mail delivery
@@ -42,18 +42,18 @@ my $str = do { local $/; <STDIN> };
 $str =~ s/\A[\r\n]*From [^\r\n]*\r?\n//s;
 $ems->prepare(\$str);
 my $eml = PublicInbox::Eml->new(\$str);
-my $config = PublicInbox::Config->new;
+my $cfg = PublicInbox::Config->new;
 my $key = 'publicinboxmda.spamcheck';
 my $default = 'PublicInbox::Spamcheck::Spamc';
-my $spamc = PublicInbox::Spamcheck::get($config, $key, $default);
+my $spamc = PublicInbox::Spamcheck::get($cfg, $key, $default);
 my $dests = [];
 my $recipient = $ENV{ORIGINAL_RECIPIENT};
 if (defined $recipient) {
-        my $ibx = $config->lookup($recipient); # first check
+        my $ibx = $cfg->lookup($recipient); # first check
         push @$dests, $ibx if $ibx;
 }
 if (!scalar(@$dests)) {
-        $dests = PublicInbox::MDA->inboxes_for_list_id($config, $eml);
+        $dests = PublicInbox::MDA->inboxes_for_list_id($cfg, $eml);
         if (!scalar(@$dests) && !defined($recipient)) {
                 die "ORIGINAL_RECIPIENT not defined in ENV\n";
         }
diff --git a/script/public-inbox-nntpd b/script/public-inbox-nntpd
index f42db6fe..9fb0a8d9 100755
--- a/script/public-inbox-nntpd
+++ b/script/public-inbox-nntpd
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Standalone NNTP server for public-inbox.
diff --git a/script/public-inbox-purge b/script/public-inbox-purge
index 7bca11ea..59c03150 100755
--- a/script/public-inbox-purge
+++ b/script/public-inbox-purge
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Used for purging messages entirely from a public-inbox.  Currently
@@ -32,7 +32,7 @@ if ($opt->{help}) { print $help; exit 0 };
 my @ibxs = PublicInbox::Admin::resolve_inboxes(\@ARGV, $opt);
 PublicInbox::AdminEdit::check_editable(\@ibxs);
 
-my $data = do { local $/; <STDIN> };
+defined(my $data = do { local $/; <STDIN> }) or die "read STDIN: $!\n";
 $data =~ s/\A[\r\n]*From [^\r\n]*\r?\n//s;
 my $n_purged = 0;
 
diff --git a/script/public-inbox-watch b/script/public-inbox-watch
index 55183ef2..86349d71 100755
--- a/script/public-inbox-watch
+++ b/script/public-inbox-watch
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 my $help = <<EOF;
 usage: public-inbox-watch
@@ -14,12 +14,12 @@ use PublicInbox::Watch;
 use PublicInbox::Config;
 use PublicInbox::DS;
 use PublicInbox::Sigfd;
-use PublicInbox::Syscall qw($SFD_NONBLOCK);
+use PublicInbox::Syscall qw(SFD_NONBLOCK);
 my $do_scan = 1;
 GetOptions('scan!' => \$do_scan, # undocumented, testing only
         'help|h' => \(my $show_help)) or do { print STDERR $help; exit 1 };
 if ($show_help) { print $help; exit 0 };
-my $oldset = PublicInbox::Sigfd::block_signals();
+my $oldset = PublicInbox::DS::block_signals();
 STDOUT->autoflush(1);
 STDERR->autoflush(1);
 local $0 = $0; # local since this script may be eval-ed
@@ -57,10 +57,10 @@ if ($watch) {
         # --no-scan is only intended for testing atm, undocumented.
         PublicInbox::DS::requeue($scan) if $do_scan;
 
-        my $sigfd = PublicInbox::Sigfd->new($sig, $SFD_NONBLOCK);
-        local %SIG = (%SIG, %$sig) if !$sigfd;
+        my $sigfd = PublicInbox::Sigfd->new($sig, SFD_NONBLOCK);
+        local @SIG{keys %$sig} = values(%$sig) unless $sigfd;
         if (!$sigfd) {
-                PublicInbox::Sigfd::sig_setmask($oldset);
+                PublicInbox::DS::sig_setmask($oldset);
                 PublicInbox::DS->SetLoopTimeout(1000);
         }
         $watch->watch($sig, $oldset) while ($watch);
diff --git a/script/public-inbox-xcpdb b/script/public-inbox-xcpdb
index 84620175..3c99fde8 100755
--- a/script/public-inbox-xcpdb
+++ b/script/public-inbox-xcpdb
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
diff --git a/script/public-inbox.cgi b/script/public-inbox.cgi
index 42ab17c9..3a430d5b 100755
--- a/script/public-inbox.cgi
+++ b/script/public-inbox.cgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ or later <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Enables using PublicInbox::WWW as a CGI script
diff --git a/scripts/dc-dlvr b/scripts/dc-dlvr
index 90aab73b..935a8312 100755
--- a/scripts/dc-dlvr
+++ b/scripts/dc-dlvr
@@ -1,5 +1,5 @@
 #!/bin/sh
-# Copyright (C) 2008-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2008-2021 all contributors <meta@public-inbox.org>
 # License: GPL-3.0+ <http://www.gnu.org/licenses/gpl-3.0.txt>
 # This is installed as /etc/dc-dcvr on my system
 # to use with postfix main.cf: mailbox_command = /etc/dc-dlvr "$EXTENSION"
diff --git a/scripts/dupe-finder b/scripts/dupe-finder
index deeb0d6f..d9744fcb 100644
--- a/scripts/dupe-finder
+++ b/scripts/dupe-finder
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # ad-hoc tool for finding duplicates, unstable!
diff --git a/scripts/import_slrnspool b/scripts/import_slrnspool
index bdcc605c..d9a35dfd 100755
--- a/scripts/import_slrnspool
+++ b/scripts/import_slrnspool
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Incremental (or one-shot) importer of a slrnpull news spool
@@ -22,8 +22,8 @@ $SIG{TERM} = $sighandler;
 my $spool = shift @ARGV or die usage();
 my $recipient = $ENV{ORIGINAL_RECIPIENT};
 defined $recipient or die usage();
-my $config = PublicInbox::Config->new;
-my $ibx = $config->lookup($recipient);
+my $cfg = PublicInbox::Config->new;
+my $ibx = $cfg->lookup($recipient);
 my $git = $ibx->git;
 my $im;
 if ($ibx->version == 2) {
diff --git a/scripts/import_vger_from_mbox b/scripts/import_vger_from_mbox
index d1ce7231..c33e42e4 100644
--- a/scripts/import_vger_from_mbox
+++ b/scripts/import_vger_from_mbox
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/scripts/slrnspool2maildir b/scripts/slrnspool2maildir
index c36de0c9..8e2ba08a 100755
--- a/scripts/slrnspool2maildir
+++ b/scripts/slrnspool2maildir
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # One-off script to convert an slrnpull news spool to Maildir
diff --git a/scripts/ssoma-replay b/scripts/ssoma-replay
index 07121423..cfb0fbd9 100755
--- a/scripts/ssoma-replay
+++ b/scripts/ssoma-replay
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # A work-in-progress, but one day I hope this script is no longer
diff --git a/scripts/xhdr-num2mid b/scripts/xhdr-num2mid
index 19f5d0e0..3ca33f5d 100755
--- a/scripts/xhdr-num2mid
+++ b/scripts/xhdr-num2mid
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Useful for mapping article IDs from existing NNTP servers to MIDs
 use strict;
diff --git a/t/address.t b/t/address.t
index 6f4bff6c..6aa94628 100644
--- a/t/address.t
+++ b/t/address.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -7,26 +7,40 @@ use_ok 'PublicInbox::Address';
 
 sub test_pkg {
         my ($pkg) = @_;
-        my $emails = \&{"${pkg}::emails"};
-        my $names = \&{"${pkg}::names"};
+        my $emails = $pkg->can('emails');
+        my $names = $pkg->can('names');
+        my $pairs = $pkg->can('pairs');
 
         is_deeply([qw(e@example.com e@example.org)],
                 [$emails->('User <e@example.com>, e@example.org')],
                 'address extraction works as expected');
 
+        is_deeply($pairs->('User <e@example.com>, e@example.org'),
+                        [[qw(User e@example.com)], [undef, 'e@example.org']],
+                "pair extraction works ($pkg)");
+
         is_deeply(['user@example.com'],
                 [$emails->('<user@example.com (Comment)>')],
                 'comment after domain accepted before >');
+        is_deeply($pairs->('<user@example.com (Comment)>'),
+                [[qw(Comment user@example.com)]], "comment as name ($pkg)");
 
-        my @names = $names->(
-                'User <e@e>, e@e, "John A. Doe" <j@d>, <x@x>, <y@x> (xyz), '.
-                'U Ser <u@x> (do not use)');
+        my $s = 'User <e@e>, e@e, "John A. Doe" <j@d>, <x@x>, <y@x> (xyz), '.
+                'U Ser <u@x> (do not use)';
+        my @names = $names->($s);
         is_deeply(\@names, ['User', 'e', 'John A. Doe', 'x', 'xyz', 'U Ser'],
                 'name extraction works as expected');
+        is_deeply($pairs->($s), [ [ 'User', 'e@e' ], [ undef, 'e@e' ],
+                        [ 'John A. Doe', 'j@d' ], [ undef, 'x@x' ],
+                        [ 'xyz', 'y@x' ], [ 'U Ser', 'u@x' ] ],
+                "pairs extraction works for $pkg");
 
         @names = $names->('"user@example.com" <user@example.com>');
         is_deeply(['user'], \@names,
                 'address-as-name extraction works as expected');
+        is_deeply($pairs->('"user@example.com" <user@example.com>'),
+                [ [ 'user@example.com', 'user@example.com' ] ],
+                "pairs for $pkg");
 
         {
                 my $backwards = 'u@example.com (John Q. Public)';
@@ -34,10 +48,17 @@ sub test_pkg {
                 is_deeply(\@names, ['John Q. Public'], 'backwards name OK');
                 my @emails = $emails->($backwards);
                 is_deeply(\@emails, ['u@example.com'], 'backwards emails OK');
+
+                is_deeply($pairs->($backwards),
+                        [ [ 'John Q. Public', 'u@example.com' ] ],
+                        "backwards pairs $pkg");
         }
 
-        @names = $names->('"Quote Unneeded" <user@example.com>');
+        $s = '"Quote Unneeded" <user@example.com>';
+        @names = $names->($s);
         is_deeply(['Quote Unneeded'], \@names, 'extra quotes dropped');
+        is_deeply($pairs->($s), [ [ 'Quote Unneeded', 'user@example.com' ] ],
+                "extra quotes dropped in pairs $pkg");
 
         my @emails = $emails->('Local User <user>');
         is_deeply([], \@emails , 'no address for local address');
diff --git a/t/admin.t b/t/admin.t
index c25667b2..fbfcd6d3 100644
--- a/t/admin.t
+++ b/t/admin.t
@@ -1,28 +1,29 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
 use Test::More;
 use PublicInbox::TestCommon;
 use PublicInbox::Import;
-use_ok 'PublicInbox::Admin', qw(resolve_repo_dir);
+use_ok 'PublicInbox::Admin';
 my ($tmpdir, $for_destroy) = tmpdir();
 my $git_dir = "$tmpdir/v1";
 my $v2_dir = "$tmpdir/v2";
 my ($res, $err, $v);
 
 PublicInbox::Import::init_bare($git_dir);
+*resolve_inboxdir = \&PublicInbox::Admin::resolve_inboxdir;
 
 # v1
-is(resolve_repo_dir($git_dir), $git_dir, 'top-level GIT_DIR resolved');
-is(resolve_repo_dir("$git_dir/objects"), $git_dir, 'GIT_DIR/objects resolved');
+is(resolve_inboxdir($git_dir), $git_dir, 'top-level GIT_DIR resolved');
+is(resolve_inboxdir("$git_dir/objects"), $git_dir, 'GIT_DIR/objects resolved');
 
 ok(chdir($git_dir), 'chdir GIT_DIR works');
-is(resolve_repo_dir(), $git_dir, 'resolve_repo_dir works in GIT_DIR');
+is(resolve_inboxdir(), $git_dir, 'resolve_inboxdir works in GIT_DIR');
 
 ok(chdir("$git_dir/objects"), 'chdir GIT_DIR/objects works');
-is(resolve_repo_dir(), $git_dir, 'resolve_repo_dir works in GIT_DIR');
-$res = resolve_repo_dir(undef, \$v);
+is(resolve_inboxdir(), $git_dir, 'resolve_inboxdir works in GIT_DIR');
+$res = resolve_inboxdir(undef, \$v);
 is($v, 1, 'version 1 detected');
 is($res, $git_dir, 'detects directory along with version');
 
@@ -36,13 +37,13 @@ SKIP: {
 
         ok(chdir($no_vcs_dir), 'chdir to a non-inbox');
         open STDERR, '>&', $null or die "redirect stderr to /dev/null: $!";
-        $res = eval { resolve_repo_dir() };
+        $res = eval { resolve_inboxdir() };
         open STDERR, '>&', $olderr or die "restore stderr: $!";
         is($res, undef, 'fails inside non-version-controlled dir');
 
         ok(chdir($tmpdir), 'back to test-specific $tmpdir');
         open STDERR, '>&', $null or die "redirect stderr to /dev/null: $!";
-        $res = eval { resolve_repo_dir($no_vcs_dir) };
+        $res = eval { resolve_inboxdir($no_vcs_dir) };
         $err = $@;
         open STDERR, '>&', $olderr or die "restore stderr: $!";
         is($res, undef, 'fails on non-version-controlled dir');
@@ -66,18 +67,25 @@ SKIP: {
         PublicInbox::V2Writable->new($ibx, 1)->idx_init;
 
         ok(-e "$v2_dir/inbox.lock", 'exists');
-        is(resolve_repo_dir($v2_dir), $v2_dir,
-                'resolve_repo_dir works on v2_dir');
-        ok(chdir($v2_dir), 'chdir v2_dir OK');
-        is(resolve_repo_dir(), $v2_dir, 'resolve_repo_dir works inside v2_dir');
-        $res = resolve_repo_dir(undef, \$v);
+        is(resolve_inboxdir($v2_dir), $v2_dir,
+                'resolve_inboxdir works on v2_dir');
+        chdir($v2_dir) or BAIL_OUT "chdir v2_dir: $!";
+        is(resolve_inboxdir(), $v2_dir, 'resolve_inboxdir works inside v2_dir');
+        $res = resolve_inboxdir(undef, \$v);
         is($v, 2, 'version 2 detected');
         is($res, $v2_dir, 'detects directory along with version');
 
         # TODO: should work from inside Xapian dirs, and git dirs, here...
+        PublicInbox::Import::init_bare("$v2_dir/git/0.git");
+        my $objdir = "$v2_dir/git/0.git/objects";
+        is($v2_dir, resolve_inboxdir($objdir, \$v), 'at $objdir');
+        is($v, 2, 'version 2 detected at $objdir');
+        chdir($objdir) or BAIL_OUT "chdir objdir: $!";
+        is(resolve_inboxdir(undef, \$v), $v2_dir, 'inside $objdir');
+        is($v, 2, 'version 2 detected inside $objdir');
 }
 
-chdir '/';
+chdir '/' or BAIL_OUT "chdir: $!";
 
 my @pairs = (
         '1g' => 1024 ** 3,
diff --git a/t/altid.t b/t/altid.t
index 816f5f5b..0e9da07e 100644
--- a/t/altid.t
+++ b/t/altid.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/altid_v2.t b/t/altid_v2.t
index f04b547b..c6295b2f 100644
--- a/t/altid_v2.t
+++ b/t/altid_v2.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/cgi.t b/t/cgi.t
index 96c627c3..3818b991 100644
--- a/t/cgi.t
+++ b/t/cgi.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # FIXME: this test is too slow and most non-CGI-requirements
 # should be moved over to things which use test_psgi
diff --git a/t/check-www-inbox.perl b/t/check-www-inbox.perl
index dc463ea8..eee8adc2 100644
--- a/t/check-www-inbox.perl
+++ b/t/check-www-inbox.perl
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Parallel WWW checker
 my $usage = "$0 [-j JOBS] [-s SLOW_THRESHOLD] URL_OF_INBOX\n";
diff --git a/t/cmd_ipc.t b/t/cmd_ipc.t
new file mode 100644
index 00000000..84f8fb4d
--- /dev/null
+++ b/t/cmd_ipc.t
@@ -0,0 +1,130 @@
+#!perl -w
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use Socket qw(AF_UNIX SOCK_STREAM MSG_EOR);
+pipe(my ($r, $w)) or BAIL_OUT;
+my ($send, $recv);
+require_ok 'PublicInbox::Spawn';
+my $SOCK_SEQPACKET = eval { Socket::SOCK_SEQPACKET() } // undef;
+use Time::HiRes qw(alarm);
+
+my $do_test = sub { SKIP: {
+        my ($type, $flag, $desc) = @_;
+        defined $type or skip 'SOCK_SEQPACKET missing', 7;
+        my ($s1, $s2);
+        my $src = 'some payload' x 40;
+        socketpair($s1, $s2, AF_UNIX, $type, 0) or BAIL_OUT $!;
+        my $sfds = [ fileno($r), fileno($w), fileno($s1) ];
+        $send->($s1, $sfds, $src, $flag);
+        my (@fds) = $recv->($s2, my $buf, length($src) + 1);
+        is($buf, $src, 'got buffer payload '.$desc);
+        my ($r1, $w1, $s1a);
+        my $opens = sub {
+                ok(open($r1, '<&=', $fds[0]), 'opened received $r');
+                ok(open($w1, '>&=', $fds[1]), 'opened received $w');
+                ok(open($s1a, '+>&=', $fds[2]), 'opened received $s1');
+        };
+        $opens->();
+        my @exp = stat $r;
+        my @cur = stat $r1;
+        is("$exp[0]\0$exp[1]", "$cur[0]\0$cur[1]", '$r dev/ino matches');
+        @exp = stat $w;
+        @cur = stat $w1;
+        is("$exp[0]\0$exp[1]", "$cur[0]\0$cur[1]", '$w dev/ino matches');
+        @exp = stat $s1;
+        @cur = stat $s1a;
+        is("$exp[0]\0$exp[1]", "$cur[0]\0$cur[1]", '$s1 dev/ino matches');
+        if (defined($SOCK_SEQPACKET) && $type == $SOCK_SEQPACKET) {
+                $r1 = $w1 = $s1a = undef;
+                $src = (',' x 1023) . '-' .('.' x 1024);
+                $send->($s1, $sfds, $src, $flag);
+                (@fds) = $recv->($s2, $buf, 1024);
+                is($buf, (',' x 1023) . '-', 'silently truncated buf');
+                $opens->();
+                $r1 = $w1 = $s1a = undef;
+
+                $s2->blocking(0);
+                @fds = $recv->($s2, $buf, length($src) + 1);
+                ok($!{EAGAIN}, "EAGAIN set by ($desc)");
+                is_deeply(\@fds, [ undef ], "EAGAIN $desc");
+                $s2->blocking(1);
+
+                my $alrm = 0;
+                local $SIG{ALRM} = sub { $alrm++ };
+                alarm(0.001);
+                @fds = $recv->($s2, $buf, length($src) + 1);
+                ok($!{EINTR}, "EINTR set by ($desc)");
+                is_deeply(\@fds, [ undef ], "EINTR $desc");
+                is($alrm, 1, 'SIGALRM hit');
+
+                close $s1;
+                @fds = $recv->($s2, $buf, length($src) + 1);
+                is_deeply(\@fds, [], "no FDs on EOF $desc");
+                is($buf, '', "buffer cleared on EOF ($desc)");
+
+                socketpair($s1, $s2, AF_UNIX, $type, 0) or BAIL_OUT $!;
+                $s1->blocking(0);
+                my $nsent = 0;
+                while (defined(my $n = $send->($s1, $sfds, $src, $flag))) {
+                        $nsent += $n;
+                        fail "sent 0 bytes" if $n == 0;
+                }
+                ok($!{EAGAIN}, "hit EAGAIN on send $desc");
+                ok($nsent > 0, 'sent some bytes');
+
+                socketpair($s1, $s2, AF_UNIX, $type, 0) or BAIL_OUT $!;
+                is($send->($s1, [], $src, $flag), length($src), 'sent w/o FDs');
+                $buf = 'nope';
+                @fds = $recv->($s2, $buf, length($src));
+                is(scalar(@fds), 0, 'no FDs received');
+                is($buf, $src, 'recv w/o FDs');
+
+                my $nr = 2 * 1024 * 1024;
+                while (1) {
+                        vec(my $vec = '', $nr * 8 - 1, 1) = 1;
+                        my $n = $send->($s1, [], $vec, $flag);
+                        if (defined($n)) {
+                                $n == length($vec) or
+                                        fail "short send: $n != ".length($vec);
+                                diag "sent $nr, retrying with more";
+                                $nr += 2 * 1024 * 1024;
+                        } else {
+                                ok($!{EMSGSIZE}, 'got EMSGSIZE');
+                                # diag "$nr bytes hits EMSGSIZE";
+                                last;
+                        }
+                }
+        }
+} };
+
+my $send_ic = PublicInbox::Spawn->can('send_cmd4');
+my $recv_ic = PublicInbox::Spawn->can('recv_cmd4');
+SKIP: {
+        ($send_ic && $recv_ic) or skip 'Inline::C not installed/enabled', 12;
+        $send = $send_ic;
+        $recv = $recv_ic;
+        $do_test->(SOCK_STREAM, 0, 'Inline::C stream');
+        $do_test->($SOCK_SEQPACKET, MSG_EOR, 'Inline::C seqpacket');
+}
+
+SKIP: {
+        require_mods('Socket::MsgHdr', 13);
+        require_ok 'PublicInbox::CmdIPC4';
+        $send = PublicInbox::CmdIPC4->can('send_cmd4');
+        $recv = PublicInbox::CmdIPC4->can('recv_cmd4');
+        $do_test->(SOCK_STREAM, 0, 'MsgHdr stream');
+        $do_test->($SOCK_SEQPACKET, MSG_EOR, 'MsgHdr seqpacket');
+        SKIP: {
+                ($send_ic && $recv_ic) or
+                        skip 'Inline::C not installed/enabled', 12;
+                $recv = $recv_ic;
+                $do_test->(SOCK_STREAM, 0, 'Inline::C -> MsgHdr stream');
+                $do_test->($SOCK_SEQPACKET, 0, 'Inline::C -> MsgHdr seqpacket');
+        }
+}
+
+done_testing;
diff --git a/t/config.t b/t/config.t
index 204fc790..fe684106 100644
--- a/t/config.t
+++ b/t/config.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -41,7 +41,6 @@ my ($tmpdir, $for_destroy) = tmpdir();
                 'url' => [ 'http://example.com/meta' ],
                 -primary_address => 'meta@public-inbox.org',
                 'name' => 'meta',
-                feedmax => 25,
                 -httpbackend_limiter => undef,
                 nntpserver => undef,
         }, "lookup matches expected output");
@@ -58,7 +57,6 @@ my ($tmpdir, $for_destroy) = tmpdir();
                 'inboxdir' => '/home/pi/test-main.git',
                 'domain' => 'public-inbox.org',
                 'name' => 'test',
-                feedmax => 25,
                 'url' => [ 'http://example.com/test' ],
                 -httpbackend_limiter => undef,
                 nntpserver => undef,
diff --git a/t/config_limiter.t b/t/config_limiter.t
index 0da8903d..8c83aca8 100644
--- a/t/config_limiter.t
+++ b/t/config_limiter.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/content_hash.t b/t/content_hash.t
index 646aab07..3f02b1b3 100644
--- a/t/content_hash.t
+++ b/t/content_hash.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/convert-compact.t b/t/convert-compact.t
index e479476d..cdb9e3f5 100644
--- a/t/convert-compact.t
+++ b/t/convert-compact.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -21,8 +21,8 @@ my $ibx = {
 
 PublicInbox::Import::init_bare($ibx->{inboxdir});
 ok(umask(077), 'set restrictive umask');
-ok(PublicInbox::Import::run_die([qw(git) , "--git-dir=$ibx->{inboxdir}",
-        qw(config core.sharedRepository 0644)]), 'set sharedRepository');
+xsys_e(qw(git) , "--git-dir=$ibx->{inboxdir}",
+        qw(config core.sharedRepository 0644));
 $ibx = PublicInbox::Inbox->new($ibx);
 my $im = PublicInbox::Import->new($ibx->git, undef, undef, $ibx);
 my $mime = PublicInbox::Eml->new(<<'EOF');
diff --git a/t/data/message_embed.eml b/t/data/message_embed.eml
index a7aa88ac..95758084 100644
--- a/t/data/message_embed.eml
+++ b/t/data/message_embed.eml
@@ -63,7 +63,7 @@ index 00000000..166baf91
 --- /dev/null
 +++ b/lib/PublicInbox/MailHeader.pm
 @@ -0,0 +1,55 @@
-+# Copyright (C) 2020 all contributors <meta@public-inbox.org>
++# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 +# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 +package PublicInbox::MailHeader;
 +use strict;
diff --git a/t/dir_idle.t b/t/dir_idle.t
index 587599e8..d62eb5a2 100644
--- a/t/dir_idle.t
+++ b/t/dir_idle.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use Test::More;
 use_ok 'PublicInbox::DirIdle';
diff --git a/t/ds-kqxs.t b/t/ds-kqxs.t
index 718567d6..43c71fed 100644
--- a/t/ds-kqxs.t
+++ b/t/ds-kqxs.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # Licensed the same as Danga::Socket (and Perl5)
 # License: GPL-1.0+ or Artistic-1.0-Perl
 #  <https://www.gnu.org/licenses/gpl-1.0.txt>
diff --git a/t/ds-leak.t b/t/ds-leak.t
index 72bf0379..57d9cd72 100644
--- a/t/ds-leak.t
+++ b/t/ds-leak.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # Licensed the same as Danga::Socket (and Perl5)
 # License: GPL-1.0+ or Artistic-1.0-Perl
 #  <https://www.gnu.org/licenses/gpl-1.0.txt>
diff --git a/t/ds-poll.t b/t/ds-poll.t
index 3771059b..d8861369 100644
--- a/t/ds-poll.t
+++ b/t/ds-poll.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # Licensed the same as Danga::Socket (and Perl5)
 # License: GPL-1.0+ or Artistic-1.0-Perl
 #  <https://www.gnu.org/licenses/gpl-1.0.txt>
@@ -16,35 +16,35 @@ pipe($r, $w) or die;
 pipe($x, $y) or die;
 is($p->epoll_ctl(EPOLL_CTL_ADD, fileno($r), EPOLLIN), 0, 'add EPOLLIN');
 my $events = [];
-my $n = $p->epoll_wait(9, 0, $events);
+$p->epoll_wait(9, 0, $events);
 is_deeply($events, [], 'no events set');
-is($n, 0, 'nothing ready, yet');
 is($p->epoll_ctl(EPOLL_CTL_ADD, fileno($w), EPOLLOUT|EPOLLONESHOT), 0,
         'add EPOLLOUT|EPOLLONESHOT');
-$n = $p->epoll_wait(9, -1, $events);
-is($n, 1, 'got POLLOUT event');
-is($events->[0]->[0], fileno($w), '$w ready');
+$p->epoll_wait(9, -1, $events);
+is(scalar(@$events), 1, 'got POLLOUT event');
+is($events->[0], fileno($w), '$w ready');
 
-$n = $p->epoll_wait(9, 0, $events);
-is($n, 0, 'nothing ready after oneshot');
+$p->epoll_wait(9, 0, $events);
+is(scalar(@$events), 0, 'nothing ready after oneshot');
 is_deeply($events, [], 'no events set after oneshot');
 
 syswrite($w, '1') == 1 or die;
 for my $t (0..1) {
-        $n = $p->epoll_wait(9, $t, $events);
-        is($events->[0]->[0], fileno($r), "level-trigger POLLIN ready #$t");
-        is($n, 1, "only event ready #$t");
+        $p->epoll_wait(9, $t, $events);
+        is($events->[0], fileno($r), "level-trigger POLLIN ready #$t");
+        is(scalar(@$events), 1, "only event ready #$t");
 }
 syswrite($y, '1') == 1 or die;
 is($p->epoll_ctl(EPOLL_CTL_ADD, fileno($x), EPOLLIN|EPOLLONESHOT), 0,
         'EPOLLIN|EPOLLONESHOT add');
-is($p->epoll_wait(9, -1, $events), 2, 'epoll_wait has 2 ready');
-my @fds = sort(map { $_->[0] } @$events);
+$p->epoll_wait(9, -1, $events);
+is(scalar @$events, 2, 'epoll_wait has 2 ready');
+my @fds = sort @$events;
 my @exp = sort((fileno($r), fileno($x)));
 is_deeply(\@fds, \@exp, 'got both ready FDs');
 
 is($p->epoll_ctl(EPOLL_CTL_DEL, fileno($r), 0), 0, 'EPOLL_CTL_DEL OK');
-$n = $p->epoll_wait(9, 0, $events);
-is($n, 0, 'nothing ready after EPOLL_CTL_DEL');
+$p->epoll_wait(9, 0, $events);
+is(scalar @$events, 0, 'nothing ready after EPOLL_CTL_DEL');
 
 done_testing;
diff --git a/t/edit.t b/t/edit.t
index dbdda394..0d57e629 100644
--- a/t/edit.t
+++ b/t/edit.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # edit frontend behavior test (t/replace.t for backend)
 use strict;
diff --git a/t/emergency.t b/t/emergency.t
index 74cc1d2e..60dba2ad 100644
--- a/t/emergency.t
+++ b/t/emergency.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/eml.t b/t/eml.t
index 4d1c1216..ebd45c13 100644
--- a/t/eml.t
+++ b/t/eml.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/eml_content_disposition.t b/t/eml_content_disposition.t
index 9bdacc05..099587f8 100644
--- a/t/eml_content_disposition.t
+++ b/t/eml_content_disposition.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # Copyright (C) 2004- Simon Cozens, Casey West, Ricardo SIGNES
 # This library is free software; you can redistribute it and/or modify
 # it under the same terms as Perl itself.
diff --git a/t/eml_content_type.t b/t/eml_content_type.t
index 5acd51ad..ab8d4b2d 100644
--- a/t/eml_content_type.t
+++ b/t/eml_content_type.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # Copyright (C) 2004- Simon Cozens, Casey West, Ricardo SIGNES
 # This library is free software; you can redistribute it and/or modify
 # it under the same terms as Perl itself.
diff --git a/t/epoll.t b/t/epoll.t
index b47650e3..a1e73e07 100644
--- a/t/epoll.t
+++ b/t/epoll.t
@@ -12,11 +12,11 @@ is(epoll_ctl($epfd, EPOLL_CTL_ADD, fileno($w), EPOLLOUT), 0,
     'epoll_ctl socket EPOLLOUT');
 
 my @events;
-is(epoll_wait($epfd, 100, 10000, \@events), 1, 'epoll_wait returns');
+epoll_wait($epfd, 100, 10000, \@events);
 is(scalar(@events), 1, 'got one event');
-is($events[0]->[0], fileno($w), 'got expected FD');
-is($events[0]->[1], EPOLLOUT, 'got expected event');
+is($events[0], fileno($w), 'got expected FD');
 close $w;
-is(epoll_wait($epfd, 100, 0, \@events), 0, 'epoll_wait timeout');
+epoll_wait($epfd, 100, 0, \@events);
+is(@events, 0, 'epoll_wait timeout');
 
 done_testing;
diff --git a/t/extsearch.t b/t/extsearch.t
new file mode 100644
index 00000000..2c3f7547
--- /dev/null
+++ b/t/extsearch.t
@@ -0,0 +1,369 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::Config;
+use PublicInbox::Search;
+use PublicInbox::InboxWritable;
+use Fcntl qw(:seek);
+require_git(2.6);
+require_mods(qw(json DBD::SQLite Search::Xapian));
+use_ok 'PublicInbox::ExtSearch';
+use_ok 'PublicInbox::ExtSearchIdx';
+use_ok 'PublicInbox::OverIdx';
+my $sock = tcp_server();
+my $host_port = $sock->sockhost . ':' . $sock->sockport;
+my ($home, $for_destroy) = tmpdir();
+local $ENV{HOME} = $home;
+mkdir "$home/.public-inbox" or BAIL_OUT $!;
+my $cfg_path = "$home/.public-inbox/config";
+open my $fh, '>', $cfg_path or BAIL_OUT $!;
+print $fh <<EOF or BAIL_OUT $!;
+[publicinboxMda]
+        spamcheck = none
+EOF
+close $fh or BAIL_OUT $!;
+my $v2addr = 'v2test@example.com';
+my $v1addr = 'v1test@example.com';
+ok(run_script([qw(-init -Lbasic -V2 v2test --newsgroup v2.example),
+        "$home/v2test", 'http://example.com/v2test', $v2addr ]), 'v2test init');
+my $env = { ORIGINAL_RECIPIENT => $v2addr };
+my $eml = eml_load('t/utf8.eml');
+
+$eml->header_set('List-Id', '<v2.example.com>');
+open($fh, '+>', undef) or BAIL_OUT $!;
+$fh->autoflush(1);
+print $fh $eml->as_string or BAIL_OUT $!;
+seek($fh, 0, SEEK_SET) or BAIL_OUT $!;
+
+run_script(['-mda', '--no-precheck'], $env, { 0 => $fh }) or BAIL_OUT '-mda';
+
+ok(run_script([qw(-init -V1 v1test --newsgroup v1.example), "$home/v1test",
+        'http://example.com/v1test', $v1addr ]), 'v1test init');
+
+$eml->header_set('List-Id', '<v1.example.com>');
+seek($fh, 0, SEEK_SET) or BAIL_OUT $!;
+truncate($fh, 0) or BAIL_OUT $!;
+print $fh $eml->as_string or BAIL_OUT $!;
+seek($fh, 0, SEEK_SET) or BAIL_OUT $!;
+
+$env = { ORIGINAL_RECIPIENT => $v1addr };
+run_script(['-mda', '--no-precheck'], $env, { 0 => $fh }) or BAIL_OUT '-mda';
+
+run_script([qw(-index -Lbasic), "$home/v1test"]) or BAIL_OUT "index $?";
+
+ok(run_script([qw(-extindex --all), "$home/extindex"]), 'extindex init');
+{
+        my $es = PublicInbox::ExtSearch->new("$home/extindex");
+        ok($es->has_threadid, '->has_threadid');
+}
+
+{ # TODO: -extindex should write this to config
+        open $fh, '>>', $cfg_path or BAIL_OUT $!;
+        print $fh <<EOF or BAIL_OUT $!;
+; for ->ALL
+[extindex "all"]
+        topdir = $home/extindex
+EOF
+        close $fh or BAIL_OUT $!;
+
+        my $pi_cfg = PublicInbox::Config->new;
+        $pi_cfg->fill_all;
+        ok($pi_cfg->ALL, '->ALL');
+        my $ibx = $pi_cfg->{-by_newsgroup}->{'v2.example'};
+        my $ret = $pi_cfg->ALL->nntp_xref_for($ibx, $ibx->over->get_art(1));
+        is_deeply($ret, { 'v1.example' => 1, 'v2.example' => 1 },
+                '->nntp_xref_for');
+}
+
+SKIP: {
+        require_mods(qw(Net::NNTP), 1);
+        my ($out, $err) = ("$home/nntpd.out.log", "$home/nntpd.err.log");
+        my $cmd = [ '-nntpd', '-W0', "--stdout=$out", "--stderr=$err" ];
+        my $td = start_script($cmd, undef, { 3 => $sock });
+        my $n = Net::NNTP->new($host_port);
+        my @xp = $n->xpath('<testmessage@example.com>');
+        is_deeply(\@xp, [ qw(v1.example/1 v2.example/1) ]);
+        $n->group('v1.example');
+        my $res = $n->head(1);
+        @$res = grep(/^Xref: /, @$res);
+        like($res->[0], qr/ v1\.example:1 v2\.example:1/, 'nntp_xref works');
+}
+
+my $es = PublicInbox::ExtSearch->new("$home/extindex");
+{
+        my $smsg = $es->over->get_art(1);
+        ok($smsg, 'got first article');
+        is($es->over->get_art(2), undef, 'only one added');
+        my $xref3 = $es->over->get_xref3(1);
+        like($xref3->[0], qr/\A\Qv2.example\E:1:/, 'order preserved 1');
+        like($xref3->[1], qr/\A\Qv1.example\E:1:/, 'order preserved 2');
+        is(scalar(@$xref3), 2, 'only to entries');
+}
+
+if ('inbox edited') {
+        my ($in, $out, $err);
+        $in = $out = $err = '';
+        my $opt = { 0 => \$in, 1 => \$out, 2 => \$err };
+        my $env = { MAIL_EDITOR => "$^X -i -p -e 's/test message/BEST MSG/'" };
+        my $cmd = [ qw(-edit -Ft/utf8.eml), "$home/v2test" ];
+        ok(run_script($cmd, $env, $opt), '-edit');
+        ok(run_script([qw(-extindex --all), "$home/extindex"], undef, $opt),
+                'extindex again');
+        like($err, qr/discontiguous range/, 'warned about discontiguous range');
+        my $msg1 = $es->over->get_art(1) or BAIL_OUT 'msg1 missing';
+        my $msg2 = $es->over->get_art(2) or BAIL_OUT 'msg2 missing';
+        is($msg1->{mid}, $msg2->{mid}, 'edited message indexed');
+        isnt($msg1->{blob}, $msg2->{blob}, 'blobs differ');
+        my $eml2 = $es->smsg_eml($msg2);
+        like($eml2->body, qr/BEST MSG/, 'edited body in #2');
+        unlike($eml2->body, qr/test message/, 'old body discarded in #2');
+        my $eml1 = $es->smsg_eml($msg1);
+        like($eml1->body, qr/test message/, 'original body in #1');
+        my $x1 = $es->over->get_xref3(1);
+        my $x2 = $es->over->get_xref3(2);
+        is(scalar(@$x1), 1, 'original only has one xref3');
+        is(scalar(@$x2), 1, 'new message has one xref3');
+        isnt($x1->[0], $x2->[0], 'xref3 differs');
+
+        my $mset = $es->mset('b:"BEST MSG"');
+        is($mset->size, 1, 'new message found');
+        $mset = $es->mset('b:"test message"');
+        is($mset->size, 1, 'old message found');
+        delete @$es{qw(git over xdb)}; # fork preparation
+
+        my $pi_cfg = PublicInbox::Config->new;
+        $pi_cfg->fill_all;
+        is(scalar($pi_cfg->ALL->mset('s:Testing')->items), 2,
+                '2 results in ->ALL');
+        my $res = {};
+        my $nr = 0;
+        $pi_cfg->each_inbox(sub {
+                $nr++;
+                my ($ibx) = @_;
+                local $SIG{__WARN__} = sub {}; # FIXME support --reindex
+                my $mset = $ibx->isrch->mset('s:Testing');
+                $res->{$ibx->eidx_key} = $ibx->isrch->mset_to_smsg($ibx, $mset);
+        });
+        is($nr, 2, 'two inboxes');
+        my $exp = {};
+        for my $v (qw(v1 v2)) {
+                my $ibx = $pi_cfg->lookup_newsgroup("$v.example");
+                my $smsg = $ibx->over->get_art(1);
+                $smsg->psgi_cull;
+                $exp->{"$v.example"} = [ $smsg ];
+        }
+        is_deeply($res, $exp, 'isearch limited results');
+        $pi_cfg = $res = $exp = undef;
+
+        open my $rmfh, '+>', undef or BAIL_OUT $!;
+        $rmfh->autoflush(1);
+        print $rmfh $eml2->as_string or BAIL_OUT $!;
+        seek($rmfh, 0, SEEK_SET) or BAIL_OUT $!;
+        $opt->{0} = $rmfh;
+        ok(run_script([qw(-learn rm --all)], undef, $opt), '-learn rm');
+
+        ok(run_script([qw(-extindex --all), "$home/extindex"], undef, undef),
+                'extindex after rm');
+        is($es->over->get_art(2), undef, 'doc #2 gone');
+        $mset = $es->mset('b:"BEST MSG"');
+        is($mset->size, 0, 'new message gone');
+}
+
+my $misc = $es->misc;
+my @it = $misc->mset('')->items;
+is(scalar(@it), 2, 'two inboxes');
+like($it[0]->get_document->get_data, qr/v2test/, 'docdata matched v2');
+like($it[1]->get_document->get_data, qr/v1test/, 'docdata matched v1');
+
+my $cfg = PublicInbox::Config->new;
+my $schema_version = PublicInbox::Search::SCHEMA_VERSION();
+my $f = "$home/extindex/ei$schema_version/over.sqlite3";
+my $oidx = PublicInbox::OverIdx->new($f);
+if ('inject w/o indexing') {
+        use PublicInbox::Import;
+        my $v1ibx = $cfg->lookup_name('v1test');
+        my $last_v1_commit = $v1ibx->mm->last_commit;
+        my $v2ibx = $cfg->lookup_name('v2test');
+        my $last_v2_commit = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        my $git0 = PublicInbox::Git->new("$v2ibx->{inboxdir}/git/0.git");
+        chomp(my $cmt = $git0->qx(qw(rev-parse HEAD^0)));
+        is($last_v2_commit, $cmt, 'v2 index up-to-date');
+
+        my $v2im = PublicInbox::Import->new($git0, undef, undef, $v2ibx);
+        $v2im->{lock_path} = undef;
+        $v2im->{path_type} = 'v2';
+        $v2im->add(eml_load('t/mda-mime.eml'));
+        $v2im->done;
+        chomp(my $tip = $git0->qx(qw(rev-parse HEAD^0)));
+        isnt($tip, $cmt, '0.git v2 updated');
+
+        # inject a message w/o updating index
+        rename("$home/v1test/public-inbox", "$home/v1test/skip-index") or
+                BAIL_OUT $!;
+        open(my $eh, '<', 't/iso-2202-jp.eml') or BAIL_OUT $!;
+        run_script(['-mda', '--no-precheck'], $env, { 0 => $eh}) or
+                BAIL_OUT '-mda';
+        rename("$home/v1test/skip-index", "$home/v1test/public-inbox") or
+                BAIL_OUT $!;
+
+        my ($in, $out, $err);
+        $in = $out = $err = '';
+        my $opt = { 0 => \$in, 1 => \$out, 2 => \$err };
+        ok(run_script([qw(-extindex -v -v --all), "$home/extindex"],
+                undef, undef), 'extindex noop');
+        $es->{xdb}->reopen;
+        my $mset = $es->mset('mid:199707281508.AAA24167@hoyogw.example');
+        is($mset->size, 0, 'did not attempt to index unindexed v1 message');
+        $mset = $es->mset('mid:multipart-html-sucks@11');
+        is($mset->size, 0, 'did not attempt to index unindexed v2 message');
+        ok(run_script([qw(-index --all)]), 'indexed v1 and v2 inboxes');
+
+        isnt($v1ibx->mm->last_commit, $last_v1_commit, '-index v1 worked');
+        isnt($v2ibx->mm->last_commit_xap($schema_version, 0),
+                $last_v2_commit, '-index v2 worked');
+        ok(run_script([qw(-extindex --all), "$home/extindex"]),
+                'extindex updates');
+
+        $es->{xdb}->reopen;
+        $mset = $es->mset('mid:199707281508.AAA24167@hoyogw.example');
+        is($mset->size, 1, 'got v1 message');
+        $mset = $es->mset('mid:multipart-html-sucks@11');
+        is($mset->size, 1, 'got v2 message');
+}
+
+if ('reindex catches missed messages') {
+        my $v2ibx = $cfg->lookup_name('v2test');
+        my $im = PublicInbox::InboxWritable->new($v2ibx)->importer(0);
+        my $cmt_a = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        my $eml = eml_load('t/data/0001.patch');
+        $im->add($eml);
+        $im->done;
+        my $cmt_b = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        isnt($cmt_a, $cmt_b, 'v2 0.git HEAD updated');
+        $oidx->dbh;
+        my $uv = $v2ibx->uidvalidity;
+        my $lc_key = "lc-v2:v2.example//$uv;0";
+        is($oidx->eidx_meta($lc_key, $cmt_b), $cmt_a,
+                'update lc-v2 meta, old is as expected');
+        my $max = $oidx->max;
+        $oidx->dbh_close;
+        ok(run_script([qw(-extindex), "$home/extindex", $v2ibx->{inboxdir}]),
+                '-extindex noop');
+        is($oidx->max, $max, '->max unchanged');
+        is($oidx->eidx_meta($lc_key), $cmt_b, 'lc-v2 unchanged');
+        $oidx->dbh_close;
+        my $opt = { 2 => \(my $err = '') };
+        ok(run_script([qw(-extindex --reindex), "$home/extindex",
+                        $v2ibx->{inboxdir}], undef, $opt),
+                        '--reindex for unseen');
+        is($oidx->max, $max + 1, '->max bumped');
+        is($oidx->eidx_meta($lc_key), $cmt_b, 'lc-v2 stays unchanged');
+        my @err = split(/^/, $err);
+        is(scalar(@err), 1, 'only one warning') or diag "err=$err";
+        like($err[0], qr/I: reindex_unseen/, 'got reindex_unseen message');
+        my $new = $oidx->get_art($max + 1);
+        is($new->{subject}, $eml->header('Subject'), 'new message added');
+
+        $es->{xdb}->reopen;
+        my $mset = $es->mset("mid:$new->{mid}");
+        is($mset->size, 1, 'previously unseen, now indexed in Xapian');
+
+        ok($im->remove($eml), 'remove new message from v2 inbox');
+        $im->done;
+        my $cmt_c = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        is($oidx->eidx_meta($lc_key, $cmt_c), $cmt_b,
+                'bump lc-v2 meta again to skip v2 remove');
+        $err = '';
+        $oidx->dbh_close;
+        ok(run_script([qw(-extindex --reindex), "$home/extindex",
+                        $v2ibx->{inboxdir}], undef, $opt),
+                        '--reindex for stale');
+        @err = split(/^/, $err);
+        is(scalar(@err), 1, 'only one warning') or diag "err=$err";
+        like($err[0], qr/\(#$new->{num}\): stale/, 'got stale message warning');
+        is($oidx->get_art($new->{num}), undef,
+                'stale message gone from over');
+        is_deeply($oidx->get_xref3($new->{num}), [],
+                'stale message has no xref3');
+        $es->{xdb}->reopen;
+        $mset = $es->mset("mid:$new->{mid}");
+        is($mset->size, 0, 'stale mid gone Xapian');
+}
+
+if ('reindex catches content bifurcation') {
+        use PublicInbox::MID qw(mids);
+        my $v2ibx = $cfg->lookup_name('v2test');
+        my $im = PublicInbox::InboxWritable->new($v2ibx)->importer(0);
+        my $eml = eml_load('t/data/message_embed.eml');
+        my $cmt_a = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        $im->add($eml);
+        $im->done;
+        my $cmt_b = $v2ibx->mm->last_commit_xap($schema_version, 0);
+        my $uv = $v2ibx->uidvalidity;
+        my $lc_key = "lc-v2:v2.example//$uv;0";
+        $oidx->dbh;
+        is($oidx->eidx_meta($lc_key, $cmt_b), $cmt_a,
+                'update lc-v2 meta, old is as expected');
+        my $mid = mids($eml)->[0];
+        my $smsg = $v2ibx->over->next_by_mid($mid, \(my $id), \(my $prev));
+        my $oldmax = $oidx->max;
+        my $x3_orig = $oidx->get_xref3(3);
+        is(scalar(@$x3_orig), 1, '#3 has one xref');
+        $oidx->add_xref3(3, $smsg->{num}, $smsg->{blob}, 'v2.example');
+        my $x3 = $oidx->get_xref3(3);
+        is(scalar(@$x3), 2, 'injected xref3');
+        $oidx->commit_lazy;
+        my $opt = { 2 => \(my $err = '') };
+        ok(run_script([qw(-extindex --all), "$home/extindex"], undef, $opt),
+                'extindex --all is noop');
+        is($err, '', 'no warnings in index');
+        $oidx->dbh;
+        is($oidx->max, $oldmax, 'oidx->max unchanged');
+        $oidx->dbh_close;
+        ok(run_script([qw(-extindex --reindex --all), "$home/extindex"],
+                undef, $opt), 'extindex --reindex');
+        $oidx->dbh;
+        ok($oidx->max > $oldmax, 'oidx->max bumped');
+        like($err, qr/split into 2 due to deduplication change/,
+                'bifurcation noted');
+        my $added = $oidx->get_art($oidx->max);
+        is($added->{blob}, $smsg->{blob}, 'new blob indexed');
+        is_deeply(["v2.example:$smsg->{num}:$smsg->{blob}"],
+                $oidx->get_xref3($added->{num}),
+                'xref3 corrected for bifurcated message');
+        is_deeply($oidx->get_xref3(3), $x3_orig, 'xref3 restored for #3');
+}
+
+if ('--reindex --rethread') {
+        my $before = $oidx->dbh->selectrow_array(<<'');
+SELECT MAX(tid) FROM over WHERE num > 0
+
+        my $opt = {};
+        ok(run_script([qw(-extindex --reindex --rethread --all),
+                        "$home/extindex"], undef, $opt),
+                        '--rethread');
+        my $after = $oidx->dbh->selectrow_array(<<'');
+SELECT MIN(tid) FROM over WHERE num > 0
+
+        # actual rethread logic is identical to v1/v2 and tested elsewhere
+        ok($after > $before, '--rethread updates MIN(tid)');
+}
+
+if ('remove v1test and test gc') {
+        xsys([qw(git config --unset publicinbox.v1test.inboxdir)],
+                { GIT_CONFIG => $cfg_path });
+        my $opt = { 2 => \(my $err = '') };
+        ok(run_script([qw(-extindex --gc), "$home/extindex"], undef, $opt),
+                'extindex --gc');
+        like($err, qr/^I: remove #1 v1\.example /ms, 'removed v1 message');
+        is(scalar(grep(!/^I:/, split(/^/m, $err))), 0,
+                'no non-informational messages');
+        $misc->{xdb}->reopen;
+        @it = $misc->mset('')->items;
+        is(scalar(@it), 1, 'only one inbox left');
+}
+
+done_testing;
diff --git a/t/fake_inotify.t b/t/fake_inotify.t
index 11dac117..5c925ae6 100644
--- a/t/fake_inotify.t
+++ b/t/fake_inotify.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Ensure FakeInotify can pick up rename(2) and link(2) operations
diff --git a/t/feed.t b/t/feed.t
index 5ad90a07..cdbc88cd 100644
--- a/t/feed.t
+++ b/t/feed.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -75,7 +75,7 @@ EOF
 {
         # check initial feed
         {
-                my $feed = string_feed({ -inbox => $ibx });
+                my $feed = string_feed({ ibx => $ibx });
                 SKIP: {
                         skip 'XML::TreePP missing', 3 unless $have_xml_treepp;
                         my $t = XML::TreePP->new->parse($feed);
@@ -109,7 +109,7 @@ EOF
 
         # check spam shows up
         {
-                my $spammy_feed = string_feed({ -inbox => $ibx });
+                my $spammy_feed = string_feed({ ibx => $ibx });
                 SKIP: {
                         skip 'XML::TreePP missing', 2 unless $have_xml_treepp;
                         my $t = XML::TreePP->new->parse($spammy_feed);
@@ -127,7 +127,7 @@ EOF
 
         # spam no longer shows up
         {
-                my $feed = string_feed({ -inbox => $ibx });
+                my $feed = string_feed({ ibx => $ibx });
                 SKIP: {
                         skip 'XML::TreePP missing', 2 unless $have_xml_treepp;
                         my $t = XML::TreePP->new->parse($feed);
diff --git a/t/filter_base.t b/t/filter_base.t
index 47d0220f..2646321a 100644
--- a/t/filter_base.t
+++ b/t/filter_base.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/filter_mirror.t b/t/filter_mirror.t
index 5bc7f3f4..678d9fb0 100644
--- a/t/filter_mirror.t
+++ b/t/filter_mirror.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/filter_rubylang.t b/t/filter_rubylang.t
index e6c53f98..81799451 100644
--- a/t/filter_rubylang.t
+++ b/t/filter_rubylang.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -35,7 +35,7 @@ SKIP: {
         ];
         my $ibx = PublicInbox::Inbox->new({ inboxdir => $git_dir,
                                                 altid => $altid });
-        $f = PublicInbox::Filter::RubyLang->new(-inbox => $ibx);
+        $f = PublicInbox::Filter::RubyLang->new(ibx => $ibx);
         $msg = <<'EOF';
 X-Mail-Count: 12
 Message-ID: <a@b>
diff --git a/t/filter_subjecttag.t b/t/filter_subjecttag.t
index e2d91e74..f88fcad5 100644
--- a/t/filter_subjecttag.t
+++ b/t/filter_subjecttag.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/filter_vger.t b/t/filter_vger.t
index ca5a6ca7..92d6a9f3 100644
--- a/t/filter_vger.t
+++ b/t/filter_vger.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/gcf2.t b/t/gcf2.t
new file mode 100644
index 00000000..fa907c8b
--- /dev/null
+++ b/t/gcf2.t
@@ -0,0 +1,162 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use PublicInbox::TestCommon;
+use Test::More;
+use Fcntl qw(:seek);
+use IO::Handle ();
+use POSIX qw(_exit);
+use Cwd qw(abs_path);
+require_mods('PublicInbox::Gcf2');
+use_ok 'PublicInbox::Gcf2';
+use PublicInbox::Import;
+my ($tmpdir, $for_destroy) = tmpdir();
+
+my $gcf2 = PublicInbox::Gcf2::new();
+is(ref($gcf2), 'PublicInbox::Gcf2', '::new works');
+my $COPYING = 'dba13ed2ddf783ee8118c6a581dbf75305f816a3';
+open my $agpl, '<', 'COPYING' or BAIL_OUT "AGPL-3 missing: $!";
+$agpl = do { local $/; <$agpl> };
+
+PublicInbox::Import::init_bare($tmpdir);
+my $fi_data = './t/git.fast-import-data';
+my $rdr = {};
+open $rdr->{0}, '<', $fi_data or BAIL_OUT $!;
+xsys([qw(git fast-import --quiet)], { GIT_DIR => $tmpdir }, $rdr);
+is($?, 0, 'fast-import succeeded');
+$gcf2->add_alternate("$tmpdir/objects");
+
+{
+        my ($r, $w);
+        pipe($r, $w) or BAIL_OUT $!;
+        my $tree = 'fdbc43725f21f485051c17463b50185f4c3cf88c';
+        $gcf2->cat_oid(fileno($w), $tree);
+        close $w;
+        is("$tree tree 30\n", <$r>, 'tree header ok');
+        $r = do { local $/; <$r> };
+        is(chop($r), "\n", 'got trailing newline');
+        is(length($r), 30, 'tree length matches');
+}
+
+chomp(my $objdir = xqx([qw(git rev-parse --git-path objects)]));
+if ($objdir =~ /\A--git-path\n/) { # git <2.5
+        chomp($objdir = xqx([qw(git rev-parse --git-dir)]));
+        $objdir .= '/objects';
+}
+if ($objdir && -d $objdir) {
+        $objdir = abs_path($objdir);
+        open my $alt, '>>', "$tmpdir/objects/info/alternates" or
+                                                        BAIL_OUT $!;
+        print $alt $objdir, "\n" or BAIL_OUT $!;
+        close $alt or BAIL_OUT $!;
+
+        # calling gcf2->add_alternate on an already-added path won't
+        # cause alternates to be reloaded, so we do
+        # $gcf2->add_alternate($objdir) later on instead of
+        # $gcf2->add_alternate("$tmpdir/objects");
+        # $objdir = "$tmpdir/objects";
+} else {
+        $objdir = undef
+}
+
+my $nr = $ENV{TEST_LEAK_NR};
+my $cat = $ENV{TEST_LEAK_CAT} // 10;
+diag "checking for leaks... (TEST_LEAK_NR=$nr TEST_LEAK_CAT=$cat)" if $nr;
+
+SKIP: {
+        skip 'not in git worktree', 21 unless defined($objdir);
+        $gcf2->add_alternate($objdir);
+        eval { $gcf2->add_alternate($objdir) };
+        ok(!$@, 'no error adding alternate redundantly');
+        if ($nr) {
+                diag "adding alternate $nr times redundantly";
+                $gcf2->add_alternate($objdir) for (1..$nr);
+                diag 'done adding redundant alternates';
+        }
+
+        open my $fh, '+>', undef or BAIL_OUT "open: $!";
+        $fh->autoflush(1);
+
+        ok(!$gcf2->cat_oid(fileno($fh), 'invalid'), 'invalid fails');
+        seek($fh, 0, SEEK_SET) or BAIL_OUT "seek: $!";
+        is(do { local $/; <$fh> }, '', 'nothing written');
+
+        open $fh, '+>', undef or BAIL_OUT "open: $!";
+        ok(!$gcf2->cat_oid(fileno($fh), '0'x40), 'z40 fails');
+        seek($fh, 0, SEEK_SET) or BAIL_OUT "seek: $!";
+        is(do { local $/; <$fh> }, '', 'nothing written for z40');
+
+        open $fh, '+>', undef or BAIL_OUT "open: $!";
+        my $ck_copying = sub {
+                my ($desc) = @_;
+                seek($fh, 0, SEEK_SET) or BAIL_OUT "seek: $!";
+                is(<$fh>, "$COPYING blob 34520\n", "got expected header $desc");
+                my $buf = do { local $/; <$fh> };
+                is(chop($buf), "\n", 'got trailing \\n');
+                is($buf, $agpl, "AGPL matches ($desc)");
+        };
+        ok($gcf2->cat_oid(fileno($fh), $COPYING), 'cat_oid normal');
+        $ck_copying->('regular file');
+
+        $gcf2 = PublicInbox::Gcf2::new();
+        $gcf2->add_alternate("$tmpdir/objects");
+        open $fh, '+>', undef or BAIL_OUT "open: $!";
+        ok($gcf2->cat_oid(fileno($fh), $COPYING), 'cat_oid alternate');
+        $ck_copying->('alternates after reopen');
+
+        $^O eq 'linux' or skip('pipe tests are Linux-only', 14);
+        for my $blk (1, 0) {
+                my ($r, $w);
+                pipe($r, $w) or BAIL_OUT $!;
+                fcntl($w, 1031, 4096) or
+                        skip('Linux too old for F_SETPIPE_SZ', 14);
+                $w->blocking($blk);
+                seek($fh, 0, SEEK_SET) or BAIL_OUT "seek: $!";
+                truncate($fh, 0) or BAIL_OUT "truncate: $!";
+                defined(my $pid = fork) or BAIL_OUT "fork: $!";
+                if ($pid == 0) {
+                        close $w;
+                        tick; # wait for parent to block on writev
+                        my $buf = do { local $/; <$r> };
+                        print $fh $buf or _exit(1);
+                        _exit(0);
+                }
+                ok($gcf2->cat_oid(fileno($w), $COPYING), "cat blocking=$blk");
+                close $w or BAIL_OUT "close: $!";
+                is(waitpid($pid, 0), $pid, 'child exited');
+                is($?, 0, 'no error in child');
+                $ck_copying->("pipe blocking($blk)");
+
+                pipe($r, $w) or BAIL_OUT $!;
+                fcntl($w, 1031, 4096) or BAIL_OUT $!;
+                $w->blocking($blk);
+                close $r;
+                local $SIG{PIPE} = 'IGNORE';
+                eval { $gcf2->cat_oid(fileno($w), $COPYING) };
+                like($@, qr/writev error:/, 'got writev error');
+        }
+}
+
+if ($nr) {
+        open my $null, '>', '/dev/null' or BAIL_OUT "open /dev/null: $!";
+        my $fd = fileno($null);
+        local $SIG{PIPE} = 'IGNORE';
+        my ($r, $w);
+        pipe($r, $w);
+        close $r;
+        my $broken = fileno($w);
+        for (1..$nr) {
+                my $obj = PublicInbox::Gcf2::new();
+                if (defined($objdir)) {
+                        $obj->add_alternate($objdir);
+                        for (1..$cat) {
+                                $obj->cat_oid($fd, $COPYING);
+                                eval { $obj->cat_oid($broken, $COPYING) };
+                                $obj->cat_oid($fd, '0'x40);
+                                $obj->cat_oid($fd, 'invalid');
+                        }
+                }
+        }
+}
+done_testing;
diff --git a/t/gcf2_client.t b/t/gcf2_client.t
new file mode 100644
index 00000000..6d059cad
--- /dev/null
+++ b/t/gcf2_client.t
@@ -0,0 +1,90 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use PublicInbox::TestCommon;
+use Test::More;
+use Cwd qw(getcwd);
+use PublicInbox::Import;
+use PublicInbox::DS;
+
+require_mods('PublicInbox::Gcf2');
+use_ok 'PublicInbox::Gcf2Client';
+my ($tmpdir, $for_destroy) = tmpdir();
+my $git_a = "$tmpdir/a.git";
+my $git_b = "$tmpdir/b.git";
+PublicInbox::Import::init_bare($git_a);
+PublicInbox::Import::init_bare($git_b);
+my $fi_data = './t/git.fast-import-data';
+my $rdr = {};
+open $rdr->{0}, '<', $fi_data or BAIL_OUT $!;
+xsys([qw(git fast-import --quiet)], { GIT_DIR => $git_a }, $rdr);
+is($?, 0, 'fast-import succeeded');
+
+my $tree = 'fdbc43725f21f485051c17463b50185f4c3cf88c';
+my $called = 0;
+my $err_f = "$tmpdir/err";
+{
+        PublicInbox::DS->Reset;
+        open my $err, '>>', $err_f or BAIL_OUT $!;
+        my $gcf2c = PublicInbox::Gcf2Client::new({ 2 => $err });
+        $gcf2c->gcf2_async(\"$tree $git_a\n", sub {
+                my ($bref, $oid, $type, $size, $arg) = @_;
+                is($oid, $tree, 'got expected OID');
+                is($size, 30, 'got expected length');
+                is($type, 'tree', 'got tree type');
+                is(length($$bref), 30, 'got a tree');
+                is($arg, 'hi', 'arg passed');
+                $called++;
+        }, 'hi');
+        $gcf2c->cat_async_step($gcf2c->{inflight});
+
+        open $err, '<', $err_f or BAIL_OUT $!;
+        my $estr = do { local $/; <$err> };
+        is($estr, '', 'nothing in stderr');
+
+        my $trunc = substr($tree, 0, 39);
+        $gcf2c->gcf2_async(\"$trunc $git_a\n", sub {
+                my ($bref, $oid, $type, $size, $arg) = @_;
+                is(undef, $bref, 'missing bref is undef');
+                is($oid, $trunc, 'truncated OID printed');
+                is($type, 'missing', 'type is "missing"');
+                is($size, undef, 'size is undef');
+                is($arg, 'bye', 'arg passed when missing');
+                $called++;
+        }, 'bye');
+        $gcf2c->cat_async_step($gcf2c->{inflight});
+
+        open $err, '<', $err_f or BAIL_OUT $!;
+        $estr = do { local $/; <$err> };
+        like($estr, qr/retrying/, 'warned about retry');
+
+        # try failed alternates lookup
+        PublicInbox::DS->Reset;
+        open $err, '>', $err_f or BAIL_OUT $!;
+        $gcf2c = PublicInbox::Gcf2Client::new({ 2 => $err });
+        $gcf2c->gcf2_async(\"$tree $git_b\n", sub {
+                my ($bref, $oid, $type, $size, $arg) = @_;
+                is(undef, $bref, 'missing bref from alt is undef');
+                $called++;
+        });
+        $gcf2c->cat_async_step($gcf2c->{inflight});
+        open $err, '<', $err_f or BAIL_OUT $!;
+        $estr = do { local $/; <$err> };
+        like($estr, qr/retrying/, 'warned about retry before alt update');
+
+        # now try successful alternates lookup
+        open my $alt, '>>', "$git_b/objects/info/alternates" or BAIL_OUT $!;
+        print $alt "$git_a/objects\n" or BAIL_OUT $!;
+        close $alt or BAIL_OUT;
+        my $expect = xqx(['git', "--git-dir=$git_a", qw(cat-file tree), $tree]);
+        $gcf2c->gcf2_async(\"$tree $git_a\n", sub {
+                my ($bref, $oid, $type, $size, $arg) = @_;
+                is($oid, $tree, 'oid match on alternates retry');
+                is($$bref, $expect, 'tree content matched');
+                $called++;
+        });
+        $gcf2c->cat_async_step($gcf2c->{inflight});
+}
+is($called, 4, 'gcf2_async callbacks hit');
+done_testing;
diff --git a/t/git-http-backend.psgi b/t/git-http-backend.psgi
index e34ebe40..a91e5de8 100644
--- a/t/git-http-backend.psgi
+++ b/t/git-http-backend.psgi
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/git.t b/t/git.t
index dfd7173a..377652ca 100644
--- a/t/git.t
+++ b/t/git.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -76,12 +76,17 @@ if (1) {
         is(length($$x), $size, 'read correct number of bytes');
 
         my $ref = $gcf->qx(qw(cat-file blob), $buf);
+        is($?, 0, 'no error on scalar success');
         my @ref = $gcf->qx(qw(cat-file blob), $buf);
+        is($?, 0, 'no error on wantarray success');
         my $nl = scalar @ref;
         ok($nl > 1, "qx returned array length of $nl");
+        is(join('', @ref), $ref, 'qx array and scalar context both work');
 
         $gcf->qx(qw(repack -adq));
         ok($gcf->packed_bytes > 0, 'packed size is positive');
+        $gcf->qx(qw(rev-parse --verify bogus));
+        isnt($?, 0, '$? set on failure'.$?);
 }
 
 SKIP: {
diff --git a/t/gzip_filter.t b/t/gzip_filter.t
index 400214e6..b349ae58 100644
--- a/t/gzip_filter.t
+++ b/t/gzip_filter.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/hl_mod.t b/t/hl_mod.t
index 95057354..f5bf433d 100644
--- a/t/hl_mod.t
+++ b/t/hl_mod.t
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/html_index.t b/t/html_index.t
index 80f81577..8e2a674f 100644
--- a/t/html_index.t
+++ b/t/html_index.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/httpd-corner.psgi b/t/httpd-corner.psgi
index cb41cfa0..5436a74d 100644
--- a/t/httpd-corner.psgi
+++ b/t/httpd-corner.psgi
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # corner case tests for the generic PSGI server
 # Usage: plackup [OPTIONS] /path/to/this/file
diff --git a/t/httpd-corner.t b/t/httpd-corner.t
index 514672a1..c3f80530 100644
--- a/t/httpd-corner.t
+++ b/t/httpd-corner.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # note: our HTTP server should be standalone and capable of running
 # generic PSGI/Plack apps.
diff --git a/t/httpd-https.t b/t/httpd-https.t
index fcfa12af..a2166ce6 100644
--- a/t/httpd-https.t
+++ b/t/httpd-https.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/httpd-unix.t b/t/httpd-unix.t
index 363f3648..2d3cecc1 100644
--- a/t/httpd-unix.t
+++ b/t/httpd-unix.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Tests for binding Unix domain sockets
 use strict;
diff --git a/t/httpd.t b/t/httpd.t
index 7404eb8b..2fc28355 100644
--- a/t/httpd.t
+++ b/t/httpd.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/hval.t b/t/hval.t
index e80a02ff..9d0dab7a 100644
--- a/t/hval.t
+++ b/t/hval.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/idx_stack.t b/t/idx_stack.t
index 35aff37b..7af096a8 100644
--- a/t/idx_stack.t
+++ b/t/idx_stack.t
@@ -1,11 +1,13 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
 use_ok 'PublicInbox::IdxStack';
 my $oid_a = '03c21563cf15c241687966b5b2a3f37cdc193316';
 my $oid_b = '963caad026055ab9bcbe3ee9550247f9d8840feb';
+my $cmt_a = 'df8e4a0612545d53672036641e9f076efc94c2f6';
+my $cmt_b = '3ba7c9fa4a083c439e768882c571c2026a981ca5';
 
 my $stk = PublicInbox::IdxStack->new;
 is($stk->read_prepare, $stk, 'nothing');
@@ -13,19 +15,19 @@ is($stk->num_records, 0, 'no records');
 is($stk->pop_rec, undef, 'undef on empty');
 
 $stk = PublicInbox::IdxStack->new;
-$stk->push_rec('m', 1234, 5678, $oid_a);
+$stk->push_rec('m', 1234, 5678, $oid_a, $cmt_a);
 is($stk->read_prepare, $stk, 'read_prepare');
 is($stk->num_records, 1, 'num_records');
-is_deeply([$stk->pop_rec], ['m', 1234, 5678, $oid_a], 'pop once');
+is_deeply([$stk->pop_rec], ['m', 1234, 5678, $oid_a, $cmt_a], 'pop once');
 is($stk->pop_rec, undef, 'undef on empty');
 
 $stk = PublicInbox::IdxStack->new;
-$stk->push_rec('m', 1234, 5678, $oid_a);
-$stk->push_rec('d', 1234, 5678, $oid_b);
+$stk->push_rec('m', 1234, 5678, $oid_a, $cmt_a);
+$stk->push_rec('d', 1234, 5678, $oid_b, $cmt_b);
 is($stk->read_prepare, $stk, 'read_prepare');
 is($stk->num_records, 2, 'num_records');
-is_deeply([$stk->pop_rec], ['d', 1234, 5678, $oid_b], 'pop');
-is_deeply([$stk->pop_rec], ['m', 1234, 5678, $oid_a], 'pop-pop');
+is_deeply([$stk->pop_rec], ['d', 1234, 5678, $oid_b, $cmt_b], 'pop');
+is_deeply([$stk->pop_rec], ['m', 1234, 5678, $oid_a, $cmt_a], 'pop-pop');
 is($stk->pop_rec, undef, 'empty');
 
 SKIP: {
@@ -37,11 +39,11 @@ SKIP: {
         while (<$fh>) {
                 chomp;
                 my ($at, $ct, $H) = split(/\./);
-                $stk //= PublicInbox::IdxStack->new($H);
+                $stk //= PublicInbox::IdxStack->new;
                 # not bothering to parse blobs here, just using commit OID
                 # as a blob OID since they're the same size + format
-                $stk->push_rec('m', $at + 0, $ct + 0, $H);
-                push(@expect, [ 'm', $at, $ct, $H ]);
+                $stk->push_rec('m', $at + 0, $ct + 0, $H, $H);
+                push(@expect, [ 'm', $at, $ct, $H, $H ]);
         }
         $stk or skip('nothing from git log', 3);
         is($stk->read_prepare, $stk, 'read_prepare');
diff --git a/t/imap.t b/t/imap.t
index 5a251c6b..0ec02818 100644
--- a/t/imap.t
+++ b/t/imap.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # unit tests (no network) for IMAP, see t/imapd.t for end-to-end tests
 use strict;
diff --git a/t/imap_searchqp.t b/t/imap_searchqp.t
index adf7b205..6b4121ea 100644
--- a/t/imap_searchqp.t
+++ b/t/imap_searchqp.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
@@ -76,17 +76,17 @@ is($q->{xap}, 'c:"b" d:..19931002', 'compound query w/ parens');
         $q = $parse->($s = qq{BEFORE 2-Oct-1993});
         is_deeply($q->{sql}, \" AND ts <= $t0", 'BEFORE SQL');
         $q = $parse->("FROM z $s");
-        is($q->{xap}, qq{f:"z" ts:..$t0}, 'BEFORE Xapian');
+        is($q->{xap}, qq{f:"z" rt:..$t0}, 'BEFORE Xapian');
 
         $q = $parse->($s = qq{SINCE 2-Oct-1993});
         is_deeply($q->{sql}, \" AND ts >= $t0", 'SINCE SQL');
         $q = $parse->("FROM z $s");
-        is($q->{xap}, qq{f:"z" ts:$t0..}, 'SINCE Xapian');
+        is($q->{xap}, qq{f:"z" rt:$t0..}, 'SINCE Xapian');
 
         $q = $parse->($s = qq{ON 2-Oct-1993});
         is_deeply($q->{sql}, \" AND ts >= $t0 AND ts <= $t1", 'ON SQL');
         $q = $parse->("FROM z $s");
-        is($q->{xap}, qq{f:"z" ts:$t0..$t1}, 'ON Xapian');
+        is($q->{xap}, qq{f:"z" rt:$t0..$t1}, 'ON Xapian');
 }
 
 {
diff --git a/t/imap_tracker.t b/t/imap_tracker.t
index 01e1d0b1..be7c6e65 100644
--- a/t/imap_tracker.t
+++ b/t/imap_tracker.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use Test::More;
 use strict;
diff --git a/t/imapd-tls.t b/t/imapd-tls.t
index df4ef85c..e40ae1e8 100644
--- a/t/imapd-tls.t
+++ b/t/imapd-tls.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/imapd.t b/t/imapd.t
index a464ad86..1df9d26e 100644
--- a/t/imapd.t
+++ b/t/imapd.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # end-to-end IMAP tests, see unit tests in t/imap.t, too
 use strict;
@@ -251,8 +251,8 @@ ok($mic->logout, 'logout works');
 
 my $have_inotify = eval { require Linux::Inotify2; 1 };
 
-my $pi_config = PublicInbox::Config->new;
-$pi_config->each_inbox(sub {
+my $pi_cfg = PublicInbox::Config->new;
+$pi_cfg->each_inbox(sub {
         my ($ibx) = @_;
         my $env = { ORIGINAL_RECIPIENT => $ibx->{-primary_address} };
         my $name = $ibx->{name};
@@ -371,11 +371,13 @@ is(scalar keys %$ret, 3, 'got all 3 messages');
 
 SKIP: {
         # do any clients use non-UID IMAP SEARCH?
-        skip 'Xapian missing', 2 if $level eq 'basic';
+        skip 'Xapian missing', 3 if $level eq 'basic';
         my $x = $mic->search('all');
         is_deeply($x, [1, 2, 3], 'MSN SEARCH works before rm');
         $x = $mic->search(qw(header subject embedded));
         is_deeply($x, [2], 'MSN SEARCH on Subject works before rm');
+        $x = $mic->search('FROM scraper@example.com');
+        is_deeply($x, [], "MSN SEARCH miss won't trigger warnings");
 }
 
 {
diff --git a/t/import.t b/t/import.t
index 9a88416f..ae76858b 100644
--- a/t/import.t
+++ b/t/import.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -7,7 +7,6 @@ use PublicInbox::Eml;
 use PublicInbox::Smsg;
 use PublicInbox::Git;
 use PublicInbox::Import;
-use PublicInbox::Spawn qw(spawn);
 use Fcntl qw(:DEFAULT SEEK_SET);
 use PublicInbox::TestCommon;
 use MIME::Base64 3.05; # Perl 5.10.0 / 5.9.2
@@ -32,20 +31,13 @@ like($im->add($mime, undef, $smsg), qr/\A:[0-9]+\z/, 'added one message');
 
 if ($v2) {
         like($smsg->{blob}, qr/\A[a-f0-9]{40}\z/, 'got last object_id');
-        my $raw_email = $smsg->{-raw_email};
-        is($mime->as_string, $$raw_email, 'string matches');
-        is($smsg->{raw_bytes}, length($$raw_email), 'length matches');
         my @cmd = ('git', "--git-dir=$git->{git_dir}", qw(hash-object --stdin));
         open my $in, '+<', undef or BAIL_OUT "open(+<): $!";
         print $in $mime->as_string or die "write failed: $!";
         $in->flush or die "flush failed: $!";
-        seek($in, 0, SEEK_SET);
-        open my $out, '+<', undef or BAIL_OUT "open(+<): $!";
-        my $pid = spawn(\@cmd, {}, { 0 => $in, 1 => $out });
-        is(waitpid($pid, 0), $pid, 'waitpid succeeds on hash-object');
+        seek($in, 0, SEEK_SET) or die "seek: $!";
+        chomp(my $hashed_obj = xqx(\@cmd, undef, { 0 => $in }));
         is($?, 0, 'hash-object');
-        seek($out, 0, SEEK_SET);
-        chomp(my $hashed_obj = <$out>);
         is($hashed_obj, $smsg->{blob}, "blob object_id matches exp");
 }
 
diff --git a/t/inbox.t b/t/inbox.t
index 08f1724f..bc8fae9a 100644
--- a/t/inbox.t
+++ b/t/inbox.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/inbox_idle.t b/t/inbox_idle.t
index e16ee11b..27facfe9 100644
--- a/t/inbox_idle.t
+++ b/t/inbox_idle.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use Test::More;
 use PublicInbox::TestCommon;
@@ -32,14 +32,14 @@ for my $V (1, 2) {
                 $sidx->set_metadata_once;
                 $sidx->idx_release; # allow watching on lockfile
         }
-        my $pi_config = PublicInbox::Config->new(\<<EOF);
+        my $pi_cfg = PublicInbox::Config->new(\<<EOF);
 publicinbox.inbox-idle.inboxdir=$inboxdir
 publicinbox.inbox-idle.indexlevel=basic
 publicinbox.inbox-idle.address=test\@example.com
 EOF
         my $ident = 'whatever';
-        $pi_config->each_inbox(sub { shift->subscribe_unlock($ident, $obj) });
-        my $ii = PublicInbox::InboxIdle->new($pi_config);
+        $pi_cfg->each_inbox(sub { shift->subscribe_unlock($ident, $obj) });
+        my $ii = PublicInbox::InboxIdle->new($pi_cfg);
         ok($ii, 'InboxIdle created');
         SKIP: {
                 skip('inotify or kqueue missing', 1) unless $ii->{sock};
@@ -50,7 +50,7 @@ EOF
         PublicInbox::SearchIdx->new($ibx)->index_sync if $V == 1;
         $ii->event_step;
         is(scalar @{$obj->{called}}, 1, 'called on unlock');
-        $pi_config->each_inbox(sub { shift->unsubscribe_unlock($ident) });
+        $pi_cfg->each_inbox(sub { shift->unsubscribe_unlock($ident) });
         ok($im->add(eml_load('t/data/0001.patch')), "$V added #2");
         $im->done;
         PublicInbox::SearchIdx->new($ibx)->index_sync if $V == 1;
diff --git a/t/index-git-times.t b/t/index-git-times.t
index f9869cfa..3cfb99f4 100644
--- a/t/index-git-times.t
+++ b/t/index-git-times.t
@@ -1,11 +1,10 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
 use Test::More;
 use PublicInbox::TestCommon;
-use PublicInbox::Import;
 use PublicInbox::Config;
 use PublicInbox::Admin;
 use File::Path qw(remove_tree);
@@ -48,7 +47,7 @@ EOF
         print $w $data or die;
         close $w or die;
         my $cmd = ['git', "--git-dir=$v1dir", 'fast-import', '--quiet'];
-        PublicInbox::Import::run_die($cmd, undef, { 0 => $r });
+        xsys_e($cmd, undef, { 0 => $r });
 }
 
 run_script(['-index', '--skip-docdata', $v1dir]) or die 'v1 index failed';
diff --git a/t/indexlevels-mirror-v1.t b/t/indexlevels-mirror-v1.t
index adcc93fd..a0cee72c 100644
--- a/t/indexlevels-mirror-v1.t
+++ b/t/indexlevels-mirror-v1.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 local $ENV{PI_TEST_VERSION} = 1;
 require './t/indexlevels-mirror.t';
diff --git a/t/indexlevels-mirror.t b/t/indexlevels-mirror.t
index 656a9a34..53826aef 100644
--- a/t/indexlevels-mirror.t
+++ b/t/indexlevels-mirror.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -172,9 +172,7 @@ my $import_index_incremental = sub {
 $import_index_incremental->($PI_TEST_VERSION, 'basic', $mime);
 
 SKIP: {
-        require PublicInbox::Search;
-        PublicInbox::Search::load_xapian() or
-                skip('Xapian perl binding missing', 2);
+        require_mods(qw(Search::Xapian), 2);
         foreach my $l (qw(medium full)) {
                 $import_index_incremental->($PI_TEST_VERSION, $l, $mime);
         }
diff --git a/t/init.t b/t/init.t
index dba59231..b8dfea66 100644
--- a/t/init.t
+++ b/t/init.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/ipc.t b/t/ipc.t
new file mode 100644
index 00000000..5801c760
--- /dev/null
+++ b/t/ipc.t
@@ -0,0 +1,210 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use Fcntl qw(SEEK_SET);
+use Digest::SHA qw(sha1_hex);
+require_mods(qw(Storable||Sereal));
+require_ok 'PublicInbox::IPC';
+state $once = eval <<'';
+package PublicInbox::IPC;
+use strict;
+use Digest::SHA qw(sha1_hex);
+sub test_array { qw(test array) }
+sub test_scalar { 'scalar' }
+sub test_scalarref { \'scalarref' }
+sub test_undef { undef }
+sub test_die { shift; die @_; 'unreachable' }
+sub test_pid { $$ }
+sub test_write_each_fd {
+        my ($self, @args) = @_;
+        for my $fd (0..2) {
+                print { $self->{$fd} } "i=$fd $$ ", @args, "\n";
+                $self->{$fd}->flush;
+        }
+}
+sub test_sha {
+        my ($self, $buf) = @_;
+        print { $self->{1} } sha1_hex($buf), "\n";
+        $self->{1}->flush;
+}
+1;
+
+my $ipc = bless {}, 'PublicInbox::IPC';
+my @t = qw(array scalar scalarref undef);
+my $test = sub {
+        my $x = shift;
+        my @res;
+        for my $type (@t) {
+                my $m = "test_$type";
+                my @ret = $ipc->ipc_do($m);
+                my @exp = $ipc->$m;
+                is_deeply(\@ret, \@exp, "wantarray $m $x");
+
+                $ipc->ipc_do($m);
+
+                $ipc->ipc_async($m, [], sub { push @res, \@_ }, \$m);
+
+                my $ret = $ipc->ipc_do($m);
+                my $exp = $ipc->$m;
+                is_deeply($ret, $exp, "!wantarray $m $x");
+
+                is_deeply(\@res, [ [ \$m, \@exp ] ], "async $m $x");
+                @res = ();
+        }
+        $ipc->ipc_async_wait(-1);
+        is_deeply(\@res, [], 'no leftover results');
+        $ipc->ipc_async('test_die', ['die test'],
+                        sub { push @res, \@_  }, 'die arg');
+        $ipc->ipc_async_wait(1);
+        is(scalar(@res), 1, 'only one result');
+        is(scalar(@{$res[0]}), 2, 'result has 2-element array');
+        is($res[0]->[0], 'die arg', 'got async die arg '.$x);
+        is(ref($res[0]->[1]), 'PublicInbox::IPC::Die',
+                "exception type $x");
+        {
+                my $nr = PublicInbox::IPC::PIPE_BUF();
+                my $count = 0;
+                my $cb = sub { ++$count };
+                $ipc->ipc_async('test_undef', [], $cb) for (1..$nr);
+                $ipc->ipc_async_wait(-1);
+                is($count, $nr, "$x async runs w/o deadlock");
+        }
+
+        my $ret = eval { $ipc->test_die('phail') };
+        my $exp = $@;
+        $ret = eval { $ipc->ipc_do('test_die', 'phail') };
+        my $err = $@;
+        my %lines;
+        for ($err, $exp) {
+                s/ line (\d+).*//s and $lines{$1}++;
+        }
+        is(scalar keys %lines, 1, 'line numbers match');
+        is((values %lines)[0], 2, '2 hits on same line number');
+        is($err, $exp, "$x die matches");
+        is($ret, undef, "$x die did not return");
+
+        eval { $ipc->test_die(['arrayref']) };
+        $exp = $@;
+        $ret = eval { $ipc->ipc_do('test_die', ['arrayref']) };
+        $err = $@;
+        is_deeply($err, $exp, 'die with unblessed ref');
+        is(ref($err), 'ARRAY', 'got an array ref');
+
+        $exp = bless ['blessed'], 'PublicInbox::WTF';
+        $ret = eval { $ipc->ipc_do('test_die', $exp) };
+        $err = $@;
+        is_deeply($err, $exp, 'die with blessed ref');
+        is(ref($err), 'PublicInbox::WTF', 'got blessed ref');
+};
+$test->('local');
+
+{
+        my $pid = $ipc->ipc_worker_spawn('test worker');
+        ok($pid > 0 && kill(0, $pid), 'worker spawned and running');
+        defined($pid) or BAIL_OUT 'no spawn, no test';
+        is($ipc->ipc_do('test_pid'), $pid, 'worker pid returned');
+        $test->('worker');
+        {
+                my ($tmp, $for_destroy) = tmpdir();
+                $ipc->ipc_lock_init("$tmp/lock");
+                is($ipc->ipc_do('test_pid'), $pid, 'worker pid returned');
+        }
+        $ipc->ipc_worker_stop;
+        ok(!kill(0, $pid) && $!{ESRCH}, 'worker stopped');
+}
+$ipc->ipc_worker_stop; # idempotent
+
+# work queues
+pipe(my ($ra, $wa)) or BAIL_OUT $!;
+pipe(my ($rb, $wb)) or BAIL_OUT $!;
+pipe(my ($rc, $wc)) or BAIL_OUT $!;
+open my $warn, '+>', undef or BAIL_OUT;
+$warn->autoflush(0);
+local $SIG{__WARN__} = sub { print $warn "PID:$$ ", @_ };
+my @ppids;
+open my $agpl, '<', 'COPYING' or BAIL_OUT "AGPL-3 missing: $!";
+my $big = do { local $/; <$agpl> } // BAIL_OUT "read: $!";
+close $agpl or BAIL_OUT "close: $!";
+
+for my $t ('local', 'worker', 'worker again') {
+        $ipc->wq_do('test_write_each_fd', [ $wa, $wb, $wc ], 'hello world');
+        my $i = 0;
+        for my $fh ($ra, $rb, $rc) {
+                my $buf = readline($fh);
+                is(chop($buf), "\n", "trailing CR ($t)");
+                like($buf, qr/\Ai=$i \d+ hello world\z/, "got expected ($t)");
+                $i++;
+        }
+        $ipc->wq_do('test_die', [ $wa, $wb, $wc ]);
+        $ipc->wq_do('test_sha', [ $wa, $wb ], 'hello world');
+        is(readline($rb), sha1_hex('hello world')."\n", "SHA small ($t)");
+        {
+                my $bigger = $big x 10;
+                $ipc->wq_do('test_sha', [ $wa, $wb ], $bigger);
+                my $exp = sha1_hex($bigger)."\n";
+                undef $bigger;
+                is(readline($rb), $exp, "SHA big ($t)");
+        }
+        my $ppid = $ipc->wq_workers_start('wq', 1);
+        push(@ppids, $ppid);
+}
+
+# wq_do works across fork (siblings can feed)
+SKIP: {
+        skip 'Socket::MsgHdr or Inline::C missing', 3 if !$ppids[0];
+        is_deeply(\@ppids, [$$, undef, undef],
+                'parent pid returned in wq_workers_start');
+        my $pid = fork // BAIL_OUT $!;
+        if ($pid == 0) {
+                use POSIX qw(_exit);
+                $ipc->wq_do('test_write_each_fd', [ $wa, $wb, $wc ], $$);
+                _exit(0);
+        } else {
+                my $i = 0;
+                my ($wpid, @rest) = keys %{$ipc->{-wq_workers}};
+                is(scalar(@rest), 0, 'only one worker');
+                for my $fh ($ra, $rb, $rc) {
+                        my $buf = readline($fh);
+                        is(chop($buf), "\n", "trailing CR #$i");
+                        like($buf, qr/^i=$i $wpid $pid\z/,
+                                'got expected from sibling');
+                        $i++;
+                }
+                is(waitpid($pid, 0), $pid, 'waitpid complete');
+                is($?, 0, 'child wq producer exited');
+        }
+}
+
+$ipc->wq_close;
+SKIP: {
+        skip 'Socket::MsgHdr or Inline::C missing', 11 if !$ppids[0];
+        seek($warn, 0, SEEK_SET) or BAIL_OUT;
+        my @warn = <$warn>;
+        is(scalar(@warn), 3, 'warned 3 times');
+        like($warn[0], qr/ wq_do: /, '1st warned from wq_do');
+        like($warn[1], qr/ wq_worker: /, '2nd warned from wq_worker');
+        is($warn[2], $warn[1], 'worker did not die');
+
+        $SIG{__WARN__} = 'DEFAULT';
+        is($ipc->wq_workers_start('wq', 1), $$, 'workers started again');
+        is($ipc->wq_workers, 1, '1 worker started');
+        SKIP: {
+                $ipc->WQ_MAX_WORKERS > 1 or
+                        skip 'Inline::C or Socket::MsgHdr not available', 4;
+                $ipc->wq_worker_incr;
+                is($ipc->wq_workers, 2, 'worker count bumped');
+                $ipc->wq_worker_decr;
+                $ipc->wq_worker_decr_wait(10);
+                is($ipc->wq_workers, 1, 'worker count lowered');
+                is($ipc->wq_workers(2), 2, 'worker count set');
+                is($ipc->wq_workers, 2, 'worker count stayed set');
+        }
+        $ipc->wq_close;
+        is($ipc->wq_workers, undef, 'workers undef after close');
+}
+
+done_testing;
diff --git a/t/kqnotify.t b/t/kqnotify.t
index c3557d3e..902ce0f1 100644
--- a/t/kqnotify.t
+++ b/t/kqnotify.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Ensure KQNotify can pick up rename(2) and link(2) operations
diff --git a/t/lei-oneshot.t b/t/lei-oneshot.t
new file mode 100644
index 00000000..7688da5b
--- /dev/null
+++ b/t/lei-oneshot.t
@@ -0,0 +1,8 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use PublicInbox::TestCommon;
+local $ENV{TEST_LEI_ONESHOT} = '1';
+require './t/lei.t';
diff --git a/t/lei.t b/t/lei.t
new file mode 100644
index 00000000..3fd1d1fe
--- /dev/null
+++ b/t/lei.t
@@ -0,0 +1,376 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::Config;
+use File::Path qw(rmtree);
+use Fcntl qw(SEEK_SET);
+use PublicInbox::Spawn qw(which);
+require_git 2.6;
+require_mods(qw(json DBD::SQLite Search::Xapian));
+my $opt = { 1 => \(my $out = ''), 2 => \(my $err = '') };
+my ($home, $for_destroy) = tmpdir();
+my $err_filter;
+my @onions = qw(http://hjrcffqmbrq6wope.onion/meta/
+        http://czquwvybam4bgbro.onion/meta/
+        http://ou63pmih66umazou.onion/meta/);
+my $lei = sub {
+        my ($cmd, $env, $xopt) = @_;
+        $out = $err = '';
+        if (!ref($cmd)) {
+                ($env, $xopt) = grep { (!defined) || ref } @_;
+                $cmd = [ grep { defined && !ref } @_ ];
+        }
+        my $res = run_script(['lei', @$cmd], $env, $xopt // $opt);
+        $err_filter and
+                $err = join('', grep(!/$err_filter/, split(/^/m, $err)));
+        $res;
+};
+
+delete local $ENV{XDG_DATA_HOME};
+delete local $ENV{XDG_CONFIG_HOME};
+local $ENV{GIT_COMMITTER_EMAIL} = 'lei@example.com';
+local $ENV{GIT_COMMITTER_NAME} = 'lei user';
+local $ENV{XDG_RUNTIME_DIR} = "$home/xdg_run";
+local $ENV{HOME} = $home;
+local $ENV{FOO} = 'BAR';
+mkdir "$home/xdg_run", 0700 or BAIL_OUT "mkdir: $!";
+my $home_trash = [ "$home/.local", "$home/.config" ];
+my $cleanup = sub { rmtree([@$home_trash, @_]) };
+my $config_file = "$home/.config/lei/config";
+my $store_dir = "$home/.local/share/lei";
+
+my $test_help = sub {
+        ok(!$lei->(), 'no args fails');
+        is($? >> 8, 1, '$? is 1');
+        is($out, '', 'nothing in stdout');
+        like($err, qr/^usage:/sm, 'usage in stderr');
+
+        for my $arg (['-h'], ['--help'], ['help'], [qw(daemon-pid --help)]) {
+                ok($lei->($arg), "lei @$arg");
+                like($out, qr/^usage:/sm, "usage in stdout (@$arg)");
+                is($err, '', "nothing in stderr (@$arg)");
+        }
+
+        for my $arg ([''], ['--halp'], ['halp'], [qw(daemon-pid --halp)]) {
+                ok(!$lei->($arg), "lei @$arg");
+                is($? >> 8, 1, '$? set correctly');
+                isnt($err, '', 'something in stderr');
+                is($out, '', 'nothing in stdout');
+        }
+        ok($lei->(qw(init -h)), 'init -h');
+        like($out, qr! \Q$home\E/\.local/share/lei/store\b!,
+                'actual path shown in init -h');
+        ok($lei->(qw(init -h), { XDG_DATA_HOME => '/XDH' }),
+                'init with XDG_DATA_HOME');
+        like($out, qr! /XDH/lei/store\b!, 'XDG_DATA_HOME in init -h');
+        is($err, '', 'no errors from init -h');
+
+        ok($lei->(qw(config -h)), 'config-h');
+        like($out, qr! \Q$home\E/\.config/lei/config\b!,
+                'actual path shown in config -h');
+        ok($lei->(qw(config -h), { XDG_CONFIG_HOME => '/XDC' }),
+                'config with XDG_CONFIG_HOME');
+        like($out, qr! /XDC/lei/config\b!, 'XDG_CONFIG_HOME in config -h');
+        is($err, '', 'no errors from config -h');
+};
+
+my $ok_err_info = sub {
+        my ($msg) = @_;
+        is(grep(!/^I:/, split(/^/, $err)), 0, $msg) or
+                diag "$msg: err=$err";
+};
+
+my $test_init = sub {
+        $cleanup->();
+        ok($lei->('init'), 'init w/o args');
+        $ok_err_info->('after init w/o args');
+        ok($lei->('init'), 'idempotent init w/o args');
+        $ok_err_info->('after idempotent init w/o args');
+
+        ok(!$lei->('init', "$home/x"), 'init conflict');
+        is(grep(/^E:/, split(/^/, $err)), 1, 'got error on conflict');
+        ok(!-e "$home/x", 'nothing created on conflict');
+        $cleanup->();
+
+        ok($lei->('init', "$home/x"), 'init conflict resolved');
+        $ok_err_info->('init w/ arg');
+        ok($lei->('init', "$home/x"), 'init idempotent w/ path');
+        $ok_err_info->('init idempotent w/ arg');
+        ok(-d "$home/x", 'created dir');
+        $cleanup->("$home/x");
+
+        ok(!$lei->('init', "$home/x", "$home/2"), 'too many args fails');
+        like($err, qr/too many/, 'noted excessive');
+        ok(!-e "$home/x", 'x not created on excessive');
+        for my $d (@$home_trash) {
+                my $base = (split(m!/!, $d))[-1];
+                ok(!-d $d, "$base not created");
+        }
+        is($out, '', 'nothing in stdout on init failure');
+};
+
+my $test_config = sub {
+        $cleanup->();
+        ok($lei->(qw(config a.b c)), 'config set var');
+        is($out.$err, '', 'no output on var set');
+        ok($lei->(qw(config -l)), 'config -l');
+        is($err, '', 'no errors on listing');
+        is($out, "a.b=c\n", 'got expected output');
+        ok(!$lei->(qw(config -f), "$home/.config/f", qw(x.y z)),
+                        'config set var with -f fails');
+        like($err, qr/not supported/, 'not supported noted');
+        ok(!-f "$home/config/f", 'no file created');
+};
+
+my $setup_publicinboxes = sub {
+        state $done = '';
+        return if $done eq $home;
+        use PublicInbox::InboxWritable;
+        for my $V (1, 2) {
+                run_script([qw(-init), "-V$V", "t$V",
+                                '--newsgroup', "t.$V",
+                                "$home/t$V", "http://example.com/t$V",
+                                "t$V\@example.com" ]) or BAIL_OUT "init v$V";
+        }
+        my $cfg = PublicInbox::Config->new;
+        my $seen = 0;
+        $cfg->each_inbox(sub {
+                my ($ibx) = @_;
+                my $im = PublicInbox::InboxWritable->new($ibx)->importer(0);
+                my $V = $ibx->version;
+                my @eml = glob('t/*.eml');
+                push(@eml, 't/data/0001.patch') if $V == 2;
+                for (@eml) {
+                        next if $_ eq 't/psgi_v2-old.eml'; # dup mid
+                        $im->add(eml_load($_)) or BAIL_OUT "v$V add $_";
+                        $seen++;
+                }
+                $im->done;
+                if ($V == 1) {
+                        run_script(['-index', $ibx->{inboxdir}]) or
+                                BAIL_OUT 'index v1';
+                }
+        });
+        $done = $home;
+        $seen || BAIL_OUT 'no imports';
+};
+
+my $test_external_remote = sub {
+        my ($url, $k) = @_;
+SKIP: {
+        my $nr = 4;
+        skip "$k unset", $nr if !$url;
+        which('curl') or skip 'no curl', $nr;
+        which('torsocks') or skip 'no torsocks', $nr if $url =~ m!\.onion/!;
+        $lei->('ls-external');
+        for my $e (split(/^/ms, $out)) {
+                $e =~ s/\s+boost.*//s;
+                $lei->('forget-external', '-q', $e) or
+                        fail "error forgetting $e: $err"
+        }
+        $lei->('add-external', $url);
+        my $mid = '20140421094015.GA8962@dcvr.yhbt.net';
+        ok($lei->('q', "m:$mid"), "query $url");
+        is($err, '', "no errors on $url");
+        my $res = PublicInbox::Config->json->decode($out);
+        is($res->[0]->{'m'}, "<$mid>", "got expected mid from $url");
+        ok($lei->('q', "m:$mid", 'd:..20101002'), 'no results, no error');
+        like($err, qr/404/, 'noted 404');
+        is($out, "[null]\n", 'got null results');
+        $lei->('forget-external', $url);
+} # /SKIP
+}; # /sub
+
+my $test_external = sub {
+        $setup_publicinboxes->();
+        $cleanup->();
+        $lei->('ls-external');
+        is($out.$err, '', 'ls-external no output, yet');
+        ok(!-e $config_file && !-e $store_dir,
+                'nothing created by ls-external');
+
+        ok(!$lei->('add-external', "$home/nonexistent"),
+                "fails on non-existent dir");
+        $lei->('ls-external');
+        is($out.$err, '', 'ls-external still has no output');
+        my $cfg = PublicInbox::Config->new;
+        $cfg->each_inbox(sub {
+                my ($ibx) = @_;
+                ok($lei->(qw(add-external -q), $ibx->{inboxdir}),
+                        'added external');
+                is($out.$err, '', 'no output');
+        });
+        ok(-s $config_file && -e $store_dir,
+                'add-external created config + store');
+        my $lcfg = PublicInbox::Config->new($config_file);
+        $cfg->each_inbox(sub {
+                my ($ibx) = @_;
+                is($lcfg->{"external.$ibx->{inboxdir}.boost"}, 0,
+                        "configured boost on $ibx->{name}");
+        });
+        $lei->('ls-external');
+        like($out, qr/boost=0\n/s, 'ls-external has output');
+        ok($lei->(qw(add-external -q https://EXAMPLE.com/ibx)), 'add remote');
+        is($err, '', 'no warnings after add-external');
+        $lei->('ls-external');
+        like($out, qr!https://example\.com/ibx/!s, 'added canonical URL');
+        is($err, '', 'no warnings on ls-external');
+        ok($lei->(qw(forget-external -q https://EXAMPLE.com/ibx)),
+                'forget');
+        $lei->('ls-external');
+        unlike($out, qr!https://example\.com/ibx/!s, 'removed canonical URL');
+
+        ok(!$lei->(qw(q s:prefix -o /dev/null -f maildir)), 'bad maildir');
+        like($err, qr!/dev/null exists and is not a directory!,
+                'error shown');
+        is($? >> 8, 1, 'errored out with exit 1');
+
+        ok(!$lei->(qw(q s:prefix -f mboxcl2 -o), $home), 'bad mbox');
+        like($err, qr!\Q$home\E exists and is not a writable file!,
+                'error shown');
+        is($? >> 8, 1, 'errored out with exit 1');
+
+        ok(!$lei->(qw(q s:prefix -o /dev/stdout -f Mbox2)), 'bad format');
+        like($err, qr/bad mbox --format=mbox2/, 'error shown');
+        is($? >> 8, 1, 'errored out with exit 1');
+
+        # note, on a Bourne shell users should be able to use either:
+        #        s:"use boolean prefix"
+        #        "s:use boolean prefix"
+        # or use single quotes, it should not matter.  Users only need
+        # to know shell quoting rules, not Xapian quoting rules.
+        # No double-quoting should be imposed on users on the CLI
+        $lei->('q', 's:use boolean prefix');
+        like($out, qr/search: use boolean prefix/, 'phrase search got result');
+        require IO::Uncompress::Gunzip;
+        for my $sfx ('', '.gz') {
+                my $f = "$home/mbox$sfx";
+                $lei->('q', '-o', "mboxcl2:$f", 's:use boolean prefix');
+                my $cat = $sfx eq '' ? sub {
+                        open my $mb, '<', $f or fail "no mbox: $!";
+                        <$mb>
+                } : sub {
+                        my $z = IO::Uncompress::Gunzip->new($f, MultiStream=>1);
+                        <$z>;
+                };
+                my @s = grep(/^Subject:/, $cat->());
+                is(scalar(@s), 1, "1 result in mbox$sfx");
+                $lei->('q', '-a', '-o', "mboxcl2:$f", 's:see attachment');
+                is($err, '', 'no errors from augment');
+                @s = grep(/^Subject:/, my @wtf = $cat->());
+                is(scalar(@s), 2, "2 results in mbox$sfx");
+
+                $lei->('q', '-a', '-o', "mboxcl2:$f", 's:nonexistent');
+                is($err, '', "no errors on no results ($sfx)");
+
+                my @s2 = grep(/^Subject:/, $cat->());
+                is_deeply(\@s2, \@s,
+                        "same 2 old results w/ --augment and bad search $sfx");
+
+                $lei->('q', '-o', "mboxcl2:$f", 's:nonexistent');
+                my @res = $cat->();
+                is_deeply(\@res, [], "clobber w/o --augment $sfx");
+        }
+        ok(!$lei->('q', '-o', "$home/mbox", 's:nope'),
+                        'fails if mbox format unspecified');
+        ok(!$lei->(qw(q --no-local s:see)), '--no-local');
+        is($? >> 8, 1, 'proper exit code');
+        like($err, qr/no local or remote.+? to search/, 'no inbox');
+        my %e = (
+                TEST_LEI_EXTERNAL_HTTPS => 'https://public-inbox.org/meta/',
+                TEST_LEI_EXTERNAL_ONION => $onions[int(rand(scalar(@onions)))],
+        );
+        for my $k (keys %e) {
+                my $url = $ENV{$k} // '';
+                $url = $e{$k} if $url eq '1';
+                $test_external_remote->($url, $k);
+        }
+};
+
+my $test_lei_common = sub {
+        $test_help->();
+        $test_config->();
+        $test_init->();
+        $test_external->();
+};
+
+if ($ENV{TEST_LEI_ONESHOT}) {
+        require_ok 'PublicInbox::LEI';
+        # force sun_path[108] overflow, ($lei->() filters out this path)
+        my $xrd = "$home/1shot-test".('.sun_path' x 108);
+        local $ENV{XDG_RUNTIME_DIR} = $xrd;
+        $err_filter = qr!\Q$xrd!;
+        $test_lei_common->();
+} else {
+SKIP: { # real socket
+        eval { require Socket::MsgHdr; 1 } // do {
+                require PublicInbox::Spawn;
+                PublicInbox::Spawn->can('send_cmd4');
+        } // skip 'Socket::MsgHdr or Inline::C missing or unconfigured', 115;
+        local $ENV{XDG_RUNTIME_DIR} = "$home/xdg_run";
+        my $sock = "$ENV{XDG_RUNTIME_DIR}/lei/5.seq.sock";
+        my $err_log = "$ENV{XDG_RUNTIME_DIR}/lei/errors.log";
+
+        ok($lei->('daemon-pid'), 'daemon-pid');
+        is($err, '', 'no error from daemon-pid');
+        like($out, qr/\A[0-9]+\n\z/s, 'pid returned') or BAIL_OUT;
+        chomp(my $pid = $out);
+        ok(kill(0, $pid), 'pid is valid');
+        ok(-S $sock, 'sock created');
+
+        $test_lei_common->();
+        is(-s $err_log, 0, 'nothing in errors.log');
+        open my $efh, '>>', $err_log or BAIL_OUT $!;
+        print $efh "phail\n" or BAIL_OUT $!;
+        close $efh or BAIL_OUT $!;
+
+        ok($lei->('daemon-pid'), 'daemon-pid');
+        chomp(my $pid_again = $out);
+        is($pid, $pid_again, 'daemon-pid idempotent');
+        like($err, qr/phail/, 'got mock "phail" error previous run');
+
+        ok($lei->(qw(daemon-kill)), 'daemon-kill');
+        is($out, '', 'no output from daemon-kill');
+        is($err, '', 'no error from daemon-kill');
+        for (0..100) {
+                kill(0, $pid) or last;
+                tick();
+        }
+        ok(-S $sock, 'sock still exists');
+        ok(!kill(0, $pid), 'pid gone after stop');
+
+        ok($lei->(qw(daemon-pid)), 'daemon-pid');
+        chomp(my $new_pid = $out);
+        ok(kill(0, $new_pid), 'new pid is running');
+        ok(-S $sock, 'sock still exists');
+
+        for my $sig (qw(-0 -CHLD)) {
+                ok($lei->('daemon-kill', $sig), "handles $sig");
+        }
+        is($out.$err, '', 'no output on innocuous signals');
+        ok($lei->('daemon-pid'), 'daemon-pid');
+        chomp $out;
+        is($out, $new_pid, 'PID unchanged after -0/-CHLD');
+
+        if ('socket inaccessible') {
+                chmod 0000, $sock or BAIL_OUT "chmod 0000: $!";
+                ok($lei->('help'), 'connect fail, one-shot fallback works');
+                like($err, qr/\bconnect\(/, 'connect error noted');
+                like($out, qr/^usage: /, 'help output works');
+                chmod 0700, $sock or BAIL_OUT "chmod 0700: $!";
+        }
+        unlink $sock or BAIL_OUT "unlink($sock) $!";
+        for (0..100) {
+                kill('CHLD', $new_pid) or last;
+                tick();
+        }
+        ok(!kill(0, $new_pid), 'daemon exits after unlink');
+        # success over socket, can't test without
+}; # SKIP
+} # else
+
+done_testing;
diff --git a/t/lei_dedupe.t b/t/lei_dedupe.t
new file mode 100644
index 00000000..bcb06a0a
--- /dev/null
+++ b/t/lei_dedupe.t
@@ -0,0 +1,86 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::Eml;
+use PublicInbox::Smsg;
+require_mods(qw(DBD::SQLite));
+use_ok 'PublicInbox::LeiDedupe';
+my $eml = eml_load('t/plack-qp.eml');
+my $mid = $eml->header_raw('Message-ID');
+my $different = eml_load('t/msg_iter-order.eml');
+$different->header_set('Message-ID', $mid);
+my $smsg = bless { ds => time }, 'PublicInbox::Smsg';
+$smsg->populate($eml);
+$smsg->{$_} //= '' for (qw(to cc references)) ;
+
+my $check_storable = sub {
+        my ($x) = @_;
+        SKIP: {
+                require_mods('Storable', 1);
+                my $dup = Storable::thaw(Storable::freeze($x));
+                is_deeply($dup, $x, "$x->[3] round-trips through storable");
+        }
+};
+
+my $lei = { opt => { dedupe => 'none' } };
+my $dd = PublicInbox::LeiDedupe->new($lei);
+$check_storable->($dd);
+$dd->prepare_dedupe;
+ok(!$dd->is_dup($eml), '1st is_dup w/o dedupe');
+ok(!$dd->is_dup($eml), '2nd is_dup w/o dedupe');
+ok(!$dd->is_dup($different), 'different is_dup w/o dedupe');
+ok(!$dd->is_smsg_dup($smsg), 'smsg dedupe none 1');
+ok(!$dd->is_smsg_dup($smsg), 'smsg dedupe none 2');
+
+for my $strat (undef, 'content') {
+        $lei->{opt}->{dedupe} = $strat;
+        $dd = PublicInbox::LeiDedupe->new($lei);
+        $check_storable->($dd);
+        $dd->prepare_dedupe;
+        my $desc = $strat // 'default';
+        ok(!$dd->is_dup($eml), "1st is_dup with $desc dedupe");
+        ok($dd->is_dup($eml), "2nd seen with $desc dedupe");
+        ok(!$dd->is_dup($different), "different is_dup with $desc dedupe");
+        ok(!$dd->is_smsg_dup($smsg), "is_smsg_dup pass w/ $desc dedupe");
+        ok($dd->is_smsg_dup($smsg), "is_smsg_dup reject w/ $desc dedupe");
+}
+$lei->{opt}->{dedupe} = 'bogus';
+eval { PublicInbox::LeiDedupe->new($lei) };
+like($@, qr/unsupported.*bogus/, 'died on bogus strategy');
+
+$lei->{opt}->{dedupe} = 'mid';
+$dd = PublicInbox::LeiDedupe->new($lei);
+$check_storable->($dd);
+$dd->prepare_dedupe;
+ok(!$dd->is_dup($eml), '1st is_dup with mid dedupe');
+ok($dd->is_dup($eml), '2nd seen with mid dedupe');
+ok($dd->is_dup($different), 'different seen with mid dedupe');
+ok(!$dd->is_smsg_dup($smsg), 'smsg mid dedupe pass');
+ok($dd->is_smsg_dup($smsg), 'smsg mid dedupe reject');
+
+$lei->{opt}->{dedupe} = 'oid';
+$dd = PublicInbox::LeiDedupe->new($lei);
+$check_storable->($dd);
+$dd->prepare_dedupe;
+
+# --augment won't have OIDs:
+ok(!$dd->is_dup($eml), '1st is_dup with oid dedupe (augment)');
+ok($dd->is_dup($eml), '2nd seen with oid dedupe (augment)');
+ok(!$dd->is_dup($different), 'different is_dup with mid dedupe (augment)');
+$different->header_set('Status', 'RO');
+ok($dd->is_dup($different), 'different seen with oid dedupe Status removed');
+
+ok(!$dd->is_dup($eml, '01d'), '1st is_dup with oid dedupe');
+ok($dd->is_dup($different, '01d'), 'different content ignored if oid matches');
+ok($dd->is_dup($eml, '01D'), 'case insensitive oid comparison :P');
+ok(!$dd->is_dup($eml, '01dbad'), 'case insensitive oid comparison :P');
+
+$smsg->{blob} = 'dead';
+ok(!$dd->is_smsg_dup($smsg), 'smsg dedupe pass');
+ok($dd->is_smsg_dup($smsg), 'smsg dedupe reject');
+
+done_testing;
diff --git a/t/lei_external.t b/t/lei_external.t
new file mode 100644
index 00000000..1f0048a1
--- /dev/null
+++ b/t/lei_external.t
@@ -0,0 +1,18 @@
+#!perl -w
+use strict;
+use v5.10.1;
+use Test::More;
+my $cls = 'PublicInbox::LeiExternal';
+require_ok $cls;
+my $canon = $cls->can('_canonicalize');
+my $exp = 'https://example.com/my-inbox/';
+is($canon->('https://example.com/my-inbox'), $exp, 'trailing slash added');
+is($canon->('https://example.com/my-inbox//'), $exp, 'trailing slash removed');
+is($canon->('https://example.com//my-inbox/'), $exp, 'leading slash removed');
+is($canon->('https://EXAMPLE.com/my-inbox/'), $exp, 'lowercased');
+is($canon->('/this/path/is/nonexistent/'), '/this/path/is/nonexistent',
+        'non-existent pathname canonicalized');
+is($canon->('/this//path/'), '/this/path', 'extra slashes gone');
+is($canon->('/ALL/CAPS'), '/ALL/CAPS', 'caps preserved');
+
+done_testing;
diff --git a/t/lei_overview.t b/t/lei_overview.t
new file mode 100644
index 00000000..896cc01a
--- /dev/null
+++ b/t/lei_overview.t
@@ -0,0 +1,33 @@
+#!perl -w
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use POSIX qw(_exit);
+require_ok 'PublicInbox::LeiOverview';
+
+my $ovv = bless {}, 'PublicInbox::LeiOverview';
+$ovv->ovv_out_lk_init;
+my $lock_path = $ovv->{lock_path};
+ok(-f $lock_path, 'lock init');
+undef $ovv;
+ok(!-f $lock_path, 'lock DESTROY');
+
+$ovv = bless {}, 'PublicInbox::LeiOverview';
+$ovv->ovv_out_lk_init;
+$lock_path = $ovv->{lock_path};
+ok(-f $lock_path, 'lock init #2');
+my $pid = fork // BAIL_OUT "fork $!";
+if ($pid == 0) {
+        undef $ovv;
+        _exit(0);
+}
+is(waitpid($pid, 0), $pid, 'child exited');
+is($?, 0, 'no error in child process');
+ok(-f $lock_path, 'lock was not destroyed by child');
+undef $ovv;
+ok(!-f $lock_path, 'lock DESTROY #2');
+
+done_testing;
diff --git a/t/lei_store.t b/t/lei_store.t
new file mode 100644
index 00000000..c9360f8f
--- /dev/null
+++ b/t/lei_store.t
@@ -0,0 +1,131 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+require_mods(qw(DBD::SQLite Search::Xapian));
+require_git 2.6;
+require_ok 'PublicInbox::LeiStore';
+require_ok 'PublicInbox::ExtSearch';
+my ($home, $for_destroy) = tmpdir();
+my $opt = { 1 => \(my $out = ''), 2 => \(my $err = '') };
+my $store_dir = "$home/lst";
+local $ENV{GIT_COMMITTER_EMAIL} = 'lei@example.com';
+local $ENV{GIT_COMMITTER_NAME} = 'lei user';
+my $lst = PublicInbox::LeiStore->new($store_dir, { creat => 1 });
+ok($lst, '->new');
+my $smsg = $lst->add_eml(eml_load('t/data/0001.patch'));
+like($smsg->{blob}, qr/\A[0-9a-f]+\z/, 'add returned OID');
+my $eml = eml_load('t/data/0001.patch');
+is($lst->add_eml($eml), undef, 'idempotent');
+$lst->done;
+is_deeply([$lst->mbox_keywords($eml)], [], 'no keywords');
+$eml->header_set('Status', 'RO');
+is_deeply([$lst->mbox_keywords($eml)], ['seen'], 'seen extracted');
+$eml->header_set('X-Status', 'A');
+is_deeply([$lst->mbox_keywords($eml)], [qw(answered seen)],
+        'seen+answered extracted');
+$eml->header_set($_) for qw(Status X-Status);
+
+is_deeply([$lst->maildir_keywords('/foo:2,')], [], 'Maildir no keywords');
+is_deeply([$lst->maildir_keywords('/foo:2,S')], ['seen'], 'Maildir seen');
+is_deeply([$lst->maildir_keywords('/foo:2,RS')], ['answered', 'seen'],
+        'Maildir answered + seen');
+is_deeply([$lst->maildir_keywords('/foo:2,RSZ')], ['answered', 'seen'],
+        'Maildir answered + seen w/o Z');
+{
+        my $es = $lst->search;
+        my $msgs = $es->over->query_xover(0, 1000);
+        is(scalar(@$msgs), 1, 'one message');
+        is($msgs->[0]->{blob}, $smsg->{blob}, 'blob matches');
+        my $mset = $es->mset("mid:$msgs->[0]->{mid}");
+        is($mset->size, 1, 'search works');
+        is_deeply($es->mset_to_artnums($mset), [ $msgs->[0]->{num} ],
+                'mset_to_artnums');
+        my @kw = $es->msg_keywords(($mset->items)[0]);
+        is_deeply(\@kw, [], 'no flags');
+}
+
+for my $parallel (0, 1) {
+        $lst->{priv_eidx}->{parallel} = $parallel;
+        my $docids = $lst->set_eml_keywords($eml, qw(seen draft));
+        is(scalar @$docids, 1, 'set keywords on one doc');
+        $lst->done;
+        my @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, [qw(draft seen)], 'kw matches');
+
+        $docids = $lst->add_eml_keywords($eml, qw(seen draft));
+        $lst->done;
+        is(scalar @$docids, 1, 'idempotently added keywords to doc');
+        @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, [qw(draft seen)], 'kw matches after noop');
+
+        $docids = $lst->remove_eml_keywords($eml, qw(seen draft));
+        is(scalar @$docids, 1, 'removed from one doc');
+        $lst->done;
+        @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, [], 'kw matches after remove');
+
+        $docids = $lst->remove_eml_keywords($eml, qw(answered));
+        is(scalar @$docids, 1, 'removed from one doc (idempotently)');
+        $lst->done;
+        @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, [], 'kw matches after remove (idempotent)');
+
+        $docids = $lst->add_eml_keywords($eml, qw(answered));
+        is(scalar @$docids, 1, 'added to empty doc');
+        $lst->done;
+        @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, ['answered'], 'kw matches after add');
+
+        $docids = $lst->set_eml_keywords($eml);
+        is(scalar @$docids, 1, 'set to clobber');
+        $lst->done;
+        @kw = $lst->search->msg_keywords($docids->[0]);
+        is_deeply(\@kw, [], 'set clobbers all');
+
+        my $set = eml_load('t/plack-qp.eml');
+        $set->header_set('Message-ID', "<set\@$parallel>");
+        my $ret = $lst->set_eml($set, 'seen');
+        is(ref $ret, 'PublicInbox::Smsg', 'initial returns smsg');
+        my $ids = $lst->set_eml($set, qw(seen));
+        is_deeply($ids, [ $ret->{num} ], 'set_eml idempotent');
+        $ids = $lst->set_eml($set, qw(seen answered));
+        is_deeply($ids, [ $ret->{num} ], 'set_eml to change kw');
+        $lst->done;
+        @kw = $lst->search->msg_keywords($ids->[0]);
+        is_deeply(\@kw, [qw(answered seen)], 'set changed kw');
+}
+
+SKIP: {
+        require_mods(qw(Storable), 1);
+        ok($lst->can('ipc_do'), 'ipc_do works if we have Storable');
+        $eml->header_set('Message-ID', '<ipc-test@example>');
+        my $pid = $lst->ipc_worker_spawn('lei-store');
+        ok($pid > 0, 'got a worker');
+        my $smsg = $lst->ipc_do('set_eml', $eml, qw(seen));
+        is(ref($smsg), 'PublicInbox::Smsg', 'set_eml works over ipc');
+        my $ids = $lst->ipc_do('set_eml', $eml, qw(seen));
+        is_deeply($ids, [ $smsg->{num} ], 'docid returned');
+
+        $eml->header_set('Message-ID');
+        my $no_mid = $lst->ipc_do('set_eml', $eml, qw(seen));
+        my $wait = $lst->ipc_do('done');
+        my @kw = $lst->search->msg_keywords($no_mid->{num});
+        is_deeply(\@kw, [qw(seen)], 'ipc set changed kw');
+
+        is(ref($smsg), 'PublicInbox::Smsg', 'no mid works ipc');
+        $ids = $lst->ipc_do('set_eml', $eml, qw(seen));
+        is_deeply($ids, [ $no_mid->{num} ], 'docid returned w/o mid w/ ipc');
+        $lst->ipc_do('done');
+        $lst->ipc_worker_stop;
+        $ids = $lst->ipc_do('set_eml', $eml, qw(seen answered));
+        is_deeply($ids, [ $no_mid->{num} ], 'docid returned w/o mid w/o ipc');
+        $wait = $lst->ipc_do('done');
+        @kw = $lst->search->msg_keywords($no_mid->{num});
+        is_deeply(\@kw, [qw(answered seen)], 'set changed kw w/o ipc');
+}
+
+done_testing;
diff --git a/t/lei_to_mail.t b/t/lei_to_mail.t
new file mode 100644
index 00000000..47c0e3d4
--- /dev/null
+++ b/t/lei_to_mail.t
@@ -0,0 +1,267 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::Eml;
+use Fcntl qw(SEEK_SET);
+use PublicInbox::Spawn qw(popen_rd which);
+use List::Util qw(shuffle);
+require_mods(qw(DBD::SQLite));
+require PublicInbox::MboxReader;
+require PublicInbox::LeiOverview;
+use_ok 'PublicInbox::LeiToMail';
+my $from = "Content-Length: 10\nSubject: x\n\nFrom hell\n";
+my $noeol = "Subject: x\n\nFrom hell";
+my $crlf = $noeol;
+$crlf =~ s/\n/\r\n/g;
+my $kw = [qw(seen answered flagged)];
+my $smsg = { kw => $kw, blob => '0'x40 };
+my @MBOX = qw(mboxcl2 mboxrd mboxcl mboxo);
+for my $mbox (@MBOX) {
+        my $m = "eml2$mbox";
+        my $cb = PublicInbox::LeiToMail->can($m);
+        my $s = $cb->(PublicInbox::Eml->new($from), $smsg);
+        is(substr($$s, -1, 1), "\n", "trailing LF in normal $mbox");
+        my $eml = PublicInbox::Eml->new($s);
+        is($eml->header('Status'), 'OR', "Status: set by $m");
+        is($eml->header('X-Status'), 'AF', "X-Status: set by $m");
+        if ($mbox eq 'mboxcl2') {
+                like($eml->body_raw, qr/^From /, "From not escaped $m");
+        } else {
+                like($eml->body_raw, qr/^>From /, "From escaped once by $m");
+        }
+        my @cl = $eml->header('Content-Length');
+        if ($mbox =~ /mboxcl/) {
+                is(scalar(@cl), 1, "$m only has one Content-Length header");
+                is($cl[0] + length("\n"),
+                        length($eml->body_raw), "$m Content-Length matches");
+        } else {
+                is(scalar(@cl), 0, "$m clobbered Content-Length");
+        }
+        $s = $cb->(PublicInbox::Eml->new($noeol), $smsg);
+        is(substr($$s, -1, 1), "\n",
+                "trailing LF added by $m when original lacks EOL");
+        $eml = PublicInbox::Eml->new($s);
+        if ($mbox eq 'mboxcl2') {
+                is($eml->body_raw, "From hell\n", "From not escaped by $m");
+        } else {
+                is($eml->body_raw, ">From hell\n", "From escaped once by $m");
+        }
+        $s = $cb->(PublicInbox::Eml->new($crlf), $smsg);
+        is(substr($$s, -2, 2), "\r\n",
+                "trailing CRLF added $m by original lacks EOL");
+        $eml = PublicInbox::Eml->new($s);
+        if ($mbox eq 'mboxcl2') {
+                is($eml->body_raw, "From hell\r\n", "From not escaped by $m");
+        } else {
+                is($eml->body_raw, ">From hell\r\n", "From escaped once by $m");
+        }
+        if ($mbox =~ /mboxcl/) {
+                is($eml->header('Content-Length') + length("\r\n"),
+                        length($eml->body_raw), "$m Content-Length matches");
+        } elsif ($mbox eq 'mboxrd') {
+                $s = $cb->($eml, $smsg);
+                $eml = PublicInbox::Eml->new($s);
+                is($eml->body_raw,
+                        ">>From hell\r\n\r\n", "From escaped again by $m");
+        }
+}
+
+my ($tmpdir, $for_destroy) = tmpdir();
+local $ENV{TMPDIR} = $tmpdir;
+open my $err, '>>', "$tmpdir/lei.err" or BAIL_OUT $!;
+my $lei = { 2 => $err };
+my $buf = <<'EOM';
+From: x@example.com
+Subject: x
+
+blah
+EOM
+my $fn = "$tmpdir/x.mbox";
+my ($mbox) = shuffle(@MBOX); # pick one, shouldn't matter
+my $wcb_get = sub {
+        my ($fmt, $dst) = @_;
+        delete $lei->{dedupe};
+        $lei->{ovv} = bless {
+                fmt => $fmt,
+                dst => $dst
+        }, 'PublicInbox::LeiOverview';
+        my $l2m = PublicInbox::LeiToMail->new($lei);
+        SKIP: {
+                require_mods('Storable', 1);
+                my $dup = Storable::thaw(Storable::freeze($l2m));
+                is_deeply($dup, $l2m, "$fmt round-trips through storable");
+        }
+        my $zpipe = $l2m->pre_augment($lei);
+        $l2m->do_augment($lei);
+        $l2m->post_augment($lei, $zpipe);
+        my $cb = $l2m->write_cb($lei);
+        delete $lei->{1};
+        $cb;
+};
+
+my $deadbeef = { blob => 'deadbeef', kw => [ qw(seen) ] };
+my $orig = do {
+        my $wcb = $wcb_get->($mbox, $fn);
+        is(ref $wcb, 'CODE', 'write_cb returned callback');
+        ok(-f $fn && !-s _, 'empty file created');
+        $wcb->(\(my $dup = $buf), $deadbeef);
+        undef $wcb;
+        open my $fh, '<', $fn or BAIL_OUT $!;
+        my $raw = do { local $/; <$fh> };
+        like($raw, qr/^blah\n/sm, 'wrote content');
+        unlink $fn or BAIL_OUT $!;
+
+        local $lei->{opt} = { jobs => 2 };
+        $wcb = $wcb_get->($mbox, $fn);
+        ok(-f $fn && !-s _, 'truncated mbox destination');
+        $wcb->(\($dup = $buf), $deadbeef);
+        undef $wcb;
+        open $fh, '<', $fn or BAIL_OUT $!;
+        is(do { local $/; <$fh> }, $raw, 'jobs > 1');
+        $raw;
+};
+for my $zsfx (qw(gz bz2 xz)) { # XXX should we support zst, zz, lzo, lzma?
+        my $zsfx2cmd = PublicInbox::LeiToMail->can('zsfx2cmd');
+        SKIP: {
+                my $cmd = eval { $zsfx2cmd->($zsfx, 0, $lei) };
+                skip $@, 3 if $@;
+                my $dc_cmd = eval { $zsfx2cmd->($zsfx, 1, $lei) };
+                ok($dc_cmd, "decompressor for .$zsfx");
+                my $f = "$fn.$zsfx";
+                my $wcb = $wcb_get->($mbox, $f);
+                $wcb->(\(my $dup = $buf), $deadbeef);
+                undef $wcb;
+                my $uncompressed = xqx([@$dc_cmd, $f]);
+                is($uncompressed, $orig, "$zsfx works unlocked");
+
+                local $lei->{opt} = { jobs => 2 }; # for atomic writes
+                unlink $f or BAIL_OUT "unlink $!";
+                $wcb = $wcb_get->($mbox, $f);
+                $wcb->(\($dup = $buf), $deadbeef);
+                undef $wcb;
+                is(xqx([@$dc_cmd, $f]), $orig, "$zsfx matches with lock");
+
+                local $lei->{opt} = { augment => 1 };
+                $wcb = $wcb_get->($mbox, $f);
+                $wcb->(\($dup = $buf . "\nx\n"), $deadbeef);
+                undef $wcb; # commit
+
+                my $cat = popen_rd([@$dc_cmd, $f]);
+                my @raw;
+                PublicInbox::MboxReader->$mbox($cat,
+                        sub { push @raw, shift->as_string });
+                like($raw[1], qr/\nblah\n\nx\n\z/s, "augmented $zsfx");
+                like($raw[0], qr/\nblah\n\z/s, "original preserved $zsfx");
+
+                local $lei->{opt} = { augment => 1, jobs => 2 };
+                $wcb = $wcb_get->($mbox, $f);
+                $wcb->(\($dup = $buf . "\ny\n"), $deadbeef);
+                undef $wcb; # commit
+
+                my @raw3;
+                $cat = popen_rd([@$dc_cmd, $f]);
+                PublicInbox::MboxReader->$mbox($cat,
+                        sub { push @raw3, shift->as_string });
+                my $y = pop @raw3;
+                is_deeply(\@raw3, \@raw, 'previous messages preserved');
+                like($y, qr/\nblah\n\ny\n\z/s, "augmented $zsfx (atomic)");
+        }
+}
+
+my $as_orig = sub {
+        my ($eml) = @_;
+        $eml->header_set('Status');
+        $eml->as_string;
+};
+
+unlink $fn or BAIL_OUT $!;
+if ('default deduplication uses content_hash') {
+        my $wcb = $wcb_get->('mboxo', $fn);
+        $deadbeef->{kw} = [];
+        $wcb->(\(my $x = $buf), $deadbeef) for (1..2);
+        undef $wcb; # undef to commit changes
+        my $cmp = '';
+        open my $fh, '<', $fn or BAIL_OUT $!;
+        PublicInbox::MboxReader->mboxo($fh, sub { $cmp .= $as_orig->(@_) });
+        is($cmp, $buf, 'only one message written');
+
+        local $lei->{opt} = { augment => 1 };
+        $wcb = $wcb_get->('mboxo', $fn);
+        $wcb->(\($x = $buf . "\nx\n"), $deadbeef) for (1..2);
+        undef $wcb; # undef to commit changes
+        open $fh, '<', $fn or BAIL_OUT $!;
+        my @x;
+        PublicInbox::MboxReader->mboxo($fh, sub { push @x, $as_orig->(@_) });
+        is(scalar(@x), 2, 'augmented mboxo');
+        is($x[0], $cmp, 'original message preserved');
+        is($x[1], $buf . "\nx\n", 'new message appended');
+}
+
+{ # stdout support
+        open my $tmp, '+>', undef or BAIL_OUT $!;
+        local $lei->{1} = $tmp;
+        my $wcb = $wcb_get->('mboxrd', '/dev/stdout');
+        $wcb->(\(my $x = $buf), $deadbeef);
+        undef $wcb; # commit
+        seek($tmp, 0, SEEK_SET) or BAIL_OUT $!;
+        my $cmp = '';
+        PublicInbox::MboxReader->mboxrd($tmp, sub { $cmp .= $as_orig->(@_) });
+        is($cmp, $buf, 'message written to stdout');
+}
+
+SKIP: { # FIFO support
+        use POSIX qw(mkfifo);
+        my $fn = "$tmpdir/fifo";
+        mkfifo($fn, 0600) or skip("mkfifo not supported: $!", 1);
+        my $cat = popen_rd([which('cat'), $fn]);
+        my $wcb = $wcb_get->('mboxo', $fn);
+        $wcb->(\(my $x = $buf), $deadbeef);
+        undef $wcb; # commit
+        my $cmp = '';
+        PublicInbox::MboxReader->mboxo($cat, sub { $cmp .= $as_orig->(@_) });
+        is($cmp, $buf, 'message written to FIFO');
+}
+
+{ # Maildir support
+        my $md = "$tmpdir/maildir/";
+        my $wcb = $wcb_get->('maildir', $md);
+        is(ref($wcb), 'CODE', 'got Maildir callback');
+        my $b4dc0ffee = { blob => 'badc0ffee', kw => [] };
+        $wcb->(\(my $x = $buf), $b4dc0ffee);
+
+        my @f;
+        PublicInbox::LeiToMail::_maildir_each_file($md, sub { push @f, shift });
+        open my $fh, $f[0] or BAIL_OUT $!;
+        is(do { local $/; <$fh> }, $buf, 'wrote to Maildir');
+
+        $wcb = $wcb_get->('maildir', $md);
+        my $deadcafe = { blob => 'deadcafe', kw => [] };
+        $wcb->(\($x = $buf."\nx\n"), $deadcafe);
+
+        my @x = ();
+        PublicInbox::LeiToMail::_maildir_each_file($md, sub { push @x, shift });
+        is(scalar(@x), 1, 'wrote one new file');
+        ok(!-f $f[0], 'old file clobbered');
+        open $fh, $x[0] or BAIL_OUT $!;
+        is(do { local $/; <$fh> }, $buf."\nx\n", 'wrote new file to Maildir');
+
+        local $lei->{opt}->{augment} = 1;
+        $wcb = $wcb_get->('maildir', $md);
+        $wcb->(\($x = $buf."\ny\n"), $deadcafe);
+        $wcb->(\($x = $buf."\ny\n"), $b4dc0ffee); # skipped by dedupe
+        @f = ();
+        PublicInbox::LeiToMail::_maildir_each_file($md, sub { push @f, shift });
+        is(scalar grep(/\A\Q$x[0]\E\z/, @f), 1, 'old file still there');
+        my @new = grep(!/\A\Q$x[0]\E\z/, @f);
+        is(scalar @new, 1, '1 new file written (b4dc0ffee skipped)');
+        open $fh, $x[0] or BAIL_OUT $!;
+        is(do { local $/; <$fh> }, $buf."\nx\n", 'old file untouched');
+        open $fh, $new[0] or BAIL_OUT $!;
+        is(do { local $/; <$fh> }, $buf."\ny\n", 'new file written');
+}
+
+done_testing;
diff --git a/t/lei_xsearch.t b/t/lei_xsearch.t
new file mode 100644
index 00000000..f745ea3e
--- /dev/null
+++ b/t/lei_xsearch.t
@@ -0,0 +1,81 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use List::Util qw(shuffle max);
+use PublicInbox::TestCommon;
+use PublicInbox::ExtSearchIdx;
+use PublicInbox::Eml;
+use PublicInbox::InboxWritable;
+require_mods(qw(DBD::SQLite Search::Xapian));
+require_git 2.6;
+require_ok 'PublicInbox::LeiXSearch';
+my ($home, $for_destroy) = tmpdir();
+my @ibx;
+for my $V (1..2) {
+        for my $i (3..6) {
+                my $ibx = PublicInbox::InboxWritable->new({
+                        inboxdir => "$home/v$V-$i",
+                        name => "test-v$V-$i",
+                        version => $V,
+                        indexlevel => 'medium',
+                        -primary_address => "v$V-$i\@example.com",
+                }, { nproc => int(rand(8)) + 1 });
+                push @ibx, $ibx;
+                my $im = $ibx->importer(0);
+                for my $j (0..9) {
+                        my $eml = PublicInbox::Eml->new(<<EOF);
+From: x\@example.com
+To: $ibx->{-primary_address}
+Date: Fri, 02 Oct 1993 0$V:0$i:0$j +0000
+Subject: v${V}i${i}j$j
+Message-ID: <v${V}i${i}j$j\@example>
+
+${V}er ${i}on j$j
+EOF
+                        $im->add($eml);
+                }
+                $im->done;
+        }
+}
+my $first = shift @ibx; is($first->{name}, 'test-v1-3', 'first plucked');
+my $last = pop @ibx; is($last->{name}, 'test-v2-6', 'last plucked');
+my $eidx = PublicInbox::ExtSearchIdx->new("$home/eidx");
+$eidx->attach_inbox($first);
+$eidx->attach_inbox($last);
+$eidx->eidx_sync({fsync => 0});
+my $es = PublicInbox::ExtSearch->new("$home/eidx");
+my $lxs = PublicInbox::LeiXSearch->new;
+for my $ibxish (shuffle($es, @ibx)) {
+        $lxs->prepare_external($ibxish);
+}
+for my $loc ($lxs->locals) {
+        $lxs->attach_external($loc);
+}
+my $nr = $lxs->xdb->get_doccount;
+my $mset = $lxs->mset('d:19931002..19931003', { limit => $nr });
+is($mset->size, $nr, 'got all messages');
+my @msgs;
+for my $mi ($mset->items) {
+        if (my $smsg = $lxs->smsg_for($mi)) {
+                push @msgs, $smsg;
+        } else {
+                diag "E: ${\$mi->get_docid} missing";
+        }
+}
+is(scalar(@msgs), $nr, 'smsgs retrieved for all');
+
+$mset = $lxs->recent(undef, { limit => 1 });
+is($mset->size, 1, 'one result');
+my $max = max(map { $_->{docid} } @msgs);
+is($lxs->smsg_for(($mset->items)[0])->{docid}, $max,
+        'got highest docid');
+
+my @ibxish = $lxs->locals;
+is(scalar(@ibxish), scalar(@ibx) + 1, 'got locals back');
+is($lxs->search, $lxs, '->search works');
+is($lxs->over, undef, '->over fails');
+
+done_testing;
diff --git a/t/linkify.t b/t/linkify.t
index 34840410..e42e1efe 100644
--- a/t/linkify.t
+++ b/t/linkify.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/mbox_reader.t b/t/mbox_reader.t
new file mode 100644
index 00000000..30a5e6e3
--- /dev/null
+++ b/t/mbox_reader.t
@@ -0,0 +1,94 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use List::Util qw(shuffle);
+use PublicInbox::Eml;
+use Fcntl qw(SEEK_SET);
+require_ok 'PublicInbox::MboxReader';
+require_ok 'PublicInbox::LeiToMail';
+my %raw = (
+        hdr_only => "From: header-only\@example.com\n\n",
+        small_from => "From: small-from\@example.com\n\nFrom hell\n",
+        small => "From: small\@example.com\n\nfrom hell\n",
+        big_hdr_only => "From: big-header\@example.com\n" .
+                (('A: '.('a' x 72)."\n") x 1000)."\n",
+        big_body => "From: big-body\@example.com\n\n".
+                (('b: '.('b' x 72)."\n") x 1000) .
+                "From hell\n",
+        big_all => "From: big-all\@example.com\n".
+                (("A: ".('a' x 72)."\n") x 1000). "\n" .
+                (("b: ".('b' x 72)."\n") x 1000) .
+                "From hell\n",
+);
+
+if ($ENV{TEST_EXTRA}) {
+        for my $fn (glob('t/*.eml'), glob('t/*/*.{patch,eml}')) {
+                $raw{$fn} = eml_load($fn)->as_string;
+        }
+}
+
+my $reader = PublicInbox::MboxReader->new;
+my $check_fmt = sub {
+        my $fmt = shift;
+        my @order = shuffle(keys %raw);
+        my $eml2mbox = PublicInbox::LeiToMail->can("eml2$fmt");
+        open my $fh, '+>', undef or BAIL_OUT "open: $!";
+        for my $k (@order) {
+                my $eml = PublicInbox::Eml->new($raw{$k});
+                my $buf = $eml2mbox->($eml);
+                print $fh $$buf or BAIL_OUT "print $!";
+        }
+        seek($fh, 0, SEEK_SET) or BAIL_OUT "seek: $!";
+        $reader->$fmt($fh, sub {
+                my ($eml) = @_;
+                $eml->header_set('Status');
+                $eml->header_set('Lines');
+                my $cur = shift @order;
+                my @cl = $eml->header_raw('Content-Length');
+                if ($fmt =~ /\Amboxcl/) {
+                        is(scalar(@cl), 1, "Content-Length set $fmt $cur");
+                        my $raw = $eml->body_raw;
+                        my $adj = 0;
+                        if ($fmt eq 'mboxcl') {
+                                my @from = ($raw =~ /^(From )/smg);
+                                $adj = scalar(@from);
+                        }
+                        is(length($raw), $cl[0] - $adj,
+                                "Content-Length is correct $fmt $cur");
+                        # clobber for ->as_string comparison below
+                        $eml->header_set('Content-Length');
+                } else {
+                        is(scalar(@cl), 0, "Content-Length unset $fmt $cur");
+                }
+                my $orig = PublicInbox::Eml->new($raw{$cur});
+                is($eml->as_string, $orig->as_string,
+                        "read back original $fmt $cur");
+        });
+};
+my @mbox = qw(mboxrd mboxo mboxcl mboxcl2);
+for my $fmt (@mbox) { $check_fmt->($fmt) }
+s/\n/\r\n/sg for (values %raw);
+for my $fmt (@mbox) { $check_fmt->($fmt) }
+
+SKIP: {
+        use PublicInbox::Spawn qw(popen_rd);
+        use Time::HiRes qw(alarm);
+        my $fh = popen_rd([ $^X, '-E', <<'' ]);
+say "From x@y Fri Oct  2 00:00:00 1993";
+print "a: b\n\n", "x" x 70000, "\n\n";
+say "From x@y Fri Oct  2 00:00:00 2010";
+print "Final: bit\n\n", "Incomplete\n\n";
+exit 1
+
+        my @x;
+        eval { $reader->mboxrd($fh, sub { push @x, shift->as_string }) };
+        like($@, qr/error closing mbox/, 'detects error reading from pipe');
+        is(scalar(@x), 1, 'only saw one message');
+        is(scalar(grep(/Final/, @x)), 0, 'no incomplete bit');
+}
+
+done_testing;
diff --git a/t/mda.t b/t/mda.t
index c5b35eec..d20cdb92 100644
--- a/t/mda.t
+++ b/t/mda.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/mda_filter_rubylang.t b/t/mda_filter_rubylang.t
index 754d52f7..d05eec25 100644
--- a/t/mda_filter_rubylang.t
+++ b/t/mda_filter_rubylang.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -44,8 +44,8 @@ something
 EOF
                 ok(run_script(['-mda'], $env, $opt), 'message delivered');
         }
-        my $config = PublicInbox::Config->new;
-        my $ibx = $config->lookup_name($v);
+        my $cfg = PublicInbox::Config->new;
+        my $ibx = $cfg->lookup_name($v);
 
         # make sure all serials are searchable:
         for my $i (1..2) {
diff --git a/t/mid.t b/t/mid.t
index 3b8f4108..e2d8dcbf 100644
--- a/t/mid.t
+++ b/t/mid.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/mime.t b/t/mime.t
index 46c1d8d7..471f0efa 100644
--- a/t/mime.t
+++ b/t/mime.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # This library is free software; you can redistribute it and/or modify
 # it under the same terms as Perl itself.
 # Artistic or GPL-1+ <https://www.gnu.org/licenses/gpl-1.0.txt>
diff --git a/t/miscsearch.t b/t/miscsearch.t
new file mode 100644
index 00000000..0424328d
--- /dev/null
+++ b/t/miscsearch.t
@@ -0,0 +1,57 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::InboxWritable;
+require_mods(qw(Search::Xapian DBD::SQLite));
+use_ok 'PublicInbox::MiscSearch';
+use_ok 'PublicInbox::MiscIdx';
+
+my ($tmp, $for_destroy) = tmpdir();
+my $eidx = { xpfx => "$tmp/eidx", -no_fsync => 1 }; # mock ExtSearchIdx
+{
+        mkdir "$tmp/v1" or BAIL_OUT "mkdir $!";
+        open my $fh, '>', "$tmp/v1/description" or BAIL_OUT "open: $!";
+        print $fh "Everything sucks this year\n" or BAIL_OUT "print $!";
+        close $fh or BAIL_OUT "close $!";
+}
+{
+        my $v1 = PublicInbox::InboxWritable->new({
+                inboxdir => "$tmp/v1",
+                name => 'hope',
+                address => [ 'nope@example.com' ],
+                indexlevel => 'basic',
+                version => 1,
+        });
+        $v1->init_inbox;
+        my $mi = PublicInbox::MiscIdx->new($eidx);
+        $mi->begin_txn;
+        $mi->index_ibx($v1);
+        $mi->commit_txn;
+}
+
+my $ms = PublicInbox::MiscSearch->new("$tmp/eidx/misc");
+my $mset = $ms->mset('"everything sucks today"');
+is(scalar($mset->items), 0, 'no match on description phrase');
+
+$mset = $ms->mset('"everything sucks this year"');
+is(scalar($mset->items), 1, 'match phrase on description');
+
+$mset = $ms->mset('everything sucks');
+is(scalar($mset->items), 1, 'match words in description');
+
+$mset = $ms->mset('nope@example.com');
+is(scalar($mset->items), 1, 'match full address');
+
+$mset = $ms->mset('nope');
+is(scalar($mset->items), 1, 'match partial address');
+
+$mset = $ms->mset('hope');
+is(scalar($mset->items), 1, 'match name');
+my $mi = ($mset->items)[0];
+my $doc = $mi->get_document;
+is($doc->get_data, '{}', 'stored empty data');
+
+done_testing;
diff --git a/t/msg_iter.t b/t/msg_iter.t
index 4ee3a201..e46d515c 100644
--- a/t/msg_iter.t
+++ b/t/msg_iter.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/msgmap.t b/t/msgmap.t
index 437e106e..2d462dfb 100644
--- a/t/msgmap.t
+++ b/t/msgmap.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -12,7 +12,7 @@ my $d = PublicInbox::Msgmap->new($tmpdir, 1);
 my %mid2num;
 my %num2mid;
 my @mids = qw(a@b c@d e@f g@h aa@bb aa@cc);
-is_deeply([$d->minmax], [undef,undef], "empty min max on new DB");
+is_deeply([$d->minmax], [0,0], "zero min max on new DB");
 
 foreach my $mid (@mids) {
         my $n = $d->mid_insert($mid);
diff --git a/t/msgtime.t b/t/msgtime.t
index 89fd9e37..00d57999 100644
--- a/t/msgtime.t
+++ b/t/msgtime.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/multi-mid.t b/t/multi-mid.t
index 41d556b9..e9c3dd8c 100644
--- a/t/multi-mid.t
+++ b/t/multi-mid.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/nntp.t b/t/nntp.t
index 9a482acb..5bad9dfe 100644
--- a/t/nntp.t
+++ b/t/nntp.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -8,6 +8,7 @@ use PublicInbox::Eml;
 require_mods(qw(DBD::SQLite Data::Dumper));
 use_ok 'PublicInbox::NNTP';
 use_ok 'PublicInbox::Inbox';
+use PublicInbox::Config;
 
 {
         sub quote_str {
@@ -98,44 +99,38 @@ use_ok 'PublicInbox::Inbox';
 
 { # test setting NNTP headers in HEAD and ARTICLE requests
         my $u = 'https://example.com/a/';
-        my $ng = PublicInbox::Inbox->new({ name => 'test',
+        my $ibx = PublicInbox::Inbox->new({ name => 'test',
                                         inboxdir => 'test.git',
                                         address => 'a@example.com',
                                         -primary_address => 'a@example.com',
                                         newsgroup => 'test',
                                         domain => 'example.com',
                                         url => [ '//example.com/a' ]});
-        is($ng->base_url, $u, 'URL expanded');
+        is($ibx->base_url, $u, 'URL expanded');
         my $mid = 'a@b';
         my $mime = PublicInbox::Eml->new("Message-ID: <$mid>\r\n\r\n");
         my $hdr = $mime->header_obj;
         my $mock_self = {
-                nntpd => { grouplist => [], servername => 'example.com' },
-                ng => $ng,
+                nntpd => {
+                        servername => 'example.com',
+                        pi_cfg => bless {}, 'PublicInbox::Config',
+                },
+                ibx => $ibx,
         };
-        my $smsg = { num => 1, mid => $mid, nntp => $mock_self, -ibx => $ng };
+        my $smsg = { num => 1, mid => $mid, nntp => $mock_self, -ibx => $ibx };
         PublicInbox::NNTP::set_nntp_headers($hdr, $smsg);
         is_deeply([ $mime->header('Message-ID') ], [ "<$mid>" ],
                 'Message-ID unchanged');
-        is_deeply([ $mime->header('Archived-At') ], [ "<${u}a\@b/>" ],
-                'Archived-At: set');
-        is_deeply([ $mime->header('List-Archive') ], [ "<$u>" ],
-                'List-Archive: set');
-        is_deeply([ $mime->header('List-Post') ], [ '<mailto:a@example.com>' ],
-                'List-Post: set');
         is_deeply([ $mime->header('Newsgroups') ], [ 'test' ],
                 'Newsgroups: set');
         is_deeply([ $mime->header('Xref') ], [ 'example.com test:1' ],
                 'Xref: set');
 
-        $ng->{-base_url} = 'http://mirror.example.com/m/';
+        $ibx->{-base_url} = 'http://mirror.example.com/m/';
         $smsg->{num} = 2;
         PublicInbox::NNTP::set_nntp_headers($hdr, $smsg);
         is_deeply([ $mime->header('Message-ID') ], [ "<$mid>" ],
                 'Message-ID unchanged');
-        is_deeply([ $mime->header('Archived-At') ],
-                [ "<${u}a\@b/>", '<http://mirror.example.com/m/a@b/>' ],
-                'Archived-At: appended');
         is_deeply([ $mime->header('Xref') ], [ 'example.com test:2' ],
                 'Old Xref: clobbered');
 }
diff --git a/t/nntpd-tls.t b/t/nntpd-tls.t
index 23baf4e4..1194be6f 100644
--- a/t/nntpd-tls.t
+++ b/t/nntpd-tls.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/nntpd-v2.t b/t/nntpd-v2.t
index 1dd992a0..0433a57a 100644
--- a/t/nntpd-v2.t
+++ b/t/nntpd-v2.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 local $ENV{PI_TEST_VERSION} = 2;
 require './t/nntpd.t';
diff --git a/t/nntpd.t b/t/nntpd.t
index c7a7ee6b..63287d43 100644
--- a/t/nntpd.t
+++ b/t/nntpd.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/nodatacow.t b/t/nodatacow.t
index e5b742a2..72860d43 100644
--- a/t/nodatacow.t
+++ b/t/nodatacow.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/nulsubject.t b/t/nulsubject.t
index ccb60d52..7f5dd378 100644
--- a/t/nulsubject.t
+++ b/t/nulsubject.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/on_destroy.t b/t/on_destroy.t
new file mode 100644
index 00000000..0de67d0b
--- /dev/null
+++ b/t/on_destroy.t
@@ -0,0 +1,34 @@
+#!perl -w
+use strict;
+use v5.10.1;
+use Test::More;
+require_ok 'PublicInbox::OnDestroy';
+my @x;
+my $od = PublicInbox::OnDestroy->new(sub { push @x, 'hi' });
+is_deeply(\@x, [], 'not called, yet');
+undef $od;
+is_deeply(\@x, [ 'hi' ], 'no args works');
+$od = PublicInbox::OnDestroy->new(sub { $x[0] = $_[0] }, 'bye');
+is_deeply(\@x, [ 'hi' ], 'nothing changed while alive');
+undef $od;
+is_deeply(\@x, [ 'bye' ], 'arg passed');
+$od = PublicInbox::OnDestroy->new(sub { @x = @_ }, qw(x y));
+undef $od;
+is_deeply(\@x, [ 'x', 'y' ], '2 args passed');
+
+open my $tmp, '+>>', undef or BAIL_OUT $!;
+$tmp->autoflush(1);
+$od = PublicInbox::OnDestroy->new(1, sub { print $tmp "$$ DESTROY\n" });
+undef $od;
+is(-s $tmp, 0, '$tmp is empty on pid mismatch');
+$od = PublicInbox::OnDestroy->new($$, sub { $tmp = $$ });
+undef $od;
+is($tmp, $$, '$tmp set to $$ by callback');
+
+if (my $nr = $ENV{TEST_LEAK_NR}) {
+        for (0..$nr) {
+                $od = PublicInbox::OnDestroy->new(sub { @x = @_ }, qw(x y));
+        }
+}
+
+done_testing;
diff --git a/t/over.t b/t/over.t
index 4c8f8098..a92d2f77 100644
--- a/t/over.t
+++ b/t/over.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -74,4 +74,28 @@ SKIP: {
                 'WAL journal_mode not clobbered if manually set');
 }
 
+# ext index additions
+$over->eidx_prep;
+{
+        my @arg = qw(1349 2019 adeadba7cafe example.key);
+        ok($over->add_xref3(@arg), 'first add');
+        ok($over->add_xref3(@arg), 'add idempotent');
+        my $xref3 = $over->get_xref3(1349);
+        is_deeply($xref3, [ 'example.key:2019:adeadba7cafe' ], 'xref3 works');
+
+        @arg = qw(1349 2018 deadbeefcafe example.kee);
+        ok($over->add_xref3(@arg), 'add another xref3');
+        $xref3 = $over->get_xref3(1349);
+        is_deeply($xref3, [ 'example.key:2019:adeadba7cafe',
+                        'example.kee:2018:deadbeefcafe' ],
+                        'xref3 works forw two');
+
+        @arg = qw(1349 adeadba7cafe example.key);
+        is($over->remove_xref3(@arg), 1, 'remove first');
+        $xref3 = $over->get_xref3(1349);
+        is_deeply($xref3, [ 'example.kee:2018:deadbeefcafe' ],
+                'confirm removal successful');
+        $over->rollback_lazy;
+}
+
 done_testing();
diff --git a/t/plack.t b/t/plack.t
index 1fedf426..8d8aa100 100644
--- a/t/plack.t
+++ b/t/plack.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -21,8 +21,8 @@ ok(-f $psgi, "psgi example file found");
 my $pfx = 'http://example.com/test';
 ok(run_script(['-init', 'test', $inboxdir, "$pfx/", $addr]),
         'initialized repo');
-PublicInbox::Import::run_die([qw(git config -f), $pi_config,
-        'publicinbox.test.newsgroup', 'inbox.test']);
+xsys_e(qw(git config -f), $pi_config,
+        qw(publicinbox.test.newsgroup inbox.test));
 open my $fh, '>', "$inboxdir/description" or die "open: $!\n";
 print $fh "test for public-inbox\n";
 close $fh or die "close: $!\n";
diff --git a/t/precheck.t b/t/precheck.t
index 11193e38..360dc74f 100644
--- a/t/precheck.t
+++ b/t/precheck.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2014-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2014-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_attach.t b/t/psgi_attach.t
index 14d20adb..65d704bf 100644
--- a/t/psgi_attach.t
+++ b/t/psgi_attach.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_bad_mids.t b/t/psgi_bad_mids.t
index 70393573..f23680f8 100644
--- a/t/psgi_bad_mids.t
+++ b/t/psgi_bad_mids.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_mount.t b/t/psgi_mount.t
index b4de8274..5836e9ce 100644
--- a/t/psgi_mount.t
+++ b/t/psgi_mount.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -17,7 +17,7 @@ use_ok 'PublicInbox::WWW';
 use PublicInbox::Import;
 use PublicInbox::Git;
 use PublicInbox::Config;
-my $config = PublicInbox::Config->new(\<<EOF);
+my $cfg = PublicInbox::Config->new(\<<EOF);
 $cfgpfx.address=$addr
 $cfgpfx.inboxdir=$maindir
 EOF
@@ -39,7 +39,7 @@ EOF
         $im->done;
 }
 
-my $www = PublicInbox::WWW->new($config);
+my $www = PublicInbox::WWW->new($cfg);
 my $app = builder(sub {
         enable('Head');
         mount('/a' => builder(sub { sub { $www->call(@_) } }));
@@ -67,11 +67,9 @@ test_psgi($app, sub {
 
         $res = $cb->(GET('/a/test/blah%40example.com/raw'));
         is($res->code, 200, 'OK with URLMap mount');
-        like($res->content, qr!^List-Archive: <http://[^/]+/a/test/>!m,
-                'List-Archive set in /raw mboxrd');
         like($res->content,
-                qr!^Archived-At: <http://[^/]+/a/test/blah\@example\.com/>!m,
-                'Archived-At set in /raw mboxrd');
+                qr/^Message-Id: <blah\@example\.com>\n/sm,
+                'headers appear in /raw');
 
         # redirects
         $res = $cb->(GET('/a/test/m/blah%40example.com.html'));
@@ -85,7 +83,7 @@ test_psgi($app, sub {
 
 SKIP: {
         require_mods(qw(DBD::SQLite Search::Xapian IO::Uncompress::Gunzip), 3);
-        my $ibx = $config->lookup_name('test');
+        my $ibx = $cfg->lookup_name('test');
         require_ok 'PublicInbox::SearchIdx';
         PublicInbox::SearchIdx->new($ibx, 1)->index_sync;
         test_psgi($app, sub {
@@ -94,12 +92,8 @@ SKIP: {
                 my $gz = $res->content;
                 my $raw;
                 IO::Uncompress::Gunzip::gunzip(\$gz => \$raw);
-                like($raw, qr!^List-Archive: <http://[^/]+/a/test/>!m,
-                        'List-Archive set in /t.mbox.gz mboxrd');
-                like($raw,
-                        qr!^Archived-At:\x20
-                                <http://[^/]+/a/test/blah\@example\.com/>!mx,
-                        'Archived-At set in /t.mbox.gz mboxrd');
+                like($raw, qr!^Message-Id:\x20<blah\@example\.com>\n!sm,
+                        'headers appear in /t.mbox.gz mboxrd');
         });
 }
 
diff --git a/t/psgi_multipart_not.t b/t/psgi_multipart_not.t
index 9b7fb4d0..8edbe088 100644
--- a/t/psgi_multipart_not.t
+++ b/t/psgi_multipart_not.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_scan_all.t b/t/psgi_scan_all.t
index c8cb2409..80b855e1 100644
--- a/t/psgi_scan_all.t
+++ b/t/psgi_scan_all.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_search.t b/t/psgi_search.t
index c1677eb3..8ba431bc 100644
--- a/t/psgi_search.t
+++ b/t/psgi_search.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -67,11 +67,11 @@ $im->done;
 PublicInbox::SearchIdx->new($ibx, 1)->index_sync;
 
 my $cfgpfx = "publicinbox.test";
-my $config = PublicInbox::Config->new(\<<EOF);
+my $cfg = PublicInbox::Config->new(\<<EOF);
 $cfgpfx.address=git\@vger.kernel.org
 $cfgpfx.inboxdir=$tmpdir
 EOF
-my $www = PublicInbox::WWW->new($config);
+my $www = PublicInbox::WWW->new($cfg);
 test_psgi(sub { $www->call(@_) }, sub {
         my ($cb) = @_;
         my $res;
@@ -144,7 +144,7 @@ test_psgi(sub { $www->call(@_) }, sub {
                 $xdb->set_metadata('has_threadid', '0');
                 $sidx->idx_release;
         }
-        $config->each_inbox(sub { delete $_[0]->{search} });
+        $cfg->each_inbox(sub { delete $_[0]->{search} });
         $res = $cb->(GET('/test/?q=s:test'));
         is($res->code, 200, 'successful search w/o has_threadid');
         unlike($html, qr/download mbox\.gz: .*?"full threads"/s,
diff --git a/t/psgi_text.t b/t/psgi_text.t
index 9867feaa..e4613945 100644
--- a/t/psgi_text.t
+++ b/t/psgi_text.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/psgi_v2.t b/t/psgi_v2.t
index c13f5e71..7ab60adc 100644
--- a/t/psgi_v2.t
+++ b/t/psgi_v2.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -87,12 +87,11 @@ like($$msg, qr/\AFrom oldbug/s,
         '"From_" line stored to test old bug workaround');
 
 my $cfgpfx = "publicinbox.v2test";
-my $cfg = <<EOF;
+my $cfg = PublicInbox::Config->new(\<<EOF);
 $cfgpfx.address=$ibx->{-primary_address}
 $cfgpfx.inboxdir=$inboxdir
 EOF
-my $config = PublicInbox::Config->new(\$cfg);
-my $www = PublicInbox::WWW->new($config);
+my $www = PublicInbox::WWW->new($cfg);
 my ($res, $raw, @from_);
 my $client0 = sub {
         my ($cb) = @_;
@@ -154,7 +153,7 @@ my $client1 = sub {
         like($raw, qr/^hello ghosts$/m, 'got third message');
         @from_ = ($raw =~ m/^From /mg);
         is(scalar(@from_), 3, 'three From_ lines');
-        $config->each_inbox(sub { $_[0]->search->reopen });
+        $cfg->each_inbox(sub { $_[0]->search->reopen });
 
         SKIP: {
                 eval { require IO::Uncompress::Gunzip };
@@ -244,7 +243,7 @@ $run_httpd->($client1, 38);
         $im->done;
         my @h = $mime->header('Message-ID');
         is_deeply($exp, \@h, 'reused existing Message-ID');
-        $config->each_inbox(sub { $_[0]->search->reopen });
+        $cfg->each_inbox(sub { $_[0]->search->reopen });
 }
 
 my $client2 = sub {
@@ -283,7 +282,7 @@ $run_httpd->($client2, 8);
                 ok($im->add($mime), "added attachment $body");
         }
         $im->done;
-        $config->each_inbox(sub { $_[0]->search->reopen });
+        $cfg->each_inbox(sub { $_[0]->search->reopen });
 }
 
 my $client3 = sub {
diff --git a/t/purge.t b/t/purge.t
index 2ca9edca..f4281c13 100644
--- a/t/purge.t
+++ b/t/purge.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/qspawn.t b/t/qspawn.t
index e37a05fd..4b9dc8a5 100644
--- a/t/qspawn.t
+++ b/t/qspawn.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/replace.t b/t/replace.t
index fd8ce2c6..51bdb964 100644
--- a/t/replace.t
+++ b/t/replace.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -186,8 +186,7 @@ test_replace(2, 'basic', $opt = { %$opt, post => \&pad_msgs });
 test_replace(2, 'basic', $opt = { %$opt, rotate_bytes => 1 });
 
 SKIP: {
-        require PublicInbox::Search;
-        PublicInbox::Search::load_xapian() or skip 'Search::Xapian missing', 8;
+        require_mods(qw(Search::Xapian), 8);
         for my $l (qw(medium)) {
                 test_replace(2, $l, {});
                 $opt = { pre => \&pad_msgs };
diff --git a/t/reply.t b/t/reply.t
index 53162df5..0b8e1f38 100644
--- a/t/reply.t
+++ b/t/reply.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/run.perl b/t/run.perl
index 1c7bcfc3..b7cb988b 100755
--- a/t/run.perl
+++ b/t/run.perl
@@ -1,5 +1,5 @@
 #!/usr/bin/perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Parallel test runner which preloads code and reuses worker processes
@@ -71,7 +71,8 @@ sub test_status () {
                 my $skip = '';
                 if (open my $fh, '<', $log) {
                         my @not_ok = grep(!/^(?:ok |[ \t]*#)/ms, <$fh>);
-                        pop @not_ok if $not_ok[-1] =~ /^[0-9]+\.\.[0-9]+$/;
+                        my $last = $not_ok[-1] // '';
+                        pop @not_ok if $last =~ /^[0-9]+\.\.[0-9]+$/;
                         my $pfx = "# $log: ";
                         print $OLDERR map { $pfx.$_ } @not_ok;
                         seek($fh, 0, SEEK_SET) or die "seek: $!";
diff --git a/t/search-thr-index.t b/t/search-thr-index.t
index bd663519..fc1b666a 100644
--- a/t/search-thr-index.t
+++ b/t/search-thr-index.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2017-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2017-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/search.t b/t/search.t
index 8df8a202..b2958c00 100644
--- a/t/search.t
+++ b/t/search.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -60,7 +60,7 @@ sub oct_is ($$$) {
 }
 
 {
-        my $crlf_adjust = \&PublicInbox::SearchIdx::crlf_adjust;
+        my $crlf_adjust = \&PublicInbox::Smsg::crlf_adjust;
         is($crlf_adjust->("hi\r\nworld\r\n"), 0, 'no adjustment needed');
         is($crlf_adjust->("hi\nworld\n"), 2, 'LF-only counts two CR');
         is($crlf_adjust->("hi\r\nworld\n"), 1, 'CRLF/LF-mix 1 counts 1 CR');
@@ -332,13 +332,13 @@ $ibx->with_umask(sub {
                 like($smsg->{to}, qr/\blist\@example\.com\b/, 'to appears');
                 my $doc = $m->get_document;
                 my $col = PublicInbox::Search::BYTES();
-                my $bytes = PublicInbox::Smsg::get_val($doc, $col);
+                my $bytes = PublicInbox::Search::int_val($doc, $col);
                 like($bytes, qr/\A[0-9]+\z/, '$bytes stored as digit');
                 ok($bytes > 0, '$bytes is > 0');
                 is($bytes, $smsg->{bytes}, 'bytes Xapian value matches Over');
 
                 $col = PublicInbox::Search::UID();
-                my $uid = PublicInbox::Smsg::get_val($doc, $col);
+                my $uid = PublicInbox::Search::int_val($doc, $col);
                 is($uid, $smsg->{num}, 'UID column matches {num}');
                 is($uid, $m->get_docid, 'UID column matches docid');
         }
@@ -535,5 +535,3 @@ $ibx->with_umask(sub {
 });
 
 done_testing();
-
-1;
diff --git a/t/shared_kv.t b/t/shared_kv.t
new file mode 100644
index 00000000..6f6374f2
--- /dev/null
+++ b/t/shared_kv.t
@@ -0,0 +1,54 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use_ok 'PublicInbox::SharedKV';
+my ($tmpdir, $for_destroy) = tmpdir();
+local $ENV{TMPDIR} = $tmpdir;
+my $skv = PublicInbox::SharedKV->new;
+my $skv_tmpdir = $skv->{tmpdir};
+ok(-d $skv_tmpdir, 'created a temporary dir');
+$skv->dbh;
+my $dead = "\xde\xad";
+my $beef = "\xbe\xef";
+my $cafe = "\xca\xfe";
+ok($skv->set($dead, $beef), 'set');
+is($skv->get($dead), $beef, 'get');
+ok($skv->set($dead, $beef), 'set idempotent');
+ok(!$skv->set_maybe($dead, $cafe), 'set_maybe ignores');
+ok($skv->set_maybe($cafe, $dead), 'set_maybe sets');
+is($skv->xchg($dead, $cafe), $beef, 'xchg');
+is($skv->get($dead), $cafe, 'get after xchg');
+is($skv->xchg($dead, undef), $cafe, 'xchg to undef');
+is($skv->get($dead), undef, 'get after xchg to undef');
+is($skv->get($cafe), $dead, 'get after set_maybe');
+ok($skv->index_values, 'index_values works');
+is($skv->replace_values($dead, $cafe), 1, 'replaced one by value');
+is($skv->get($cafe), $cafe, 'value updated');
+is($skv->replace_values($dead, $cafe), 0, 'replaced none by value');
+is($skv->xchg($dead, $cafe), undef, 'xchg from undef');
+is($skv->count, 2, 'count works');
+
+my %seen;
+my $sth = $skv->each_kv_iter;
+while (my ($k, $v) = $sth->fetchrow_array) {
+        $seen{$k} = $v;
+}
+is($seen{$dead}, $cafe, '$dead has expected value');
+is($seen{$cafe}, $cafe, '$cafe has expected value');
+is(scalar keys %seen, 2, 'iterated through all');
+
+is($skv->replace_values($cafe, $dead), 2, 'replaced 2 by value');
+is($skv->delete_by_val('bogus'), 0, 'delete_by_val misses');
+is($skv->delete_by_val($dead), 2, 'delete_by_val hits');
+is($skv->delete_by_val($dead), 0, 'delete_by_val misses again');
+
+undef $skv;
+ok(!-d $skv_tmpdir, 'temporary dir gone');
+$skv = PublicInbox::SharedKV->new("$tmpdir/dir", 'base');
+ok(-e "$tmpdir/dir/base.sqlite3", 'file created');
+
+done_testing;
diff --git a/t/sigfd.t b/t/sigfd.t
index 8daf3137..3a383d79 100644
--- a/t/sigfd.t
+++ b/t/sigfd.t
@@ -1,10 +1,10 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 use strict;
 use Test::More;
 use IO::Handle;
 use POSIX qw(:signal_h);
 use Errno qw(ENOSYS);
-use PublicInbox::Syscall qw($SFD_NONBLOCK);
+use PublicInbox::Syscall qw(SFD_NONBLOCK);
 require_ok 'PublicInbox::Sigfd';
 
 SKIP: {
@@ -42,8 +42,8 @@ SKIP: {
                 }
                 $sigfd = undef;
 
-                my $nbsig = PublicInbox::Sigfd->new($sig, $SFD_NONBLOCK);
-                ok($nbsig, 'Sigfd->new $SFD_NONBLOCK works');
+                my $nbsig = PublicInbox::Sigfd->new($sig, SFD_NONBLOCK);
+                ok($nbsig, 'Sigfd->new SFD_NONBLOCK works');
                 is($nbsig->wait_once, undef, 'nonblocking ->wait_once');
                 ok($! == Errno::EAGAIN, 'got EAGAIN');
                 kill('HUP', $$) or die "kill $!";
diff --git a/t/solver_git.t b/t/solver_git.t
index 6b0ed8d2..d03a6f38 100644
--- a/t/solver_git.t
+++ b/t/solver_git.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/spamcheck_spamc.t b/t/spamcheck_spamc.t
index 2d9da631..ab46d62b 100644
--- a/t/spamcheck_spamc.t
+++ b/t/spamcheck_spamc.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/spawn.t b/t/spawn.t
index a0019202..0eed79bb 100644
--- a/t/spawn.t
+++ b/t/spawn.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2015-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2015-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -32,7 +32,7 @@ elsif ($pid > 0) {
         select(undef, undef, undef, 0.01) while 1;
 }
 EOF
-        my $oldset = PublicInbox::Sigfd::block_signals();
+        my $oldset = PublicInbox::DS::block_signals();
         my $rd = popen_rd([$^X, '-e', $script]);
         diag 'waiting for child to reap grandchild...';
         chomp(my $line = readline($rd));
@@ -41,7 +41,7 @@ EOF
         ok(kill('CHLD', $pid), 'sent SIGCHLD to child');
         is(readline($rd), "HI\n", '$SIG{CHLD} works in child');
         ok(close $rd, 'popen_rd close works');
-        PublicInbox::Sigfd::sig_setmask($oldset);
+        PublicInbox::DS::sig_setmask($oldset);
 }
 
 {
@@ -98,6 +98,44 @@ EOF
         isnt($?, 0, '$? set properly: '.$?);
 }
 
+{ # ->CLOSE vs ->DESTROY waitpid caller distinction
+        my @c;
+        my $fh = popen_rd(['true'], undef, { cb => sub { @c = caller } });
+        ok(close($fh), '->CLOSE fired and successful');
+        ok(scalar(@c), 'callback fired by ->CLOSE');
+        ok(grep(!m[/PublicInbox/DS\.pm\z], @c), 'callback not invoked by DS');
+
+        @c = ();
+        $fh = popen_rd(['true'], undef, { cb => sub { @c = caller } });
+        undef $fh; # ->DESTROY
+        ok(scalar(@c), 'callback fired by ->DESTROY');
+        ok(grep(!m[/PublicInbox/ProcessPipe\.pm\z], @c),
+                'callback not invoked by ProcessPipe');
+}
+
+{ # children don't wait on siblings
+        use POSIX qw(_exit);
+        pipe(my ($r, $w)) or BAIL_OUT $!;
+        my $cb = sub { warn "x=$$\n" };
+        my $fh = popen_rd(['cat'], undef, { 0 => $r, cb => $cb });
+        my $pp = tied *$fh;
+        my $pid = fork // BAIL_OUT $!;
+        local $SIG{__WARN__} = sub { _exit(1) };
+        if ($pid == 0) {
+                local $SIG{__DIE__} = sub { _exit(2) };
+                undef $fh;
+                _exit(0);
+        }
+        waitpid($pid, 0);
+        is($?, 0, 'forked process exited');
+        my @w;
+        local $SIG{__WARN__} = sub { push @w, @_ };
+        close $w;
+        close $fh;
+        is($?, 0, 'cat exited');
+        is_deeply(\@w, [ "x=$$\n" ], 'callback fired from owner');
+}
+
 SKIP: {
         eval {
                 require BSD::Resource;
diff --git a/t/thread-cycle.t b/t/thread-cycle.t
index 484ea443..613c142e 100644
--- a/t/thread-cycle.t
+++ b/t/thread-cycle.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/thread-index-gap.t b/t/thread-index-gap.t
index 49f254e9..83c3707d 100644
--- a/t/thread-index-gap.t
+++ b/t/thread-index-gap.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
@@ -45,12 +45,15 @@ for my $msgs (['orig', reverse @msgs], ['shuffle', shuffle(@msgs)]) {
         }
         $im->done;
         my $over = $ibx->over;
-        my @tid = $over->dbh->selectall_array('SELECT DISTINCT(tid) FROM over');
+        my $dbh = $over->dbh;
+        my $tid = $dbh->selectall_arrayref('SELECT DISTINCT(tid) FROM over');
+        my @tid = map { $_->[0] } @$tid;
         is(scalar(@tid), 1, "only one thread initially ($desc)");
         $over->dbh_close;
         run_script([qw(-index --reindex --rethread), $ibx->{inboxdir}]) or
                 BAIL_OUT 'rethread';
-        @tid = $over->dbh->selectall_array('SELECT DISTINCT(tid) FROM over');
+        $tid = $dbh->selectall_arrayref('SELECT DISTINCT(tid) FROM over');
+        @tid = map { $_->[0] } @$tid;
         is(scalar(@tid), 1, "only one thread after rethread ($desc)");
 }
 
diff --git a/t/time.t b/t/time.t
index b491711d..fae20897 100644
--- a/t/time.t
+++ b/t/time.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/uri_imap.t b/t/uri_imap.t
index a2e86a7e..6c4207c3 100644
--- a/t/uri_imap.t
+++ b/t/uri_imap.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/v1-add-remove-add.t b/t/v1-add-remove-add.t
index 2cd45f60..a94bf7fd 100644
--- a/t/v1-add-remove-add.t
+++ b/t/v1-add-remove-add.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v1reindex.t b/t/v1reindex.t
index e66d89e5..36cefda5 100644
--- a/t/v1reindex.t
+++ b/t/v1reindex.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v2-add-remove-add.t b/t/v2-add-remove-add.t
index cfdc8cf1..b325e521 100644
--- a/t/v2-add-remove-add.t
+++ b/t/v2-add-remove-add.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v2dupindex.t b/t/v2dupindex.t
index b1abccd9..4b20c8e0 100644
--- a/t/v2dupindex.t
+++ b/t/v2dupindex.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # we can index a message from a mirror which bypasses dedupe.
diff --git a/t/v2mda.t b/t/v2mda.t
index abbdc8e4..38aea0c1 100644
--- a/t/v2mda.t
+++ b/t/v2mda.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v2mirror.t b/t/v2mirror.t
index 81b9544d..ebad2566 100644
--- a/t/v2mirror.t
+++ b/t/v2mirror.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v2reindex.t b/t/v2reindex.t
index ae1570ed..05ea952f 100644
--- a/t/v2reindex.t
+++ b/t/v2reindex.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/v2writable.t b/t/v2writable.t
index 2f71fafa..f5c8313a 100644
--- a/t/v2writable.t
+++ b/t/v2writable.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -274,14 +274,13 @@ EOF
         $mime->header_set('Message-ID', "<$y>");
         $mime->header_set('References', "<$x>");
         ok($im->add($mime), 'add excessively long References');
-        $im->barrier;
+        $im->done;
 
         my $msgs = $ibx->over->get_thread('x'x244);
         is(2, scalar(@$msgs), 'got both messages');
         is($msgs->[0]->{mid}, 'x'x244, 'stored truncated mid');
         is($msgs->[1]->{references}, '<'.('x'x244).'>', 'stored truncated ref');
         is($msgs->[1]->{mid}, 'y'x244, 'stored truncated mid(2)');
-        $im->done;
 }
 
 my $tmp = {
diff --git a/t/view.t b/t/view.t
index 462667f1..114c3304 100644
--- a/t/view.t
+++ b/t/view.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2013-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2013-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/watch_filter_rubylang.t b/t/watch_filter_rubylang.t
index 6513f30b..29a9f793 100644
--- a/t/watch_filter_rubylang.t
+++ b/t/watch_filter_rubylang.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -72,11 +72,11 @@ $cfgpfx.filter=PublicInbox::Filter::RubyLang
 $cfgpfx.altid=serial:alerts:file=msgmap.sqlite3
 publicinboxwatch.watchspam=maildir:$spamdir
 EOF
-        my $config = PublicInbox::Config->new(\$orig);
-        my $ibx = $config->lookup_name($v);
+        my $cfg = PublicInbox::Config->new(\$orig);
+        my $ibx = $cfg->lookup_name($v);
         ok($ibx, 'found inbox by name');
 
-        my $w = PublicInbox::Watch->new($config);
+        my $w = PublicInbox::Watch->new($cfg);
         for my $i (1..2) {
                 $w->scan('full');
         }
@@ -101,8 +101,8 @@ EOF
         }
         $w->scan('full');
 
-        $config = PublicInbox::Config->new(\$orig);
-        $ibx = $config->lookup_name($v);
+        $cfg = PublicInbox::Config->new(\$orig);
+        $ibx = $cfg->lookup_name($v);
         is($ibx->search->reopen->mset('b:spam')->size, 0, 'spam removed');
 
         is_deeply([], \@warn, 'no warnings');
diff --git a/t/watch_imap.t b/t/watch_imap.t
index fb71d3df..eeda29eb 100644
--- a/t/watch_imap.t
+++ b/t/watch_imap.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/watch_maildir.t b/t/watch_maildir.t
index ae53caf9..e74b512f 100644
--- a/t/watch_maildir.t
+++ b/t/watch_maildir.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
@@ -34,13 +34,13 @@ my $sem = PublicInbox::Emergency->new($spamdir); # create dirs
 {
         my @w;
         local $SIG{__WARN__} = sub { push @w, @_ };
-        my $config = PublicInbox::Config->new(\<<EOF);
+        my $cfg = PublicInbox::Config->new(\<<EOF);
 $cfgpfx.address=$addr
 $cfgpfx.inboxdir=$git_dir
 $cfgpfx.watch=maildir:$spamdir
 publicinboxlearn.watchspam=maildir:$spamdir
 EOF
-        my $wm = PublicInbox::Watch->new($config);
+        my $wm = PublicInbox::Watch->new($cfg);
         is(scalar grep(/is a spam folder/, @w), 1, 'got warning about spam');
         is_deeply($wm->{mdmap}, { "$spamdir/cur" => 'watchspam' },
                 'only got the spam folder to watch');
@@ -61,8 +61,8 @@ EOF
         close $fh or BAIL_OUT $!;
 }
 
-my $config = PublicInbox::Config->new($cfg_path);
-PublicInbox::Watch->new($config)->scan('full');
+my $cfg = PublicInbox::Config->new($cfg_path);
+PublicInbox::Watch->new($cfg)->scan('full');
 my $git = PublicInbox::Git->new($git_dir);
 my @list = $git->qx(qw(rev-list refs/heads/master));
 is(scalar @list, 1, 'one revision in rev-list');
@@ -79,7 +79,7 @@ my $write_spam = sub {
 };
 $write_spam->();
 is(unlink(glob("$maildir/new/*")), 1, 'unlinked old spam');
-PublicInbox::Watch->new($config)->scan('full');
+PublicInbox::Watch->new($cfg)->scan('full');
 @list = $git->qx(qw(rev-list refs/heads/master));
 is(scalar @list, 2, 'two revisions in rev-list');
 @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
@@ -93,7 +93,7 @@ To unsubscribe from this list: send the line "unsubscribe git" in
 the body of a message to majordomo\@vger.kernel.org
 More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
         is(scalar @list, 1, 'tree has one file');
         my $mref = $git->cat_file('HEAD:'.$list[0]);
@@ -101,7 +101,7 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
 
         is(unlink(glob("$maildir/new/*")), 1, 'unlinked spam');
         $write_spam->();
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
         is(scalar @list, 0, 'tree is empty');
         @list = $git->qx(qw(rev-list refs/heads/master));
@@ -115,10 +115,10 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         my $fail_path = "$fail_bin:$ENV{PATH}"; # for spamc ham mock
         local $ENV{PATH} = $fail_path;
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        $config->{'publicinboxwatch.spamcheck'} = 'spamc';
+        $cfg->{'publicinboxwatch.spamcheck'} = 'spamc';
         {
                 local $SIG{__WARN__} = sub {}; # quiet spam check warning
-                PublicInbox::Watch->new($config)->scan('full');
+                PublicInbox::Watch->new($cfg)->scan('full');
         }
         @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
         is(scalar @list, 0, 'tree has no files spamc checked');
@@ -131,9 +131,9 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         my $main_path = "$main_bin:$ENV{PATH}"; # for spamc ham mock
         local $ENV{PATH} = $main_path;
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        $config->{'publicinboxwatch.spamcheck'} = 'spamc';
+        $cfg->{'publicinboxwatch.spamcheck'} = 'spamc';
         @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         @list = $git->qx(qw(ls-tree -r --name-only refs/heads/master));
         is(scalar @list, 1, 'tree has one file after spamc checked');
 
@@ -166,9 +166,9 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
                 $delivered++;
         };
         PublicInbox::DS->Reset;
-        my $ii = PublicInbox::InboxIdle->new($config);
+        my $ii = PublicInbox::InboxIdle->new($cfg);
         my $obj = bless \$cb, 'PublicInbox::TestCommon::InboxWakeup';
-        $config->each_inbox(sub { $_[0]->subscribe_unlock('ident', $obj) });
+        $cfg->each_inbox(sub { $_[0]->subscribe_unlock('ident', $obj) });
         PublicInbox::DS->SetPostLoopCallback(sub { $delivered == 0 });
 
         # wait for -watch to setup inotify watches
diff --git a/t/watch_maildir_v2.t b/t/watch_maildir_v2.t
index 12546418..195e238b 100644
--- a/t/watch_maildir_v2.t
+++ b/t/watch_maildir_v2.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
@@ -44,11 +44,11 @@ $cfgpfx.watch=maildir:$maildir
 $cfgpfx.filter=PublicInbox::Filter::Vger
 publicinboxlearn.watchspam=maildir:$spamdir
 EOF
-my $config = PublicInbox::Config->new(\$orig);
-my $ibx = $config->lookup_name('test');
+my $cfg = PublicInbox::Config->new(\$orig);
+my $ibx = $cfg->lookup_name('test');
 ok($ibx, 'found inbox by name');
 
-PublicInbox::Watch->new($config)->scan('full');
+PublicInbox::Watch->new($cfg)->scan('full');
 my $total = scalar @{$ibx->over->recent};
 is($total, 1, 'got one revision');
 
@@ -68,7 +68,7 @@ my $write_spam = sub {
 };
 $write_spam->();
 is(unlink(glob("$maildir/new/*")), 1, 'unlinked old spam');
-PublicInbox::Watch->new($config)->scan('full');
+PublicInbox::Watch->new($cfg)->scan('full');
 is_deeply($ibx->over->recent, [], 'deleted file');
 is(unlink(glob("$spamdir/cur/*")), 1, 'unlinked trained spam');
 
@@ -79,7 +79,7 @@ To unsubscribe from this list: send the line "unsubscribe git" in
 the body of a message to majordomo\@vger.kernel.org
 More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         my $msgs = $ibx->over->recent;
         is(scalar(@$msgs), 1, 'got one file back');
         my $mref = $ibx->msg_by_smsg($msgs->[0]);
@@ -87,7 +87,7 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
 
         is(unlink(glob("$maildir/new/*")), 1, 'unlinked spam');
         $write_spam->();
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         $msgs = $ibx->over->recent;
         is(scalar(@$msgs), 0, 'inbox is empty again');
         is(unlink(glob("$spamdir/cur/*")), 1, 'unlinked trained spam');
@@ -99,10 +99,10 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         my $fail_path = "$fail_bin:$ENV{PATH}"; # for spamc ham mock
         local $ENV{PATH} = $fail_path;
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        $config->{'publicinboxwatch.spamcheck'} = 'spamc';
+        $cfg->{'publicinboxwatch.spamcheck'} = 'spamc';
         {
                 local $SIG{__WARN__} = sub {}; # quiet spam check warning
-                PublicInbox::Watch->new($config)->scan('full');
+                PublicInbox::Watch->new($cfg)->scan('full');
         }
         my $msgs = $ibx->over->recent;
         is(scalar(@$msgs), 0, 'inbox is still empty');
@@ -115,13 +115,13 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         my $main_path = "$main_bin:$ENV{PATH}"; # for spamc ham mock
         local $ENV{PATH} = $main_path;
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        $config->{'publicinboxwatch.spamcheck'} = 'spamc';
-        PublicInbox::Watch->new($config)->scan('full');
+        $cfg->{'publicinboxwatch.spamcheck'} = 'spamc';
+        PublicInbox::Watch->new($cfg)->scan('full');
         my $msgs = $ibx->over->recent;
         is(scalar(@$msgs), 1, 'inbox has one mail after spamc OK-ed a message');
         my $mref = $ibx->msg_by_smsg($msgs->[0]);
         like($$mref, qr/something\n\z/s, 'message scrubbed on import');
-        delete $config->{'publicinboxwatch.spamcheck'};
+        delete $cfg->{'publicinboxwatch.spamcheck'};
 }
 
 {
@@ -129,7 +129,7 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         open my $fh, '<', $patch or die "failed to open $patch: $!\n";
         $msg = do { local $/; <$fh> };
         PublicInbox::Emergency->new($maildir)->prepare(\$msg);
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         my $post = $ibx->search->reopen->mset('dfpost:6e006fd7');
         is($post->size, 1, 'diff postimage found');
         my $pre = $ibx->search->mset('dfpre:090d998b6c2c');
@@ -146,12 +146,12 @@ More majordomo info at  http://vger.kernel.org/majordomo-info.html\n);
         my $v1pfx = "publicinbox.v1";
         my $v1addr = 'v1-public@example.com';
         PublicInbox::Import::init_bare($v1repo);
-        my $cfg2 = <<EOF;
+        my $raw = <<EOF;
 $orig$v1pfx.address=$v1addr
 $v1pfx.inboxdir=$v1repo
 $v1pfx.watch=maildir:$maildir
 EOF
-        my $config = PublicInbox::Config->new(\$cfg2);
+        my $cfg = PublicInbox::Config->new(\$raw);
         my $both = <<EOF;
 From: user\@example.com
 To: $addr, $v1addr
@@ -162,10 +162,10 @@ Date: Sat, 18 Jun 2016 00:00:00 +0000
 both
 EOF
         PublicInbox::Emergency->new($maildir)->prepare(\$both);
-        PublicInbox::Watch->new($config)->scan('full');
+        PublicInbox::Watch->new($cfg)->scan('full');
         my $mset = $ibx->search->reopen->mset('m:both@b.com');
         my $msgs = $ibx->search->mset_to_smsg($ibx, $mset);
-        my $v1 = $config->lookup_name('v1');
+        my $v1 = $cfg->lookup_name('v1');
         my $msg = $v1->git->cat_file($msgs->[0]->{blob});
         is($both, $$msg, 'got original message back from v1');
         $msg = $ibx->git->cat_file($msgs->[0]->{blob});
@@ -184,21 +184,21 @@ List-Id: <do.not.want>
 X-Mailing-List: no@example.com
 Message-ID: <do.not.want@example.com>
 EOF
-        my $cfg = $orig."$cfgpfx.listid=i.want.you.to.want.me\n";
+        my $raw = $orig."$cfgpfx.listid=i.want.you.to.want.me\n";
         PublicInbox::Emergency->new($maildir)->prepare(\$want);
         PublicInbox::Emergency->new($maildir)->prepare(\$do_not_want);
-        my $config = PublicInbox::Config->new(\$cfg);
-        PublicInbox::Watch->new($config)->scan('full');
-        $ibx = $config->lookup_name('test');
+        my $cfg = PublicInbox::Config->new(\$raw);
+        PublicInbox::Watch->new($cfg)->scan('full');
+        $ibx = $cfg->lookup_name('test');
         my $num = $ibx->mm->num_for('do.want@example.com');
         ok(defined $num, 'List-ID matched for watch');
         $num = $ibx->mm->num_for('do.not.want@example.com');
         is($num, undef, 'unaccepted List-ID matched for watch');
 
-        $cfg = $orig."$cfgpfx.watchheader=X-Mailing-List:no\@example.com\n";
-        $config = PublicInbox::Config->new(\$cfg);
-        PublicInbox::Watch->new($config)->scan('full');
-        $ibx = $config->lookup_name('test');
+        $raw = $orig."$cfgpfx.watchheader=X-Mailing-List:no\@example.com\n";
+        $cfg = PublicInbox::Config->new(\$raw);
+        PublicInbox::Watch->new($cfg)->scan('full');
+        $ibx = $cfg->lookup_name('test');
         $num = $ibx->mm->num_for('do.not.want@example.com');
         ok(defined $num, 'X-Mailing-List matched');
 }
diff --git a/t/watch_multiple_headers.t b/t/watch_multiple_headers.t
index a0813532..33ed0770 100644
--- a/t/watch_multiple_headers.t
+++ b/t/watch_multiple_headers.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
@@ -54,16 +54,16 @@ PublicInbox::Emergency->new($maildir)->prepare(\$msg_to);
 PublicInbox::Emergency->new($maildir)->prepare(\$msg_cc);
 PublicInbox::Emergency->new($maildir)->prepare(\$msg_none);
 
-my $cfg = <<EOF;
+my $raw = <<EOF;
 $cfgpfx.address=$addr
 $cfgpfx.inboxdir=$inboxdir
 $cfgpfx.watch=maildir:$maildir
 $cfgpfx.watchheader=To:$addr
 $cfgpfx.watchheader=Cc:$addr
 EOF
-my $config = PublicInbox::Config->new(\$cfg);
-PublicInbox::Watch->new($config)->scan('full');
-my $ibx = $config->lookup_name('test');
+my $cfg = PublicInbox::Config->new(\$raw);
+PublicInbox::Watch->new($cfg)->scan('full');
+my $ibx = $cfg->lookup_name('test');
 ok($ibx, 'found inbox by name');
 
 my $num = $ibx->mm->num_for('to@a.com');
diff --git a/t/watch_nntp.t b/t/watch_nntp.t
index ce1a3153..c0ad3098 100644
--- a/t/watch_nntp.t
+++ b/t/watch_nntp.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/www_altid.t b/t/www_altid.t
index 337303d9..14eda030 100644
--- a/t/www_altid.t
+++ b/t/www_altid.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/t/www_listing.t b/t/www_listing.t
index 4309a5e1..1bcbaefb 100644
--- a/t/www_listing.t
+++ b/t/www_listing.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # manifest.js.gz generation and grok-pull integration test
 use strict;
@@ -7,22 +7,19 @@ use Test::More;
 use PublicInbox::Spawn qw(which);
 use PublicInbox::TestCommon;
 use PublicInbox::Import;
-require_mods(qw(URI::Escape Plack::Builder Digest::SHA
+require_mods(qw(json URI::Escape Plack::Builder Digest::SHA
                 IO::Compress::Gzip IO::Uncompress::Gunzip HTTP::Tiny));
 require PublicInbox::WwwListing;
 require PublicInbox::ManifestJsGz;
-my $json = do {
-        no warnings 'once';
-        $PublicInbox::ManifestJsGz::json;
-} or plan skip_all => "JSON module missing";
+use PublicInbox::Config;
+my $json = PublicInbox::Config::json();
 
 use_ok 'PublicInbox::Git';
 
 my ($tmpdir, $for_destroy) = tmpdir();
 my $bare = PublicInbox::Git->new("$tmpdir/bare.git");
 PublicInbox::Import::init_bare($bare->{git_dir});
-is(PublicInbox::ManifestJsGz::fingerprint($bare), undef,
-        'empty repo has no fingerprint');
+is($bare->manifest_entry, undef, 'empty repo has no manifest entry');
 {
         my $fi_data = './t/git.fast-import-data';
         open my $fh, '<', $fi_data or die "open $fi_data: $!";
@@ -31,7 +28,7 @@ is(PublicInbox::ManifestJsGz::fingerprint($bare), undef,
                 'fast-import');
 }
 
-like(PublicInbox::ManifestJsGz::fingerprint($bare), qr/\A[a-f0-9]{40}\z/,
+like($bare->manifest_entry->{fingerprint}, qr/\A[a-f0-9]{40}\z/,
         'got fingerprint with non-empty repo');
 
 sub tiny_test {
diff --git a/t/www_static.t b/t/www_static.t
index 364b9447..3281751c 100644
--- a/t/www_static.t
+++ b/t/www_static.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/t/xcpdb-reshard.t b/t/xcpdb-reshard.t
index ede736c1..1b726f1a 100644
--- a/t/xcpdb-reshard.t
+++ b/t/xcpdb-reshard.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/xt/cmp-msgstr.t b/xt/cmp-msgstr.t
index 0276f845..e0e8ed5a 100644
--- a/xt/cmp-msgstr.t
+++ b/xt/cmp-msgstr.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/xt/cmp-msgview.t b/xt/cmp-msgview.t
index 5bd7aa17..49dcbc9e 100644
--- a/xt/cmp-msgview.t
+++ b/xt/cmp-msgview.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
@@ -24,7 +24,7 @@ vec(my $vec = '', fileno($fh), 1) = 1;
 select($vec, undef, undef, 60) or die "timed out waiting for --batch-check";
 my $mime_ctx = {
         env => { HTTP_HOST => 'example.com', 'psgi.url_scheme' => 'https' },
-        -inbox => $ibx,
+        ibx => $ibx,
         www => Plack::Util::inline_object(style => sub {''}),
         obuf => \(my $mime_buf = ''),
         mhref => '../',
diff --git a/xt/create-many-inboxes.t b/xt/create-many-inboxes.t
new file mode 100644
index 00000000..0c2de40d
--- /dev/null
+++ b/xt/create-many-inboxes.t
@@ -0,0 +1,99 @@
+#!perl -w
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use Test::More;
+use PublicInbox::TestCommon;
+use PublicInbox::Eml;
+use File::Path qw(mkpath);
+use IO::Handle (); # autoflush
+use POSIX qw(_exit);
+use Cwd qw(getcwd abs_path);
+use File::Spec;
+my $many_root = $ENV{TEST_MANY_ROOT} or
+        plan skip_all => 'TEST_MANY_ROOT not defined';
+my $cwd = getcwd();
+mkpath($many_root);
+-d $many_root or BAIL_OUT "$many_root: $!";
+$many_root = abs_path($many_root);
+$many_root =~ m!\A\Q$cwd\E/! and BAIL_OUT "$many_root must not be in $cwd";
+require_git 2.6;
+require_mods(qw(DBD::SQLite Search::Xapian));
+use_ok 'PublicInbox::V2Writable';
+my $nr_inbox = $ENV{NR_INBOX} // 10;
+my $nproc = $ENV{NPROC} || PublicInbox::V2Writable::detect_nproc() || 2;
+my $indexlevel = $ENV{TEST_INDEXLEVEL} // 'basic';
+diag "NR_INBOX=$nr_inbox NPROC=$nproc TEST_INDEXLEVEL=$indexlevel";
+diag "TEST_MANY_ROOT=$many_root";
+my $level_cfg = $indexlevel eq 'full' ? '' : "\tindexlevel = $indexlevel\n";
+my $pfx = "$many_root/$nr_inbox-$indexlevel";
+mkpath($pfx);
+open my $cfg_fh, '>>', "$pfx/config" or BAIL_OUT $!;
+$cfg_fh->autoflush(1);
+my $v2_init_add = sub {
+        my ($i) = @_;
+        my $ibx = PublicInbox::Inbox->new({
+                inboxdir => "$pfx/test-$i",
+                name => "test-$i",
+                newsgroup => "inbox.comp.test.foo.test-$i",
+                address => [ "test-$i\@example.com" ],
+                url => [ "//example.com/test-$i" ],
+                version => 2,
+        });
+        $ibx->{indexlevel} = $indexlevel if $level_cfg ne '';
+        my $entry = <<EOF;
+[publicinbox "$ibx->{name}"]
+        address = $ibx->{-primary_address}
+        url = $ibx->{url}->[0]
+        newsgroup = $ibx->{newsgroup}
+        inboxdir = $ibx->{inboxdir}
+EOF
+        $entry .= $level_cfg;
+        print $cfg_fh $entry or die $!;
+        my $v2w = PublicInbox::V2Writable->new($ibx, { nproc => 0 });
+        $v2w->init_inbox(0);
+        $v2w->add(PublicInbox::Eml->new(<<EOM));
+Date: Sat, 02 Oct 2010 00:00:00 +0000
+From: Lorelei <l\@example.com>
+To: test-$i\@example.com
+Message-ID: <20101002-000000-$i\@example.com>
+Subject: hello world $i
+
+hi
+EOM
+        $v2w->done;
+};
+
+my @children;
+for my $i (1..$nproc) {
+        my ($r, $w);
+        pipe($r, $w) or BAIL_OUT $!;
+        my $pid = fork;
+        if ($pid == 0) {
+                close $w;
+                while (my $i = <$r>) {
+                        chomp $i;
+                        $v2_init_add->($i);
+                }
+                _exit(0);
+        }
+        defined $pid or BAIL_OUT "fork: $!";
+        close $r or BAIL_OUT $!;
+        push @children, [ $w, $pid ];
+        $w->autoflush(1);
+}
+
+for my $i (0..$nr_inbox) {
+        print { $children[$i % @children]->[0] } "$i\n" or BAIL_OUT $!;
+}
+
+for my $c (@children) {
+        close $c->[0] or BAIL_OUT "close $!";
+}
+my $i = 0;
+for my $c (@children) {
+        my $pid = waitpid($c->[1], 0);
+        is($?, 0, ++$i.' exited ok');
+}
+ok(close($cfg_fh), 'config written');
+done_testing;
diff --git a/xt/eml_check_limits.t b/xt/eml_check_limits.t
index 9f821946..536a25f1 100644
--- a/xt/eml_check_limits.t
+++ b/xt/eml_check_limits.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use v5.10.1;
diff --git a/xt/git-http-backend.t b/xt/git-http-backend.t
index 2f02725a..dcff72cc 100644
--- a/xt/git-http-backend.t
+++ b/xt/git-http-backend.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # Ensure buffering behavior in -httpd doesn't cause runaway memory use
diff --git a/xt/git_async_cmp.t b/xt/git_async_cmp.t
index f9c9ddef..a7a94c2d 100644
--- a/xt/git_async_cmp.t
+++ b/xt/git_async_cmp.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/xt/httpd-async-stream.t b/xt/httpd-async-stream.t
index 22a96875..f6715c58 100644
--- a/xt/httpd-async-stream.t
+++ b/xt/httpd-async-stream.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Expensive test to validate compression and TLS.
 use strict;
diff --git a/xt/imapd-mbsync-oimap.t b/xt/imapd-mbsync-oimap.t
index f8641d06..5f671fc8 100644
--- a/xt/imapd-mbsync-oimap.t
+++ b/xt/imapd-mbsync-oimap.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # ensure mbsync and offlineimap compatibility
 use strict;
diff --git a/xt/imapd-validate.t b/xt/imapd-validate.t
index 3e445156..b6ac3e21 100644
--- a/xt/imapd-validate.t
+++ b/xt/imapd-validate.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Expensive test to validate compression and TLS.
 use strict;
diff --git a/xt/lei-sigpipe.t b/xt/lei-sigpipe.t
new file mode 100644
index 00000000..448bd7db
--- /dev/null
+++ b/xt/lei-sigpipe.t
@@ -0,0 +1,35 @@
+#!perl -w
+# Copyright (C) 2021 all contributors <meta@public-inbox.org>
+# License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
+use strict;
+use v5.10.1;
+use Test::More;
+use PublicInbox::TestCommon;
+use POSIX qw(WTERMSIG WIFSIGNALED SIGPIPE);
+require_mods(qw(json DBD::SQLite Search::Xapian));
+# XXX this needs an already configured lei instance with many messages
+
+my $do_test = sub {
+        my $env = shift // {};
+        for my $out ([], [qw(-f mboxcl2)]) {
+                pipe(my ($r, $w)) or BAIL_OUT $!;
+                open my $err, '+>', undef or BAIL_OUT $!;
+                my $opt = { run_mode => 0, 1 => $w, 2 => $err };
+                my $cmd = [qw(lei q -t), @$out, 'bytes:1..'];
+                my $tp = start_script($cmd, $env, $opt);
+                close $w;
+                sysread($r, my $buf, 1);
+                close $r; # trigger SIGPIPE
+                $tp->join;
+                ok(WIFSIGNALED($?), "signaled @$out");
+                is(WTERMSIG($?), SIGPIPE, "got SIGPIPE @$out");
+                seek($err, 0, 0);
+                my @err = grep(!m{mkdir /dev/null\b}, <$err>);
+                is_deeply(\@err, [], "no errors @$out");
+        }
+};
+
+$do_test->();
+$do_test->({XDG_RUNTIME_DIR => '/dev/null'});
+
+done_testing;
diff --git a/xt/mem-imapd-tls.t b/xt/mem-imapd-tls.t
index 3f1436c7..e4b3b8cd 100644
--- a/xt/mem-imapd-tls.t
+++ b/xt/mem-imapd-tls.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Idle client memory usage test, particularly after EXAMINE when
 # Message Sequence Numbers are loaded
diff --git a/xt/mem-msgview.t b/xt/mem-msgview.t
index c09afde0..dceb24b2 100644
--- a/xt/mem-msgview.t
+++ b/xt/mem-msgview.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 # Note: this may be altered as-needed to demonstrate improvements.
 # See history in git for this file.
diff --git a/xt/msgtime_cmp.t b/xt/msgtime_cmp.t
index aa96be4d..ae9e4215 100644
--- a/xt/msgtime_cmp.t
+++ b/xt/msgtime_cmp.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;
diff --git a/xt/nntpd-validate.t b/xt/nntpd-validate.t
index 322e6f62..efe97c02 100644
--- a/xt/nntpd-validate.t
+++ b/xt/nntpd-validate.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 
 # Integration test to validate compression.
diff --git a/xt/perf-msgview.t b/xt/perf-msgview.t
index d99101a3..59980839 100644
--- a/xt/perf-msgview.t
+++ b/xt/perf-msgview.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2019-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2019-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
@@ -29,7 +29,7 @@ select($vec, undef, undef, 60) or die "timed out waiting for --batch-check";
 
 my $ctx = {
         env => { HTTP_HOST => 'example.com', 'psgi.url_scheme' => 'https' },
-        -inbox => $ibx,
+        ibx => $ibx,
         www => Plack::Util::inline_object(style => sub {''}),
 };
 my ($mime, $res, $oid, $type);
diff --git a/xt/perf-nntpd.t b/xt/perf-nntpd.t
index f73afacc..cd0d4938 100644
--- a/xt/perf-nntpd.t
+++ b/xt/perf-nntpd.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2018-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2018-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use warnings;
diff --git a/xt/perf-threading.t b/xt/perf-threading.t
index b27c9cbd..57e9db9b 100644
--- a/xt/perf-threading.t
+++ b/xt/perf-threading.t
@@ -1,4 +1,4 @@
-# Copyright (C) 2016-2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2016-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 #
 # real-world testing of search threading
@@ -25,7 +25,7 @@ ok($n, 'got some messages');
 diag "enquire: ".timestr($elapsed)." for $n";
 
 $elapsed = timeit(1, sub {
-        PublicInbox::View::thread_results({-inbox => $ibx}, $msgs);
+        PublicInbox::View::thread_results({ibx => $ibx}, $msgs);
 });
 diag "thread_results ".timestr($elapsed);
 
diff --git a/xt/solver.t b/xt/solver.t
index 99fca0d3..2f2fcc44 100644
--- a/xt/solver.t
+++ b/xt/solver.t
@@ -1,5 +1,5 @@
 #!perl -w
-# Copyright (C) 2020 all contributors <meta@public-inbox.org>
+# Copyright (C) 2020-2021 all contributors <meta@public-inbox.org>
 # License: AGPL-3.0+ <https://www.gnu.org/licenses/agpl-3.0.txt>
 use strict;
 use Test::More;